diff --git a/.air.toml b/.air.toml new file mode 100644 index 0000000..435a885 --- /dev/null +++ b/.air.toml @@ -0,0 +1,17 @@ +# Working directory +root = "." + +# The main Go file +main = "main.go" + +bin = "tmp/main.exe" + +# Watching all Go files, excluding certain directories +[build] + cmd = "go build -o ./tmp/main.exe main.go" + include_ext = ["go"] + exclude_dir = ["fe", "panels", "builds"] + +# Restart on file changes +[log] + time = true diff --git a/.github/workflows/windows-release.yml b/.github/workflows/windows-release.yml deleted file mode 100644 index 5048c9b..0000000 --- a/.github/workflows/windows-release.yml +++ /dev/null @@ -1,70 +0,0 @@ -name: Release Build (Windows) - -on: - push: - branches: - - "release/**" - -permissions: - contents: write - -jobs: - windows-release-build: - runs-on: windows-latest - - steps: - - name: Checkout the release branch - uses: actions/checkout@v4 - with: - token: ${{ secrets.GITHUB_TOKEN }} - - - name: Extract version from branch name - id: extract - shell: bash - run: | - version="${GITHUB_REF##*/}" - echo "version=$version" >> $GITHUB_OUTPUT - - - name: Set up Git - shell: bash - run: | - git config user.name "github-actions" - git config user.email "github-actions@github.com" - - - name: Run build script - shell: cmd - run: .\build-scripts\windows-build.bat - - - name: Cleanup root directory - shell: pwsh - run: | - $folders = @("app", "ui", "build-scripts") - foreach ($folder in $folders) { - if (Test-Path $folder) { - Remove-Item -Recurse -Force -Path $folder - Write-Output "Removed development folder: $folder" - } else { - Write-Output "$folder does not exist" - } - } - - # Delete all files except: Macrame.exe, favicon.ico, README.md - Get-ChildItem -File | Where-Object { $_.Name -notin @("Macrame.exe", "favicon.ico", "README.md") } | ForEach-Object { - Write-Output "Deleting file: $($_.Name)" - Remove-Item -Force $_.FullName - } - - - name: Commit and push build artifacts - shell: bash - run: | - git add -A - git commit -m "Automated release build for version: ${{ steps.extract.outputs.version }}" - git push origin ${{ github.ref }} - - - name: Fetch and force merge into main - shell: bash - run: | - git fetch origin main - git checkout main - git merge -X theirs ${{ github.ref }} -m "Merging release version ${{ steps.extract.outputs.version }} into main" - git push origin main diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..345ff6f --- /dev/null +++ b/.gitignore @@ -0,0 +1,14 @@ +.env +config.js + +devices/* +tmp/ +log.txt + +Macrame.exe + +public +macros/* +builds +node_modules +ToDo.md \ No newline at end of file diff --git a/README.md b/README.md deleted file mode 100644 index 35d673b..0000000 --- a/README.md +++ /dev/null @@ -1,13 +0,0 @@ -# Macrame icon Macrame - -**Version 1.0.0 is now available: [Macrame 1.0.0](https://github.com/Macrame-App/Macrame/archive/refs/heads/release/1.0.0.zip)** - -Turn Any Device into a button panel. Open-source, easy, and built to supercharge your workflow or gaming. -Macrame is released under the GPL V3 licence. More information can be found at: [Macrame License](https://macrame-app.github.io/license.html) - -Macrame is small application that can be used to record keyboard macros. -The macros can be linked to button panels and the panels can be used by devices on the same network. - -## Getting Started - -Read the [official documentation](https://macrame-app.github.io/) about the Macrame app to get started. diff --git a/add-gpl-header.sh b/add-gpl-header.sh new file mode 100644 index 0000000..fe20142 --- /dev/null +++ b/add-gpl-header.sh @@ -0,0 +1,47 @@ +#!/bin/bash + +# Directory to start searching from (default to current directory) +DIR="${1:-.}" + +# Define the GPLv3 header content +GPL_HEADER="Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see ." + +# Loop through all files in the directory (and subdirectories), excluding node_modules +find "$DIR" \( -iname \*.go -o \( -path "$DIR/fe/src/*.js" -o -path "$DIR/fe/src/*.vue" -o -path "$DIR/fe/src/*.css" \) \) ! -path "*/node_modules/*" | while read file +do + # Check if the file already has a GPL header + if ! grep -q "Copyright (C) 2025 Jesse Malotaux" "$file"; then + # Check if it's a Vue file and handle it carefully + if [[ "$file" == *.vue ]]; then + echo "Adding GPL header to: $file" + # Prepend the GPL header to Vue files as raw text + # Make sure we don't add comment marks that break Vue syntax + echo -e "\n\n$(cat "$file")" > "$file" + else + echo "Adding GPL header to: $file" + # Prepend the GPL header to other files (go, js, ts, etc.) as comments + echo -e "/*\n$GPL_HEADER\n*/\n\n$(cat "$file")" > "$file" + fi + else + echo "GPL header already present in: $file" + fi +done + +echo "GPL header addition complete!" diff --git a/app/api.go b/app/api.go new file mode 100644 index 0000000..e9c2f84 --- /dev/null +++ b/app/api.go @@ -0,0 +1,137 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package app + +import ( + "macrame/app/helper" + "mime" + "net/http" + "path/filepath" + "strings" +) + +func ApiCORS(w http.ResponseWriter, r *http.Request) (http.ResponseWriter, *http.Request) { + origin := r.Header.Get("Origin") + + w.Header().Set("Access-Control-Allow-Origin", "http://localhost:5173") + + if strings.HasPrefix(r.Host, "192.168.") { + w.Header().Set("Access-Control-Allow-Origin", origin) + } + + w.Header().Set("Access-Control-Allow-Methods", "GET, POST, OPTIONS") + w.Header().Set("Access-Control-Allow-Headers", "Content-Type, Accept, Accept-Language, Accept-Encoding") + + return w, r +} + +func ApiGet(w http.ResponseWriter, r *http.Request) { + root, err := filepath.Abs("public") + if err != nil { + MCRMLog("ApiGet Abs Error: ", err) + return + } + + var file string + + if strings.Contains(r.URL.Path, "/config.js") { + file = filepath.Join(root, "config.js") + w.Header().Set("Content-Type", "text/javascript") // set content type header + } else if r.URL.Path != "/" { + file = filepath.Join(root, r.URL.Path) + } + + contentType := mime.TypeByExtension(filepath.Ext(file)) // get content type + + if contentType == "" { + file = filepath.Join(root, "index.html") + } + + http.ServeFile(w, r, file) +} + +func ApiPost(w http.ResponseWriter, r *http.Request) { + access, data, err := helper.EndpointAccess(w, r) + + if !access || err != nil { + MCRMLog("ApiPost EndPointAccess Error: ", err) + return + } + + if data != "" { + ApiAuth(data, w, r) + return + } + + switch r.URL.Path { + case "/macro/check": + CheckMacro(w, r) + case "/macro/record": + SaveMacro(w, r) + case "/macro/list": + ListMacros(w, r) + case "/macro/open": + OpenMacro(w, r) + case "/macro/delete": + DeleteMacro(w, r) + case "/macro/play": + PlayMacro("", w, r) + case "/device/server/ip": + ListServerIP(w) + case "/device/list": + DeviceList(w, r) + case "/device/access/check": + DeviceAccessCheck(w, r) + case "/device/access/request": + DeviceAccessRequest(w, r) + case "/device/link/ping": + PingLink(w, r) + case "/device/link/start": + StartLink(w, r) + case "/device/link/poll": + PollLink(w, r) + case "/device/link/remove": + RemoveLink("", w, r) + case "/device/handshake": + Handshake(w, r) + case "/panel/list": + PanelList(w, r) + case "/panel/get": + GetPanel("", w, r) + case "/panel/save/json": + SavePanelJSON(w, r) + } +} + +func ApiAuth(data string, w http.ResponseWriter, r *http.Request) { + switch r.URL.Path { + case "/macro/play": + PlayMacro(data, w, r) + case "/device/link/remove": + RemoveLink(data, w, r) + case "/panel/list": + MCRMLog("Authenticated Panellist") + PanelList(w, r) + case "/panel/get": + GetPanel(data, w, r) + } +} diff --git a/app/device.go b/app/device.go new file mode 100644 index 0000000..6352e5f --- /dev/null +++ b/app/device.go @@ -0,0 +1,329 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package app + +import ( + "encoding/json" + "fmt" + "macrame/app/helper" + "macrame/app/structs" + "math/rand" + "net" + "net/http" + "os" + "path/filepath" + "strings" + "time" +) + +func ListServerIP(w http.ResponseWriter) { + ip, err := GetServerIp() + + if err != nil { + MCRMLog("GetServerIP err: ", err) + return + } + + json.NewEncoder(w).Encode(ip) +} + +func GetServerIp() (string, error) { + ifs, err := net.Interfaces() + if err != nil { + MCRMLog(err) + return "", err + } + + for _, ifi := range ifs { + // Skip interfaces that are down + if ifi.Flags&net.FlagUp == 0 { + continue + } + // Skip loopback interfaces + if ifi.Flags&net.FlagLoopback != 0 { + continue + } + + addrs, err := ifi.Addrs() + if err != nil { + MCRMLog(err) + continue + } + + for _, addr := range addrs { + var ip net.IP + + switch v := addr.(type) { + case *net.IPNet: + ip = v.IP + case *net.IPAddr: + ip = v.IP + } + + if ip == nil || ip.To4() == nil { + continue + } + + // Skip APIPA (169.254.x.x) addresses + if ip.IsLinkLocalUnicast() { + continue + } + + // Found a good IP, return it + return ip.String(), nil + } + } + + return "", fmt.Errorf("No IP found") +} + +func DeviceList(w http.ResponseWriter, r *http.Request) { + dir := "devices" + + files, err := os.ReadDir(dir) + if err != nil { + os.MkdirAll(dir, 0600) + files = nil + MCRMLog("DeviceList Error: ", err) + } + + devices := make(map[string]map[string]interface{}) + + for _, file := range files { + filePath := dir + "/" + file.Name() + ext := filepath.Ext(filePath) + device := strings.TrimSuffix(file.Name(), ext) + + if _, ok := devices[device]; !ok { + devices[device] = make(map[string]interface{}) + } + + if ext == ".json" { + devices[device]["settings"] = readDeviceSettings(filePath) + } + if ext == ".key" { + devices[device]["key"] = true + } + } + + result := map[string]interface{}{ + "devices": devices, + } + + json.NewEncoder(w).Encode(result) +} + +func readDeviceSettings(filepath string) (settings structs.Settings) { + data, err := os.ReadFile(filepath) + if err != nil { + MCRMLog("readDeviceSettings Error: ", err) + } + + err = json.Unmarshal(data, &settings) + if err != nil { + MCRMLog("readDeviceSettings JSON Error: ", err) + } + + return settings +} + +func DeviceAccessCheck(w http.ResponseWriter, r *http.Request) { + var req structs.Check + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + MCRMLog("DeviceAccessCheck Error: ", err) + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + _, errSett := os.Stat("devices/" + req.Uuid + ".json") + _, errKey := os.Stat("devices/" + req.Uuid + ".key") + + if (errSett == nil) && (errKey == nil) { + json.NewEncoder(w).Encode("authorized") + } else if (errSett == nil) && (errKey != nil) { + MCRMLog("DeviceAccessCheck: UUID: ", req.Uuid, "; Access: Unauthorized") + json.NewEncoder(w).Encode("unauthorized") + } else { + MCRMLog("DeviceAccessCheck: UUID: ", req.Uuid, "; Access: Unlinked") + json.NewEncoder(w).Encode("unlinked") + } +} + +func DeviceAccessRequest(w http.ResponseWriter, r *http.Request) { + var req structs.Request + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + deviceSettings := structs.Settings{Name: req.Name, Type: req.Type} + + settingsJSON, err := json.Marshal(deviceSettings) + if err != nil { + MCRMLog("DeviceAccessRequest JSON Error: ", err) + return + } + + err = os.WriteFile("devices/"+req.Uuid+".json", settingsJSON, 0644) + + if err != nil { + MCRMLog("DeviceAccessRequest Error: ", err) + return + } + + json.NewEncoder(w).Encode("unauthorized") +} + +func PingLink(w http.ResponseWriter, r *http.Request) { + var req structs.Check + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + MCRMLog("PingLink Error: ", err) + json.NewEncoder(w).Encode(false) + return + } + + key, keyErr := os.ReadFile("devices/" + req.Uuid + ".key") + pin, pinErr := os.ReadFile("devices/" + req.Uuid + ".tmp") + + encryptedKey, encErr := helper.EncryptAES(string(pin), string(key)) + + if keyErr == nil && pinErr == nil && encErr == nil { + MCRMLog("PINGLINK FIXED") + w.Header().Set("Content-Type", "application/json") + w.Write([]byte(encryptedKey)) + return + } else { + MCRMLog("PingLink Error: keyErr:", keyErr, "; pinErr:", pinErr, "; encErr:", encErr) + } + + json.NewEncoder(w).Encode(false) +} + +func StartLink(w http.ResponseWriter, r *http.Request) { + var req structs.Check + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + MCRMLog("StartLink Error: ", err) + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + pin := fmt.Sprintf("%04d", rand.Intn(10000)) + + deviceKey := helper.GenerateKey() + + errKey := helper.SaveDeviceKey(req.Uuid, deviceKey) + savedPin, errPin := helper.TempPinFile(req.Uuid, pin) + + if errKey == nil && errPin == nil && savedPin { + json.NewEncoder(w).Encode(pin) + } else { + MCRMLog("StartLink Error: errKey:", errKey, "; errPin:", errPin) + } +} + +func PollLink(w http.ResponseWriter, r *http.Request) { + var req structs.Check + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + json.NewEncoder(w).Encode(false) + return + } + + if helper.CheckPinFile(req.Uuid) { + json.NewEncoder(w).Encode(true) + return + } + + json.NewEncoder(w).Encode(false) +} + +func RemoveLink(data string, w http.ResponseWriter, r *http.Request) { + req := &structs.Check{} + _, err := helper.ParseRequest(req, data, r) + + if err != nil { + MCRMLog("RemoveLink ParseRequest Error: ", err) + json.NewEncoder(w).Encode(false) + return + } + + err = os.Remove("devices/" + req.Uuid + ".key") + + if err != nil { + MCRMLog("RemoveLink Remove Error: ", err) + json.NewEncoder(w).Encode(false) + return + } + + json.NewEncoder(w).Encode(true) +} + +func Handshake(w http.ResponseWriter, r *http.Request) { + var req structs.Handshake + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + return + } + + deviceKey, err := helper.GetKeyByUuid(req.Uuid) + + if err != nil { + MCRMLog("Handshake GetKeyByUuid Error: ", err) + json.NewEncoder(w).Encode(false) + return + } + + decryptShake, _ := helper.DecryptAES(deviceKey, req.Shake) + + helper.RemovePinFile(req.Uuid) + + if decryptShake == getDateStr() { + json.NewEncoder(w).Encode(true) + return + } else { + os.Remove("devices/" + req.Uuid + ".key") + } + + json.NewEncoder(w).Encode(false) +} + +func getDateStr() string { + date := time.Now() + year, month, day := date.Date() + formattedDate := fmt.Sprintf("%04d%02d%02d", year, month, day) + return formattedDate +} diff --git a/app/helper/api-helper.go b/app/helper/api-helper.go new file mode 100644 index 0000000..f88106b --- /dev/null +++ b/app/helper/api-helper.go @@ -0,0 +1,123 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package helper + +import ( + "encoding/json" + "errors" + "net" + "net/http" + "strings" + + "macrame/app/structs" + . "macrame/app/structs" +) + +func EndpointAccess(w http.ResponseWriter, r *http.Request) (bool, string, error) { + ip, _, err := net.SplitHostPort(r.RemoteAddr) + + if err != nil { + return false, "", errors.New(r.URL.Path + ": SplitHostPort error: " + err.Error()) + } + + if (isLocal(ip) && isEndpointAllowed("Local", r.URL.Path)) || + (isLanRemote(ip) && isEndpointAllowed("Remote", r.URL.Path)) { + return true, "", nil + } else if isLanRemote(ip) && isEndpointAllowed("Auth", r.URL.Path) { + data, err := decryptAuth(r) + + if err != nil { + return false, "", err + } + + return data != "", data, nil + } + + return false, "", errors.New(r.URL.Path + ": not authorized or accessible") +} + +func isLocal(ip string) bool { + return ip == "127.0.0.1" || ip == "::1" +} + +func isLanRemote(ip string) bool { + return strings.HasPrefix(ip, "192.168.") +} + +func isEndpointAllowed(source string, endpoint string) bool { + var endpoints, err = getAllowedEndpoints(source) + if err != "" { + return false + } + + if (endpoints != nil) && (len(endpoints) > 0) { + for _, e := range endpoints { + if e == endpoint { + return true + } + } + } + + return false +} + +func getAllowedEndpoints(source string) (endpoints []string, err string) { + if source == "Local" { + return Endpoints.Local, "" + } + if source == "Remote" { + return Endpoints.Remote, "" + } + if source == "Auth" { + return Endpoints.Auth, "" + } + + return []string{}, "No allowed endpoints" +} + +func decryptAuth(r *http.Request) (string, error) { + var req structs.Authcall + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil || req.Uuid == "" || req.Data == "" { + return "", errors.New("DecryptAuth Error: " + err.Error() + "; UUID: " + req.Uuid + "; Data: " + req.Data) + } + + deviceKey, errKey := GetKeyByUuid(req.Uuid) + decryptData, errDec := DecryptAES(deviceKey, req.Data) + + if errKey != nil && errDec != nil || decryptData == "" { + return "", errors.New("DecryptAuth Error: " + errKey.Error() + "; " + errDec.Error() + "; UUID: " + req.Uuid + "; Data: " + req.Data) + } + + return decryptData, nil +} + +func ParseRequest(req interface{}, data string, r *http.Request) (d interface{}, err error) { + if data != "" { + dataBytes := []byte(data) + return req, json.Unmarshal(dataBytes, &req) + } else { + return req, json.NewDecoder(r.Body).Decode(&req) + } +} diff --git a/app/helper/browser-helper.go b/app/helper/browser-helper.go new file mode 100644 index 0000000..5b2e3d0 --- /dev/null +++ b/app/helper/browser-helper.go @@ -0,0 +1,44 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package helper + +import ( + "os/exec" + "runtime" +) + +func OpenBrowser(url string) bool { + var args []string + + switch runtime.GOOS { + case "darwin": + args = []string{"open"} + case "windows": + args = []string{"cmd", "/c", "start"} + default: + args = []string{"xdg-open"} + } + + cmd := exec.Command(args[0], append(args[1:], url)...) + + return cmd.Start() == nil +} diff --git a/app/helper/device-helper.go b/app/helper/device-helper.go new file mode 100644 index 0000000..30d7c56 --- /dev/null +++ b/app/helper/device-helper.go @@ -0,0 +1,66 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package helper + +import ( + "errors" + "os" + "time" +) + +func TempPinFile(Uuid string, pin string) (bool, error) { + err := os.WriteFile("devices/"+Uuid+".tmp", []byte(pin), 0644) + if err != nil { + return false, errors.New("TempPinFile Error: " + err.Error()) + } + + time.AfterFunc(1*time.Minute, func() { + os.Remove("devices/" + Uuid + ".tmp") + }) + + return true, nil +} + +func RemovePinFile(Uuid string) error { return os.Remove("devices/" + Uuid + ".tmp") } + +func CheckPinFile(Uuid string) bool { + _, err := os.Stat("devices/" + Uuid + ".tmp") + return err == nil +} + +func SaveDeviceKey(Uuid string, key string) error { + err := os.WriteFile("devices/"+Uuid+".key", []byte(key), 0644) + + if err != nil { + return err + } + + return nil +} + +func GetKeyByUuid(Uuid string) (string, error) { + data, err := os.ReadFile("devices/" + Uuid + ".key") + if err != nil { + return "", err + } + return string(data), nil +} diff --git a/app/helper/encrypt-helper.go b/app/helper/encrypt-helper.go new file mode 100644 index 0000000..ad883c5 --- /dev/null +++ b/app/helper/encrypt-helper.go @@ -0,0 +1,135 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package helper + +import ( + "bytes" + "crypto/aes" + "crypto/cipher" + "crypto/rand" + "encoding/base64" + "errors" + mathRand "math/rand" + "strings" +) + +func EncryptAES(key string, plaintext string) (string, error) { + origData := []byte(plaintext) + + // Create AES cipher + block, err := aes.NewCipher(keyToBytes(key)) + if err != nil { + return "", err + } + blockSize := block.BlockSize() + + origData = PKCS5Padding(origData, blockSize) + + iv := []byte(EnvGet("MCRM__IV")) + blockMode := cipher.NewCBCEncrypter(block, iv) + + crypted := make([]byte, len(origData)) + blockMode.CryptBlocks(crypted, origData) + + cryptedString := base64.StdEncoding.EncodeToString(crypted) + + return cryptedString, nil +} + +func DecryptAES(key string, cryptedText string) (string, error) { + crypted, err := base64.StdEncoding.DecodeString(cryptedText) + + if err != nil { + return "", err + } + + block, err := aes.NewCipher(keyToBytes(key)) + if err != nil { + return "", err + } + + iv := []byte(EnvGet("MCRM__IV")) + blockMode := cipher.NewCBCDecrypter(block, iv) + + origData := make([]byte, len(crypted)) + + blockMode.CryptBlocks(origData, crypted) + origData, err = PKCS5UnPadding(origData) + + if err != nil || len(origData) <= 3 { + return "", errors.New("invalid key") + } + + origDataString := string(origData) + + return origDataString, nil +} + +func GenerateRandomString(length int) string { + b := make([]byte, length) + _, err := rand.Read(b) + if err != nil { + panic(err) + } + return base64.StdEncoding.EncodeToString(b) +} + +func GenerateRandomIntegerString(length int) string { + var sb strings.Builder + for i := 0; i < length; i++ { + sb.WriteByte('0' + byte(mathRand.Intn(10))) + } + return sb.String() +} + +func GenerateKey() string { + return strings.Replace(GenerateRandomString(24), "=", "", -1) +} + +func keyToBytes(key string) []byte { + // Convert key to bytes + keyBytes := []byte(key) + + // If key is 4 characters, append salt + if len(key) == 4 { + keyBytes = []byte(key + EnvGet("MCRM__SALT")) + } + + return keyBytes +} + +func PKCS5Padding(ciphertext []byte, blockSize int) []byte { + padding := blockSize - len(ciphertext)%blockSize + padtext := bytes.Repeat([]byte{byte(padding)}, padding) + return append(ciphertext, padtext...) +} + +func PKCS5UnPadding(origData []byte) ([]byte, error) { + length := len(origData) + unpadding := int(origData[length-1]) + + if (unpadding >= length) || (unpadding == 0) { + return nil, errors.New("unpadding error") + } + + return origData[:(length - unpadding)], nil +} diff --git a/app/helper/env-helper.go b/app/helper/env-helper.go new file mode 100644 index 0000000..28af4d4 --- /dev/null +++ b/app/helper/env-helper.go @@ -0,0 +1,128 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package helper + +import ( + "encoding/json" + "log" + "net" + "os" + "strconv" + "strings" +) + +var configPath = "public/config.js" + +func EnvGet(key string) string { + + if !configFileExists() { + CreateConfigFile(configPath) + CheckFeDevDir() + } + + data, err := os.ReadFile(configPath) + if err != nil { + log.Println("Error reading config.js:", err) + return "" + } + + raw := strings.TrimSpace(string(data)) + raw = strings.TrimPrefix(raw, "window.__CONFIG__ = ") + raw = strings.TrimSuffix(raw, ";") + + var config map[string]string + if err := json.Unmarshal([]byte(raw), &config); err != nil { + log.Println("Error parsing config.js:", err) + return "" + } + + return config[key] +} + +func configFileExists() bool { + _, err := os.Stat(configPath) + return err == nil +} + +func CheckFeDevDir() { + log.Println("Checking FE dev directory...") + _, err := os.Stat("fe") + + if err != nil { + log.Println("Error checking FE dev directory:", err) + return + } + + copyConfigToFe() +} + +func copyConfigToFe() { + data, err := os.ReadFile(configPath) + + if err != nil { + log.Println("Error reading config.js:", err) + return + } + + if err := os.WriteFile("fe/config.js", data, 0644); err != nil { + log.Println("Error writing config.js:", err) + } +} + +func CreateConfigFile(filename string) { + port, _ := findOpenPort() + saltKey := GenerateKey() + salt := saltKey[:28] + iv := GenerateRandomIntegerString(16) + + config := map[string]string{ + "MCRM__PORT": port, + "MCRM__SALT": salt, + "MCRM__IV": iv, + } + + jsonData, err := json.MarshalIndent(config, "", " ") + if err != nil { + log.Println("Error creating config JSON:", err) + return + } + jsData := "window.__CONFIG__ = " + string(jsonData) + ";" + + log.Println("Created JS config:", jsData) + + if err := os.WriteFile(filename, []byte(jsData), 0644); err != nil { + log.Println("Error writing config.js:", err) + } +} + +func findOpenPort() (string, error) { + addr, err := net.ResolveTCPAddr("tcp", "localhost:0") + if err != nil { + return "", err + } + l, err := net.ListenTCP("tcp", addr) + if err != nil { + return "", err + } + defer l.Close() + return strconv.Itoa(l.Addr().(*net.TCPAddr).Port), nil +} diff --git a/app/helper/macro-helper.go b/app/helper/macro-helper.go new file mode 100644 index 0000000..a49dc57 --- /dev/null +++ b/app/helper/macro-helper.go @@ -0,0 +1,114 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package helper + +import ( + "encoding/json" + "errors" + "fmt" + "os" + "regexp" + "strings" + "time" + + "github.com/go-vgo/robotgo" +) + +func FormatMacroFileName(s string) string { + // Remove invalid characters + re := regexp.MustCompile(`[\/\?\*\>\<\:\"\| +]`) + s = re.ReplaceAllString(s, "") + + // Replace spaces with underscores + s = strings.ReplaceAll(s, " ", "_") + + // Remove special characters + re = regexp.MustCompile(`[!@#$%^&\(\)\[\]\{\}\~]`) + s = re.ReplaceAllString(s, "") + + // Truncate the string + if len(s) > 255 { + s = s[:255] + } + + return s +} + +func ReadMacroFile(filename string) (steps []map[string]interface{}, err error) { + content, err := os.ReadFile(filename) + + if err != nil { + return nil, err + } + + err = json.Unmarshal(content, &steps) + + return steps, err +} + +func RunMacroSteps(steps []map[string]interface{}) error { + for _, step := range steps { + switch step["type"] { + case "key": + keyCode := step["code"].(string) + + if strings.Contains(keyCode, "|") { + keyCode = handleToggleCode(keyCode, step["direction"].(string)) + } + + robotgo.KeyToggle(keyCode, step["direction"].(string)) + case "delay": + + time.Sleep(time.Duration(step["value"].(float64)) * time.Millisecond) + + default: + return errors.New("RunMacroSteps Unknown step type: %v" + fmt.Sprint(step["type"])) + } + } + return nil +} + +var toggleCodes = map[string]bool{} + +func handleToggleCode(keyCode string, direction string) string { + splitCodes := strings.Split(keyCode, "|") + + if direction == "down" { + if _, ok := toggleCodes[splitCodes[0]]; !ok { + toggleCodes[splitCodes[0]] = true + return splitCodes[0] + } + return splitCodes[1] + } + + if direction == "up" { + if toggleCodes[splitCodes[0]] { + toggleCodes[splitCodes[0]] = false + return splitCodes[0] + } + delete(toggleCodes, splitCodes[0]) + return splitCodes[1] + } + + return "" +} diff --git a/app/helper/translation-helper.go b/app/helper/translation-helper.go new file mode 100644 index 0000000..fdcffff --- /dev/null +++ b/app/helper/translation-helper.go @@ -0,0 +1,101 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package helper + +import ( + "strings" +) + +var translations = map[string]string{ + "ArrowUp": "up", + "ArrowDown": "down", + "ArrowRight": "right", + "ArrowLeft": "left", + "Meta": "cmd", + "MetaLeft": "lcmd", + "MetaRight": "rcmd", + "Alt": "alt", + "AltLeft": "lalt", + "AltRight": "ralt", + "Control": "ctrl", + "ControlLeft": "lctrl", + "ControlRight": "rctrl", + "Shift": "shift", + "ShiftLeft": "lshift", + "ShiftRight": "rshift", + "AudioVolumeMute": "audio_mute", + "AudioVolumeDown": "audio_vol_down", + "AudioVolumeUp": "audio_vol_up", + "MediaTrackPrevious": "audio_prev", + "MediaTrackNext": "audio_next", + "MediaPlayPause": "audio_play|audio_pause", + "Numpad0": "num0", + "Numpad1": "num1", + "Numpad2": "num2", + "Numpad3": "num3", + "Numpad4": "num4", + "Numpad5": "num5", + "Numpad6": "num6", + "Numpad7": "num7", + "Numpad8": "num8", + "Numpad9": "num9", + "NumLock": "num_lock", + "NumpadDecimal": "num.", + "NumpadAdd": "num+", + "NumpadSubtract": "num-", + "NumpadMultiply": "num*", + "NumpadDivide": "num/", + "NumpadEnter": "num_enter", + "Clear": "num_clear", + "BracketLeft": "[", + "BracketRight": "]", + "Quote": "'", + "Semicolon": ";", + "Backquote": "`", + "Backslash": "\\", + "IntlBackslash": "\\", + "Slash": "/", + "Comma": ",", + "Period": ".", + "Equal": "=", + "Minus": "-", +} + +func Translate(code string) string { + if val, ok := translations[code]; ok { + return val + } + return strings.ToLower(code) +} + +func ReverseTranslate(name string) string { + if name == "\\" { + return "Backslash" + } + + for key, value := range translations { + if value == name { + return key + } + } + return name +} diff --git a/app/log.go b/app/log.go new file mode 100644 index 0000000..db662ed --- /dev/null +++ b/app/log.go @@ -0,0 +1,45 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package app + +import ( + "log" + "os" +) + +var logFile *os.File + +func MCRMLogInit() { + var err error + // Open or create the log file with append permissions + logFile, err = os.OpenFile("log.txt", os.O_CREATE|os.O_WRONLY|os.O_APPEND, 0666) + if err != nil { + log.Fatal(err) // Exit if we can't open the log file + } + + // Optionally set log to write to file in addition to standard log output + log.SetOutput(logFile) +} + +func MCRMLog(v ...interface{}) { + log.Println(v...) // Logs to terminal as well +} diff --git a/app/macro.go b/app/macro.go new file mode 100644 index 0000000..5dff9e0 --- /dev/null +++ b/app/macro.go @@ -0,0 +1,229 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package app + +import ( + "encoding/json" + "fmt" + "io" + "log" + "net/http" + "os" + "path/filepath" + "strings" + + "macrame/app/helper" + "macrame/app/structs" +) + +func CheckMacro(w http.ResponseWriter, r *http.Request) { + var req structs.MacroRequest + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + MCRMLog("OpenMacro Decode Error: ", err) + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + var filename = helper.FormatMacroFileName(req.Macro) + + macroFile, err := helper.ReadMacroFile(fmt.Sprintf("macros/%s.json", filename)) + + if macroFile != nil && err == nil { + json.NewEncoder(w).Encode(true) + return + } else { + MCRMLog("OpenMacro ReadMacroFile Error: ", err) + json.NewEncoder(w).Encode(false) + return + } +} + +func SaveMacro(w http.ResponseWriter, r *http.Request) { + var newMacro structs.NewMacro + + body, err := io.ReadAll(r.Body) + if err != nil { + MCRMLog("SaveMacro ReadAll Error: ", err) + return + } + + err = json.Unmarshal(body, &newMacro) + if err != nil { + MCRMLog("SaveMacro Unmarshal Error: ", err) + return + } + + simplifiedSteps := make([]map[string]interface{}, 0) + for _, step := range newMacro.Steps { + simplifiedSteps = append(simplifiedSteps, simplifyMacro(step)) + } + + stepsJSON, err := json.Marshal(simplifiedSteps) + if err != nil { + MCRMLog("SaveMacro Marshal Error: ", err) + return + } + + err = os.WriteFile("macros/"+helper.FormatMacroFileName(newMacro.Name)+".json", stepsJSON, 0644) + if err != nil { + MCRMLog("SaveMacro WriteFile Error: ", err) + return + } +} + +func simplifyMacro(step structs.Step) map[string]interface{} { + simplified := make(map[string]interface{}) + + simplified["type"] = step.Type + + switch step.Type { + case "delay": + simplified["value"] = step.Value + case "key": + keyCode := step.Code + + if keyCode == "" || (strings.Contains(keyCode, "Digit")) { + keyCode = step.Key + } else if strings.Contains(keyCode, "Key") { + keyCode = strings.Replace(keyCode, "Key", "", 1) + } + + simplified["code"] = helper.Translate(keyCode) + simplified["direction"] = step.Direction + } + + return simplified +} + +func ListMacros(w http.ResponseWriter, r *http.Request) { + dir := "macros" + files, err := os.ReadDir(dir) + if err != nil { + MCRMLog("ListMacros ReadDir Error: ", err) + json.NewEncoder(w).Encode(false) + return + } + + var macroList []structs.MacroInfo + + for _, file := range files { + filename := filepath.Base(file.Name()) + macroname := strings.TrimSuffix(filename, filepath.Ext(filename)) + nicename := strings.Replace(macroname, "_", " ", -1) + + macroList = append(macroList, structs.MacroInfo{ + Name: nicename, + Macroname: macroname, + }) + } + + json.NewEncoder(w).Encode(macroList) +} + +func DeleteMacro(w http.ResponseWriter, r *http.Request) { + var req structs.MacroRequest + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + MCRMLog("DeleteMacro Decode Error: ", err) + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + var filename = helper.FormatMacroFileName(req.Macro) + + err = os.Remove("macros/" + filename + ".json") + + if err != nil { + MCRMLog("DeleteMacro Remove Error: ", err) + json.NewEncoder(w).Encode(false) + return + } + log.Println("Deleted Macro:", req.Macro) + json.NewEncoder(w).Encode(true) +} + +func PlayMacro(data string, w http.ResponseWriter, r *http.Request) { + req := &structs.MacroRequest{} + _, err := helper.ParseRequest(req, data, r) + + if err != nil { + MCRMLog("PlayMacro ParseRequest Error: ", err) + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + macro := req.Macro + + MCRMLog("Playing Macro: ", macro) + + var filename = helper.FormatMacroFileName(macro) + var filepath = fmt.Sprintf("macros/%s.json", filename) + + macroFile, err := helper.ReadMacroFile(filepath) + if err != nil { + MCRMLog("PlayMacro ReadMacroFile Error: ", err) + http.Error(w, err.Error(), http.StatusInternalServerError) + return + } + + err = helper.RunMacroSteps(macroFile) + + if err != nil { + MCRMLog("PlayMacro RunMacroSteps Error: ", err) + return + } +} + +func OpenMacro(w http.ResponseWriter, r *http.Request) { + var req structs.MacroRequest + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + MCRMLog("OpenMacro Decode Error: ", err) + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + macroFile, err := helper.ReadMacroFile(fmt.Sprintf("macros/%s.json", req.Macro)) + + if err != nil { + MCRMLog("OpenMacro ReadMacroFile Error: ", err) + http.Error(w, err.Error(), http.StatusInternalServerError) + return + } + + // Walk through the macro file and reverse translate codes + for i, action := range macroFile { + if actionType, ok := action["type"].(string); ok && actionType == "key" { + if code, ok := action["code"].(string); ok { + macroFile[i]["code"] = helper.ReverseTranslate(code) + } + } + } + + json.NewEncoder(w).Encode(macroFile) +} diff --git a/app/panel.go b/app/panel.go new file mode 100644 index 0000000..9c4a15f --- /dev/null +++ b/app/panel.go @@ -0,0 +1,176 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package app + +import ( + "encoding/base64" + "encoding/json" + "macrame/app/helper" + "macrame/app/structs" + "net/http" + "os" + "strings" +) + +func PanelList(w http.ResponseWriter, r *http.Request) { + panelDirs, err := os.ReadDir("panels") + if err != nil { + MCRMLog("PanelList ReadDir Error: ", err) + json.NewEncoder(w).Encode(false) + return + } + + var panelList []interface{} + + for _, panelDir := range panelDirs { + if panelDir.IsDir() { + panelList = append(panelList, getPanelInfo(panelDir.Name())) + } + } + + if len(panelList) == 0 { + MCRMLog("PanelList: No panels found") + json.NewEncoder(w).Encode(false) + return + } + + json.NewEncoder(w).Encode(panelList) +} + +func getPanelInfo(dirname string) structs.PanelInfo { + var panelInfo structs.PanelInfo + + jsonFile, err := os.ReadFile("panels/" + dirname + "/panel.json") + + if err != nil { + panelInfo.Name = strings.Replace(dirname, "_", " ", -1) + panelInfo.Description = "null" + panelInfo.AspectRatio = "null" + panelInfo.Macros = make(map[string]string) + } else { + err = json.Unmarshal(jsonFile, &panelInfo) + if err != nil { + MCRMLog("getPanelInfo Unmarshal Error: ", err) + } + } + + panelInfo.Dir = dirname + + thumb := getPanelThumb(dirname) + panelInfo.Thumb = thumb + + return panelInfo +} + +func getPanelThumb(dirname string) string { + extensions := []string{".jpg", ".jpeg", ".png", ".webp"} + + for _, ext := range extensions { + filename := "thumbnail" + ext + file, err := os.Open("panels/" + dirname + "/" + filename) + if err != nil { + MCRMLog("getPanelThumb Open Error: ", err) + continue + } + defer file.Close() + + return encodeImg(file) + } + + return "" +} + +func getPanelCode(dirname string) (html string, css string) { + htmlBytes, _ := os.ReadFile("panels/" + dirname + "/index.html") + cssBytes, _ := os.ReadFile("panels/" + dirname + "/output.css") + + return string(htmlBytes), string(cssBytes) +} + +func encodeImg(file *os.File) string { + contents, err := os.ReadFile(file.Name()) + if err != nil { + MCRMLog("encodeImg ReadFile Error: ", err) + return "" + } + + encoded := base64.StdEncoding.EncodeToString(contents) + return encoded +} + +func GetPanel(data string, w http.ResponseWriter, r *http.Request) { + req := &structs.PanelRequest{} + + _, err := helper.ParseRequest(req, data, r) + if err != nil { + MCRMLog("GetPanel ParseRequest Error: ", err) + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + var response = structs.PanelResponse{} + + panelInfo := getPanelInfo(req.Dir) + panelHtml, panelCss := getPanelCode(req.Dir) + + response.Dir = panelInfo.Dir + response.Name = panelInfo.Name + response.Description = panelInfo.Description + response.AspectRatio = panelInfo.AspectRatio + response.Macros = panelInfo.Macros + response.Thumb = panelInfo.Thumb + response.HTML = panelHtml + response.Style = panelCss + + json.NewEncoder(w).Encode(response) +} + +func SavePanelJSON(w http.ResponseWriter, r *http.Request) { + var req structs.PanelSaveJSON + err := json.NewDecoder(r.Body).Decode(&req) + if err != nil { + MCRMLog("SavePanelJSON Decode Error: ", err) + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + filePath := "panels/" + req.Dir + "/panel.json" + + req.Dir = "" + + // Marshal the data to JSON without the dir field + jsonData, err := json.Marshal(req) + if err != nil { + MCRMLog("SavePanelJSON Marshal Error: ", err) + http.Error(w, err.Error(), http.StatusInternalServerError) + return + } + + err = os.WriteFile(filePath, jsonData, 0644) + if err != nil { + MCRMLog("SavePanelJSON WriteFile Error: ", err) + http.Error(w, err.Error(), http.StatusInternalServerError) + return + } + + w.WriteHeader(http.StatusOK) +} diff --git a/app/structs/api-struct.go b/app/structs/api-struct.go new file mode 100644 index 0000000..7fc7889 --- /dev/null +++ b/app/structs/api-struct.go @@ -0,0 +1,66 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package structs + +type Allowed struct { + Local []string + Remote []string + Auth []string +} + +var Endpoints = Allowed{ + Local: []string{ + "/macro/check", + "/macro/record", + "/macro/list", + "/macro/open", + "/macro/delete", + "/macro/play", + "/device/server/ip", + "/device/list", + "/device/access/check", + "/device/access/request", + "/device/link/ping", + "/device/link/start", + "/device/link/poll", + "/device/link/remove", + "/device/handshake", + "/panel/get", + "/panel/list", + "/panel/save/json", + }, + Remote: []string{ + "/device/access/check", + "/device/access/request", + "/device/server/ip", + "/device/link/ping", + "/device/link/end", + "/device/handshake", + "/device/auth", + }, + Auth: []string{ + "/macro/play", + "/device/link/remove", + "/panel/get", + "/panel/list", + }, +} diff --git a/app/structs/device-struct.go b/app/structs/device-struct.go new file mode 100644 index 0000000..dcad84b --- /dev/null +++ b/app/structs/device-struct.go @@ -0,0 +1,52 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package structs + +type Settings struct { + Name string `json:"name"` + Type string `json:"type"` +} + +type RemoteWebhook struct { + Event string `json:"event"` + Data string `json:"data"` +} + +type Check struct { + Uuid string `json:"uuid"` +} + +type Request struct { + Uuid string `json:"uuid"` + Name string `json:"name"` + Type string `json:"type"` +} + +type Handshake struct { + Uuid string `json:"uuid"` + Shake string `json:"shake"` +} + +type Authcall struct { + Uuid string `json:"uuid"` + Data string `json:"d"` +} diff --git a/app/structs/macro-struct.go b/app/structs/macro-struct.go new file mode 100644 index 0000000..94e1fef --- /dev/null +++ b/app/structs/macro-struct.go @@ -0,0 +1,58 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package structs + +type MacroRequest struct { + Macro string `json:"macro"` +} + +type Step struct { + Type string `json:"type"` + Key string `json:"key"` + Code string `json:"code"` + Location int `json:"location"` + Direction string `json:"direction"` + Value int `json:"value"` +} + +type NewMacro struct { + Name string `json:"name"` + Steps []Step `json:"steps"` +} + +type MacroInfo struct { + Name string `json:"name"` + Macroname string `json:"macroname"` +} + +type MacroKey struct { + Type string `json:"type"` + Key string `json:"key"` + Code string `json:"code"` + Location int `json:"location"` + Direction string `json:"direction"` +} + +type MacroDelay struct { + Type string `json:"type"` + Value int `json:"value"` +} diff --git a/app/structs/panel-struct.go b/app/structs/panel-struct.go new file mode 100644 index 0000000..7d1bb97 --- /dev/null +++ b/app/structs/panel-struct.go @@ -0,0 +1,65 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package structs + +type PanelJSON struct { + Name string `json:"name"` + Description string `json:"description"` + AspectRatio string `json:"aspectRatio"` + Macros map[string]string `json:"macros"` +} + +type PanelSaveJSON struct { + // Name string `json:"name"` + // Description string `json:"description"` + // AspectRatio string `json:"aspectRatio"` + // Macros map[string]string `json:"macros"` + Dir string `json:"dir"` + Name string `json:"name"` + Description string `json:"description"` + AspectRatio string `json:"aspectRatio"` + Macros interface{} `json:"macros"` +} + +type PanelInfo struct { + Dir string `json:"dir"` + Name string `json:"name"` + Description string `json:"description"` + AspectRatio string `json:"aspectRatio"` + Macros map[string]string `json:"macros"` + Thumb string `json:"thumb"` +} + +type PanelRequest struct { + Dir string `json:"dir"` +} + +type PanelResponse struct { + Dir string `json:"dir"` + Name string `json:"name"` + Description string `json:"description"` + AspectRatio string `json:"aspectRatio"` + Macros map[string]string `json:"macros"` + Thumb string `json:"thumb"` + HTML string `json:"html"` + Style string `json:"style"` +} diff --git a/app/systray.go b/app/systray.go new file mode 100644 index 0000000..2c4d819 --- /dev/null +++ b/app/systray.go @@ -0,0 +1,64 @@ +package app + +import ( + "macrame/app/helper" + "os" + + "github.com/getlantern/systray" +) + +func InitSystray() { + go func() { + systray.Run(OnReady, OnExit) + }() +} + +func OnReady() { + systray.SetIcon(getIcon("favicon.ico")) + systray.SetTitle("Macrame") + systray.SetTooltip("Macrame - Server") + + ip, err := GetServerIp() + + if err == nil { + systray.AddMenuItem("IP: "+ip+":"+helper.EnvGet("MCRM__PORT"), "Server IP") + } + + systray.AddSeparator() + + addMCRMItem("Dashboard", "/") + addMCRMItem("Panels", "/panels") + addMCRMItem("Macros", "/macros") + addMCRMItem("Devices", "/devices") + + systray.AddSeparator() + + mQuit := systray.AddMenuItem("Quit Macrame", "Quit Macrame") + go func() { + <-mQuit.ClickedCh + os.Exit(0) + }() +} + +func addMCRMItem(name, urlPath string) { + m := systray.AddMenuItem(name, name) + + go func() { + <-m.ClickedCh + helper.OpenBrowser("http://localhost:" + helper.EnvGet("MCRM__PORT") + urlPath) + }() +} + +func OnExit() { + systray.Quit() +} + +func getIcon(path string) []byte { + icon, err := os.ReadFile(path) + + if err != nil { + MCRMLog("getIcon Error: ", err) + } + + return icon +} diff --git a/be/app/api.go b/be/app/api.go new file mode 100644 index 0000000..41535e3 --- /dev/null +++ b/be/app/api.go @@ -0,0 +1,99 @@ +package app + +import ( + "be/app/helper" + "log" + "mime" + "net/http" + "path/filepath" + "strings" +) + +func ApiCORS(w http.ResponseWriter, r *http.Request) (http.ResponseWriter, *http.Request) { + origin := r.Header.Get("Origin") + + w.Header().Set("Access-Control-Allow-Origin", "http://localhost:5173") + + if strings.HasPrefix(r.Host, "192.168.") { + log.Println("lan device") + w.Header().Set("Access-Control-Allow-Origin", origin) + } + + w.Header().Set("Access-Control-Allow-Methods", "GET, POST, OPTIONS") + w.Header().Set("Access-Control-Allow-Headers", "Content-Type, Accept, Accept-Language, Accept-Encoding") + + return w, r +} + +func ApiGet(w http.ResponseWriter, r *http.Request) { + file := "" // base directory + + if r.URL.Path != "/" { + file = "../public" + r.URL.Path // request + } + contentType := mime.TypeByExtension(filepath.Ext(file)) // get content type + + if contentType != "" { + w.Header().Set("Content-Type", contentType) // set content type header + } + + if contentType == "" { + file = "../public/index.html" // default + } + + // log.Println("GET:", file) + + http.ServeFile(w, r, file) // serve file +} + +func ApiPost(w http.ResponseWriter, r *http.Request) { + + access, data := helper.EndpointAccess(w, r) + + if !access { + return + } + + log.Println("api post", data == "") + if data != "" { + ApiAuth(data, w, r) + return + } + + switch r.URL.Path { + case "/macro/record": + SaveMacro(w, r) + case "/macro/list": + ListMacros(w, r) + case "/macro/delete": + DeleteMacro(w, r) + case "/macro/play": + PlayMacro("", w, r) + case "/device/list": + DeviceList(w, r) + case "/device/access/check": + DeviceAccessCheck(w, r) + case "/device/access/request": + DeviceAccessRequest(w, r) + case "/device/link/ping": + PingLink(w, r) + case "/device/link/start": + StartLink(w, r) + case "/device/link/poll": + PollLink(w, r) + case "/device/link/remove": + RemoveLink("", w, r) + case "/device/handshake": + Handshake(w, r) + } +} + +func ApiAuth(data string, w http.ResponseWriter, r *http.Request) { + log.Println("apiauth", data != "") + switch r.URL.Path { + case "/macro/play": + PlayMacro(data, w, r) + case "/device/link/remove": + RemoveLink(data, w, r) + } +} diff --git a/be/app/device.go b/be/app/device.go new file mode 100644 index 0000000..90165db --- /dev/null +++ b/be/app/device.go @@ -0,0 +1,245 @@ +package app + +import ( + "be/app/helper" + "be/app/structs" + "encoding/json" + "fmt" + "log" + "math/rand" + "net/http" + "os" + "path/filepath" + "strings" + "time" +) + +func DeviceList(w http.ResponseWriter, r *http.Request) { + log.Println("device list") + dir := "devices" + files, err := os.ReadDir(dir) + if err != nil { + log.Fatal(err) + } + + devices := make(map[string]map[string]interface{}) + + for _, file := range files { + filePath := dir + "/" + file.Name() + ext := filepath.Ext(filePath) + device := strings.TrimSuffix(file.Name(), ext) + + log.Println(device, ext) + + if _, ok := devices[device]; !ok { + devices[device] = make(map[string]interface{}) + } + + if ext == ".json" { + devices[device]["settings"] = readDeviceSettings(filePath) + } + if ext == ".key" { + devices[device]["key"] = true + } + } + + result := map[string]interface{}{ + "devices": devices, + } + + json.NewEncoder(w).Encode(result) +} + +func readDeviceSettings(filepath string) (settings structs.Settings) { + data, err := os.ReadFile(filepath) + if err != nil { + log.Println(err) + } + + err = json.Unmarshal(data, &settings) + if err != nil { + log.Println(err) + } + log.Println(settings) + return settings +} + +func DeviceAccessCheck(w http.ResponseWriter, r *http.Request) { + log.Println("device access check") + var req structs.Check + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + _, errSett := os.Stat("devices/" + req.Uuid + ".json") + _, errKey := os.Stat("devices/" + req.Uuid + ".key") + + if (errSett == nil) && (errKey == nil) { + log.Println("authorized") + json.NewEncoder(w).Encode("authorized") + } else if (errSett == nil) && (errKey != nil) { + log.Println("unauthorized") + json.NewEncoder(w).Encode("unauthorized") + } else { + log.Println("unauthorized") + json.NewEncoder(w).Encode("unlinked") + } + + return +} + +func DeviceAccessRequest(w http.ResponseWriter, r *http.Request) { + var req structs.Request + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + deviceSettings := structs.Settings{Name: req.Name, Type: req.Type} + + settingsJSON, err := json.Marshal(deviceSettings) + if err != nil { + log.Println(err) + return + } + + err = os.WriteFile("devices/"+req.Uuid+".json", settingsJSON, 0644) + + if err != nil { + log.Println(err) + return + } + + json.NewEncoder(w).Encode("unauthorized") +} + +func PingLink(w http.ResponseWriter, r *http.Request) { + log.Println("ping link") + var req structs.Check + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + json.NewEncoder(w).Encode(false) + return + } + + key, keyErr := os.ReadFile("devices/" + req.Uuid + ".key") + pin, pinErr := os.ReadFile("devices/" + req.Uuid + ".tmp") + + encryptedKey, encErr := helper.EncryptAES(string(pin), string(key)) + + log.Println(encryptedKey, string(pin), string(key)) + + if keyErr == nil && pinErr == nil && encErr == nil { + w.Header().Set("Content-Type", "application/json") + w.Write([]byte(encryptedKey)) + return + } + + json.NewEncoder(w).Encode(false) +} + +func StartLink(w http.ResponseWriter, r *http.Request) { + log.Println("start link") + var req structs.Check + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + pin := fmt.Sprintf("%04d", rand.Intn(10000)) + + deviceKey := helper.GenerateKey() + + err = helper.SaveDeviceKey(req.Uuid, deviceKey) + + if err == nil && helper.TempPinFile(req.Uuid, pin) { + json.NewEncoder(w).Encode(pin) + } + + return +} + +func PollLink(w http.ResponseWriter, r *http.Request) { + var req structs.Check + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + json.NewEncoder(w).Encode(false) + return + } + + if helper.CheckPinFile(req.Uuid) { + json.NewEncoder(w).Encode(true) + return + } + + json.NewEncoder(w).Encode(false) +} + +func RemoveLink(data string, w http.ResponseWriter, r *http.Request) { + req := &structs.Check{} + _, err := helper.ParseRequest(req, data, r) + + if err != nil { + json.NewEncoder(w).Encode(false) + return + } + + err = os.Remove("devices/" + req.Uuid + ".key") + + if err != nil { + json.NewEncoder(w).Encode(false) + return + } + + json.NewEncoder(w).Encode(true) +} + +func Handshake(w http.ResponseWriter, r *http.Request) { + var req structs.Handshake + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + return + } + + deviceKey, err := helper.GetKeyByUuid(req.Uuid) + + if err != nil { + json.NewEncoder(w).Encode(false) + return + } + + decryptShake, _ := helper.DecryptAES(deviceKey, req.Shake) + + if decryptShake == getDateStr() { + os.Remove("devices/" + req.Uuid + ".tmp") + + json.NewEncoder(w).Encode(true) + return + } else { + os.Remove("devices/" + req.Uuid + ".key") + } + + json.NewEncoder(w).Encode(false) +} + +func getDateStr() string { + date := time.Now() + year, month, day := date.Date() + formattedDate := fmt.Sprintf("%04d%02d%02d", year, month, day) + return formattedDate +} diff --git a/be/app/helper/api-helper.go b/be/app/helper/api-helper.go new file mode 100644 index 0000000..8adacde --- /dev/null +++ b/be/app/helper/api-helper.go @@ -0,0 +1,102 @@ +package helper + +import ( + "encoding/json" + "log" + "net" + "net/http" + "strings" + + "be/app/structs" + . "be/app/structs" +) + +func EndpointAccess(w http.ResponseWriter, r *http.Request) (bool, string) { + ip, _, err := net.SplitHostPort(r.RemoteAddr) + if err != nil { + log.Fatal(err) + } + + if (isLocal(ip) && isEndpointAllowed("Local", r.URL.Path)) || + (isLanRemote(ip) && isEndpointAllowed("Remote", r.URL.Path)) { + log.Println(r.URL.Path, "endpoint access: accessible") + return true, "" + } else if isLanRemote(ip) && isEndpointAllowed("Auth", r.URL.Path) { + log.Println(r.URL.Path, "endpoint access: authorized") + + data := decryptAuth(r) + + return data != "", data + } + + log.Println(r.URL.Path, "endpoint access: not authorized or accessible") + + return false, "" +} + +func isLocal(ip string) bool { + return ip == "127.0.0.1" || ip == "::1" +} + +func isLanRemote(ip string) bool { + return strings.HasPrefix(ip, "192.168.") +} + +func isEndpointAllowed(source string, endpoint string) bool { + var endpoints, err = getAllowedEndpoints(source) + if err != "" { + log.Println(err) + } + + if (endpoints != nil) && (len(endpoints) > 0) { + for _, e := range endpoints { + if e == endpoint { + return true + } + } + } + + return false +} + +func getAllowedEndpoints(source string) (endpoints []string, err string) { + if source == "Local" { + return Endpoints.Local, "" + } + if source == "Remote" { + return Endpoints.Remote, "" + } + if source == "Auth" { + return Endpoints.Auth, "" + } + + return []string{}, "No allowed endpoints" +} + +func decryptAuth(r *http.Request) string { + var req structs.Authcall + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil || req.Uuid == "" || req.Data == "" { + return "" + } + + deviceKey, errKey := GetKeyByUuid(req.Uuid) + decryptData, errDec := DecryptAES(deviceKey, req.Data) + + if errKey != nil && errDec != nil || decryptData == "" { + return "" + } + + return decryptData +} + +func ParseRequest(req interface{}, data string, r *http.Request) (d interface{}, err error) { + if data != "" { + dataBytes := []byte(data) + return req, json.Unmarshal(dataBytes, &req) + } else { + return req, json.NewDecoder(r.Body).Decode(&req) + } +} diff --git a/be/app/helper/browser-helper.go b/be/app/helper/browser-helper.go new file mode 100644 index 0000000..579bc9e --- /dev/null +++ b/be/app/helper/browser-helper.go @@ -0,0 +1,23 @@ +package helper + +import ( + "os/exec" + "runtime" +) + +func OpenBrowser(url string) bool { + var args []string + + switch runtime.GOOS { + case "darwin": + args = []string{"open"} + case "windows": + args = []string{"cmd", "/c", "start"} + default: + args = []string{"xdg-open"} + } + + cmd := exec.Command(args[0], append(args[1:], url)...) + + return cmd.Start() == nil +} diff --git a/be/app/helper/device-helper.go b/be/app/helper/device-helper.go new file mode 100644 index 0000000..38db5ba --- /dev/null +++ b/be/app/helper/device-helper.go @@ -0,0 +1,46 @@ +package helper + +import ( + "log" + "os" + "time" +) + +func TempPinFile(Uuid string, pin string) bool { + log.Println("temp pin file", Uuid, pin) + err := os.WriteFile("devices/"+Uuid+".tmp", []byte(pin), 0644) + if err != nil { + log.Println(err) + return false + } + + time.AfterFunc(1*time.Minute, func() { + log.Println("deleting", Uuid, pin) + os.Remove("devices/" + Uuid + ".tmp") + }) + + return true +} + +func CheckPinFile(Uuid string) bool { + _, err := os.Stat("devices/" + Uuid + ".tmp") + return err == nil +} + +func SaveDeviceKey(Uuid string, key string) error { + err := os.WriteFile("devices/"+Uuid+".key", []byte(key), 0644) + + if err != nil { + return err + } + + return nil +} + +func GetKeyByUuid(Uuid string) (string, error) { + data, err := os.ReadFile("devices/" + Uuid + ".key") + if err != nil { + return "", err + } + return string(data), nil +} diff --git a/be/app/helper/encrypt-helper.go b/be/app/helper/encrypt-helper.go new file mode 100644 index 0000000..f5a6f91 --- /dev/null +++ b/be/app/helper/encrypt-helper.go @@ -0,0 +1,105 @@ +package helper + +import ( + "bytes" + "crypto/aes" + "crypto/cipher" + "crypto/rand" + "encoding/base64" + "errors" + "strings" +) + +func EncryptAES(key string, plaintext string) (string, error) { + origData := []byte(plaintext) + + // Create AES cipher + block, err := aes.NewCipher(keyToBytes(key)) + if err != nil { + return "", err + } + blockSize := block.BlockSize() + + origData = PKCS5Padding(origData, blockSize) + + iv := []byte(EnvGet("MCRM__IV")) + blockMode := cipher.NewCBCEncrypter(block, iv) + + crypted := make([]byte, len(origData)) + blockMode.CryptBlocks(crypted, origData) + + cryptedString := base64.StdEncoding.EncodeToString(crypted) + + return cryptedString, nil +} + +func DecryptAES(key string, cryptedText string) (string, error) { + crypted, err := base64.StdEncoding.DecodeString(cryptedText) + + if err != nil { + return "", err + } + + block, err := aes.NewCipher(keyToBytes(key)) + if err != nil { + return "", err + } + + iv := []byte(EnvGet("MCRM__IV")) + blockMode := cipher.NewCBCDecrypter(block, iv) + + origData := make([]byte, len(crypted)) + + blockMode.CryptBlocks(origData, crypted) + origData, err = PKCS5UnPadding(origData) + + if err != nil || len(origData) <= 3 { + return "", errors.New("invalid key") + } + + origDataString := string(origData) + + return origDataString, nil +} + +func generateRandomString(length int) string { + b := make([]byte, length) + _, err := rand.Read(b) + if err != nil { + panic(err) + } + return base64.StdEncoding.EncodeToString(b) +} + +func GenerateKey() string { + return strings.Replace(generateRandomString(24), "=", "", -1) +} + +func keyToBytes(key string) []byte { + // Convert key to bytes + keyBytes := []byte(key) + + // If key is 4 characters, append salt + if len(key) == 4 { + keyBytes = []byte(key + EnvGet("MCRM__SALT")) + } + + return keyBytes +} + +func PKCS5Padding(ciphertext []byte, blockSize int) []byte { + padding := blockSize - len(ciphertext)%blockSize + padtext := bytes.Repeat([]byte{byte(padding)}, padding) + return append(ciphertext, padtext...) +} + +func PKCS5UnPadding(origData []byte) ([]byte, error) { + length := len(origData) + unpadding := int(origData[length-1]) + + if (unpadding >= length) || (unpadding == 0) { + return nil, errors.New("unpadding error") + } + + return origData[:(length - unpadding)], nil +} diff --git a/be/app/helper/env-helper.go b/be/app/helper/env-helper.go new file mode 100644 index 0000000..0c58023 --- /dev/null +++ b/be/app/helper/env-helper.go @@ -0,0 +1,16 @@ +package helper + +import ( + "log" + "os" + + "github.com/joho/godotenv" +) + +func EnvGet(key string) string { + err := godotenv.Load("../.env") + if err != nil { + log.Fatal("Error loading .env file") + } + return os.Getenv("VITE_" + key) +} diff --git a/be/app/helper/macro-helper.go b/be/app/helper/macro-helper.go new file mode 100644 index 0000000..ec6a94a --- /dev/null +++ b/be/app/helper/macro-helper.go @@ -0,0 +1,64 @@ +package helper + +import ( + "encoding/json" + "log" + "os" + "regexp" + "strings" + "time" + + "be/app/structs" + + "github.com/go-vgo/robotgo" +) + +func FormatMacroFileName(s string) string { + // Remove invalid characters + re := regexp.MustCompile(`[\/\?\*\>\<\:\\"\|\n]`) + s = re.ReplaceAllString(s, "") + + // Replace spaces with underscores + s = strings.ReplaceAll(s, " ", "_") + + // Remove special characters + re = regexp.MustCompile(`[!@#$%^&\(\)\[\]\{\}\~]`) + s = re.ReplaceAllString(s, "") + + // Truncate the string + if len(s) > 255 { + s = s[:255] + } + + return s +} + +func ReadMacroFile(filename string) (steps []structs.Step, err error) { + log.Println(filename) + + content, err := os.ReadFile(filename) + + if err != nil { + log.Fatal("Error when opening file: ", err) + } + + err = json.Unmarshal(content, &steps) + + return steps, err +} + +func RunMacroSteps(steps []structs.Step) { + for _, step := range steps { + // log.Println(step) + switch step.Type { + case "key": + robotgo.KeyToggle(step.Key, step.Direction) + // log.Println("Toggling", step.Key, "to", step.Direction) + case "delay": + time.Sleep(time.Duration(step.Location) * time.Millisecond) + // log.Println("Sleeping for", step.Value, "milliseconds") + default: + log.Println("Unknown step type:", step.Type) + } + } +} diff --git a/be/app/macro.go b/be/app/macro.go new file mode 100644 index 0000000..4b82e5a --- /dev/null +++ b/be/app/macro.go @@ -0,0 +1,88 @@ +package app + +import ( + "encoding/json" + "fmt" + "io" + "log" + "net/http" + "os" + "path/filepath" + "strings" + + "be/app/helper" + "be/app/structs" +) + +func SaveMacro(w http.ResponseWriter, r *http.Request) { + var newMacro structs.NewMacro + + body, err := io.ReadAll(r.Body) + if err != nil { + panic(err) + } + + log.Println(string(body)) + + err = json.Unmarshal(body, &newMacro) + if err != nil { + panic(err) + } + + stepsJSON, err := json.Marshal(newMacro.Steps) + if err != nil { + panic(err) + } + + err = os.WriteFile("../macros/"+helper.FormatMacroFileName(newMacro.Name)+".json", stepsJSON, 0644) + if err != nil { + panic(err) + } +} + +func ListMacros(w http.ResponseWriter, r *http.Request) { + log.Println("listing macros") + dir := "../macros" + files, err := os.ReadDir(dir) + if err != nil { + log.Println(err) + } + + var fileNames []string + + for _, file := range files { + filename := filepath.Base(file.Name()) + filename = strings.TrimSuffix(filename, filepath.Ext(filename)) + filename = strings.Replace(filename, "_", " ", -1) + + fileNames = append(fileNames, filename) + } + + json.NewEncoder(w).Encode(fileNames) +} + +func DeleteMacro(w http.ResponseWriter, r *http.Request) {} + +func PlayMacro(data string, w http.ResponseWriter, r *http.Request) { + req := &structs.MacroRequest{} + _, err := helper.ParseRequest(req, data, r) + + if err != nil { + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + macro := req.Macro + + var filename = helper.FormatMacroFileName(macro) + var filepath = fmt.Sprintf("../macros/%s.json", filename) + + macroFile, err := helper.ReadMacroFile(filepath) + if err != nil { + fmt.Println(err) + http.Error(w, err.Error(), http.StatusInternalServerError) + return + } + + helper.RunMacroSteps(macroFile) +} diff --git a/be/app/structs/api-struct.go b/be/app/structs/api-struct.go new file mode 100644 index 0000000..774bbad --- /dev/null +++ b/be/app/structs/api-struct.go @@ -0,0 +1,37 @@ +package structs + +type Allowed struct { + Local []string + Remote []string + Auth []string +} + +var Endpoints = Allowed{ + Local: []string{ + "/macro/record", + "/macro/list", + "/macro/delete", + "/macro/play", + "/device/list", + "/device/access/check", + "/device/access/request", + "/device/link/ping", + "/device/link/start", + "/device/link/poll", + "/device/link/remove", + "/device/handshake", + }, + Remote: []string{ + "/macro/list", + "/device/access/check", + "/device/access/request", + "/device/link/ping", + "/device/link/end", + "/device/handshake", + "/device/auth", + }, + Auth: []string{ + "/macro/play", + "/device/link/remove", + }, +} diff --git a/be/app/structs/device-struct.go b/be/app/structs/device-struct.go new file mode 100644 index 0000000..39586cd --- /dev/null +++ b/be/app/structs/device-struct.go @@ -0,0 +1,31 @@ +package structs + +type Settings struct { + Name string `json:"name"` + Type string `json:"type"` +} + +type RemoteWebhook struct { + Event string `json:"event"` + Data string `json:"data"` +} + +type Check struct { + Uuid string `json:"uuid"` +} + +type Request struct { + Uuid string `json:"uuid"` + Name string `json:"name"` + Type string `json:"type"` +} + +type Handshake struct { + Uuid string `json:"uuid"` + Shake string `json:"shake"` +} + +type Authcall struct { + Uuid string `json:"uuid"` + Data string `json:"d"` +} diff --git a/be/app/structs/macro-struct.go b/be/app/structs/macro-struct.go new file mode 100644 index 0000000..a22fa1b --- /dev/null +++ b/be/app/structs/macro-struct.go @@ -0,0 +1,19 @@ +package structs + +type MacroRequest struct { + Macro string `json:"macro"` +} + +type Step struct { + Type string `json:"type"` + Key string `json:"key"` + Code string `json:"code"` + Location int `json:"location"` + Direction string `json:"direction"` + Value int `json:"value"` +} + +type NewMacro struct { + Name string `json:"name"` + Steps []Step `json:"steps"` +} diff --git a/be/devices/a42e16a8-0e99-4bb9-a93f-363740c45b24.json b/be/devices/a42e16a8-0e99-4bb9-a93f-363740c45b24.json new file mode 100644 index 0000000..e0eb582 --- /dev/null +++ b/be/devices/a42e16a8-0e99-4bb9-a93f-363740c45b24.json @@ -0,0 +1 @@ +{"name":"Unknown desktop","type":"desktop"} \ No newline at end of file diff --git a/be/devices/a42e16a8-0e99-4bb9-a93f-363740c45b24.key b/be/devices/a42e16a8-0e99-4bb9-a93f-363740c45b24.key new file mode 100644 index 0000000..5bb53d8 --- /dev/null +++ b/be/devices/a42e16a8-0e99-4bb9-a93f-363740c45b24.key @@ -0,0 +1 @@ +3JYxP8LOq1Y2fhpgEtpXVJ3v4s3qdML3 \ No newline at end of file diff --git a/be/devices/f70778be-99c1-4c5c-b1a2-36ef73d971a0.json b/be/devices/f70778be-99c1-4c5c-b1a2-36ef73d971a0.json new file mode 100644 index 0000000..203fbb3 --- /dev/null +++ b/be/devices/f70778be-99c1-4c5c-b1a2-36ef73d971a0.json @@ -0,0 +1 @@ +{"name":"Unknown mobile","type":"mobile"} \ No newline at end of file diff --git a/be/devices/f70778be-99c1-4c5c-b1a2-36ef73d971a0.key b/be/devices/f70778be-99c1-4c5c-b1a2-36ef73d971a0.key new file mode 100644 index 0000000..4aa4e7a --- /dev/null +++ b/be/devices/f70778be-99c1-4c5c-b1a2-36ef73d971a0.key @@ -0,0 +1 @@ +4MqIbBoPsHizsWCyeqg6gd/wpQzfhc7e \ No newline at end of file diff --git a/be/go.mod b/be/go.mod new file mode 100644 index 0000000..abe1604 --- /dev/null +++ b/be/go.mod @@ -0,0 +1,38 @@ +module be + +go 1.24.0 + +require ( + github.com/go-vgo/robotgo v0.110.6 + github.com/joho/godotenv v1.5.1 +) + +require ( + github.com/dblohm7/wingoes v0.0.0-20240820181039-f2b84150679e // indirect + github.com/ebitengine/purego v0.8.2 // indirect + github.com/gen2brain/shm v0.1.1 // indirect + github.com/go-ole/go-ole v1.3.0 // indirect + github.com/godbus/dbus/v5 v5.1.0 // indirect + github.com/jezek/xgb v1.1.1 // indirect + github.com/kbinani/screenshot v0.0.0-20250118074034-a3924b7bbc8c // indirect + github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683 // indirect + github.com/lxn/win v0.0.0-20210218163916-a377121e959e // indirect + github.com/otiai10/gosseract v2.2.1+incompatible // indirect + github.com/otiai10/mint v1.6.3 // indirect + github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55 // indirect + github.com/robotn/xgb v0.10.0 // indirect + github.com/robotn/xgbutil v0.10.0 // indirect + github.com/shirou/gopsutil/v4 v4.25.1 // indirect + github.com/tailscale/win v0.0.0-20250213223159-5992cb43ca35 // indirect + github.com/tklauser/go-sysconf v0.3.14 // indirect + github.com/tklauser/numcpus v0.9.0 // indirect + github.com/vcaesar/gops v0.40.0 // indirect + github.com/vcaesar/imgo v0.40.2 // indirect + github.com/vcaesar/keycode v0.10.1 // indirect + github.com/vcaesar/tt v0.20.1 // indirect + github.com/yusufpapurcu/wmi v1.2.4 // indirect + golang.org/x/exp v0.0.0-20250215185904-eff6e970281f // indirect + golang.org/x/image v0.24.0 // indirect + golang.org/x/net v0.38.0 // indirect + golang.org/x/sys v0.31.0 // indirect +) diff --git a/be/go.sum b/be/go.sum new file mode 100644 index 0000000..27c1608 --- /dev/null +++ b/be/go.sum @@ -0,0 +1,80 @@ +github.com/BurntSushi/freetype-go v0.0.0-20160129220410-b763ddbfe298/go.mod h1:D+QujdIlUNfa0igpNMk6UIvlb6C252URs4yupRUV4lQ= +github.com/BurntSushi/graphics-go v0.0.0-20160129215708-b43f31a4a966/go.mod h1:Mid70uvE93zn9wgF92A/r5ixgnvX8Lh68fxp9KQBaI0= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/dblohm7/wingoes v0.0.0-20240820181039-f2b84150679e h1:L+XrFvD0vBIBm+Wf9sFN6aU395t7JROoai0qXZraA4U= +github.com/dblohm7/wingoes v0.0.0-20240820181039-f2b84150679e/go.mod h1:SUxUaAK/0UG5lYyZR1L1nC4AaYYvSSYTWQSH3FPcxKU= +github.com/ebitengine/purego v0.8.2 h1:jPPGWs2sZ1UgOSgD2bClL0MJIqu58nOmIcBuXr62z1I= +github.com/ebitengine/purego v0.8.2/go.mod h1:iIjxzd6CiRiOG0UyXP+V1+jWqUXVjPKLAI0mRfJZTmQ= +github.com/gen2brain/shm v0.1.1 h1:1cTVA5qcsUFixnDHl14TmRoxgfWEEZlTezpUj1vm5uQ= +github.com/gen2brain/shm v0.1.1/go.mod h1:UgIcVtvmOu+aCJpqJX7GOtiN7X2ct+TKLg4RTxwPIUA= +github.com/go-ole/go-ole v1.2.6/go.mod h1:pprOEPIfldk/42T2oK7lQ4v4JSDwmV0As9GaiUsvbm0= +github.com/go-ole/go-ole v1.3.0 h1:Dt6ye7+vXGIKZ7Xtk4s6/xVdGDQynvom7xCFEdWr6uE= +github.com/go-ole/go-ole v1.3.0/go.mod h1:5LS6F96DhAwUc7C+1HLexzMXY1xGRSryjyPPKW6zv78= +github.com/go-vgo/robotgo v0.110.6 h1:1tOxlmTXYg6F3Xs8IT++331MxY2nZ+Q3B6eW312llbo= +github.com/go-vgo/robotgo v0.110.6/go.mod h1:eBUjTHY1HYjzdi1+UWJUbxB+b9gE+l4Ei7vQU/9SnLw= +github.com/godbus/dbus/v5 v5.1.0 h1:4KLkAxT3aOY8Li4FRJe/KvhoNFFxo0m6fNuFUO8QJUk= +github.com/godbus/dbus/v5 v5.1.0/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= +github.com/google/go-cmp v0.6.0 h1:ofyhxvXcZhMsU5ulbFiLKl/XBFqE1GSq7atu8tAmTRI= +github.com/google/go-cmp v0.6.0/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= +github.com/jezek/xgb v1.1.1 h1:bE/r8ZZtSv7l9gk6nU0mYx51aXrvnyb44892TwSaqS4= +github.com/jezek/xgb v1.1.1/go.mod h1:nrhwO0FX/enq75I7Y7G8iN1ubpSGZEiA3v9e9GyRFlk= +github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0= +github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4= +github.com/kbinani/screenshot v0.0.0-20250118074034-a3924b7bbc8c h1:1IlzDla/ZATV/FsRn1ETf7ir91PHS2mrd4VMunEtd9k= +github.com/kbinani/screenshot v0.0.0-20250118074034-a3924b7bbc8c/go.mod h1:Pmpz2BLf55auQZ67u3rvyI2vAQvNetkK/4zYUmpauZQ= +github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683 h1:7UMa6KCCMjZEMDtTVdcGu0B1GmmC7QJKiCCjyTAWQy0= +github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683/go.mod h1:ilwx/Dta8jXAgpFYFvSWEMwxmbWXyiUHkd5FwyKhb5k= +github.com/lxn/win v0.0.0-20210218163916-a377121e959e h1:H+t6A/QJMbhCSEH5rAuRxh+CtW96g0Or0Fxa9IKr4uc= +github.com/lxn/win v0.0.0-20210218163916-a377121e959e/go.mod h1:KxxjdtRkfNoYDCUP5ryK7XJJNTnpC8atvtmTheChOtk= +github.com/nfnt/resize v0.0.0-20180221191011-83c6a9932646 h1:zYyBkD/k9seD2A7fsi6Oo2LfFZAehjjQMERAvZLEDnQ= +github.com/nfnt/resize v0.0.0-20180221191011-83c6a9932646/go.mod h1:jpp1/29i3P1S/RLdc7JQKbRpFeM1dOBd8T9ki5s+AY8= +github.com/otiai10/gosseract v2.2.1+incompatible h1:Ry5ltVdpdp4LAa2bMjsSJH34XHVOV7XMi41HtzL8X2I= +github.com/otiai10/gosseract v2.2.1+incompatible/go.mod h1:XrzWItCzCpFRZ35n3YtVTgq5bLAhFIkascoRo8G32QE= +github.com/otiai10/mint v1.6.3 h1:87qsV/aw1F5as1eH1zS/yqHY85ANKVMgkDrf9rcxbQs= +github.com/otiai10/mint v1.6.3/go.mod h1:MJm72SBthJjz8qhefc4z1PYEieWmy8Bku7CjcAqyUSM= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55 h1:o4JXh1EVt9k/+g42oCprj/FisM4qX9L3sZB3upGN2ZU= +github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55/go.mod h1:OmDBASR4679mdNQnz2pUhc2G8CO2JrUAVFDRBDP/hJE= +github.com/robotn/xgb v0.0.0-20190912153532-2cb92d044934/go.mod h1:SxQhJskUJ4rleVU44YvnrdvxQr0tKy5SRSigBrCgyyQ= +github.com/robotn/xgb v0.10.0 h1:O3kFbIwtwZ3pgLbp1h5slCQ4OpY8BdwugJLrUe6GPIM= +github.com/robotn/xgb v0.10.0/go.mod h1:SxQhJskUJ4rleVU44YvnrdvxQr0tKy5SRSigBrCgyyQ= +github.com/robotn/xgbutil v0.10.0 h1:gvf7mGQqCWQ68aHRtCxgdewRk+/KAJui6l3MJQQRCKw= +github.com/robotn/xgbutil v0.10.0/go.mod h1:svkDXUDQjUiWzLrA0OZgHc4lbOts3C+uRfP6/yjwYnU= +github.com/shirou/gopsutil/v4 v4.25.1 h1:QSWkTc+fu9LTAWfkZwZ6j8MSUk4A2LV7rbH0ZqmLjXs= +github.com/shirou/gopsutil/v4 v4.25.1/go.mod h1:RoUCUpndaJFtT+2zsZzzmhvbfGoDCJ7nFXKJf8GqJbI= +github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA= +github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY= +github.com/tailscale/win v0.0.0-20250213223159-5992cb43ca35 h1:wAZbkTZkqDzWsqxPh2qkBd3KvFU7tcxV0BP0Rnhkxog= +github.com/tailscale/win v0.0.0-20250213223159-5992cb43ca35/go.mod h1:aMd4yDHLjbOuYP6fMxj1d9ACDQlSWwYztcpybGHCQc8= +github.com/tc-hib/winres v0.2.1 h1:YDE0FiP0VmtRaDn7+aaChp1KiF4owBiJa5l964l5ujA= +github.com/tc-hib/winres v0.2.1/go.mod h1:C/JaNhH3KBvhNKVbvdlDWkbMDO9H4fKKDaN7/07SSuk= +github.com/tklauser/go-sysconf v0.3.14 h1:g5vzr9iPFFz24v2KZXs/pvpvh8/V9Fw6vQK5ZZb78yU= +github.com/tklauser/go-sysconf v0.3.14/go.mod h1:1ym4lWMLUOhuBOPGtRcJm7tEGX4SCYNEEEtghGG/8uY= +github.com/tklauser/numcpus v0.9.0 h1:lmyCHtANi8aRUgkckBgoDk1nHCux3n2cgkJLXdQGPDo= +github.com/tklauser/numcpus v0.9.0/go.mod h1:SN6Nq1O3VychhC1npsWostA+oW+VOQTxZrS604NSRyI= +github.com/vcaesar/gops v0.40.0 h1:I+1RCGiV+LkZJUYNzAd373xs0uM2UyeFdZBmow8HfCM= +github.com/vcaesar/gops v0.40.0/go.mod h1:3u/USW7JovqUK6i13VOD3qWfvXXd2TIIKE4PYIv4TOM= +github.com/vcaesar/imgo v0.40.2 h1:5GWScRLdBCMtO1v2I1bs+ZmDLZFINxYSMZ+mtUw5qPM= +github.com/vcaesar/imgo v0.40.2/go.mod h1:MVCl+FxHI2gTgmiHoi0n5xNCbYcfv9SVtdEOUC92+eo= +github.com/vcaesar/keycode v0.10.1 h1:0DesGmMAPWpYTCYddOFiCMKCDKgNnwiQa2QXindVUHw= +github.com/vcaesar/keycode v0.10.1/go.mod h1:JNlY7xbKsh+LAGfY2j4M3znVrGEm5W1R8s/Uv6BJcfQ= +github.com/vcaesar/tt v0.20.1 h1:D/jUeeVCNbq3ad8M7hhtB3J9x5RZ6I1n1eZ0BJp7M+4= +github.com/vcaesar/tt v0.20.1/go.mod h1:cH2+AwGAJm19Wa6xvEa+0r+sXDJBT0QgNQey6mwqLeU= +github.com/yusufpapurcu/wmi v1.2.4 h1:zFUKzehAFReQwLys1b/iSMl+JQGSCSjtVqQn9bBrPo0= +github.com/yusufpapurcu/wmi v1.2.4/go.mod h1:SBZ9tNy3G9/m5Oi98Zks0QjeHVDvuK0qfxQmPyzfmi0= +golang.org/x/exp v0.0.0-20250215185904-eff6e970281f h1:oFMYAjX0867ZD2jcNiLBrI9BdpmEkvPyi5YrBGXbamg= +golang.org/x/exp v0.0.0-20250215185904-eff6e970281f/go.mod h1:BHOTPb3L19zxehTsLoJXVaTktb06DFgmdW6Wb9s8jqk= +golang.org/x/image v0.24.0 h1:AN7zRgVsbvmTfNyqIbbOraYL8mSwcKncEj8ofjgzcMQ= +golang.org/x/image v0.24.0/go.mod h1:4b/ITuLfqYq1hqZcjofwctIhi7sZh2WaCjvsBNjjya8= +golang.org/x/net v0.38.0 h1:vRMAPTMaeGqVhG5QyLJHqNDwecKTomGeqbnfZyKlBI8= +golang.org/x/net v0.38.0/go.mod h1:ivrbrMbzFq5J41QOQh0siUuly180yBYtLp+CKbEaFx8= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201018230417-eeed37f84f13/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201204225414-ed752295db88/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.31.0 h1:ioabZlmFYtWhL+TRYpcnNlLwhyxaM9kWTDEmfnprqik= +golang.org/x/sys v0.31.0/go.mod h1:BJP2sWEmIv4KK5OTEluFJCKSidICx8ciO85XgH3Ak8k= +gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA= +gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= diff --git a/be/index.html b/be/index.html new file mode 100644 index 0000000..bc22877 --- /dev/null +++ b/be/index.html @@ -0,0 +1,23 @@ + + + + + + 404 - BALLS + + + +

Balls found

+ So not the content you're looking for. + + diff --git a/be/macroOLD/macro.go b/be/macroOLD/macro.go new file mode 100644 index 0000000..4abe231 --- /dev/null +++ b/be/macroOLD/macro.go @@ -0,0 +1,162 @@ +package macro + +import ( + "encoding/json" + "fmt" + "io" + "log" + "net/http" + "os" + "path/filepath" + "regexp" + "strings" + "time" + + "github.com/go-vgo/robotgo" +) + +type Step struct { + Type string `json:"type"` + Key string `json:"key"` + Code string `json:"code"` + Location int `json:"location"` + Direction string `json:"direction"` + Value int `json:"value"` +} + +var newMacro struct { + Name string `json:"name"` + Steps []Step `json:"steps"` +} + +func Save(w http.ResponseWriter, r *http.Request) { + body, err := io.ReadAll(r.Body) + + if err != nil { + panic(err) + } + + log.Println(string(body)) + + err = json.Unmarshal(body, &newMacro) + + if err != nil { + panic(err) + } + + stepsJSON, err := json.Marshal(newMacro.Steps) + if err != nil { + panic(err) + } + + err = os.WriteFile("../macros/"+makeValidFilename(newMacro.Name)+".json", stepsJSON, 0644) + if err != nil { + panic(err) + } +} + +func makeValidFilename(s string) string { + // Remove invalid characters + re := regexp.MustCompile(`[\/\?\*\>\<\:\\"\|\n]`) + s = re.ReplaceAllString(s, "") + + // Replace spaces with underscores + s = strings.ReplaceAll(s, " ", "_") + + // Remove special characters + re = regexp.MustCompile(`[!@#$%^&\(\)\[\]\{\}\~]`) + s = re.ReplaceAllString(s, "") + + // Truncate the string + if len(s) > 255 { + s = s[:255] + } + + return s +} + +func List(w http.ResponseWriter, r *http.Request) { + log.Println("listing macros") + dir := "../macros" + files, err := os.ReadDir(dir) + if err != nil { + log.Fatal(err) + } + + var fileNames []string + + for _, file := range files { + filename := filepath.Base(file.Name()) + filename = strings.TrimSuffix(filename, filepath.Ext(filename)) + filename = strings.Replace(filename, "_", " ", -1) + + fileNames = append(fileNames, filename) + } + + json.NewEncoder(w).Encode(fileNames) +} + +func Delete(w http.ResponseWriter, r *http.Request) {} + +func Play(w http.ResponseWriter, r *http.Request) { + type MacroRequest struct { + Macro string `json:"macro"` + } + + var req MacroRequest + + err := json.NewDecoder(r.Body).Decode(&req) + + if err != nil { + http.Error(w, err.Error(), http.StatusBadRequest) + return + } + + macro := req.Macro + + macroFile, err := readMacroFile(fmt.Sprintf("../macros/%s.json", makeValidFilename(macro))) + + if err != nil { + fmt.Println(err) + http.Error(w, err.Error(), http.StatusInternalServerError) + return + } + + playMacro(macroFile) + // fmt.Println(macroFile) +} + +func readMacroFile(filename string) (steps []Step, err error) { + + log.Println(filename) + // Let's first read the `config.json` file + content, err := os.ReadFile(filename) + if err != nil { + log.Fatal("Error when opening file: ", err) + } + + // Now let's unmarshall the data into `steps` + err = json.Unmarshal(content, &steps) + if err != nil { + log.Fatal("Error during Unmarshal(): ", err) + } + + return steps, nil +} + +func playMacro(steps []Step) { + for _, step := range steps { + // log.Println(step) + switch step.Type { + case "key": + robotgo.KeyToggle(step.Key, step.Direction) + // log.Println("Toggling", step.Key, "to", step.Direction) + case "delay": + time.Sleep(time.Duration(step.Location) * time.Millisecond) + // log.Println("Sleeping for", step.Value, "milliseconds") + default: + log.Println("Unknown step type:", step.Type) + } + } + +} diff --git a/be/main.go b/be/main.go new file mode 100644 index 0000000..6c02643 --- /dev/null +++ b/be/main.go @@ -0,0 +1,26 @@ +package main + +import ( + "log" + "net/http" + + "be/app" +) + +func main() { + http.HandleFunc("/", func(w http.ResponseWriter, r *http.Request) { + apiInit(w, r) + }) + + log.Println(http.ListenAndServe(":6970", nil)) +} + +func apiInit(w http.ResponseWriter, r *http.Request) { + app.ApiCORS(w, r) + + if r.Method == "GET" { + app.ApiGet(w, r) + } else if r.Method == "POST" { + app.ApiPost(w, r) + } +} diff --git a/be/tmp/build-errors.log b/be/tmp/build-errors.log new file mode 100644 index 0000000..d4bc9c7 --- /dev/null +++ b/be/tmp/build-errors.log @@ -0,0 +1 @@ +exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1exit status 1 \ No newline at end of file diff --git a/Macrame.exe b/be/tmp/main.exe similarity index 70% rename from Macrame.exe rename to be/tmp/main.exe index c900c64..86c4c25 100644 Binary files a/Macrame.exe and b/be/tmp/main.exe differ diff --git a/build.sh b/build.sh new file mode 100644 index 0000000..65eb876 --- /dev/null +++ b/build.sh @@ -0,0 +1,35 @@ +#!/bin/bash + +# Set the name of the build directory +BUILD_DIR="Macrame_$(date +'%m%d%H%M%S')" + +# Build the Go application +go build -ldflags "-H=windowsgui" -o Macrame.exe main.go + +# Build the frontend +cd fe +npm run build + +cd ../builds + +# Create the new build directory +mkdir $BUILD_DIR +mkdir $BUILD_DIR/macros +mkdir $BUILD_DIR/panels +mkdir $BUILD_DIR/panels/test_panel +mkdir $BUILD_DIR/public +mkdir $BUILD_DIR/public/assets + +# Move the generated files to the new build directory +cp ../Macrame.exe $BUILD_DIR/Macrame.exe +cp ../favicon.ico $BUILD_DIR/favicon.ico +find ../macros -type f ! -name 'ED-*' -exec cp --parents {} "$BUILD_DIR/macros/" \; +cp -r ../panels/test_panel/* $BUILD_DIR/panels/test_panel/ +mv ../public/* $BUILD_DIR/public/ + +# cp ../install.bat $BUILD_DIR/install.bat + +powershell -Command "Compress-Archive -Path $BUILD_DIR/* -DestinationPath $BUILD_DIR.zip -Force" + +# Print the path to the new build directory +echo "Build directory: ../$BUILD_DIR" \ No newline at end of file diff --git a/fe/.editorconfig b/fe/.editorconfig new file mode 100644 index 0000000..7f5b23f --- /dev/null +++ b/fe/.editorconfig @@ -0,0 +1,9 @@ +[*.{js,jsx,mjs,cjs,ts,tsx,mts,cts,vue}] +charset = utf-8 +indent_size = 2 +indent_style = space +insert_final_newline = true +trim_trailing_whitespace = true + +end_of_line = lf +max_line_length = 100 diff --git a/fe/.gitattributes b/fe/.gitattributes new file mode 100644 index 0000000..6313b56 --- /dev/null +++ b/fe/.gitattributes @@ -0,0 +1 @@ +* text=auto eol=lf diff --git a/fe/.gitignore b/fe/.gitignore new file mode 100644 index 0000000..8ee54e8 --- /dev/null +++ b/fe/.gitignore @@ -0,0 +1,30 @@ +# Logs +logs +*.log +npm-debug.log* +yarn-debug.log* +yarn-error.log* +pnpm-debug.log* +lerna-debug.log* + +node_modules +.DS_Store +dist +dist-ssr +coverage +*.local + +/cypress/videos/ +/cypress/screenshots/ + +# Editor directories and files +.vscode/* +!.vscode/extensions.json +.idea +*.suo +*.ntvs* +*.njsproj +*.sln +*.sw? + +*.tsbuildinfo diff --git a/fe/.prettierrc.json b/fe/.prettierrc.json new file mode 100644 index 0000000..17a23d0 --- /dev/null +++ b/fe/.prettierrc.json @@ -0,0 +1,7 @@ + +{ + "$schema": "https://json.schemastore.org/prettierrc", + "semi": false, + "singleQuote": true, + "printWidth": 100 +} diff --git a/fe/.vscode/extensions.json b/fe/.vscode/extensions.json new file mode 100644 index 0000000..c92168f --- /dev/null +++ b/fe/.vscode/extensions.json @@ -0,0 +1,8 @@ +{ + "recommendations": [ + "Vue.volar", + "dbaeumer.vscode-eslint", + "EditorConfig.EditorConfig", + "esbenp.prettier-vscode" + ] +} diff --git a/fe/README.md b/fe/README.md new file mode 100644 index 0000000..ae6174c --- /dev/null +++ b/fe/README.md @@ -0,0 +1,35 @@ +# fe + +This template should help get you started developing with Vue 3 in Vite. + +## Recommended IDE Setup + +[VSCode](https://code.visualstudio.com/) + [Volar](https://marketplace.visualstudio.com/items?itemName=Vue.volar) (and disable Vetur). + +## Customize configuration + +See [Vite Configuration Reference](https://vite.dev/config/). + +## Project Setup + +```sh +npm install +``` + +### Compile and Hot-Reload for Development + +```sh +npm run dev +``` + +### Compile and Minify for Production + +```sh +npm run build +``` + +### Lint with [ESLint](https://eslint.org/) + +```sh +npm run lint +``` diff --git a/fe/assets/main.css b/fe/assets/main.css new file mode 100644 index 0000000..1b2d914 --- /dev/null +++ b/fe/assets/main.css @@ -0,0 +1,4 @@ +html, +body { + background-color: white; +} diff --git a/fe/eslint.config.js b/fe/eslint.config.js new file mode 100644 index 0000000..76c70ec --- /dev/null +++ b/fe/eslint.config.js @@ -0,0 +1,19 @@ +import js from '@eslint/js' +import pluginVue from 'eslint-plugin-vue' +import skipFormatting from '@vue/eslint-config-prettier/skip-formatting' + +export default [ + { + name: 'app/files-to-lint', + files: ['**/*.{js,mjs,jsx,vue}'], + }, + + { + name: 'app/files-to-ignore', + ignores: ['**/dist/**', '**/dist-ssr/**', '**/coverage/**'], + }, + + js.configs.recommended, + ...pluginVue.configs['flat/essential'], + skipFormatting, +] diff --git a/fe/index.html b/fe/index.html new file mode 100644 index 0000000..3dbdfe8 --- /dev/null +++ b/fe/index.html @@ -0,0 +1,20 @@ + + + + + + + + + + Macrame + + + +
+ + + diff --git a/fe/jsconfig.json b/fe/jsconfig.json new file mode 100644 index 0000000..5a1f2d2 --- /dev/null +++ b/fe/jsconfig.json @@ -0,0 +1,8 @@ +{ + "compilerOptions": { + "paths": { + "@/*": ["./src/*"] + } + }, + "exclude": ["node_modules", "dist"] +} diff --git a/public/assets/mcrm-icon-_gnb1h7S.svg b/fe/mcrm-icon.svg similarity index 100% rename from public/assets/mcrm-icon-_gnb1h7S.svg rename to fe/mcrm-icon.svg diff --git a/fe/package-lock.json b/fe/package-lock.json new file mode 100644 index 0000000..96e15e3 --- /dev/null +++ b/fe/package-lock.json @@ -0,0 +1,5334 @@ +{ + "name": "fe", + "version": "0.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "name": "fe", + "version": "0.0.0", + "dependencies": { + "@tabler/icons-vue": "^3.30.0", + "@tailwindcss/vite": "^4.0.9", + "vue": "^3.5.13", + "vue-router": "^4.5.0" + }, + "devDependencies": { + "@basitcodeenv/vue3-device-detect": "^1.0.3", + "@eslint/js": "^9.20.0", + "@vitejs/plugin-vue": "^5.2.1", + "@vue/eslint-config-prettier": "^10.2.0", + "axios": "^1.8.3", + "crypto-js": "^4.2.0", + "eslint": "^9.20.1", + "eslint-plugin-vue": "^9.32.0", + "pinia": "^3.0.1", + "prettier": "^3.5.1", + "qrcode": "^1.5.4", + "sass-embedded": "^1.85.1", + "tailwindcss": "^4.0.9", + "uuid": "^11.1.0", + "vite": "^6.1.0", + "vite-plugin-vue-devtools": "^7.7.2" + } + }, + "node_modules/@ampproject/remapping": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/@ampproject/remapping/-/remapping-2.3.0.tgz", + "integrity": "sha512-30iZtAPgz+LTIYoeivqYo853f02jBYSd5uGnGpkFV0M3xOt9aN73erkgYAmZU43x4VfqcnLxW9Kpg3R5LC4YYw==", + "dev": true, + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.5", + "@jridgewell/trace-mapping": "^0.3.24" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@antfu/utils": { + "version": "0.7.10", + "resolved": "https://registry.npmjs.org/@antfu/utils/-/utils-0.7.10.tgz", + "integrity": "sha512-+562v9k4aI80m1+VuMHehNJWLOFjBnXn3tdOitzD0il5b7smkSBal4+a3oKiQTbrwMmN/TBUMDvbdoWDehgOww==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/antfu" + } + }, + "node_modules/@babel/code-frame": { + "version": "7.26.2", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.26.2.tgz", + "integrity": "sha512-RJlIHRueQgwWitWgF8OdFYGZX328Ax5BCemNGlqHfplnRT9ESi8JkFlvaVYbS+UubVY6dpv87Fs2u5M29iNFVQ==", + "dev": true, + "dependencies": { + "@babel/helper-validator-identifier": "^7.25.9", + "js-tokens": "^4.0.0", + "picocolors": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/compat-data": { + "version": "7.26.8", + "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.26.8.tgz", + "integrity": "sha512-oH5UPLMWR3L2wEFLnFJ1TZXqHufiTKAiLfqw5zkhS4dKXLJ10yVztfil/twG8EDTA4F/tvVNw9nOl4ZMslB8rQ==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/core": { + "version": "7.26.10", + "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.26.10.tgz", + "integrity": "sha512-vMqyb7XCDMPvJFFOaT9kxtiRh42GwlZEg1/uIgtZshS5a/8OaduUfCi7kynKgc3Tw/6Uo2D+db9qBttghhmxwQ==", + "dev": true, + "dependencies": { + "@ampproject/remapping": "^2.2.0", + "@babel/code-frame": "^7.26.2", + "@babel/generator": "^7.26.10", + "@babel/helper-compilation-targets": "^7.26.5", + "@babel/helper-module-transforms": "^7.26.0", + "@babel/helpers": "^7.26.10", + "@babel/parser": "^7.26.10", + "@babel/template": "^7.26.9", + "@babel/traverse": "^7.26.10", + "@babel/types": "^7.26.10", + "convert-source-map": "^2.0.0", + "debug": "^4.1.0", + "gensync": "^1.0.0-beta.2", + "json5": "^2.2.3", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/babel" + } + }, + "node_modules/@babel/core/node_modules/semver": { + "version": "6.3.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz", + "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/@babel/generator": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.27.0.tgz", + "integrity": "sha512-VybsKvpiN1gU1sdMZIp7FcqphVVKEwcuj02x73uvcHE0PTihx1nlBcowYWhDwjpoAXRv43+gDzyggGnn1XZhVw==", + "dev": true, + "dependencies": { + "@babel/parser": "^7.27.0", + "@babel/types": "^7.27.0", + "@jridgewell/gen-mapping": "^0.3.5", + "@jridgewell/trace-mapping": "^0.3.25", + "jsesc": "^3.0.2" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-annotate-as-pure": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/helper-annotate-as-pure/-/helper-annotate-as-pure-7.25.9.tgz", + "integrity": "sha512-gv7320KBUFJz1RnylIg5WWYPRXKZ884AGkYpgpWW02TH66Dl+HaC1t1CKd0z3R4b6hdYEcmrNZHUmfCP+1u3/g==", + "dev": true, + "dependencies": { + "@babel/types": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-compilation-targets": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.27.0.tgz", + "integrity": "sha512-LVk7fbXml0H2xH34dFzKQ7TDZ2G4/rVTOrq9V+icbbadjbVxxeFeDsNHv2SrZeWoA+6ZiTyWYWtScEIW07EAcA==", + "dev": true, + "dependencies": { + "@babel/compat-data": "^7.26.8", + "@babel/helper-validator-option": "^7.25.9", + "browserslist": "^4.24.0", + "lru-cache": "^5.1.1", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-compilation-targets/node_modules/semver": { + "version": "6.3.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz", + "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/@babel/helper-create-class-features-plugin": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/helper-create-class-features-plugin/-/helper-create-class-features-plugin-7.27.0.tgz", + "integrity": "sha512-vSGCvMecvFCd/BdpGlhpXYNhhC4ccxyvQWpbGL4CWbvfEoLFWUZuSuf7s9Aw70flgQF+6vptvgK2IfOnKlRmBg==", + "dev": true, + "dependencies": { + "@babel/helper-annotate-as-pure": "^7.25.9", + "@babel/helper-member-expression-to-functions": "^7.25.9", + "@babel/helper-optimise-call-expression": "^7.25.9", + "@babel/helper-replace-supers": "^7.26.5", + "@babel/helper-skip-transparent-expression-wrappers": "^7.25.9", + "@babel/traverse": "^7.27.0", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0" + } + }, + "node_modules/@babel/helper-create-class-features-plugin/node_modules/semver": { + "version": "6.3.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz", + "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/@babel/helper-member-expression-to-functions": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/helper-member-expression-to-functions/-/helper-member-expression-to-functions-7.25.9.tgz", + "integrity": "sha512-wbfdZ9w5vk0C0oyHqAJbc62+vet5prjj01jjJ8sKn3j9h3MQQlflEdXYvuqRWjHnM12coDEqiC1IRCi0U/EKwQ==", + "dev": true, + "dependencies": { + "@babel/traverse": "^7.25.9", + "@babel/types": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-module-imports": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.25.9.tgz", + "integrity": "sha512-tnUA4RsrmflIM6W6RFTLFSXITtl0wKjgpnLgXyowocVPrbYrLUXSBXDgTs8BlbmIzIdlBySRQjINYs2BAkiLtw==", + "dev": true, + "dependencies": { + "@babel/traverse": "^7.25.9", + "@babel/types": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-module-transforms": { + "version": "7.26.0", + "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.26.0.tgz", + "integrity": "sha512-xO+xu6B5K2czEnQye6BHA7DolFFmS3LB7stHZFaOLb1pAwO1HWLS8fXA+eh0A2yIvltPVmx3eNNDBJA2SLHXFw==", + "dev": true, + "dependencies": { + "@babel/helper-module-imports": "^7.25.9", + "@babel/helper-validator-identifier": "^7.25.9", + "@babel/traverse": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0" + } + }, + "node_modules/@babel/helper-optimise-call-expression": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/helper-optimise-call-expression/-/helper-optimise-call-expression-7.25.9.tgz", + "integrity": "sha512-FIpuNaz5ow8VyrYcnXQTDRGvV6tTjkNtCK/RYNDXGSLlUD6cBuQTSw43CShGxjvfBTfcUA/r6UhUCbtYqkhcuQ==", + "dev": true, + "dependencies": { + "@babel/types": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-plugin-utils": { + "version": "7.26.5", + "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.26.5.tgz", + "integrity": "sha512-RS+jZcRdZdRFzMyr+wcsaqOmld1/EqTghfaBGQQd/WnRdzdlvSZ//kF7U8VQTxf1ynZ4cjUcYgjVGx13ewNPMg==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-replace-supers": { + "version": "7.26.5", + "resolved": "https://registry.npmjs.org/@babel/helper-replace-supers/-/helper-replace-supers-7.26.5.tgz", + "integrity": "sha512-bJ6iIVdYX1YooY2X7w1q6VITt+LnUILtNk7zT78ykuwStx8BauCzxvFqFaHjOpW1bVnSUM1PN1f0p5P21wHxvg==", + "dev": true, + "dependencies": { + "@babel/helper-member-expression-to-functions": "^7.25.9", + "@babel/helper-optimise-call-expression": "^7.25.9", + "@babel/traverse": "^7.26.5" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0" + } + }, + "node_modules/@babel/helper-skip-transparent-expression-wrappers": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/helper-skip-transparent-expression-wrappers/-/helper-skip-transparent-expression-wrappers-7.25.9.tgz", + "integrity": "sha512-K4Du3BFa3gvyhzgPcntrkDgZzQaq6uozzcpGbOO1OEJaI+EJdqWIMTLgFgQf6lrfiDFo5FU+BxKepI9RmZqahA==", + "dev": true, + "dependencies": { + "@babel/traverse": "^7.25.9", + "@babel/types": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-string-parser": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/helper-string-parser/-/helper-string-parser-7.25.9.tgz", + "integrity": "sha512-4A/SCr/2KLd5jrtOMFzaKjVtAei3+2r/NChoBNoZ3EyP/+GlhoaEGoWOZUmFmoITP7zOJyHIMm+DYRd8o3PvHA==", + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-validator-identifier": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.25.9.tgz", + "integrity": "sha512-Ed61U6XJc3CVRfkERJWDz4dJwKe7iLmmJsbOGu9wSloNSFttHV0I8g6UAgb7qnK5ly5bGLPd4oXZlxCdANBOWQ==", + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-validator-option": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-option/-/helper-validator-option-7.25.9.tgz", + "integrity": "sha512-e/zv1co8pp55dNdEcCynfj9X7nyUKUXoUEwfXqaZt0omVOmDe9oOTdKStH4GmAw6zxMFs50ZayuMfHDKlO7Tfw==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helpers": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.27.0.tgz", + "integrity": "sha512-U5eyP/CTFPuNE3qk+WZMxFkp/4zUzdceQlfzf7DdGdhp+Fezd7HD+i8Y24ZuTMKX3wQBld449jijbGq6OdGNQg==", + "dev": true, + "dependencies": { + "@babel/template": "^7.27.0", + "@babel/types": "^7.27.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/parser": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.27.0.tgz", + "integrity": "sha512-iaepho73/2Pz7w2eMS0Q5f83+0RKI7i4xmiYeBmDzfRVbQtTOG7Ts0S4HzJVsTMGI9keU8rNfuZr8DKfSt7Yyg==", + "dependencies": { + "@babel/types": "^7.27.0" + }, + "bin": { + "parser": "bin/babel-parser.js" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/plugin-proposal-decorators": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/plugin-proposal-decorators/-/plugin-proposal-decorators-7.25.9.tgz", + "integrity": "sha512-smkNLL/O1ezy9Nhy4CNosc4Va+1wo5w4gzSZeLe6y6dM4mmHfYOCPolXQPHQxonZCF+ZyebxN9vqOolkYrSn5g==", + "dev": true, + "dependencies": { + "@babel/helper-create-class-features-plugin": "^7.25.9", + "@babel/helper-plugin-utils": "^7.25.9", + "@babel/plugin-syntax-decorators": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-syntax-decorators": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-decorators/-/plugin-syntax-decorators-7.25.9.tgz", + "integrity": "sha512-ryzI0McXUPJnRCvMo4lumIKZUzhYUO/ScI+Mz4YVaTLt04DHNSjEUjKVvbzQjZFLuod/cYEc07mJWhzl6v4DPg==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-syntax-import-attributes": { + "version": "7.26.0", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-import-attributes/-/plugin-syntax-import-attributes-7.26.0.tgz", + "integrity": "sha512-e2dttdsJ1ZTpi3B9UYGLw41hifAubg19AtCu/2I/F1QNVclOBr1dYpTdmdyZ84Xiz43BS/tCUkMAZNLv12Pi+A==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-syntax-import-meta": { + "version": "7.10.4", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-import-meta/-/plugin-syntax-import-meta-7.10.4.tgz", + "integrity": "sha512-Yqfm+XDx0+Prh3VSeEQCPU81yC+JWZ2pDPFSS4ZdpfZhp4MkFMaDC1UqseovEKwSUpnIL7+vK+Clp7bfh0iD7g==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.10.4" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-syntax-jsx": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-jsx/-/plugin-syntax-jsx-7.25.9.tgz", + "integrity": "sha512-ld6oezHQMZsZfp6pWtbjaNDF2tiiCYYDqQszHt5VV437lewP9aSi2Of99CK0D0XB21k7FLgnLcmQKyKzynfeAA==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-syntax-typescript": { + "version": "7.25.9", + "resolved": "https://registry.npmjs.org/@babel/plugin-syntax-typescript/-/plugin-syntax-typescript-7.25.9.tgz", + "integrity": "sha512-hjMgRy5hb8uJJjUcdWunWVcoi9bGpJp8p5Ol1229PoN6aytsLwNMgmdftO23wnCLMfVmTwZDWMPNq/D1SY60JQ==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-transform-typescript": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-typescript/-/plugin-transform-typescript-7.27.0.tgz", + "integrity": "sha512-fRGGjO2UEGPjvEcyAZXRXAS8AfdaQoq7HnxAbJoAoW10B9xOKesmmndJv+Sym2a+9FHWZ9KbyyLCe9s0Sn5jtg==", + "dev": true, + "dependencies": { + "@babel/helper-annotate-as-pure": "^7.25.9", + "@babel/helper-create-class-features-plugin": "^7.27.0", + "@babel/helper-plugin-utils": "^7.26.5", + "@babel/helper-skip-transparent-expression-wrappers": "^7.25.9", + "@babel/plugin-syntax-typescript": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/template": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.27.0.tgz", + "integrity": "sha512-2ncevenBqXI6qRMukPlXwHKHchC7RyMuu4xv5JBXRfOGVcTy1mXCD12qrp7Jsoxll1EV3+9sE4GugBVRjT2jFA==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.26.2", + "@babel/parser": "^7.27.0", + "@babel/types": "^7.27.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/traverse": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.27.0.tgz", + "integrity": "sha512-19lYZFzYVQkkHkl4Cy4WrAVcqBkgvV2YM2TU3xG6DIwO7O3ecbDPfW3yM3bjAGcqcQHi+CCtjMR3dIEHxsd6bA==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.26.2", + "@babel/generator": "^7.27.0", + "@babel/parser": "^7.27.0", + "@babel/template": "^7.27.0", + "@babel/types": "^7.27.0", + "debug": "^4.3.1", + "globals": "^11.1.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/traverse/node_modules/globals": { + "version": "11.12.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", + "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/@babel/types": { + "version": "7.27.0", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.27.0.tgz", + "integrity": "sha512-H45s8fVLYjbhFH62dIJ3WtmJ6RSPt/3DRO0ZcT2SUiYiQyz3BLVb9ADEnLl91m74aQPS3AzzeajZHYOalWe3bg==", + "dependencies": { + "@babel/helper-string-parser": "^7.25.9", + "@babel/helper-validator-identifier": "^7.25.9" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@basitcodeenv/vue3-device-detect": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/@basitcodeenv/vue3-device-detect/-/vue3-device-detect-1.0.3.tgz", + "integrity": "sha512-BDHoM2KYJx/PrEyEzgYOLEVSTxQmvd1PR7UqRQSMClgnM7O1cGoagG/5K0CZy6LUHGifyU5qnrQdC3Sy9nt3zQ==", + "dev": true, + "dependencies": { + "ua-parser-js": "^1.0.37", + "vue": "^3.0.0-0" + } + }, + "node_modules/@bufbuild/protobuf": { + "version": "2.2.5", + "resolved": "https://registry.npmjs.org/@bufbuild/protobuf/-/protobuf-2.2.5.tgz", + "integrity": "sha512-/g5EzJifw5GF8aren8wZ/G5oMuPoGeS6MQD3ca8ddcvdXR5UELUfdTZITCGNhNXynY/AYl3Z4plmxdj/tRl/hQ==", + "devOptional": true + }, + "node_modules/@esbuild/aix-ppc64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.25.2.tgz", + "integrity": "sha512-wCIboOL2yXZym2cgm6mlA742s9QeJ8DjGVaL39dLN4rRwrOgOyYSnOaFPhKZGLb2ngj4EyfAFjsNJwPXZvseag==", + "cpu": [ + "ppc64" + ], + "optional": true, + "os": [ + "aix" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-arm": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.25.2.tgz", + "integrity": "sha512-NQhH7jFstVY5x8CKbcfa166GoV0EFkaPkCKBQkdPJFvo5u+nGXLEH/ooniLb3QI8Fk58YAx7nsPLozUWfCBOJA==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-arm64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.25.2.tgz", + "integrity": "sha512-5ZAX5xOmTligeBaeNEPnPaeEuah53Id2tX4c2CVP3JaROTH+j4fnfHCkr1PjXMd78hMst+TlkfKcW/DlTq0i4w==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/android-x64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.25.2.tgz", + "integrity": "sha512-Ffcx+nnma8Sge4jzddPHCZVRvIfQ0kMsUsCMcJRHkGJ1cDmhe4SsrYIjLUKn1xpHZybmOqCWwB0zQvsjdEHtkg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/darwin-arm64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.25.2.tgz", + "integrity": "sha512-MpM6LUVTXAzOvN4KbjzU/q5smzryuoNjlriAIx+06RpecwCkL9JpenNzpKd2YMzLJFOdPqBpuub6eVRP5IgiSA==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/darwin-x64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.25.2.tgz", + "integrity": "sha512-5eRPrTX7wFyuWe8FqEFPG2cU0+butQQVNcT4sVipqjLYQjjh8a8+vUTfgBKM88ObB85ahsnTwF7PSIt6PG+QkA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/freebsd-arm64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.25.2.tgz", + "integrity": "sha512-mLwm4vXKiQ2UTSX4+ImyiPdiHjiZhIaE9QvC7sw0tZ6HoNMjYAqQpGyui5VRIi5sGd+uWq940gdCbY3VLvsO1w==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/freebsd-x64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.25.2.tgz", + "integrity": "sha512-6qyyn6TjayJSwGpm8J9QYYGQcRgc90nmfdUb0O7pp1s4lTY+9D0H9O02v5JqGApUyiHOtkz6+1hZNvNtEhbwRQ==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-arm": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.25.2.tgz", + "integrity": "sha512-UHBRgJcmjJv5oeQF8EpTRZs/1knq6loLxTsjc3nxO9eXAPDLcWW55flrMVc97qFPbmZP31ta1AZVUKQzKTzb0g==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-arm64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.25.2.tgz", + "integrity": "sha512-gq/sjLsOyMT19I8obBISvhoYiZIAaGF8JpeXu1u8yPv8BE5HlWYobmlsfijFIZ9hIVGYkbdFhEqC0NvM4kNO0g==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-ia32": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.25.2.tgz", + "integrity": "sha512-bBYCv9obgW2cBP+2ZWfjYTU+f5cxRoGGQ5SeDbYdFCAZpYWrfjjfYwvUpP8MlKbP0nwZ5gyOU/0aUzZ5HWPuvQ==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-loong64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.25.2.tgz", + "integrity": "sha512-SHNGiKtvnU2dBlM5D8CXRFdd+6etgZ9dXfaPCeJtz+37PIUlixvlIhI23L5khKXs3DIzAn9V8v+qb1TRKrgT5w==", + "cpu": [ + "loong64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-mips64el": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.25.2.tgz", + "integrity": "sha512-hDDRlzE6rPeoj+5fsADqdUZl1OzqDYow4TB4Y/3PlKBD0ph1e6uPHzIQcv2Z65u2K0kpeByIyAjCmjn1hJgG0Q==", + "cpu": [ + "mips64el" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-ppc64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.25.2.tgz", + "integrity": "sha512-tsHu2RRSWzipmUi9UBDEzc0nLc4HtpZEI5Ba+Omms5456x5WaNuiG3u7xh5AO6sipnJ9r4cRWQB2tUjPyIkc6g==", + "cpu": [ + "ppc64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-riscv64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.25.2.tgz", + "integrity": "sha512-k4LtpgV7NJQOml/10uPU0s4SAXGnowi5qBSjaLWMojNCUICNu7TshqHLAEbkBdAszL5TabfvQ48kK84hyFzjnw==", + "cpu": [ + "riscv64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-s390x": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.25.2.tgz", + "integrity": "sha512-GRa4IshOdvKY7M/rDpRR3gkiTNp34M0eLTaC1a08gNrh4u488aPhuZOCpkF6+2wl3zAN7L7XIpOFBhnaE3/Q8Q==", + "cpu": [ + "s390x" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/linux-x64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.25.2.tgz", + "integrity": "sha512-QInHERlqpTTZ4FRB0fROQWXcYRD64lAoiegezDunLpalZMjcUcld3YzZmVJ2H/Cp0wJRZ8Xtjtj0cEHhYc/uUg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/netbsd-arm64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-arm64/-/netbsd-arm64-0.25.2.tgz", + "integrity": "sha512-talAIBoY5M8vHc6EeI2WW9d/CkiO9MQJ0IOWX8hrLhxGbro/vBXJvaQXefW2cP0z0nQVTdQ/eNyGFV1GSKrxfw==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/netbsd-x64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.25.2.tgz", + "integrity": "sha512-voZT9Z+tpOxrvfKFyfDYPc4DO4rk06qamv1a/fkuzHpiVBMOhpjK+vBmWM8J1eiB3OLSMFYNaOaBNLXGChf5tg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/openbsd-arm64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-arm64/-/openbsd-arm64-0.25.2.tgz", + "integrity": "sha512-dcXYOC6NXOqcykeDlwId9kB6OkPUxOEqU+rkrYVqJbK2hagWOMrsTGsMr8+rW02M+d5Op5NNlgMmjzecaRf7Tg==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/openbsd-x64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.25.2.tgz", + "integrity": "sha512-t/TkWwahkH0Tsgoq1Ju7QfgGhArkGLkF1uYz8nQS/PPFlXbP5YgRpqQR3ARRiC2iXoLTWFxc6DJMSK10dVXluw==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/sunos-x64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.25.2.tgz", + "integrity": "sha512-cfZH1co2+imVdWCjd+D1gf9NjkchVhhdpgb1q5y6Hcv9TP6Zi9ZG/beI3ig8TvwT9lH9dlxLq5MQBBgwuj4xvA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "sunos" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-arm64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.25.2.tgz", + "integrity": "sha512-7Loyjh+D/Nx/sOTzV8vfbB3GJuHdOQyrOryFdZvPHLf42Tk9ivBU5Aedi7iyX+x6rbn2Mh68T4qq1SDqJBQO5Q==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-ia32": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.25.2.tgz", + "integrity": "sha512-WRJgsz9un0nqZJ4MfhabxaD9Ft8KioqU3JMinOTvobbX6MOSUigSBlogP8QB3uxpJDsFS6yN+3FDBdqE5lg9kg==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@esbuild/win32-x64": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.25.2.tgz", + "integrity": "sha512-kM3HKb16VIXZyIeVrM1ygYmZBKybX8N4p754bw390wGO3Tf2j4L2/WYL+4suWujpgf6GBYs3jv7TyUivdd05JA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=18" + } + }, + "node_modules/@eslint-community/eslint-utils": { + "version": "4.5.1", + "resolved": "https://registry.npmjs.org/@eslint-community/eslint-utils/-/eslint-utils-4.5.1.tgz", + "integrity": "sha512-soEIOALTfTK6EjmKMMoLugwaP0rzkad90iIWd1hMO9ARkSAyjfMfkRRhLvD5qH7vvM0Cg72pieUfR6yh6XxC4w==", + "dev": true, + "dependencies": { + "eslint-visitor-keys": "^3.4.3" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + }, + "peerDependencies": { + "eslint": "^6.0.0 || ^7.0.0 || >=8.0.0" + } + }, + "node_modules/@eslint-community/eslint-utils/node_modules/eslint-visitor-keys": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz", + "integrity": "sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==", + "dev": true, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/@eslint-community/regexpp": { + "version": "4.12.1", + "resolved": "https://registry.npmjs.org/@eslint-community/regexpp/-/regexpp-4.12.1.tgz", + "integrity": "sha512-CCZCDJuduB9OUkFkY2IgppNZMi2lBQgD2qzwXkEia16cge2pijY/aXi96CJMquDMn3nJdlPV1A5KrJEXwfLNzQ==", + "dev": true, + "engines": { + "node": "^12.0.0 || ^14.0.0 || >=16.0.0" + } + }, + "node_modules/@eslint/config-array": { + "version": "0.19.2", + "resolved": "https://registry.npmjs.org/@eslint/config-array/-/config-array-0.19.2.tgz", + "integrity": "sha512-GNKqxfHG2ySmJOBSHg7LxeUx4xpuCoFjacmlCoYWEbaPXLwvfIjixRI12xCQZeULksQb23uiA8F40w5TojpV7w==", + "dev": true, + "dependencies": { + "@eslint/object-schema": "^2.1.6", + "debug": "^4.3.1", + "minimatch": "^3.1.2" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/config-helpers": { + "version": "0.2.1", + "resolved": "https://registry.npmjs.org/@eslint/config-helpers/-/config-helpers-0.2.1.tgz", + "integrity": "sha512-RI17tsD2frtDu/3dmI7QRrD4bedNKPM08ziRYaC5AhkGrzIAJelm9kJU1TznK+apx6V+cqRz8tfpEeG3oIyjxw==", + "dev": true, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/core": { + "version": "0.12.0", + "resolved": "https://registry.npmjs.org/@eslint/core/-/core-0.12.0.tgz", + "integrity": "sha512-cmrR6pytBuSMTaBweKoGMwu3EiHiEC+DoyupPmlZ0HxBJBtIxwe+j/E4XPIKNx+Q74c8lXKPwYawBf5glsTkHg==", + "dev": true, + "dependencies": { + "@types/json-schema": "^7.0.15" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/eslintrc": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-3.3.1.tgz", + "integrity": "sha512-gtF186CXhIl1p4pJNGZw8Yc6RlshoePRvE0X91oPGb3vZ8pM3qOS9W9NGPat9LziaBV7XrJWGylNQXkGcnM3IQ==", + "dev": true, + "dependencies": { + "ajv": "^6.12.4", + "debug": "^4.3.2", + "espree": "^10.0.1", + "globals": "^14.0.0", + "ignore": "^5.2.0", + "import-fresh": "^3.2.1", + "js-yaml": "^4.1.0", + "minimatch": "^3.1.2", + "strip-json-comments": "^3.1.1" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/@eslint/js": { + "version": "9.23.0", + "resolved": "https://registry.npmjs.org/@eslint/js/-/js-9.23.0.tgz", + "integrity": "sha512-35MJ8vCPU0ZMxo7zfev2pypqTwWTofFZO6m4KAtdoFhRpLJUpHTZZ+KB3C7Hb1d7bULYwO4lJXGCi5Se+8OMbw==", + "dev": true, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/object-schema": { + "version": "2.1.6", + "resolved": "https://registry.npmjs.org/@eslint/object-schema/-/object-schema-2.1.6.tgz", + "integrity": "sha512-RBMg5FRL0I0gs51M/guSAj5/e14VQ4tpZnQNWwuDT66P14I43ItmPfIZRhO9fUVIPOAQXU47atlywZ/czoqFPA==", + "dev": true, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/plugin-kit": { + "version": "0.2.8", + "resolved": "https://registry.npmjs.org/@eslint/plugin-kit/-/plugin-kit-0.2.8.tgz", + "integrity": "sha512-ZAoA40rNMPwSm+AeHpCq8STiNAwzWLJuP8Xv4CHIc9wv/PSuExjMrmjfYNj682vW0OOiZ1HKxzvjQr9XZIisQA==", + "dev": true, + "dependencies": { + "@eslint/core": "^0.13.0", + "levn": "^0.4.1" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@eslint/plugin-kit/node_modules/@eslint/core": { + "version": "0.13.0", + "resolved": "https://registry.npmjs.org/@eslint/core/-/core-0.13.0.tgz", + "integrity": "sha512-yfkgDw1KR66rkT5A8ci4irzDysN7FRpq3ttJolR88OqQikAWqwA8j5VZyas+vjyBNFIJ7MfybJ9plMILI2UrCw==", + "dev": true, + "dependencies": { + "@types/json-schema": "^7.0.15" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + } + }, + "node_modules/@humanfs/core": { + "version": "0.19.1", + "resolved": "https://registry.npmjs.org/@humanfs/core/-/core-0.19.1.tgz", + "integrity": "sha512-5DyQ4+1JEUzejeK1JGICcideyfUbGixgS9jNgex5nqkW+cY7WZhxBigmieN5Qnw9ZosSNVC9KQKyb+GUaGyKUA==", + "dev": true, + "engines": { + "node": ">=18.18.0" + } + }, + "node_modules/@humanfs/node": { + "version": "0.16.6", + "resolved": "https://registry.npmjs.org/@humanfs/node/-/node-0.16.6.tgz", + "integrity": "sha512-YuI2ZHQL78Q5HbhDiBA1X4LmYdXCKCMQIfw0pw7piHJwyREFebJUvrQN4cMssyES6x+vfUbx1CIpaQUKYdQZOw==", + "dev": true, + "dependencies": { + "@humanfs/core": "^0.19.1", + "@humanwhocodes/retry": "^0.3.0" + }, + "engines": { + "node": ">=18.18.0" + } + }, + "node_modules/@humanfs/node/node_modules/@humanwhocodes/retry": { + "version": "0.3.1", + "resolved": "https://registry.npmjs.org/@humanwhocodes/retry/-/retry-0.3.1.tgz", + "integrity": "sha512-JBxkERygn7Bv/GbN5Rv8Ul6LVknS+5Bp6RgDC/O8gEBU/yeH5Ui5C/OlWrTb6qct7LjjfT6Re2NxB0ln0yYybA==", + "dev": true, + "engines": { + "node": ">=18.18" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/nzakas" + } + }, + "node_modules/@humanwhocodes/module-importer": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz", + "integrity": "sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==", + "dev": true, + "engines": { + "node": ">=12.22" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/nzakas" + } + }, + "node_modules/@humanwhocodes/retry": { + "version": "0.4.2", + "resolved": "https://registry.npmjs.org/@humanwhocodes/retry/-/retry-0.4.2.tgz", + "integrity": "sha512-xeO57FpIu4p1Ri3Jq/EXq4ClRm86dVF2z/+kvFnyqVYRavTZmaFaUBbWCOuuTh0o/g7DSsk6kc2vrS4Vl5oPOQ==", + "dev": true, + "engines": { + "node": ">=18.18" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/nzakas" + } + }, + "node_modules/@jridgewell/gen-mapping": { + "version": "0.3.8", + "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.8.tgz", + "integrity": "sha512-imAbBGkb+ebQyxKgzv5Hu2nmROxoDOXHh80evxdoXNOrvAnVx7zimzc1Oo5h9RlfV4vPXaE2iM5pOFbvOCClWA==", + "dev": true, + "dependencies": { + "@jridgewell/set-array": "^1.2.1", + "@jridgewell/sourcemap-codec": "^1.4.10", + "@jridgewell/trace-mapping": "^0.3.24" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/resolve-uri": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.2.tgz", + "integrity": "sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/set-array": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/@jridgewell/set-array/-/set-array-1.2.1.tgz", + "integrity": "sha512-R8gLRTZeyp03ymzP/6Lil/28tGeGEzhx1q2k703KGWRAI1VdvPIXdG70VJc2pAMw3NA6JKL5hhFu1sJX0Mnn/A==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/sourcemap-codec": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.5.0.tgz", + "integrity": "sha512-gv3ZRaISU3fjPAgNsriBRqGWQL6quFx04YMPW/zD8XMLsU32mhCCbfbO6KZFLjvYpCZ8zyDEgqsgf+PwPaM7GQ==" + }, + "node_modules/@jridgewell/trace-mapping": { + "version": "0.3.25", + "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.25.tgz", + "integrity": "sha512-vNk6aEwybGtawWmy/PzwnGDOjCkLWSD2wqvjGGAgOAwCGWySYXfYoxt00IJkTF+8Lb57DwOb3Aa0o9CApepiYQ==", + "dev": true, + "dependencies": { + "@jridgewell/resolve-uri": "^3.1.0", + "@jridgewell/sourcemap-codec": "^1.4.14" + } + }, + "node_modules/@pkgr/core": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/@pkgr/core/-/core-0.2.0.tgz", + "integrity": "sha512-vsJDAkYR6qCPu+ioGScGiMYR7LvZYIXh/dlQeviqoTWNCVfKTLYD/LkNWH4Mxsv2a5vpIRc77FN5DnmK1eBggQ==", + "dev": true, + "engines": { + "node": "^12.20.0 || ^14.18.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/unts" + } + }, + "node_modules/@polka/url": { + "version": "1.0.0-next.28", + "resolved": "https://registry.npmjs.org/@polka/url/-/url-1.0.0-next.28.tgz", + "integrity": "sha512-8LduaNlMZGwdZ6qWrKlfa+2M4gahzFkprZiAt2TF8uS0qQgBizKXpXURqvTJ4WtmupWxaLqjRb2UCTe72mu+Aw==", + "dev": true + }, + "node_modules/@rollup/pluginutils": { + "version": "5.1.4", + "resolved": "https://registry.npmjs.org/@rollup/pluginutils/-/pluginutils-5.1.4.tgz", + "integrity": "sha512-USm05zrsFxYLPdWWq+K3STlWiT/3ELn3RcV5hJMghpeAIhxfsUIg6mt12CBJBInWMV4VneoV7SfGv8xIwo2qNQ==", + "dev": true, + "dependencies": { + "@types/estree": "^1.0.0", + "estree-walker": "^2.0.2", + "picomatch": "^4.0.2" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "rollup": "^1.20.0||^2.0.0||^3.0.0||^4.0.0" + }, + "peerDependenciesMeta": { + "rollup": { + "optional": true + } + } + }, + "node_modules/@rollup/rollup-android-arm-eabi": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.39.0.tgz", + "integrity": "sha512-lGVys55Qb00Wvh8DMAocp5kIcaNzEFTmGhfFd88LfaogYTRKrdxgtlO5H6S49v2Nd8R2C6wLOal0qv6/kCkOwA==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-android-arm64": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.39.0.tgz", + "integrity": "sha512-It9+M1zE31KWfqh/0cJLrrsCPiF72PoJjIChLX+rEcujVRCb4NLQ5QzFkzIZW8Kn8FTbvGQBY5TkKBau3S8cCQ==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-darwin-arm64": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.39.0.tgz", + "integrity": "sha512-lXQnhpFDOKDXiGxsU9/l8UEGGM65comrQuZ+lDcGUx+9YQ9dKpF3rSEGepyeR5AHZ0b5RgiligsBhWZfSSQh8Q==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-darwin-x64": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.39.0.tgz", + "integrity": "sha512-mKXpNZLvtEbgu6WCkNij7CGycdw9cJi2k9v0noMb++Vab12GZjFgUXD69ilAbBh034Zwn95c2PNSz9xM7KYEAQ==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-freebsd-arm64": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-freebsd-arm64/-/rollup-freebsd-arm64-4.39.0.tgz", + "integrity": "sha512-jivRRlh2Lod/KvDZx2zUR+I4iBfHcu2V/BA2vasUtdtTN2Uk3jfcZczLa81ESHZHPHy4ih3T/W5rPFZ/hX7RtQ==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "freebsd" + ] + }, + "node_modules/@rollup/rollup-freebsd-x64": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-freebsd-x64/-/rollup-freebsd-x64-4.39.0.tgz", + "integrity": "sha512-8RXIWvYIRK9nO+bhVz8DwLBepcptw633gv/QT4015CpJ0Ht8punmoHU/DuEd3iw9Hr8UwUV+t+VNNuZIWYeY7Q==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "freebsd" + ] + }, + "node_modules/@rollup/rollup-linux-arm-gnueabihf": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.39.0.tgz", + "integrity": "sha512-mz5POx5Zu58f2xAG5RaRRhp3IZDK7zXGk5sdEDj4o96HeaXhlUwmLFzNlc4hCQi5sGdR12VDgEUqVSHer0lI9g==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm-musleabihf": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.39.0.tgz", + "integrity": "sha512-+YDwhM6gUAyakl0CD+bMFpdmwIoRDzZYaTWV3SDRBGkMU/VpIBYXXEvkEcTagw/7VVkL2vA29zU4UVy1mP0/Yw==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-gnu": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.39.0.tgz", + "integrity": "sha512-EKf7iF7aK36eEChvlgxGnk7pdJfzfQbNvGV/+l98iiMwU23MwvmV0Ty3pJ0p5WQfm3JRHOytSIqD9LB7Bq7xdQ==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-musl": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.39.0.tgz", + "integrity": "sha512-vYanR6MtqC7Z2SNr8gzVnzUul09Wi1kZqJaek3KcIlI/wq5Xtq4ZPIZ0Mr/st/sv/NnaPwy/D4yXg5x0B3aUUA==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-loongarch64-gnu": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-loongarch64-gnu/-/rollup-linux-loongarch64-gnu-4.39.0.tgz", + "integrity": "sha512-NMRUT40+h0FBa5fb+cpxtZoGAggRem16ocVKIv5gDB5uLDgBIwrIsXlGqYbLwW8YyO3WVTk1FkFDjMETYlDqiw==", + "cpu": [ + "loong64" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-powerpc64le-gnu": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.39.0.tgz", + "integrity": "sha512-0pCNnmxgduJ3YRt+D+kJ6Ai/r+TaePu9ZLENl+ZDV/CdVczXl95CbIiwwswu4L+K7uOIGf6tMo2vm8uadRaICQ==", + "cpu": [ + "ppc64" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-riscv64-gnu": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.39.0.tgz", + "integrity": "sha512-t7j5Zhr7S4bBtksT73bO6c3Qa2AV/HqiGlj9+KB3gNF5upcVkx+HLgxTm8DK4OkzsOYqbdqbLKwvGMhylJCPhQ==", + "cpu": [ + "riscv64" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-riscv64-musl": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-musl/-/rollup-linux-riscv64-musl-4.39.0.tgz", + "integrity": "sha512-m6cwI86IvQ7M93MQ2RF5SP8tUjD39Y7rjb1qjHgYh28uAPVU8+k/xYWvxRO3/tBN2pZkSMa5RjnPuUIbrwVxeA==", + "cpu": [ + "riscv64" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-s390x-gnu": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.39.0.tgz", + "integrity": "sha512-iRDJd2ebMunnk2rsSBYlsptCyuINvxUfGwOUldjv5M4tpa93K8tFMeYGpNk2+Nxl+OBJnBzy2/JCscGeO507kA==", + "cpu": [ + "s390x" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-gnu": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.39.0.tgz", + "integrity": "sha512-t9jqYw27R6Lx0XKfEFe5vUeEJ5pF3SGIM6gTfONSMb7DuG6z6wfj2yjcoZxHg129veTqU7+wOhY6GX8wmf90dA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-musl": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.39.0.tgz", + "integrity": "sha512-ThFdkrFDP55AIsIZDKSBWEt/JcWlCzydbZHinZ0F/r1h83qbGeenCt/G/wG2O0reuENDD2tawfAj2s8VK7Bugg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-win32-arm64-msvc": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.39.0.tgz", + "integrity": "sha512-jDrLm6yUtbOg2TYB3sBF3acUnAwsIksEYjLeHL+TJv9jg+TmTwdyjnDex27jqEMakNKf3RwwPahDIt7QXCSqRQ==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-ia32-msvc": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.39.0.tgz", + "integrity": "sha512-6w9uMuza+LbLCVoNKL5FSLE7yvYkq9laSd09bwS0tMjkwXrmib/4KmoJcrKhLWHvw19mwU+33ndC69T7weNNjQ==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-x64-msvc": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.39.0.tgz", + "integrity": "sha512-yAkUOkIKZlK5dl7u6dg897doBgLXmUHhIINM2c+sND3DZwnrdQkkSiDh7N75Ll4mM4dxSkYfXqU9fW3lLkMFug==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@sec-ant/readable-stream": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/@sec-ant/readable-stream/-/readable-stream-0.4.1.tgz", + "integrity": "sha512-831qok9r2t8AlxLko40y2ebgSDhenenCatLVeW/uBtnHPyhHOvG0C7TvfgecV+wHzIm5KUICgzmVpWS+IMEAeg==", + "dev": true + }, + "node_modules/@sindresorhus/merge-streams": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/@sindresorhus/merge-streams/-/merge-streams-4.0.0.tgz", + "integrity": "sha512-tlqY9xq5ukxTUZBmoOp+m61cqwQD5pHJtFY3Mn8CA8ps6yghLH/Hw8UPdqg4OLmFW3IFlcXnQNmo/dh8HzXYIQ==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/@tabler/icons": { + "version": "3.31.0", + "resolved": "https://registry.npmjs.org/@tabler/icons/-/icons-3.31.0.tgz", + "integrity": "sha512-dblAdeKY3+GA1U+Q9eziZ0ooVlZMHsE8dqP0RkwvRtEsAULoKOYaCUOcJ4oW1DjWegdxk++UAt2SlQVnmeHv+g==", + "funding": { + "type": "github", + "url": "https://github.com/sponsors/codecalm" + } + }, + "node_modules/@tabler/icons-vue": { + "version": "3.31.0", + "resolved": "https://registry.npmjs.org/@tabler/icons-vue/-/icons-vue-3.31.0.tgz", + "integrity": "sha512-a6kMUSakgjHhyDiQvi+nLh0uign8xEkzpOzmXpNF+tVyUA6Y9dCeK8c3o67onYZdPZPg22RpvQuX3K6bAuV/oA==", + "dependencies": { + "@tabler/icons": "3.31.0" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/codecalm" + }, + "peerDependencies": { + "vue": ">=3.0.1" + } + }, + "node_modules/@tailwindcss/node": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/node/-/node-4.1.2.tgz", + "integrity": "sha512-ZwFnxH+1z8Ehh8bNTMX3YFrYdzAv7JLY5X5X7XSFY+G9QGJVce/P9xb2mh+j5hKt8NceuHmdtllJvAHWKtsNrQ==", + "dependencies": { + "enhanced-resolve": "^5.18.1", + "jiti": "^2.4.2", + "lightningcss": "1.29.2", + "tailwindcss": "4.1.2" + } + }, + "node_modules/@tailwindcss/oxide": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide/-/oxide-4.1.2.tgz", + "integrity": "sha512-Zwz//1QKo6+KqnCKMT7lA4bspGfwEgcPAHlSthmahtgrpKDfwRGk8PKQrW8Zg/ofCDIlg6EtjSTKSxxSufC+CQ==", + "engines": { + "node": ">= 10" + }, + "optionalDependencies": { + "@tailwindcss/oxide-android-arm64": "4.1.2", + "@tailwindcss/oxide-darwin-arm64": "4.1.2", + "@tailwindcss/oxide-darwin-x64": "4.1.2", + "@tailwindcss/oxide-freebsd-x64": "4.1.2", + "@tailwindcss/oxide-linux-arm-gnueabihf": "4.1.2", + "@tailwindcss/oxide-linux-arm64-gnu": "4.1.2", + "@tailwindcss/oxide-linux-arm64-musl": "4.1.2", + "@tailwindcss/oxide-linux-x64-gnu": "4.1.2", + "@tailwindcss/oxide-linux-x64-musl": "4.1.2", + "@tailwindcss/oxide-win32-arm64-msvc": "4.1.2", + "@tailwindcss/oxide-win32-x64-msvc": "4.1.2" + } + }, + "node_modules/@tailwindcss/oxide-android-arm64": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-android-arm64/-/oxide-android-arm64-4.1.2.tgz", + "integrity": "sha512-IxkXbntHX8lwGmwURUj4xTr6nezHhLYqeiJeqa179eihGv99pRlKV1W69WByPJDQgSf4qfmwx904H6MkQqTA8w==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-darwin-arm64": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-darwin-arm64/-/oxide-darwin-arm64-4.1.2.tgz", + "integrity": "sha512-ZRtiHSnFYHb4jHKIdzxlFm6EDfijTCOT4qwUhJ3GWxfDoW2yT3z/y8xg0nE7e72unsmSj6dtfZ9Y5r75FIrlpA==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-darwin-x64": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-darwin-x64/-/oxide-darwin-x64-4.1.2.tgz", + "integrity": "sha512-BiKUNZf1A0pBNzndBvnPnBxonCY49mgbOsPfILhcCE5RM7pQlRoOgN7QnwNhY284bDbfQSEOWnFR0zbPo6IDTw==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-freebsd-x64": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-freebsd-x64/-/oxide-freebsd-x64-4.1.2.tgz", + "integrity": "sha512-Z30VcpUfRGkiddj4l5NRCpzbSGjhmmklVoqkVQdkEC0MOelpY+fJrVhzSaXHmWrmSvnX8yiaEqAbdDScjVujYQ==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm-gnueabihf": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm-gnueabihf/-/oxide-linux-arm-gnueabihf-4.1.2.tgz", + "integrity": "sha512-w3wsK1ChOLeQ3gFOiwabtWU5e8fY3P1Ss8jR3IFIn/V0va3ir//hZ8AwURveS4oK1Pu6b8i+yxesT4qWnLVUow==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm64-gnu": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm64-gnu/-/oxide-linux-arm64-gnu-4.1.2.tgz", + "integrity": "sha512-oY/u+xJHpndTj7B5XwtmXGk8mQ1KALMfhjWMMpE8pdVAznjJsF5KkCceJ4Fmn5lS1nHMCwZum5M3/KzdmwDMdw==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm64-musl": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm64-musl/-/oxide-linux-arm64-musl-4.1.2.tgz", + "integrity": "sha512-k7G6vcRK/D+JOWqnKzKN/yQq1q4dCkI49fMoLcfs2pVcaUAXEqCP9NmA8Jv+XahBv5DtDjSAY3HJbjosEdKczg==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-x64-gnu": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-x64-gnu/-/oxide-linux-x64-gnu-4.1.2.tgz", + "integrity": "sha512-fLL+c678TkYKgkDLLNxSjPPK/SzTec7q/E5pTwvpTqrth867dftV4ezRyhPM5PaiCqX651Y8Yk0wRQMcWUGnmQ==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-x64-musl": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-x64-musl/-/oxide-linux-x64-musl-4.1.2.tgz", + "integrity": "sha512-0tU1Vjd1WucZ2ooq6y4nI9xyTSaH2g338bhrqk+2yzkMHskBm+pMsOCfY7nEIvALkA1PKPOycR4YVdlV7Czo+A==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-win32-arm64-msvc": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-win32-arm64-msvc/-/oxide-win32-arm64-msvc-4.1.2.tgz", + "integrity": "sha512-r8QaMo3QKiHqUcn+vXYCypCEha+R0sfYxmaZSgZshx9NfkY+CHz91aS2xwNV/E4dmUDkTPUag7sSdiCHPzFVTg==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-win32-x64-msvc": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-win32-x64-msvc/-/oxide-win32-x64-msvc-4.1.2.tgz", + "integrity": "sha512-lYCdkPxh9JRHXoBsPE8Pu/mppUsC2xihYArNAESub41PKhHTnvn6++5RpmFM+GLSt3ewyS8fwCVvht7ulWm6cw==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/vite": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/@tailwindcss/vite/-/vite-4.1.2.tgz", + "integrity": "sha512-3r/ZdMW0gxY8uOx1To0lpYa4coq4CzINcCX4laM1rS340Kcn0ac4A/MMFfHN8qba51aorZMYwMcOxYk4wJ9FYg==", + "dependencies": { + "@tailwindcss/node": "4.1.2", + "@tailwindcss/oxide": "4.1.2", + "tailwindcss": "4.1.2" + }, + "peerDependencies": { + "vite": "^5.2.0 || ^6" + } + }, + "node_modules/@types/estree": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/@types/estree/-/estree-1.0.7.tgz", + "integrity": "sha512-w28IoSUCJpidD/TGviZwwMJckNESJZXFu7NBZ5YJ4mEUnNraUn9Pm8HSZm/jDF1pDWYKspWE7oVphigUPRakIQ==" + }, + "node_modules/@types/json-schema": { + "version": "7.0.15", + "resolved": "https://registry.npmjs.org/@types/json-schema/-/json-schema-7.0.15.tgz", + "integrity": "sha512-5+fP8P8MFNC+AyZCDxrB2pkZFPGzqQWUzpSeuuVLvm8VMcorNYavBqoFcxK8bQz4Qsbn4oUEEem4wDLfcysGHA==", + "dev": true + }, + "node_modules/@vitejs/plugin-vue": { + "version": "5.2.3", + "resolved": "https://registry.npmjs.org/@vitejs/plugin-vue/-/plugin-vue-5.2.3.tgz", + "integrity": "sha512-IYSLEQj4LgZZuoVpdSUCw3dIynTWQgPlaRP6iAvMle4My0HdYwr5g5wQAfwOeHQBmYwEkqF70nRpSilr6PoUDg==", + "dev": true, + "engines": { + "node": "^18.0.0 || >=20.0.0" + }, + "peerDependencies": { + "vite": "^5.0.0 || ^6.0.0", + "vue": "^3.2.25" + } + }, + "node_modules/@vue/babel-helper-vue-transform-on": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/@vue/babel-helper-vue-transform-on/-/babel-helper-vue-transform-on-1.4.0.tgz", + "integrity": "sha512-mCokbouEQ/ocRce/FpKCRItGo+013tHg7tixg3DUNS+6bmIchPt66012kBMm476vyEIJPafrvOf4E5OYj3shSw==", + "dev": true + }, + "node_modules/@vue/babel-plugin-jsx": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/@vue/babel-plugin-jsx/-/babel-plugin-jsx-1.4.0.tgz", + "integrity": "sha512-9zAHmwgMWlaN6qRKdrg1uKsBKHvnUU+Py+MOCTuYZBoZsopa90Di10QRjB+YPnVss0BZbG/H5XFwJY1fTxJWhA==", + "dev": true, + "dependencies": { + "@babel/helper-module-imports": "^7.25.9", + "@babel/helper-plugin-utils": "^7.26.5", + "@babel/plugin-syntax-jsx": "^7.25.9", + "@babel/template": "^7.26.9", + "@babel/traverse": "^7.26.9", + "@babel/types": "^7.26.9", + "@vue/babel-helper-vue-transform-on": "1.4.0", + "@vue/babel-plugin-resolve-type": "1.4.0", + "@vue/shared": "^3.5.13" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + }, + "peerDependenciesMeta": { + "@babel/core": { + "optional": true + } + } + }, + "node_modules/@vue/babel-plugin-resolve-type": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/@vue/babel-plugin-resolve-type/-/babel-plugin-resolve-type-1.4.0.tgz", + "integrity": "sha512-4xqDRRbQQEWHQyjlYSgZsWj44KfiF6D+ktCuXyZ8EnVDYV3pztmXJDf1HveAjUAXxAnR8daCQT51RneWWxtTyQ==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.26.2", + "@babel/helper-module-imports": "^7.25.9", + "@babel/helper-plugin-utils": "^7.26.5", + "@babel/parser": "^7.26.9", + "@vue/compiler-sfc": "^3.5.13" + }, + "funding": { + "url": "https://github.com/sponsors/sxzz" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@vue/compiler-core": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/compiler-core/-/compiler-core-3.5.13.tgz", + "integrity": "sha512-oOdAkwqUfW1WqpwSYJce06wvt6HljgY3fGeM9NcVA1HaYOij3mZG9Rkysn0OHuyUAGMbEbARIpsG+LPVlBJ5/Q==", + "dependencies": { + "@babel/parser": "^7.25.3", + "@vue/shared": "3.5.13", + "entities": "^4.5.0", + "estree-walker": "^2.0.2", + "source-map-js": "^1.2.0" + } + }, + "node_modules/@vue/compiler-dom": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/compiler-dom/-/compiler-dom-3.5.13.tgz", + "integrity": "sha512-ZOJ46sMOKUjO3e94wPdCzQ6P1Lx/vhp2RSvfaab88Ajexs0AHeV0uasYhi99WPaogmBlRHNRuly8xV75cNTMDA==", + "dependencies": { + "@vue/compiler-core": "3.5.13", + "@vue/shared": "3.5.13" + } + }, + "node_modules/@vue/compiler-sfc": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/compiler-sfc/-/compiler-sfc-3.5.13.tgz", + "integrity": "sha512-6VdaljMpD82w6c2749Zhf5T9u5uLBWKnVue6XWxprDobftnletJ8+oel7sexFfM3qIxNmVE7LSFGTpv6obNyaQ==", + "dependencies": { + "@babel/parser": "^7.25.3", + "@vue/compiler-core": "3.5.13", + "@vue/compiler-dom": "3.5.13", + "@vue/compiler-ssr": "3.5.13", + "@vue/shared": "3.5.13", + "estree-walker": "^2.0.2", + "magic-string": "^0.30.11", + "postcss": "^8.4.48", + "source-map-js": "^1.2.0" + } + }, + "node_modules/@vue/compiler-ssr": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/compiler-ssr/-/compiler-ssr-3.5.13.tgz", + "integrity": "sha512-wMH6vrYHxQl/IybKJagqbquvxpWCuVYpoUJfCqFZwa/JY1GdATAQ+TgVtgrwwMZ0D07QhA99rs/EAAWfvG6KpA==", + "dependencies": { + "@vue/compiler-dom": "3.5.13", + "@vue/shared": "3.5.13" + } + }, + "node_modules/@vue/devtools-api": { + "version": "7.7.2", + "resolved": "https://registry.npmjs.org/@vue/devtools-api/-/devtools-api-7.7.2.tgz", + "integrity": "sha512-1syn558KhyN+chO5SjlZIwJ8bV/bQ1nOVTG66t2RbG66ZGekyiYNmRO7X9BJCXQqPsFHlnksqvPhce2qpzxFnA==", + "dev": true, + "dependencies": { + "@vue/devtools-kit": "^7.7.2" + } + }, + "node_modules/@vue/devtools-core": { + "version": "7.7.2", + "resolved": "https://registry.npmjs.org/@vue/devtools-core/-/devtools-core-7.7.2.tgz", + "integrity": "sha512-lexREWj1lKi91Tblr38ntSsy6CvI8ba7u+jmwh2yruib/ltLUcsIzEjCnrkh1yYGGIKXbAuYV2tOG10fGDB9OQ==", + "dev": true, + "dependencies": { + "@vue/devtools-kit": "^7.7.2", + "@vue/devtools-shared": "^7.7.2", + "mitt": "^3.0.1", + "nanoid": "^5.0.9", + "pathe": "^2.0.2", + "vite-hot-client": "^0.2.4" + }, + "peerDependencies": { + "vue": "^3.0.0" + } + }, + "node_modules/@vue/devtools-core/node_modules/nanoid": { + "version": "5.1.5", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-5.1.5.tgz", + "integrity": "sha512-Ir/+ZpE9fDsNH0hQ3C68uyThDXzYcim2EqcZ8zn8Chtt1iylPT9xXJB0kPCnqzgcEGikO9RxSrh63MsmVCU7Fw==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "bin": { + "nanoid": "bin/nanoid.js" + }, + "engines": { + "node": "^18 || >=20" + } + }, + "node_modules/@vue/devtools-kit": { + "version": "7.7.2", + "resolved": "https://registry.npmjs.org/@vue/devtools-kit/-/devtools-kit-7.7.2.tgz", + "integrity": "sha512-CY0I1JH3Z8PECbn6k3TqM1Bk9ASWxeMtTCvZr7vb+CHi+X/QwQm5F1/fPagraamKMAHVfuuCbdcnNg1A4CYVWQ==", + "dev": true, + "dependencies": { + "@vue/devtools-shared": "^7.7.2", + "birpc": "^0.2.19", + "hookable": "^5.5.3", + "mitt": "^3.0.1", + "perfect-debounce": "^1.0.0", + "speakingurl": "^14.0.1", + "superjson": "^2.2.1" + } + }, + "node_modules/@vue/devtools-shared": { + "version": "7.7.2", + "resolved": "https://registry.npmjs.org/@vue/devtools-shared/-/devtools-shared-7.7.2.tgz", + "integrity": "sha512-uBFxnp8gwW2vD6FrJB8JZLUzVb6PNRG0B0jBnHsOH8uKyva2qINY8PTF5Te4QlTbMDqU5K6qtJDr6cNsKWhbOA==", + "dev": true, + "dependencies": { + "rfdc": "^1.4.1" + } + }, + "node_modules/@vue/eslint-config-prettier": { + "version": "10.2.0", + "resolved": "https://registry.npmjs.org/@vue/eslint-config-prettier/-/eslint-config-prettier-10.2.0.tgz", + "integrity": "sha512-GL3YBLwv/+b86yHcNNfPJxOTtVFJ4Mbc9UU3zR+KVoG7SwGTjPT+32fXamscNumElhcpXW3mT0DgzS9w32S7Bw==", + "dev": true, + "dependencies": { + "eslint-config-prettier": "^10.0.1", + "eslint-plugin-prettier": "^5.2.2" + }, + "peerDependencies": { + "eslint": ">= 8.21.0", + "prettier": ">= 3.0.0" + } + }, + "node_modules/@vue/reactivity": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/reactivity/-/reactivity-3.5.13.tgz", + "integrity": "sha512-NaCwtw8o48B9I6L1zl2p41OHo/2Z4wqYGGIK1Khu5T7yxrn+ATOixn/Udn2m+6kZKB/J7cuT9DbWWhRxqixACg==", + "dependencies": { + "@vue/shared": "3.5.13" + } + }, + "node_modules/@vue/runtime-core": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/runtime-core/-/runtime-core-3.5.13.tgz", + "integrity": "sha512-Fj4YRQ3Az0WTZw1sFe+QDb0aXCerigEpw418pw1HBUKFtnQHWzwojaukAs2X/c9DQz4MQ4bsXTGlcpGxU/RCIw==", + "dependencies": { + "@vue/reactivity": "3.5.13", + "@vue/shared": "3.5.13" + } + }, + "node_modules/@vue/runtime-dom": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/runtime-dom/-/runtime-dom-3.5.13.tgz", + "integrity": "sha512-dLaj94s93NYLqjLiyFzVs9X6dWhTdAlEAciC3Moq7gzAc13VJUdCnjjRurNM6uTLFATRHexHCTu/Xp3eW6yoog==", + "dependencies": { + "@vue/reactivity": "3.5.13", + "@vue/runtime-core": "3.5.13", + "@vue/shared": "3.5.13", + "csstype": "^3.1.3" + } + }, + "node_modules/@vue/server-renderer": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/server-renderer/-/server-renderer-3.5.13.tgz", + "integrity": "sha512-wAi4IRJV/2SAW3htkTlB+dHeRmpTiVIK1OGLWV1yeStVSebSQQOwGwIq0D3ZIoBj2C2qpgz5+vX9iEBkTdk5YA==", + "dependencies": { + "@vue/compiler-ssr": "3.5.13", + "@vue/shared": "3.5.13" + }, + "peerDependencies": { + "vue": "3.5.13" + } + }, + "node_modules/@vue/shared": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/@vue/shared/-/shared-3.5.13.tgz", + "integrity": "sha512-/hnE/qP5ZoGpol0a5mDi45bOd7t3tjYJBjsgCsivow7D48cJeV5l05RD82lPqi7gRiphZM37rnhW1l6ZoCNNnQ==" + }, + "node_modules/acorn": { + "version": "8.14.1", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.14.1.tgz", + "integrity": "sha512-OvQ/2pUDKmgfCg++xsTX1wGxfTaszcHVcTctW4UJB4hibJx2HXxxO5UmVgyjMa+ZDsiaf5wWLXYpRWMmBI0QHg==", + "dev": true, + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/acorn-jsx": { + "version": "5.3.2", + "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.3.2.tgz", + "integrity": "sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==", + "dev": true, + "peerDependencies": { + "acorn": "^6.0.0 || ^7.0.0 || ^8.0.0" + } + }, + "node_modules/ajv": { + "version": "6.12.6", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", + "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", + "dev": true, + "dependencies": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/epoberezkin" + } + }, + "node_modules/ansi-regex": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dev": true, + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/chalk/ansi-styles?sponsor=1" + } + }, + "node_modules/argparse": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz", + "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==", + "dev": true + }, + "node_modules/asynckit": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz", + "integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q==", + "dev": true + }, + "node_modules/axios": { + "version": "1.8.4", + "resolved": "https://registry.npmjs.org/axios/-/axios-1.8.4.tgz", + "integrity": "sha512-eBSYY4Y68NNlHbHBMdeDmKNtDgXWhQsJcGqzO3iLUM0GraQFSS9cVgPX5I9b3lbdFKyYoAEGAZF1DwhTaljNAw==", + "dev": true, + "dependencies": { + "follow-redirects": "^1.15.6", + "form-data": "^4.0.0", + "proxy-from-env": "^1.1.0" + } + }, + "node_modules/balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", + "dev": true + }, + "node_modules/birpc": { + "version": "0.2.19", + "resolved": "https://registry.npmjs.org/birpc/-/birpc-0.2.19.tgz", + "integrity": "sha512-5WeXXAvTmitV1RqJFppT5QtUiz2p1mRSYU000Jkft5ZUCLJIk4uQriYNO50HknxKwM6jd8utNc66K1qGIwwWBQ==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/antfu" + } + }, + "node_modules/boolbase": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/boolbase/-/boolbase-1.0.0.tgz", + "integrity": "sha512-JZOSA7Mo9sNGB8+UjSgzdLtokWAky1zbztM3WRLCbZ70/3cTANmQmOdR7y2g+J0e2WXywy1yS468tY+IruqEww==", + "dev": true + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "dev": true, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/browserslist": { + "version": "4.24.4", + "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.24.4.tgz", + "integrity": "sha512-KDi1Ny1gSePi1vm0q4oxSF8b4DR44GF4BbmS2YdhPLOEqd8pDviZOGH/GsmRwoWJ2+5Lr085X7naowMwKHDG1A==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "caniuse-lite": "^1.0.30001688", + "electron-to-chromium": "^1.5.73", + "node-releases": "^2.0.19", + "update-browserslist-db": "^1.1.1" + }, + "bin": { + "browserslist": "cli.js" + }, + "engines": { + "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" + } + }, + "node_modules/buffer-builder": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/buffer-builder/-/buffer-builder-0.2.0.tgz", + "integrity": "sha512-7VPMEPuYznPSoR21NE1zvd2Xna6c/CloiZCfcMXR1Jny6PjX0N4Nsa38zcBFo/FMK+BlA+FLKbJCQ0i2yxp+Xg==", + "devOptional": true + }, + "node_modules/bundle-name": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/bundle-name/-/bundle-name-4.1.0.tgz", + "integrity": "sha512-tjwM5exMg6BGRI+kNmTntNsvdZS1X8BFYS6tnJ2hdH0kVxM6/eVZ2xy+FqStSWvYmtfFMDLIxurorHwDKfDz5Q==", + "dev": true, + "dependencies": { + "run-applescript": "^7.0.0" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/call-bind-apply-helpers": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/call-bind-apply-helpers/-/call-bind-apply-helpers-1.0.2.tgz", + "integrity": "sha512-Sp1ablJ0ivDkSzjcaJdxEunN5/XvksFJ2sMBFfq6x0ryhQV/2b/KwFe21cMpmHtPOSij8K99/wSfoEuTObmuMQ==", + "dev": true, + "dependencies": { + "es-errors": "^1.3.0", + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/callsites": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz", + "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/camelcase": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-5.3.1.tgz", + "integrity": "sha512-L28STB170nwWS63UjtlEOE3dldQApaJXZkOI1uMFfzf3rRuPegHaHesyee+YxQ+W6SvRDQV6UrdOdRiR153wJg==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/caniuse-lite": { + "version": "1.0.30001710", + "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001710.tgz", + "integrity": "sha512-B5C0I0UmaGqHgo5FuqJ7hBd4L57A4dDD+Xi+XX1nXOoxGeDdY4Ko38qJYOyqznBVJEqON5p8P1x5zRR3+rsnxA==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/caniuse-lite" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ] + }, + "node_modules/chalk": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz", + "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==", + "dev": true, + "dependencies": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/chalk/chalk?sponsor=1" + } + }, + "node_modules/cliui": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/cliui/-/cliui-6.0.0.tgz", + "integrity": "sha512-t6wbgtoCXvAzst7QgXxJYqPt0usEfbgQdftEPbLL/cvv6HPE5VgvqCuAIDR0NgU52ds6rFwqrgakNLrHEjCbrQ==", + "dev": true, + "dependencies": { + "string-width": "^4.2.0", + "strip-ansi": "^6.0.0", + "wrap-ansi": "^6.2.0" + } + }, + "node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dev": true, + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", + "dev": true + }, + "node_modules/colorjs.io": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/colorjs.io/-/colorjs.io-0.5.2.tgz", + "integrity": "sha512-twmVoizEW7ylZSN32OgKdXRmo1qg+wT5/6C3xu5b9QsWzSFAhHLn2xd8ro0diCsKfCj1RdaTP/nrcW+vAoQPIw==", + "devOptional": true + }, + "node_modules/combined-stream": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz", + "integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==", + "dev": true, + "dependencies": { + "delayed-stream": "~1.0.0" + }, + "engines": { + "node": ">= 0.8" + } + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", + "dev": true + }, + "node_modules/convert-source-map": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-2.0.0.tgz", + "integrity": "sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg==", + "dev": true + }, + "node_modules/copy-anything": { + "version": "3.0.5", + "resolved": "https://registry.npmjs.org/copy-anything/-/copy-anything-3.0.5.tgz", + "integrity": "sha512-yCEafptTtb4bk7GLEQoM8KVJpxAfdBJYaXyzQEgQQQgYrZiDp8SJmGKlYza6CYjEDNstAdNdKA3UuoULlEbS6w==", + "dev": true, + "dependencies": { + "is-what": "^4.1.8" + }, + "engines": { + "node": ">=12.13" + }, + "funding": { + "url": "https://github.com/sponsors/mesqueeb" + } + }, + "node_modules/cross-spawn": { + "version": "7.0.6", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.6.tgz", + "integrity": "sha512-uV2QOWP2nWzsy2aMp8aRibhi9dlzF5Hgh5SHaB9OiTGEyDTiJJyx0uy51QXdyWbtAHNua4XJzUKca3OzKUd3vA==", + "dev": true, + "dependencies": { + "path-key": "^3.1.0", + "shebang-command": "^2.0.0", + "which": "^2.0.1" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/crypto-js": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/crypto-js/-/crypto-js-4.2.0.tgz", + "integrity": "sha512-KALDyEYgpY+Rlob/iriUtjV6d5Eq+Y191A5g4UqLAi8CyGP9N1+FdVbkc1SxKc2r4YAYqG8JzO2KGL+AizD70Q==", + "dev": true + }, + "node_modules/cssesc": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", + "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", + "dev": true, + "bin": { + "cssesc": "bin/cssesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/csstype": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/csstype/-/csstype-3.1.3.tgz", + "integrity": "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw==" + }, + "node_modules/debug": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.4.0.tgz", + "integrity": "sha512-6WTZ/IxCY/T6BALoZHaE4ctp9xm+Z5kY/pzYaCHRFeyVhojxlrm+46y68HA6hr0TcwEssoxNiDEUJQjfPZ/RYA==", + "dev": true, + "dependencies": { + "ms": "^2.1.3" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/decamelize": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/decamelize/-/decamelize-1.2.0.tgz", + "integrity": "sha512-z2S+W9X73hAUUki+N+9Za2lBlun89zigOyGrsax+KUQ6wKW4ZoWpEYBkGhQjwAjjDCkWxhY0VKEhk8wzY7F5cA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/deep-is": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.4.tgz", + "integrity": "sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==", + "dev": true + }, + "node_modules/default-browser": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/default-browser/-/default-browser-5.2.1.tgz", + "integrity": "sha512-WY/3TUME0x3KPYdRRxEJJvXRHV4PyPoUsxtZa78lwItwRQRHhd2U9xOscaT/YTf8uCXIAjeJOFBVEh/7FtD8Xg==", + "dev": true, + "dependencies": { + "bundle-name": "^4.1.0", + "default-browser-id": "^5.0.0" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/default-browser-id": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/default-browser-id/-/default-browser-id-5.0.0.tgz", + "integrity": "sha512-A6p/pu/6fyBcA1TRz/GqWYPViplrftcW2gZC9q79ngNCKAeR/X3gcEdXQHl4KNXV+3wgIJ1CPkJQ3IHM6lcsyA==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/define-lazy-prop": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/define-lazy-prop/-/define-lazy-prop-3.0.0.tgz", + "integrity": "sha512-N+MeXYoqr3pOgn8xfyRPREN7gHakLYjhsHhWGT3fWAiL4IkAt0iDw14QiiEm2bE30c5XX5q0FtAA3CK5f9/BUg==", + "dev": true, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/delayed-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz", + "integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==", + "dev": true, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/detect-libc": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-2.0.3.tgz", + "integrity": "sha512-bwy0MGW55bG41VqxxypOsdSdGqLwXPI/focwgTYCFMbdUiBAxLg9CFzG08sz2aqzknwiX7Hkl0bQENjg8iLByw==", + "engines": { + "node": ">=8" + } + }, + "node_modules/dijkstrajs": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/dijkstrajs/-/dijkstrajs-1.0.3.tgz", + "integrity": "sha512-qiSlmBq9+BCdCA/L46dw8Uy93mloxsPSbwnm5yrKn2vMPiy8KyAskTF6zuV/j5BMsmOGZDPs7KjU+mjb670kfA==", + "dev": true + }, + "node_modules/dunder-proto": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/dunder-proto/-/dunder-proto-1.0.1.tgz", + "integrity": "sha512-KIN/nDJBQRcXw0MLVhZE9iQHmG68qAVIBg9CqmUYjmQIhgij9U5MFvrqkUL5FbtyyzZuOeOt0zdeRe4UY7ct+A==", + "dev": true, + "dependencies": { + "call-bind-apply-helpers": "^1.0.1", + "es-errors": "^1.3.0", + "gopd": "^1.2.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/electron-to-chromium": { + "version": "1.5.132", + "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.5.132.tgz", + "integrity": "sha512-QgX9EBvWGmvSRa74zqfnG7+Eno0Ak0vftBll0Pt2/z5b3bEGYL6OUXLgKPtvx73dn3dvwrlyVkjPKRRlhLYTEg==", + "dev": true + }, + "node_modules/emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==", + "dev": true + }, + "node_modules/enhanced-resolve": { + "version": "5.18.1", + "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-5.18.1.tgz", + "integrity": "sha512-ZSW3ma5GkcQBIpwZTSRAI8N71Uuwgs93IezB7mf7R60tC8ZbJideoDNKjHn2O9KIlx6rkGTTEk1xUCK2E1Y2Yg==", + "dependencies": { + "graceful-fs": "^4.2.4", + "tapable": "^2.2.0" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/entities": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/entities/-/entities-4.5.0.tgz", + "integrity": "sha512-V0hjH4dGPh9Ao5p0MoRY6BVqtwCjhz6vI5LT8AJ55H+4g9/4vbHx1I54fS0XuclLhDHArPQCiMjDxjaL8fPxhw==", + "engines": { + "node": ">=0.12" + }, + "funding": { + "url": "https://github.com/fb55/entities?sponsor=1" + } + }, + "node_modules/error-stack-parser-es": { + "version": "0.1.5", + "resolved": "https://registry.npmjs.org/error-stack-parser-es/-/error-stack-parser-es-0.1.5.tgz", + "integrity": "sha512-xHku1X40RO+fO8yJ8Wh2f2rZWVjqyhb1zgq1yZ8aZRQkv6OOKhKWRUaht3eSCUbAOBaKIgM+ykwFLE+QUxgGeg==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/antfu" + } + }, + "node_modules/es-define-property": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.1.tgz", + "integrity": "sha512-e3nRfgfUZ4rNGL232gUgX06QNyyez04KdjFrF+LTRoOXmrOgFKDg4BCdsjW8EnT69eqdYGmRpJwiPVYNrCaW3g==", + "dev": true, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-errors": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz", + "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==", + "dev": true, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-object-atoms": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/es-object-atoms/-/es-object-atoms-1.1.1.tgz", + "integrity": "sha512-FGgH2h8zKNim9ljj7dankFPcICIK9Cp5bm+c2gQSYePhpaG5+esrLODihIorn+Pe6FGJzWhXQotPv73jTaldXA==", + "dev": true, + "dependencies": { + "es-errors": "^1.3.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-set-tostringtag": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/es-set-tostringtag/-/es-set-tostringtag-2.1.0.tgz", + "integrity": "sha512-j6vWzfrGVfyXxge+O0x5sh6cvxAog0a/4Rdd2K36zCMV5eJ+/+tOAngRO8cODMNWbVRdVlmGZQL2YS3yR8bIUA==", + "dev": true, + "dependencies": { + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.6", + "has-tostringtag": "^1.0.2", + "hasown": "^2.0.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/esbuild": { + "version": "0.25.2", + "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.25.2.tgz", + "integrity": "sha512-16854zccKPnC+toMywC+uKNeYSv+/eXkevRAfwRD/G9Cleq66m8XFIrigkbvauLLlCfDL45Q2cWegSg53gGBnQ==", + "hasInstallScript": true, + "bin": { + "esbuild": "bin/esbuild" + }, + "engines": { + "node": ">=18" + }, + "optionalDependencies": { + "@esbuild/aix-ppc64": "0.25.2", + "@esbuild/android-arm": "0.25.2", + "@esbuild/android-arm64": "0.25.2", + "@esbuild/android-x64": "0.25.2", + "@esbuild/darwin-arm64": "0.25.2", + "@esbuild/darwin-x64": "0.25.2", + "@esbuild/freebsd-arm64": "0.25.2", + "@esbuild/freebsd-x64": "0.25.2", + "@esbuild/linux-arm": "0.25.2", + "@esbuild/linux-arm64": "0.25.2", + "@esbuild/linux-ia32": "0.25.2", + "@esbuild/linux-loong64": "0.25.2", + "@esbuild/linux-mips64el": "0.25.2", + "@esbuild/linux-ppc64": "0.25.2", + "@esbuild/linux-riscv64": "0.25.2", + "@esbuild/linux-s390x": "0.25.2", + "@esbuild/linux-x64": "0.25.2", + "@esbuild/netbsd-arm64": "0.25.2", + "@esbuild/netbsd-x64": "0.25.2", + "@esbuild/openbsd-arm64": "0.25.2", + "@esbuild/openbsd-x64": "0.25.2", + "@esbuild/sunos-x64": "0.25.2", + "@esbuild/win32-arm64": "0.25.2", + "@esbuild/win32-ia32": "0.25.2", + "@esbuild/win32-x64": "0.25.2" + } + }, + "node_modules/escalade": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.2.0.tgz", + "integrity": "sha512-WUj2qlxaQtO4g6Pq5c29GTcWGDyd8itL8zTlipgECz3JesAiiOKotd8JU6otB3PACgG6xkJUyVhboMS+bje/jA==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/escape-string-regexp": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz", + "integrity": "sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/eslint": { + "version": "9.23.0", + "resolved": "https://registry.npmjs.org/eslint/-/eslint-9.23.0.tgz", + "integrity": "sha512-jV7AbNoFPAY1EkFYpLq5bslU9NLNO8xnEeQXwErNibVryjk67wHVmddTBilc5srIttJDBrB0eMHKZBFbSIABCw==", + "dev": true, + "dependencies": { + "@eslint-community/eslint-utils": "^4.2.0", + "@eslint-community/regexpp": "^4.12.1", + "@eslint/config-array": "^0.19.2", + "@eslint/config-helpers": "^0.2.0", + "@eslint/core": "^0.12.0", + "@eslint/eslintrc": "^3.3.1", + "@eslint/js": "9.23.0", + "@eslint/plugin-kit": "^0.2.7", + "@humanfs/node": "^0.16.6", + "@humanwhocodes/module-importer": "^1.0.1", + "@humanwhocodes/retry": "^0.4.2", + "@types/estree": "^1.0.6", + "@types/json-schema": "^7.0.15", + "ajv": "^6.12.4", + "chalk": "^4.0.0", + "cross-spawn": "^7.0.6", + "debug": "^4.3.2", + "escape-string-regexp": "^4.0.0", + "eslint-scope": "^8.3.0", + "eslint-visitor-keys": "^4.2.0", + "espree": "^10.3.0", + "esquery": "^1.5.0", + "esutils": "^2.0.2", + "fast-deep-equal": "^3.1.3", + "file-entry-cache": "^8.0.0", + "find-up": "^5.0.0", + "glob-parent": "^6.0.2", + "ignore": "^5.2.0", + "imurmurhash": "^0.1.4", + "is-glob": "^4.0.0", + "json-stable-stringify-without-jsonify": "^1.0.1", + "lodash.merge": "^4.6.2", + "minimatch": "^3.1.2", + "natural-compare": "^1.4.0", + "optionator": "^0.9.3" + }, + "bin": { + "eslint": "bin/eslint.js" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "funding": { + "url": "https://eslint.org/donate" + }, + "peerDependencies": { + "jiti": "*" + }, + "peerDependenciesMeta": { + "jiti": { + "optional": true + } + } + }, + "node_modules/eslint-config-prettier": { + "version": "10.1.1", + "resolved": "https://registry.npmjs.org/eslint-config-prettier/-/eslint-config-prettier-10.1.1.tgz", + "integrity": "sha512-4EQQr6wXwS+ZJSzaR5ZCrYgLxqvUjdXctaEtBqHcbkW944B1NQyO4qpdHQbXBONfwxXdkAY81HH4+LUfrg+zPw==", + "dev": true, + "bin": { + "eslint-config-prettier": "bin/cli.js" + }, + "peerDependencies": { + "eslint": ">=7.0.0" + } + }, + "node_modules/eslint-plugin-prettier": { + "version": "5.2.6", + "resolved": "https://registry.npmjs.org/eslint-plugin-prettier/-/eslint-plugin-prettier-5.2.6.tgz", + "integrity": "sha512-mUcf7QG2Tjk7H055Jk0lGBjbgDnfrvqjhXh9t2xLMSCjZVcw9Rb1V6sVNXO0th3jgeO7zllWPTNRil3JW94TnQ==", + "dev": true, + "dependencies": { + "prettier-linter-helpers": "^1.0.0", + "synckit": "^0.11.0" + }, + "engines": { + "node": "^14.18.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint-plugin-prettier" + }, + "peerDependencies": { + "@types/eslint": ">=8.0.0", + "eslint": ">=8.0.0", + "eslint-config-prettier": ">= 7.0.0 <10.0.0 || >=10.1.0", + "prettier": ">=3.0.0" + }, + "peerDependenciesMeta": { + "@types/eslint": { + "optional": true + }, + "eslint-config-prettier": { + "optional": true + } + } + }, + "node_modules/eslint-plugin-vue": { + "version": "9.33.0", + "resolved": "https://registry.npmjs.org/eslint-plugin-vue/-/eslint-plugin-vue-9.33.0.tgz", + "integrity": "sha512-174lJKuNsuDIlLpjeXc5E2Tss8P44uIimAfGD0b90k0NoirJqpG7stLuU9Vp/9ioTOrQdWVREc4mRd1BD+CvGw==", + "dev": true, + "dependencies": { + "@eslint-community/eslint-utils": "^4.4.0", + "globals": "^13.24.0", + "natural-compare": "^1.4.0", + "nth-check": "^2.1.1", + "postcss-selector-parser": "^6.0.15", + "semver": "^7.6.3", + "vue-eslint-parser": "^9.4.3", + "xml-name-validator": "^4.0.0" + }, + "engines": { + "node": "^14.17.0 || >=16.0.0" + }, + "peerDependencies": { + "eslint": "^6.2.0 || ^7.0.0 || ^8.0.0 || ^9.0.0" + } + }, + "node_modules/eslint-plugin-vue/node_modules/globals": { + "version": "13.24.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz", + "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==", + "dev": true, + "dependencies": { + "type-fest": "^0.20.2" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/eslint-scope": { + "version": "8.3.0", + "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-8.3.0.tgz", + "integrity": "sha512-pUNxi75F8MJ/GdeKtVLSbYg4ZI34J6C0C7sbL4YOp2exGwen7ZsuBqKzUhXd0qMQ362yET3z+uPwKeg/0C2XCQ==", + "dev": true, + "dependencies": { + "esrecurse": "^4.3.0", + "estraverse": "^5.2.0" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/eslint-visitor-keys": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-4.2.0.tgz", + "integrity": "sha512-UyLnSehNt62FFhSwjZlHmeokpRK59rcz29j+F1/aDgbkbRTk7wIc9XzdoasMUbRNKDM0qQt/+BJ4BrpFeABemw==", + "dev": true, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/espree": { + "version": "10.3.0", + "resolved": "https://registry.npmjs.org/espree/-/espree-10.3.0.tgz", + "integrity": "sha512-0QYC8b24HWY8zjRnDTL6RiHfDbAWn63qb4LMj1Z4b076A4une81+z03Kg7l7mn/48PUTqoLptSXez8oknU8Clg==", + "dev": true, + "dependencies": { + "acorn": "^8.14.0", + "acorn-jsx": "^5.3.2", + "eslint-visitor-keys": "^4.2.0" + }, + "engines": { + "node": "^18.18.0 || ^20.9.0 || >=21.1.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/esquery": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.6.0.tgz", + "integrity": "sha512-ca9pw9fomFcKPvFLXhBKUK90ZvGibiGOvRJNbjljY7s7uq/5YO4BOzcYtJqExdx99rF6aAcnRxHmcUHcz6sQsg==", + "dev": true, + "dependencies": { + "estraverse": "^5.1.0" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/esrecurse": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz", + "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==", + "dev": true, + "dependencies": { + "estraverse": "^5.2.0" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/estraverse": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.3.0.tgz", + "integrity": "sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==", + "dev": true, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/estree-walker": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/estree-walker/-/estree-walker-2.0.2.tgz", + "integrity": "sha512-Rfkk/Mp/DL7JVje3u18FxFujQlTNR2q6QfMSMB7AvCBx91NGj/ba3kCfza0f6dVDbw7YlRf/nDrn7pQrCCyQ/w==" + }, + "node_modules/esutils": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", + "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/execa": { + "version": "9.5.2", + "resolved": "https://registry.npmjs.org/execa/-/execa-9.5.2.tgz", + "integrity": "sha512-EHlpxMCpHWSAh1dgS6bVeoLAXGnJNdR93aabr4QCGbzOM73o5XmRfM/e5FUqsw3aagP8S8XEWUWFAxnRBnAF0Q==", + "dev": true, + "dependencies": { + "@sindresorhus/merge-streams": "^4.0.0", + "cross-spawn": "^7.0.3", + "figures": "^6.1.0", + "get-stream": "^9.0.0", + "human-signals": "^8.0.0", + "is-plain-obj": "^4.1.0", + "is-stream": "^4.0.1", + "npm-run-path": "^6.0.0", + "pretty-ms": "^9.0.0", + "signal-exit": "^4.1.0", + "strip-final-newline": "^4.0.0", + "yoctocolors": "^2.0.0" + }, + "engines": { + "node": "^18.19.0 || >=20.5.0" + }, + "funding": { + "url": "https://github.com/sindresorhus/execa?sponsor=1" + } + }, + "node_modules/fast-deep-equal": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", + "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==", + "dev": true + }, + "node_modules/fast-diff": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/fast-diff/-/fast-diff-1.3.0.tgz", + "integrity": "sha512-VxPP4NqbUjj6MaAOafWeUn2cXWLcCtljklUtZf0Ind4XQ+QPtmA0b18zZy0jIQx+ExRVCR/ZQpBmik5lXshNsw==", + "dev": true + }, + "node_modules/fast-json-stable-stringify": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", + "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==", + "dev": true + }, + "node_modules/fast-levenshtein": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz", + "integrity": "sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==", + "dev": true + }, + "node_modules/figures": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/figures/-/figures-6.1.0.tgz", + "integrity": "sha512-d+l3qxjSesT4V7v2fh+QnmFnUWv9lSpjarhShNTgBOfA0ttejbQUAlHLitbjkoRiDulW0OPoQPYIGhIC8ohejg==", + "dev": true, + "dependencies": { + "is-unicode-supported": "^2.0.0" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/file-entry-cache": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-8.0.0.tgz", + "integrity": "sha512-XXTUwCvisa5oacNGRP9SfNtYBNAMi+RPwBFmblZEF7N7swHYQS6/Zfk7SRwx4D5j3CH211YNRco1DEMNVfZCnQ==", + "dev": true, + "dependencies": { + "flat-cache": "^4.0.0" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/find-up": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-5.0.0.tgz", + "integrity": "sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==", + "dev": true, + "dependencies": { + "locate-path": "^6.0.0", + "path-exists": "^4.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/flat-cache": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-4.0.1.tgz", + "integrity": "sha512-f7ccFPK3SXFHpx15UIGyRJ/FJQctuKZ0zVuN3frBo4HnK3cay9VEW0R6yPYFHC0AgqhukPzKjq22t5DmAyqGyw==", + "dev": true, + "dependencies": { + "flatted": "^3.2.9", + "keyv": "^4.5.4" + }, + "engines": { + "node": ">=16" + } + }, + "node_modules/flatted": { + "version": "3.3.3", + "resolved": "https://registry.npmjs.org/flatted/-/flatted-3.3.3.tgz", + "integrity": "sha512-GX+ysw4PBCz0PzosHDepZGANEuFCMLrnRTiEy9McGjmkCQYwRq4A/X786G/fjM/+OjsWSU1ZrY5qyARZmO/uwg==", + "dev": true + }, + "node_modules/follow-redirects": { + "version": "1.15.9", + "resolved": "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.15.9.tgz", + "integrity": "sha512-gew4GsXizNgdoRyqmyfMHyAmXsZDk6mHkSxZFCzW9gwlbtOW44CDtYavM+y+72qD/Vq2l550kMF52DT8fOLJqQ==", + "dev": true, + "funding": [ + { + "type": "individual", + "url": "https://github.com/sponsors/RubenVerborgh" + } + ], + "engines": { + "node": ">=4.0" + }, + "peerDependenciesMeta": { + "debug": { + "optional": true + } + } + }, + "node_modules/form-data": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/form-data/-/form-data-4.0.2.tgz", + "integrity": "sha512-hGfm/slu0ZabnNt4oaRZ6uREyfCj6P4fT/n6A1rGV+Z0VdGXjfOhVUpkn6qVQONHGIFwmveGXyDs75+nr6FM8w==", + "dev": true, + "dependencies": { + "asynckit": "^0.4.0", + "combined-stream": "^1.0.8", + "es-set-tostringtag": "^2.1.0", + "mime-types": "^2.1.12" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/fs-extra": { + "version": "11.3.0", + "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-11.3.0.tgz", + "integrity": "sha512-Z4XaCL6dUDHfP/jT25jJKMmtxvuwbkrD1vNSMFlo9lNLY2c5FHYSQgHPRZUjAB26TpDEoW9HCOgplrdbaPV/ew==", + "dev": true, + "dependencies": { + "graceful-fs": "^4.2.0", + "jsonfile": "^6.0.1", + "universalify": "^2.0.0" + }, + "engines": { + "node": ">=14.14" + } + }, + "node_modules/fsevents": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz", + "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==", + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gensync": { + "version": "1.0.0-beta.2", + "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.2.tgz", + "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/get-caller-file": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/get-caller-file/-/get-caller-file-2.0.5.tgz", + "integrity": "sha512-DyFP3BM/3YHTQOCUL/w0OZHR0lpKeGrxotcHWcqNEdnltqFwXVfhEBQ94eIo34AfQpo0rGki4cyIiftY06h2Fg==", + "dev": true, + "engines": { + "node": "6.* || 8.* || >= 10.*" + } + }, + "node_modules/get-intrinsic": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.3.0.tgz", + "integrity": "sha512-9fSjSaos/fRIVIp+xSJlE6lfwhES7LNtKaCBIamHsjr2na1BiABJPo0mOjjz8GJDURarmCPGqaiVg5mfjb98CQ==", + "dev": true, + "dependencies": { + "call-bind-apply-helpers": "^1.0.2", + "es-define-property": "^1.0.1", + "es-errors": "^1.3.0", + "es-object-atoms": "^1.1.1", + "function-bind": "^1.1.2", + "get-proto": "^1.0.1", + "gopd": "^1.2.0", + "has-symbols": "^1.1.0", + "hasown": "^2.0.2", + "math-intrinsics": "^1.1.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-proto": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/get-proto/-/get-proto-1.0.1.tgz", + "integrity": "sha512-sTSfBjoXBp89JvIKIefqw7U2CCebsc74kiY6awiGogKtoSGbgjYE/G/+l9sF3MWFPNc9IcoOC4ODfKHfxFmp0g==", + "dev": true, + "dependencies": { + "dunder-proto": "^1.0.1", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/get-stream": { + "version": "9.0.1", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-9.0.1.tgz", + "integrity": "sha512-kVCxPF3vQM/N0B1PmoqVUqgHP+EeVjmZSQn+1oCRPxd2P21P2F19lIgbR3HBosbB1PUhOAoctJnfEn2GbN2eZA==", + "dev": true, + "dependencies": { + "@sec-ant/readable-stream": "^0.4.1", + "is-stream": "^4.0.1" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/glob-parent": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz", + "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.3" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/globals": { + "version": "14.0.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-14.0.0.tgz", + "integrity": "sha512-oahGvuMGQlPw/ivIYBjVSrWAfWLBeku5tpPE2fOPLi+WHffIWbuh2tCjhyQhTBPMf5E9jDEH4FOmTYgYwbKwtQ==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/gopd": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.2.0.tgz", + "integrity": "sha512-ZUKRh6/kUFoAiTAtTYPZJ3hw9wNxx+BIBOijnlG9PnrJsCcSjs1wyyD6vJpaYtgnzDrKYRSqf3OO6Rfa93xsRg==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/graceful-fs": { + "version": "4.2.11", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.11.tgz", + "integrity": "sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ==" + }, + "node_modules/has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "devOptional": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/has-symbols": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.1.0.tgz", + "integrity": "sha512-1cDNdwJ2Jaohmb3sg4OmKaMBwuC48sYni5HUw2DvsC8LjGTLK9h+eb1X6RyuOHe4hT0ULCW68iomhjUoKUqlPQ==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-tostringtag": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/has-tostringtag/-/has-tostringtag-1.0.2.tgz", + "integrity": "sha512-NqADB8VjPFLM2V0VvHUewwwsw0ZWBaIdgo+ieHtK3hasLz4qeCRjYcqfB6AQrBggRKppKF8L52/VqdVsO47Dlw==", + "dev": true, + "dependencies": { + "has-symbols": "^1.0.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/hasown": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz", + "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==", + "dev": true, + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/hookable": { + "version": "5.5.3", + "resolved": "https://registry.npmjs.org/hookable/-/hookable-5.5.3.tgz", + "integrity": "sha512-Yc+BQe8SvoXH1643Qez1zqLRmbA5rCL+sSmk6TVos0LWVfNIB7PGncdlId77WzLGSIB5KaWgTaNTs2lNVEI6VQ==", + "dev": true + }, + "node_modules/human-signals": { + "version": "8.0.1", + "resolved": "https://registry.npmjs.org/human-signals/-/human-signals-8.0.1.tgz", + "integrity": "sha512-eKCa6bwnJhvxj14kZk5NCPc6Hb6BdsU9DZcOnmQKSnO1VKrfV0zCvtttPZUsBvjmNDn8rpcJfpwSYnHBjc95MQ==", + "dev": true, + "engines": { + "node": ">=18.18.0" + } + }, + "node_modules/ignore": { + "version": "5.3.2", + "resolved": "https://registry.npmjs.org/ignore/-/ignore-5.3.2.tgz", + "integrity": "sha512-hsBTNUqQTDwkWtcdYI2i06Y/nUBEsNEDJKjWdigLvegy8kDuJAS8uRlpkkcQpyEXL0Z/pjDy5HBmMjRCJ2gq+g==", + "dev": true, + "engines": { + "node": ">= 4" + } + }, + "node_modules/immutable": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/immutable/-/immutable-5.1.1.tgz", + "integrity": "sha512-3jatXi9ObIsPGr3N5hGw/vWWcTkq6hUYhpQz4k0wLC+owqWi/LiugIw9x0EdNZ2yGedKN/HzePiBvaJRXa0Ujg==", + "devOptional": true + }, + "node_modules/import-fresh": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.1.tgz", + "integrity": "sha512-TR3KfrTZTYLPB6jUjfx6MF9WcWrHL9su5TObK4ZkYgBdWKPOFoSoQIdEuTuR82pmtxH2spWG9h6etwfr1pLBqQ==", + "dev": true, + "dependencies": { + "parent-module": "^1.0.0", + "resolve-from": "^4.0.0" + }, + "engines": { + "node": ">=6" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/imurmurhash": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", + "integrity": "sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA==", + "dev": true, + "engines": { + "node": ">=0.8.19" + } + }, + "node_modules/is-docker": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-docker/-/is-docker-3.0.0.tgz", + "integrity": "sha512-eljcgEDlEns/7AXFosB5K/2nCM4P7FQPkGc/DWLy5rmFEWvZayGrik1d9/QIY5nJ4f9YsVvBkA6kJpHn9rISdQ==", + "dev": true, + "bin": { + "is-docker": "cli.js" + }, + "engines": { + "node": "^12.20.0 || ^14.13.1 || >=16.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dev": true, + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-inside-container": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-inside-container/-/is-inside-container-1.0.0.tgz", + "integrity": "sha512-KIYLCCJghfHZxqjYBE7rEy0OBuTd5xCHS7tHVgvCLkx7StIoaxwNW3hCALgEUjFfeRk+MG/Qxmp/vtETEF3tRA==", + "dev": true, + "dependencies": { + "is-docker": "^3.0.0" + }, + "bin": { + "is-inside-container": "cli.js" + }, + "engines": { + "node": ">=14.16" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/is-plain-obj": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/is-plain-obj/-/is-plain-obj-4.1.0.tgz", + "integrity": "sha512-+Pgi+vMuUNkJyExiMBt5IlFoMyKnr5zhJ4Uspz58WOhBF5QoIZkFyNHIbBAtHwzVAgk5RtndVNsDRN61/mmDqg==", + "dev": true, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/is-stream": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/is-stream/-/is-stream-4.0.1.tgz", + "integrity": "sha512-Dnz92NInDqYckGEUJv689RbRiTSEHCQ7wOVeALbkOz999YpqT46yMRIGtSNl2iCL1waAZSx40+h59NV/EwzV/A==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/is-unicode-supported": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-unicode-supported/-/is-unicode-supported-2.1.0.tgz", + "integrity": "sha512-mE00Gnza5EEB3Ds0HfMyllZzbBrmLOX3vfWoj9A9PEnTfratQ/BcaJOuMhnkhjXvb2+FkY3VuHqtAGpTPmglFQ==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/is-what": { + "version": "4.1.16", + "resolved": "https://registry.npmjs.org/is-what/-/is-what-4.1.16.tgz", + "integrity": "sha512-ZhMwEosbFJkA0YhFnNDgTM4ZxDRsS6HqTo7qsZM08fehyRYIYa0yHu5R6mgo1n/8MgaPBXiPimPD77baVFYg+A==", + "dev": true, + "engines": { + "node": ">=12.13" + }, + "funding": { + "url": "https://github.com/sponsors/mesqueeb" + } + }, + "node_modules/is-wsl": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/is-wsl/-/is-wsl-3.1.0.tgz", + "integrity": "sha512-UcVfVfaK4Sc4m7X3dUSoHoozQGBEFeDC+zVo06t98xe8CzHSZZBekNXH+tu0NalHolcJ/QAGqS46Hef7QXBIMw==", + "dev": true, + "dependencies": { + "is-inside-container": "^1.0.0" + }, + "engines": { + "node": ">=16" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/isexe": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", + "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==", + "dev": true + }, + "node_modules/jiti": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/jiti/-/jiti-2.4.2.tgz", + "integrity": "sha512-rg9zJN+G4n2nfJl5MW3BMygZX56zKPNVEYYqq7adpmMh4Jn2QNEwhvQlFy6jPVdcod7txZtKHWnyZiA3a0zP7A==", + "bin": { + "jiti": "lib/jiti-cli.mjs" + } + }, + "node_modules/js-tokens": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", + "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==", + "dev": true + }, + "node_modules/js-yaml": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.0.tgz", + "integrity": "sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==", + "dev": true, + "dependencies": { + "argparse": "^2.0.1" + }, + "bin": { + "js-yaml": "bin/js-yaml.js" + } + }, + "node_modules/jsesc": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-3.1.0.tgz", + "integrity": "sha512-/sM3dO2FOzXjKQhJuo0Q173wf2KOo8t4I8vHy6lF9poUp7bKT0/NHE8fPX23PwfhnykfqnC2xRxOnVw5XuGIaA==", + "dev": true, + "bin": { + "jsesc": "bin/jsesc" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/json-buffer": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/json-buffer/-/json-buffer-3.0.1.tgz", + "integrity": "sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==", + "dev": true + }, + "node_modules/json-schema-traverse": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", + "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==", + "dev": true + }, + "node_modules/json-stable-stringify-without-jsonify": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz", + "integrity": "sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==", + "dev": true + }, + "node_modules/json5": { + "version": "2.2.3", + "resolved": "https://registry.npmjs.org/json5/-/json5-2.2.3.tgz", + "integrity": "sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg==", + "dev": true, + "bin": { + "json5": "lib/cli.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/jsonfile": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-6.1.0.tgz", + "integrity": "sha512-5dgndWOriYSm5cnYaJNhalLNDKOqFwyDB/rr1E9ZsGciGvKPs8R2xYGCacuf3z6K1YKDz182fd+fY3cn3pMqXQ==", + "dev": true, + "dependencies": { + "universalify": "^2.0.0" + }, + "optionalDependencies": { + "graceful-fs": "^4.1.6" + } + }, + "node_modules/keyv": { + "version": "4.5.4", + "resolved": "https://registry.npmjs.org/keyv/-/keyv-4.5.4.tgz", + "integrity": "sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==", + "dev": true, + "dependencies": { + "json-buffer": "3.0.1" + } + }, + "node_modules/kolorist": { + "version": "1.8.0", + "resolved": "https://registry.npmjs.org/kolorist/-/kolorist-1.8.0.tgz", + "integrity": "sha512-Y+60/zizpJ3HRH8DCss+q95yr6145JXZo46OTpFvDZWLfRCE4qChOyk1b26nMaNpfHHgxagk9dXT5OP0Tfe+dQ==", + "dev": true + }, + "node_modules/levn": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/levn/-/levn-0.4.1.tgz", + "integrity": "sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==", + "dev": true, + "dependencies": { + "prelude-ls": "^1.2.1", + "type-check": "~0.4.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/lightningcss": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss/-/lightningcss-1.29.2.tgz", + "integrity": "sha512-6b6gd/RUXKaw5keVdSEtqFVdzWnU5jMxTUjA2bVcMNPLwSQ08Sv/UodBVtETLCn7k4S1Ibxwh7k68IwLZPgKaA==", + "dependencies": { + "detect-libc": "^2.0.3" + }, + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + }, + "optionalDependencies": { + "lightningcss-darwin-arm64": "1.29.2", + "lightningcss-darwin-x64": "1.29.2", + "lightningcss-freebsd-x64": "1.29.2", + "lightningcss-linux-arm-gnueabihf": "1.29.2", + "lightningcss-linux-arm64-gnu": "1.29.2", + "lightningcss-linux-arm64-musl": "1.29.2", + "lightningcss-linux-x64-gnu": "1.29.2", + "lightningcss-linux-x64-musl": "1.29.2", + "lightningcss-win32-arm64-msvc": "1.29.2", + "lightningcss-win32-x64-msvc": "1.29.2" + } + }, + "node_modules/lightningcss-darwin-arm64": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-darwin-arm64/-/lightningcss-darwin-arm64-1.29.2.tgz", + "integrity": "sha512-cK/eMabSViKn/PG8U/a7aCorpeKLMlK0bQeNHmdb7qUnBkNPnL+oV5DjJUo0kqWsJUapZsM4jCfYItbqBDvlcA==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-darwin-x64": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-darwin-x64/-/lightningcss-darwin-x64-1.29.2.tgz", + "integrity": "sha512-j5qYxamyQw4kDXX5hnnCKMf3mLlHvG44f24Qyi2965/Ycz829MYqjrVg2H8BidybHBp9kom4D7DR5VqCKDXS0w==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-freebsd-x64": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-freebsd-x64/-/lightningcss-freebsd-x64-1.29.2.tgz", + "integrity": "sha512-wDk7M2tM78Ii8ek9YjnY8MjV5f5JN2qNVO+/0BAGZRvXKtQrBC4/cn4ssQIpKIPP44YXw6gFdpUF+Ps+RGsCwg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm-gnueabihf": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm-gnueabihf/-/lightningcss-linux-arm-gnueabihf-1.29.2.tgz", + "integrity": "sha512-IRUrOrAF2Z+KExdExe3Rz7NSTuuJ2HvCGlMKoquK5pjvo2JY4Rybr+NrKnq0U0hZnx5AnGsuFHjGnNT14w26sg==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm64-gnu": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-gnu/-/lightningcss-linux-arm64-gnu-1.29.2.tgz", + "integrity": "sha512-KKCpOlmhdjvUTX/mBuaKemp0oeDIBBLFiU5Fnqxh1/DZ4JPZi4evEH7TKoSBFOSOV3J7iEmmBaw/8dpiUvRKlQ==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm64-musl": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-musl/-/lightningcss-linux-arm64-musl-1.29.2.tgz", + "integrity": "sha512-Q64eM1bPlOOUgxFmoPUefqzY1yV3ctFPE6d/Vt7WzLW4rKTv7MyYNky+FWxRpLkNASTnKQUaiMJ87zNODIrrKQ==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-x64-gnu": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-gnu/-/lightningcss-linux-x64-gnu-1.29.2.tgz", + "integrity": "sha512-0v6idDCPG6epLXtBH/RPkHvYx74CVziHo6TMYga8O2EiQApnUPZsbR9nFNrg2cgBzk1AYqEd95TlrsL7nYABQg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-x64-musl": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-musl/-/lightningcss-linux-x64-musl-1.29.2.tgz", + "integrity": "sha512-rMpz2yawkgGT8RULc5S4WiZopVMOFWjiItBT7aSfDX4NQav6M44rhn5hjtkKzB+wMTRlLLqxkeYEtQ3dd9696w==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-win32-arm64-msvc": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-win32-arm64-msvc/-/lightningcss-win32-arm64-msvc-1.29.2.tgz", + "integrity": "sha512-nL7zRW6evGQqYVu/bKGK+zShyz8OVzsCotFgc7judbt6wnB2KbiKKJwBE4SGoDBQ1O94RjW4asrCjQL4i8Fhbw==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-win32-x64-msvc": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-win32-x64-msvc/-/lightningcss-win32-x64-msvc-1.29.2.tgz", + "integrity": "sha512-EdIUW3B2vLuHmv7urfzMI/h2fmlnOQBk1xlsDxkN1tCWKjNFjfLhGxYk8C8mzpSfr+A6jFFIi8fU6LbQGsRWjA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/locate-path": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-6.0.0.tgz", + "integrity": "sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==", + "dev": true, + "dependencies": { + "p-locate": "^5.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/lodash": { + "version": "4.17.21", + "resolved": "https://registry.npmjs.org/lodash/-/lodash-4.17.21.tgz", + "integrity": "sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg==", + "dev": true + }, + "node_modules/lodash.merge": { + "version": "4.6.2", + "resolved": "https://registry.npmjs.org/lodash.merge/-/lodash.merge-4.6.2.tgz", + "integrity": "sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==", + "dev": true + }, + "node_modules/lru-cache": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", + "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", + "dev": true, + "dependencies": { + "yallist": "^3.0.2" + } + }, + "node_modules/magic-string": { + "version": "0.30.17", + "resolved": "https://registry.npmjs.org/magic-string/-/magic-string-0.30.17.tgz", + "integrity": "sha512-sNPKHvyjVf7gyjwS4xGTaW/mCnF8wnjtifKBEhxfZ7E/S8tQ0rssrwGNn6q8JH/ohItJfSQp9mBtQYuTlH5QnA==", + "dependencies": { + "@jridgewell/sourcemap-codec": "^1.5.0" + } + }, + "node_modules/math-intrinsics": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/math-intrinsics/-/math-intrinsics-1.1.0.tgz", + "integrity": "sha512-/IXtbwEk5HTPyEwyKX6hGkYXxM9nbj64B+ilVJnC/R6B0pH5G4V3b0pVbL7DBj4tkhBAppbQUlf6F6Xl9LHu1g==", + "dev": true, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==", + "dev": true, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "dev": true, + "dependencies": { + "mime-db": "1.52.0" + }, + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dev": true, + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/mitt": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/mitt/-/mitt-3.0.1.tgz", + "integrity": "sha512-vKivATfr97l2/QBCYAkXYDbrIWPM2IIKEl7YPhjCvKlG3kE2gm+uBo6nEXK3M5/Ffh/FLpKExzOQ3JJoJGFKBw==", + "dev": true + }, + "node_modules/mrmime": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/mrmime/-/mrmime-2.0.1.tgz", + "integrity": "sha512-Y3wQdFg2Va6etvQ5I82yUhGdsKrcYox6p7FfL1LbK2J4V01F9TGlepTIhnK24t7koZibmg82KGglhA1XK5IsLQ==", + "dev": true, + "engines": { + "node": ">=10" + } + }, + "node_modules/ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "dev": true + }, + "node_modules/nanoid": { + "version": "3.3.11", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.11.tgz", + "integrity": "sha512-N8SpfPUnUp1bK+PMYW8qSWdl9U+wwNWI4QKxOYDy9JAro3WMX7p2OeVRF9v+347pnakNevPmiHhNmZ2HbFA76w==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "bin": { + "nanoid": "bin/nanoid.cjs" + }, + "engines": { + "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" + } + }, + "node_modules/natural-compare": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/natural-compare/-/natural-compare-1.4.0.tgz", + "integrity": "sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==", + "dev": true + }, + "node_modules/node-releases": { + "version": "2.0.19", + "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.19.tgz", + "integrity": "sha512-xxOWJsBKtzAq7DY0J+DTzuz58K8e7sJbdgwkbMWQe8UYB6ekmsQ45q0M/tJDsGaZmbC+l7n57UV8Hl5tHxO9uw==", + "dev": true + }, + "node_modules/npm-run-path": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/npm-run-path/-/npm-run-path-6.0.0.tgz", + "integrity": "sha512-9qny7Z9DsQU8Ou39ERsPU4OZQlSTP47ShQzuKZ6PRXpYLtIFgl/DEBYEXKlvcEa+9tHVcK8CF81Y2V72qaZhWA==", + "dev": true, + "dependencies": { + "path-key": "^4.0.0", + "unicorn-magic": "^0.3.0" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/npm-run-path/node_modules/path-key": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-key/-/path-key-4.0.0.tgz", + "integrity": "sha512-haREypq7xkM7ErfgIyA0z+Bj4AGKlMSdlQE2jvJo6huWD1EdkKYV+G/T4nq0YEF2vgTT8kqMFKo1uHn950r4SQ==", + "dev": true, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/nth-check": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/nth-check/-/nth-check-2.1.1.tgz", + "integrity": "sha512-lqjrjmaOoAnWfMmBPL+XNnynZh2+swxiX3WUE0s4yEHI6m+AwrK2UZOimIRl3X/4QctVqS8AiZjFqyOGrMXb/w==", + "dev": true, + "dependencies": { + "boolbase": "^1.0.0" + }, + "funding": { + "url": "https://github.com/fb55/nth-check?sponsor=1" + } + }, + "node_modules/open": { + "version": "10.1.0", + "resolved": "https://registry.npmjs.org/open/-/open-10.1.0.tgz", + "integrity": "sha512-mnkeQ1qP5Ue2wd+aivTD3NHd/lZ96Lu0jgf0pwktLPtx6cTZiH7tyeGRRHs0zX0rbrahXPnXlUnbeXyaBBuIaw==", + "dev": true, + "dependencies": { + "default-browser": "^5.2.1", + "define-lazy-prop": "^3.0.0", + "is-inside-container": "^1.0.0", + "is-wsl": "^3.1.0" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/optionator": { + "version": "0.9.4", + "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.4.tgz", + "integrity": "sha512-6IpQ7mKUxRcZNLIObR0hz7lxsapSSIYNZJwXPGeF0mTVqGKFIXj1DQcMoT22S3ROcLyY/rz0PWaWZ9ayWmad9g==", + "dev": true, + "dependencies": { + "deep-is": "^0.1.3", + "fast-levenshtein": "^2.0.6", + "levn": "^0.4.1", + "prelude-ls": "^1.2.1", + "type-check": "^0.4.0", + "word-wrap": "^1.2.5" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/p-limit": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-3.1.0.tgz", + "integrity": "sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==", + "dev": true, + "dependencies": { + "yocto-queue": "^0.1.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/p-locate": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-5.0.0.tgz", + "integrity": "sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==", + "dev": true, + "dependencies": { + "p-limit": "^3.0.2" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/p-try": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/p-try/-/p-try-2.2.0.tgz", + "integrity": "sha512-R4nPAVTAU0B9D35/Gk3uJf/7XYbQcyohSKdvAxIRSNghFl4e71hVoGnBNQz9cWaXxO2I10KTC+3jMdvvoKw6dQ==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/parent-module": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/parent-module/-/parent-module-1.0.1.tgz", + "integrity": "sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==", + "dev": true, + "dependencies": { + "callsites": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/parse-ms": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/parse-ms/-/parse-ms-4.0.0.tgz", + "integrity": "sha512-TXfryirbmq34y8QBwgqCVLi+8oA3oWx2eAnSn62ITyEhEYaWRlVZ2DvMM9eZbMs/RfxPu/PK/aBLyGj4IrqMHw==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/path-key": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz", + "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/pathe": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/pathe/-/pathe-2.0.3.tgz", + "integrity": "sha512-WUjGcAqP1gQacoQe+OBJsFA7Ld4DyXuUIjZ5cc75cLHvJ7dtNsTugphxIADwspS+AraAUePCKrSVtPLFj/F88w==", + "dev": true + }, + "node_modules/perfect-debounce": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/perfect-debounce/-/perfect-debounce-1.0.0.tgz", + "integrity": "sha512-xCy9V055GLEqoFaHoC1SoLIaLmWctgCUaBaWxDZ7/Zx4CTyX7cJQLJOok/orfjZAh9kEYpjJa4d0KcJmCbctZA==", + "dev": true + }, + "node_modules/picocolors": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.1.1.tgz", + "integrity": "sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==" + }, + "node_modules/picomatch": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-4.0.2.tgz", + "integrity": "sha512-M7BAV6Rlcy5u+m6oPhAPFgJTzAioX/6B0DxyvDlo9l8+T3nLKbrczg2WLUyzd45L8RqfUMyGPzekbMvX2Ldkwg==", + "dev": true, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/pinia": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/pinia/-/pinia-3.0.1.tgz", + "integrity": "sha512-WXglsDzztOTH6IfcJ99ltYZin2mY8XZCXujkYWVIJlBjqsP6ST7zw+Aarh63E1cDVYeyUcPCxPHzJpEOmzB6Wg==", + "dev": true, + "dependencies": { + "@vue/devtools-api": "^7.7.2" + }, + "funding": { + "url": "https://github.com/sponsors/posva" + }, + "peerDependencies": { + "typescript": ">=4.4.4", + "vue": "^2.7.0 || ^3.5.11" + }, + "peerDependenciesMeta": { + "typescript": { + "optional": true + } + } + }, + "node_modules/pngjs": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/pngjs/-/pngjs-5.0.0.tgz", + "integrity": "sha512-40QW5YalBNfQo5yRYmiw7Yz6TKKVr3h6970B2YE+3fQpsWcrbj1PzJgxeJ19DRQjhMbKPIuMY8rFaXc8moolVw==", + "dev": true, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/postcss": { + "version": "8.5.3", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.5.3.tgz", + "integrity": "sha512-dle9A3yYxlBSrt8Fu+IpjGT8SY8hN0mlaA6GY8t0P5PjIOZemULz/E2Bnm/2dcUOena75OTNkHI76uZBNUUq3A==", + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/postcss" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "nanoid": "^3.3.8", + "picocolors": "^1.1.1", + "source-map-js": "^1.2.1" + }, + "engines": { + "node": "^10 || ^12 || >=14" + } + }, + "node_modules/postcss-selector-parser": { + "version": "6.1.2", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.1.2.tgz", + "integrity": "sha512-Q8qQfPiZ+THO/3ZrOrO0cJJKfpYCagtMUkXbnEfmgUjwXg6z/WBeOyS9APBBPCTSiDV+s4SwQGu8yFsiMRIudg==", + "dev": true, + "dependencies": { + "cssesc": "^3.0.0", + "util-deprecate": "^1.0.2" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/prelude-ls": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.2.1.tgz", + "integrity": "sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==", + "dev": true, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/prettier": { + "version": "3.5.3", + "resolved": "https://registry.npmjs.org/prettier/-/prettier-3.5.3.tgz", + "integrity": "sha512-QQtaxnoDJeAkDvDKWCLiwIXkTgRhwYDEQCghU9Z6q03iyek/rxRh/2lC3HB7P8sWT2xC/y5JDctPLBIGzHKbhw==", + "dev": true, + "bin": { + "prettier": "bin/prettier.cjs" + }, + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/prettier/prettier?sponsor=1" + } + }, + "node_modules/prettier-linter-helpers": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/prettier-linter-helpers/-/prettier-linter-helpers-1.0.0.tgz", + "integrity": "sha512-GbK2cP9nraSSUF9N2XwUwqfzlAFlMNYYl+ShE/V+H8a9uNl/oUqB1w2EL54Jh0OlyRSd8RfWYJ3coVS4TROP2w==", + "dev": true, + "dependencies": { + "fast-diff": "^1.1.2" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/pretty-ms": { + "version": "9.2.0", + "resolved": "https://registry.npmjs.org/pretty-ms/-/pretty-ms-9.2.0.tgz", + "integrity": "sha512-4yf0QO/sllf/1zbZWYnvWw3NxCQwLXKzIj0G849LSufP15BXKM0rbD2Z3wVnkMfjdn/CB0Dpp444gYAACdsplg==", + "dev": true, + "dependencies": { + "parse-ms": "^4.0.0" + }, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/proxy-from-env": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/proxy-from-env/-/proxy-from-env-1.1.0.tgz", + "integrity": "sha512-D+zkORCbA9f1tdWRK0RaCR3GPv50cMxcrz4X8k5LTSUD1Dkw47mKJEZQNunItRTkWwgtaUSo1RVFRIG9ZXiFYg==", + "dev": true + }, + "node_modules/punycode": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.3.1.tgz", + "integrity": "sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/qrcode": { + "version": "1.5.4", + "resolved": "https://registry.npmjs.org/qrcode/-/qrcode-1.5.4.tgz", + "integrity": "sha512-1ca71Zgiu6ORjHqFBDpnSMTR2ReToX4l1Au1VFLyVeBTFavzQnv5JxMFr3ukHVKpSrSA2MCk0lNJSykjUfz7Zg==", + "dev": true, + "dependencies": { + "dijkstrajs": "^1.0.1", + "pngjs": "^5.0.0", + "yargs": "^15.3.1" + }, + "bin": { + "qrcode": "bin/qrcode" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/require-directory": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.1.tgz", + "integrity": "sha512-fGxEI7+wsG9xrvdjsrlmL22OMTTiHRwAMroiEeMgq8gzoLC/PQr7RsRDSTLUg/bZAZtF+TVIkHc6/4RIKrui+Q==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/require-main-filename": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/require-main-filename/-/require-main-filename-2.0.0.tgz", + "integrity": "sha512-NKN5kMDylKuldxYLSUfrbo5Tuzh4hd+2E8NPPX02mZtn1VuREQToYe/ZdlJy+J3uCpfaiGF05e7B8W0iXbQHmg==", + "dev": true + }, + "node_modules/resolve-from": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-4.0.0.tgz", + "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/rfdc": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/rfdc/-/rfdc-1.4.1.tgz", + "integrity": "sha512-q1b3N5QkRUWUl7iyylaaj3kOpIT0N2i9MqIEQXP73GVsN9cw3fdx8X63cEmWhJGi2PPCF23Ijp7ktmd39rawIA==", + "dev": true + }, + "node_modules/rollup": { + "version": "4.39.0", + "resolved": "https://registry.npmjs.org/rollup/-/rollup-4.39.0.tgz", + "integrity": "sha512-thI8kNc02yNvnmJp8dr3fNWJ9tCONDhp6TV35X6HkKGGs9E6q7YWCHbe5vKiTa7TAiNcFEmXKj3X/pG2b3ci0g==", + "dependencies": { + "@types/estree": "1.0.7" + }, + "bin": { + "rollup": "dist/bin/rollup" + }, + "engines": { + "node": ">=18.0.0", + "npm": ">=8.0.0" + }, + "optionalDependencies": { + "@rollup/rollup-android-arm-eabi": "4.39.0", + "@rollup/rollup-android-arm64": "4.39.0", + "@rollup/rollup-darwin-arm64": "4.39.0", + "@rollup/rollup-darwin-x64": "4.39.0", + "@rollup/rollup-freebsd-arm64": "4.39.0", + "@rollup/rollup-freebsd-x64": "4.39.0", + "@rollup/rollup-linux-arm-gnueabihf": "4.39.0", + "@rollup/rollup-linux-arm-musleabihf": "4.39.0", + "@rollup/rollup-linux-arm64-gnu": "4.39.0", + "@rollup/rollup-linux-arm64-musl": "4.39.0", + "@rollup/rollup-linux-loongarch64-gnu": "4.39.0", + "@rollup/rollup-linux-powerpc64le-gnu": "4.39.0", + "@rollup/rollup-linux-riscv64-gnu": "4.39.0", + "@rollup/rollup-linux-riscv64-musl": "4.39.0", + "@rollup/rollup-linux-s390x-gnu": "4.39.0", + "@rollup/rollup-linux-x64-gnu": "4.39.0", + "@rollup/rollup-linux-x64-musl": "4.39.0", + "@rollup/rollup-win32-arm64-msvc": "4.39.0", + "@rollup/rollup-win32-ia32-msvc": "4.39.0", + "@rollup/rollup-win32-x64-msvc": "4.39.0", + "fsevents": "~2.3.2" + } + }, + "node_modules/run-applescript": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/run-applescript/-/run-applescript-7.0.0.tgz", + "integrity": "sha512-9by4Ij99JUr/MCFBUkDKLWK3G9HVXmabKz9U5MlIAIuvuzkiOicRYs8XJLxX+xahD+mLiiCYDqF9dKAgtzKP1A==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/rxjs": { + "version": "7.8.2", + "resolved": "https://registry.npmjs.org/rxjs/-/rxjs-7.8.2.tgz", + "integrity": "sha512-dhKf903U/PQZY6boNNtAGdWbG85WAbjT/1xYoZIC7FAY0yWapOBQVsVrDl58W86//e1VpMNBtRV4MaXfdMySFA==", + "devOptional": true, + "dependencies": { + "tslib": "^2.1.0" + } + }, + "node_modules/sass-embedded": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded/-/sass-embedded-1.86.3.tgz", + "integrity": "sha512-3pZSp24ibO1hdopj+W9DuiWsZOb2YY6AFRo/jjutKLBkqJGM1nJjXzhAYfzRV+Xn5BX1eTI4bBTE09P0XNHOZg==", + "devOptional": true, + "dependencies": { + "@bufbuild/protobuf": "^2.0.0", + "buffer-builder": "^0.2.0", + "colorjs.io": "^0.5.0", + "immutable": "^5.0.2", + "rxjs": "^7.4.0", + "supports-color": "^8.1.1", + "sync-child-process": "^1.0.2", + "varint": "^6.0.0" + }, + "bin": { + "sass": "dist/bin/sass.js" + }, + "engines": { + "node": ">=16.0.0" + }, + "optionalDependencies": { + "sass-embedded-android-arm": "1.86.3", + "sass-embedded-android-arm64": "1.86.3", + "sass-embedded-android-ia32": "1.86.3", + "sass-embedded-android-riscv64": "1.86.3", + "sass-embedded-android-x64": "1.86.3", + "sass-embedded-darwin-arm64": "1.86.3", + "sass-embedded-darwin-x64": "1.86.3", + "sass-embedded-linux-arm": "1.86.3", + "sass-embedded-linux-arm64": "1.86.3", + "sass-embedded-linux-ia32": "1.86.3", + "sass-embedded-linux-musl-arm": "1.86.3", + "sass-embedded-linux-musl-arm64": "1.86.3", + "sass-embedded-linux-musl-ia32": "1.86.3", + "sass-embedded-linux-musl-riscv64": "1.86.3", + "sass-embedded-linux-musl-x64": "1.86.3", + "sass-embedded-linux-riscv64": "1.86.3", + "sass-embedded-linux-x64": "1.86.3", + "sass-embedded-win32-arm64": "1.86.3", + "sass-embedded-win32-ia32": "1.86.3", + "sass-embedded-win32-x64": "1.86.3" + } + }, + "node_modules/sass-embedded-android-arm": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-android-arm/-/sass-embedded-android-arm-1.86.3.tgz", + "integrity": "sha512-UyeXrFzZSvrGbvrWUBcspbsbivGgAgebLGJdSqJulgSyGbA6no3DWQ5Qpdd6+OAUC39BlpPu74Wx9s4RrVuaFw==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-android-arm64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-android-arm64/-/sass-embedded-android-arm64-1.86.3.tgz", + "integrity": "sha512-q+XwFp6WgAv+UgnQhsB8KQ95kppvWAB7DSoJp+8Vino8b9ND+1ai3cUUZPE5u4SnLZrgo5NtrbPvN5KLc4Pfyg==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-android-ia32": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-android-ia32/-/sass-embedded-android-ia32-1.86.3.tgz", + "integrity": "sha512-gTJjVh2cRzvGujXj5ApPk/owUTL5SiO7rDtNLrzYAzi1N5HRuLYXqk3h1IQY3+eCOBjGl7mQ9XyySbJs/3hDvg==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-android-riscv64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-android-riscv64/-/sass-embedded-android-riscv64-1.86.3.tgz", + "integrity": "sha512-Po3JnyiCS16kd6REo1IMUbFGYtvL9O0rmKaXx5vOuBaJD1LPy2LiSSp7TU7wkJ9IxsTDGzFaSeP1I9qb6D8VVg==", + "cpu": [ + "riscv64" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-android-x64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-android-x64/-/sass-embedded-android-x64-1.86.3.tgz", + "integrity": "sha512-+7h3jdDv/0kUFx0BvxYlq2fa7CcHiDPlta6k5OxO5K6jyqJwo9hc0Z052BoYEauWTqZ+vK6bB5rv2BIzq4U9nA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-darwin-arm64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-darwin-arm64/-/sass-embedded-darwin-arm64-1.86.3.tgz", + "integrity": "sha512-EgLwV4ORm5Hr0DmIXo0Xw/vlzwLnfAiqD2jDXIglkBsc5czJmo4/IBdGXOP65TRnsgJEqvbU3aQhuawX5++x9A==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-darwin-x64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-darwin-x64/-/sass-embedded-darwin-x64-1.86.3.tgz", + "integrity": "sha512-dfKhfrGPRNLWLC82vy/vQGmNKmAiKWpdFuWiePRtg/E95pqw+sCu6080Y6oQLfFu37Iq3MpnXiSpDuSo7UnPWA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-arm": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-arm/-/sass-embedded-linux-arm-1.86.3.tgz", + "integrity": "sha512-+fVCIH+OR0SMHn2NEhb/VfbpHuUxcPtqMS34OCV3Ka99LYZUJZqth4M3lT/ppGl52mwIVLNYzR4iLe6mdZ6mYA==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-arm64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-arm64/-/sass-embedded-linux-arm64-1.86.3.tgz", + "integrity": "sha512-tYq5rywR53Qtc+0KI6pPipOvW7a47ETY69VxfqI9BR2RKw2hBbaz0bIw6OaOgEBv2/XNwcWb7a4sr7TqgkqKAA==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-ia32": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-ia32/-/sass-embedded-linux-ia32-1.86.3.tgz", + "integrity": "sha512-CmQ5OkqnaeLdaF+bMqlYGooBuenqm3LvEN9H8BLhjkpWiFW8hnYMetiqMcJjhrXLvDw601KGqA5sr/Rsg5s45g==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-musl-arm": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-musl-arm/-/sass-embedded-linux-musl-arm-1.86.3.tgz", + "integrity": "sha512-SEm65SQknI4pl+mH5Xf231hOkHJyrlgh5nj4qDbiBG6gFeutaNkNIeRgKEg3cflXchCr8iV/q/SyPgjhhzQb7w==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-musl-arm64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-musl-arm64/-/sass-embedded-linux-musl-arm64-1.86.3.tgz", + "integrity": "sha512-4zOr2C/eW89rxb4ozTfn7lBzyyM5ZigA1ZSRTcAR26Qbg/t2UksLdGnVX9/yxga0d6aOi0IvO/7iM2DPPRRotg==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-musl-ia32": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-musl-ia32/-/sass-embedded-linux-musl-ia32-1.86.3.tgz", + "integrity": "sha512-84Tcld32LB1loiqUvczWyVBQRCChm0wNLlkT59qF29nxh8njFIVf9yaPgXcSyyjpPoD9Tu0wnq3dvVzoMCh9AQ==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-musl-riscv64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-musl-riscv64/-/sass-embedded-linux-musl-riscv64-1.86.3.tgz", + "integrity": "sha512-IxEqoiD7vdNpiOwccybbV93NljBy64wSTkUOknGy21SyV43C8uqESOwTwW9ywa3KufImKm8L3uQAW/B0KhJMWg==", + "cpu": [ + "riscv64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-musl-x64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-musl-x64/-/sass-embedded-linux-musl-x64-1.86.3.tgz", + "integrity": "sha512-ePeTPXUxPK6JgHcUfnrkIyDtyt+zlAvF22mVZv6y1g/PZFm1lSfX+Za7TYHg9KaYqaaXDiw6zICX4i44HhR8rA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-riscv64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-riscv64/-/sass-embedded-linux-riscv64-1.86.3.tgz", + "integrity": "sha512-NuXQ72dwfNLe35E+RaXJ4Noq4EkFwM65eWwCwxEWyJO9qxOx1EXiCAJii6x8kkOh5daWuMU0VAI1B9RsJaqqQQ==", + "cpu": [ + "riscv64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-linux-x64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-linux-x64/-/sass-embedded-linux-x64-1.86.3.tgz", + "integrity": "sha512-t8be9zJ5B82+og9bQmIQ83yMGYZMTMrlGA+uGWtYacmwg6w3093dk91Fx0YzNSZBp3Tk60qVYjCZnEIwy60x0g==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-win32-arm64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-win32-arm64/-/sass-embedded-win32-arm64-1.86.3.tgz", + "integrity": "sha512-4ghuAzjX4q8Nksm0aifRz8hgXMMxS0SuymrFfkfJlrSx68pIgvAge6AOw0edoZoe0Tf5ZbsWUWamhkNyNxkTvw==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-win32-ia32": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-win32-ia32/-/sass-embedded-win32-ia32-1.86.3.tgz", + "integrity": "sha512-tCaK4zIRq9mLRPxLzBAdYlfCuS/xLNpmjunYxeWkIwlJo+k53h1udyXH/FInnQ2GgEz0xMXyvH3buuPgzwWYsw==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded-win32-x64": { + "version": "1.86.3", + "resolved": "https://registry.npmjs.org/sass-embedded-win32-x64/-/sass-embedded-win32-x64-1.86.3.tgz", + "integrity": "sha512-zS+YNKfTF4SnOfpC77VTb0qNZyTXrxnAezSoRV0xnw6HlY+1WawMSSB6PbWtmbvyfXNgpmJUttoTtsvJjRCucg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/sass-embedded/node_modules/supports-color": { + "version": "8.1.1", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-8.1.1.tgz", + "integrity": "sha512-MpUEN2OodtUzxvKQl72cUF7RQ5EiHsGvSsVG0ia9c5RbWGL2CI4C7EpPS8UTBIplnlzZiNuV56w+FuNxy3ty2Q==", + "devOptional": true, + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/chalk/supports-color?sponsor=1" + } + }, + "node_modules/semver": { + "version": "7.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.7.1.tgz", + "integrity": "sha512-hlq8tAfn0m/61p4BVRcPzIGr6LKiMwo4VM6dGi6pt4qcRkmNzTcWq6eCEjEh+qXjkMDvPlOFFSGwQjoEa6gyMA==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + }, + "engines": { + "node": ">=10" + } + }, + "node_modules/set-blocking": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", + "integrity": "sha512-KiKBS8AnWGEyLzofFfmvKwpdPzqiy16LvQfK3yv/fVH7Bj13/wl3JSR1J+rfgRE9q7xUJK4qvgS8raSOeLUehw==", + "dev": true + }, + "node_modules/shebang-command": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz", + "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==", + "dev": true, + "dependencies": { + "shebang-regex": "^3.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/shebang-regex": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz", + "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/signal-exit": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-4.1.0.tgz", + "integrity": "sha512-bzyZ1e88w9O1iNJbKnOlvYTrWPDl46O1bG0D3XInv+9tkPrxrN8jUUTiFlDkkmKWgn1M6CfIA13SuGqOa9Korw==", + "dev": true, + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/sirv": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/sirv/-/sirv-3.0.1.tgz", + "integrity": "sha512-FoqMu0NCGBLCcAkS1qA+XJIQTR6/JHfQXl+uGteNCQ76T91DMUjPa9xfmeqMY3z80nLSg9yQmNjK0Px6RWsH/A==", + "dev": true, + "dependencies": { + "@polka/url": "^1.0.0-next.24", + "mrmime": "^2.0.0", + "totalist": "^3.0.0" + }, + "engines": { + "node": ">=18" + } + }, + "node_modules/source-map-js": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.2.1.tgz", + "integrity": "sha512-UXWMKhLOwVKb728IUtQPXxfYU+usdybtUrK/8uGE8CQMvrhOpwvzDBwj0QhSL7MQc7vIsISBG8VQ8+IDQxpfQA==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/speakingurl": { + "version": "14.0.1", + "resolved": "https://registry.npmjs.org/speakingurl/-/speakingurl-14.0.1.tgz", + "integrity": "sha512-1POYv7uv2gXoyGFpBCmpDVSNV74IfsWlDW216UPjbWufNf+bSU6GdbDsxdcxtfwb4xlI3yxzOTKClUosxARYrQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/string-width": { + "version": "4.2.3", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", + "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", + "dev": true, + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/strip-ansi": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "dev": true, + "dependencies": { + "ansi-regex": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/strip-final-newline": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/strip-final-newline/-/strip-final-newline-4.0.0.tgz", + "integrity": "sha512-aulFJcD6YK8V1G7iRB5tigAP4TsHBZZrOV8pjV++zdUwmeV8uzbY7yn6h9MswN62adStNZFuCIx4haBnRuMDaw==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/strip-json-comments": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.1.1.tgz", + "integrity": "sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==", + "dev": true, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/superjson": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/superjson/-/superjson-2.2.2.tgz", + "integrity": "sha512-5JRxVqC8I8NuOUjzBbvVJAKNM8qoVuH0O77h4WInc/qC2q5IreqKxYwgkga3PfA22OayK2ikceb/B26dztPl+Q==", + "dev": true, + "dependencies": { + "copy-anything": "^3.0.2" + }, + "engines": { + "node": ">=16" + } + }, + "node_modules/supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dev": true, + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/sync-child-process": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/sync-child-process/-/sync-child-process-1.0.2.tgz", + "integrity": "sha512-8lD+t2KrrScJ/7KXCSyfhT3/hRq78rC0wBFqNJXv3mZyn6hW2ypM05JmlSvtqRbeq6jqA94oHbxAr2vYsJ8vDA==", + "devOptional": true, + "dependencies": { + "sync-message-port": "^1.0.0" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/sync-message-port": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/sync-message-port/-/sync-message-port-1.1.3.tgz", + "integrity": "sha512-GTt8rSKje5FilG+wEdfCkOcLL7LWqpMlr2c3LRuKt/YXxcJ52aGSbGBAdI4L3aaqfrBt6y711El53ItyH1NWzg==", + "devOptional": true, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/synckit": { + "version": "0.11.2", + "resolved": "https://registry.npmjs.org/synckit/-/synckit-0.11.2.tgz", + "integrity": "sha512-1IUffI8zZ8qUMB3NUJIjk0RpLroG/8NkQDAWH1NbB2iJ0/5pn3M8rxfNzMz4GH9OnYaGYn31LEDSXJp/qIlxgA==", + "dev": true, + "dependencies": { + "@pkgr/core": "^0.2.0", + "tslib": "^2.8.1" + }, + "engines": { + "node": "^14.18.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/synckit" + } + }, + "node_modules/tailwindcss": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-4.1.2.tgz", + "integrity": "sha512-VCsK+fitIbQF7JlxXaibFhxrPq4E2hDcG8apzHUdWFMCQWD8uLdlHg4iSkZ53cgLCCcZ+FZK7vG8VjvLcnBgKw==" + }, + "node_modules/tapable": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/tapable/-/tapable-2.2.1.tgz", + "integrity": "sha512-GNzQvQTOIP6RyTfE2Qxb8ZVlNmw0n88vp1szwWRimP02mnTsx3Wtn5qRdqY9w2XduFNUgvOwhNnQsjwCp+kqaQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/totalist": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/totalist/-/totalist-3.0.1.tgz", + "integrity": "sha512-sf4i37nQ2LBx4m3wB74y+ubopq6W/dIzXg0FDGjsYnZHVa1Da8FH853wlL2gtUhg+xJXjfk3kUZS3BRoQeoQBQ==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/tslib": { + "version": "2.8.1", + "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.8.1.tgz", + "integrity": "sha512-oJFu94HQb+KVduSUQL7wnpmqnfmLsOA/nAh6b6EH0wCEoK0/mPeXU6c3wKDV83MkOuHPRHtSXKKU99IBazS/2w==", + "devOptional": true + }, + "node_modules/type-check": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.4.0.tgz", + "integrity": "sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==", + "dev": true, + "dependencies": { + "prelude-ls": "^1.2.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/type-fest": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.20.2.tgz", + "integrity": "sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/ua-parser-js": { + "version": "1.0.40", + "resolved": "https://registry.npmjs.org/ua-parser-js/-/ua-parser-js-1.0.40.tgz", + "integrity": "sha512-z6PJ8Lml+v3ichVojCiB8toQJBuwR42ySM4ezjXIqXK3M0HczmKQ3LF4rhU55PfD99KEEXQG6yb7iOMyvYuHew==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/ua-parser-js" + }, + { + "type": "paypal", + "url": "https://paypal.me/faisalman" + }, + { + "type": "github", + "url": "https://github.com/sponsors/faisalman" + } + ], + "bin": { + "ua-parser-js": "script/cli.js" + }, + "engines": { + "node": "*" + } + }, + "node_modules/unicorn-magic": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/unicorn-magic/-/unicorn-magic-0.3.0.tgz", + "integrity": "sha512-+QBBXBCvifc56fsbuxZQ6Sic3wqqc3WWaqxs58gvJrcOuN83HGTCwz3oS5phzU9LthRNE9VrJCFCLUgHeeFnfA==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/universalify": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/universalify/-/universalify-2.0.1.tgz", + "integrity": "sha512-gptHNQghINnc/vTGIk0SOFGFNXw7JVrlRUtConJRlvaw6DuX0wO5Jeko9sWrMBhh+PsYAZ7oXAiOnf/UKogyiw==", + "dev": true, + "engines": { + "node": ">= 10.0.0" + } + }, + "node_modules/update-browserslist-db": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.1.3.tgz", + "integrity": "sha512-UxhIZQ+QInVdunkDAaiazvvT/+fXL5Osr0JZlJulepYu6Jd7qJtDZjlur0emRlT71EN3ScPoE7gvsuIKKNavKw==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "escalade": "^3.2.0", + "picocolors": "^1.1.1" + }, + "bin": { + "update-browserslist-db": "cli.js" + }, + "peerDependencies": { + "browserslist": ">= 4.21.0" + } + }, + "node_modules/uri-js": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.1.tgz", + "integrity": "sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==", + "dev": true, + "dependencies": { + "punycode": "^2.1.0" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==", + "dev": true + }, + "node_modules/uuid": { + "version": "11.1.0", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-11.1.0.tgz", + "integrity": "sha512-0/A9rDy9P7cJ+8w1c9WD9V//9Wj15Ce2MPz8Ri6032usz+NfePxx5AcN3bN+r6ZL6jEo066/yNYB3tn4pQEx+A==", + "dev": true, + "funding": [ + "https://github.com/sponsors/broofa", + "https://github.com/sponsors/ctavan" + ], + "bin": { + "uuid": "dist/esm/bin/uuid" + } + }, + "node_modules/varint": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/varint/-/varint-6.0.0.tgz", + "integrity": "sha512-cXEIW6cfr15lFv563k4GuVuW/fiwjknytD37jIOLSdSWuOI6WnO/oKwmP2FQTU2l01LP8/M5TSAJpzUaGe3uWg==", + "devOptional": true + }, + "node_modules/vite": { + "version": "6.2.6", + "resolved": "https://registry.npmjs.org/vite/-/vite-6.2.6.tgz", + "integrity": "sha512-9xpjNl3kR4rVDZgPNdTL0/c6ao4km69a/2ihNQbcANz8RuCOK3hQBmLSJf3bRKVQjVMda+YvizNE8AwvogcPbw==", + "dependencies": { + "esbuild": "^0.25.0", + "postcss": "^8.5.3", + "rollup": "^4.30.1" + }, + "bin": { + "vite": "bin/vite.js" + }, + "engines": { + "node": "^18.0.0 || ^20.0.0 || >=22.0.0" + }, + "funding": { + "url": "https://github.com/vitejs/vite?sponsor=1" + }, + "optionalDependencies": { + "fsevents": "~2.3.3" + }, + "peerDependencies": { + "@types/node": "^18.0.0 || ^20.0.0 || >=22.0.0", + "jiti": ">=1.21.0", + "less": "*", + "lightningcss": "^1.21.0", + "sass": "*", + "sass-embedded": "*", + "stylus": "*", + "sugarss": "*", + "terser": "^5.16.0", + "tsx": "^4.8.1", + "yaml": "^2.4.2" + }, + "peerDependenciesMeta": { + "@types/node": { + "optional": true + }, + "jiti": { + "optional": true + }, + "less": { + "optional": true + }, + "lightningcss": { + "optional": true + }, + "sass": { + "optional": true + }, + "sass-embedded": { + "optional": true + }, + "stylus": { + "optional": true + }, + "sugarss": { + "optional": true + }, + "terser": { + "optional": true + }, + "tsx": { + "optional": true + }, + "yaml": { + "optional": true + } + } + }, + "node_modules/vite-hot-client": { + "version": "0.2.4", + "resolved": "https://registry.npmjs.org/vite-hot-client/-/vite-hot-client-0.2.4.tgz", + "integrity": "sha512-a1nzURqO7DDmnXqabFOliz908FRmIppkBKsJthS8rbe8hBEXwEwe4C3Pp33Z1JoFCYfVL4kTOMLKk0ZZxREIeA==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/antfu" + }, + "peerDependencies": { + "vite": "^2.6.0 || ^3.0.0 || ^4.0.0 || ^5.0.0-0 || ^6.0.0-0" + } + }, + "node_modules/vite-plugin-inspect": { + "version": "0.8.9", + "resolved": "https://registry.npmjs.org/vite-plugin-inspect/-/vite-plugin-inspect-0.8.9.tgz", + "integrity": "sha512-22/8qn+LYonzibb1VeFZmISdVao5kC22jmEKm24vfFE8siEn47EpVcCLYMv6iKOYMJfjSvSJfueOwcFCkUnV3A==", + "dev": true, + "dependencies": { + "@antfu/utils": "^0.7.10", + "@rollup/pluginutils": "^5.1.3", + "debug": "^4.3.7", + "error-stack-parser-es": "^0.1.5", + "fs-extra": "^11.2.0", + "open": "^10.1.0", + "perfect-debounce": "^1.0.0", + "picocolors": "^1.1.1", + "sirv": "^3.0.0" + }, + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/antfu" + }, + "peerDependencies": { + "vite": "^3.1.0 || ^4.0.0 || ^5.0.0-0 || ^6.0.1" + }, + "peerDependenciesMeta": { + "@nuxt/kit": { + "optional": true + } + } + }, + "node_modules/vite-plugin-vue-devtools": { + "version": "7.7.2", + "resolved": "https://registry.npmjs.org/vite-plugin-vue-devtools/-/vite-plugin-vue-devtools-7.7.2.tgz", + "integrity": "sha512-5V0UijQWiSBj32blkyPEqIbzc6HO9c1bwnBhx+ay2dzU0FakH+qMdNUT8nF9BvDE+i6I1U8CqCuJiO20vKEdQw==", + "dev": true, + "dependencies": { + "@vue/devtools-core": "^7.7.2", + "@vue/devtools-kit": "^7.7.2", + "@vue/devtools-shared": "^7.7.2", + "execa": "^9.5.1", + "sirv": "^3.0.0", + "vite-plugin-inspect": "0.8.9", + "vite-plugin-vue-inspector": "^5.3.1" + }, + "engines": { + "node": ">=v14.21.3" + }, + "peerDependencies": { + "vite": "^3.1.0 || ^4.0.0-0 || ^5.0.0-0 || ^6.0.0-0" + } + }, + "node_modules/vite-plugin-vue-inspector": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/vite-plugin-vue-inspector/-/vite-plugin-vue-inspector-5.3.1.tgz", + "integrity": "sha512-cBk172kZKTdvGpJuzCCLg8lJ909wopwsu3Ve9FsL1XsnLBiRT9U3MePcqrgGHgCX2ZgkqZmAGR8taxw+TV6s7A==", + "dev": true, + "dependencies": { + "@babel/core": "^7.23.0", + "@babel/plugin-proposal-decorators": "^7.23.0", + "@babel/plugin-syntax-import-attributes": "^7.22.5", + "@babel/plugin-syntax-import-meta": "^7.10.4", + "@babel/plugin-transform-typescript": "^7.22.15", + "@vue/babel-plugin-jsx": "^1.1.5", + "@vue/compiler-dom": "^3.3.4", + "kolorist": "^1.8.0", + "magic-string": "^0.30.4" + }, + "peerDependencies": { + "vite": "^3.0.0-0 || ^4.0.0-0 || ^5.0.0-0 || ^6.0.0-0" + } + }, + "node_modules/vue": { + "version": "3.5.13", + "resolved": "https://registry.npmjs.org/vue/-/vue-3.5.13.tgz", + "integrity": "sha512-wmeiSMxkZCSc+PM2w2VRsOYAZC8GdipNFRTsLSfodVqI9mbejKeXEGr8SckuLnrQPGe3oJN5c3K0vpoU9q/wCQ==", + "dependencies": { + "@vue/compiler-dom": "3.5.13", + "@vue/compiler-sfc": "3.5.13", + "@vue/runtime-dom": "3.5.13", + "@vue/server-renderer": "3.5.13", + "@vue/shared": "3.5.13" + }, + "peerDependencies": { + "typescript": "*" + }, + "peerDependenciesMeta": { + "typescript": { + "optional": true + } + } + }, + "node_modules/vue-eslint-parser": { + "version": "9.4.3", + "resolved": "https://registry.npmjs.org/vue-eslint-parser/-/vue-eslint-parser-9.4.3.tgz", + "integrity": "sha512-2rYRLWlIpaiN8xbPiDyXZXRgLGOtWxERV7ND5fFAv5qo1D2N9Fu9MNajBNc6o13lZ+24DAWCkQCvj4klgmcITg==", + "dev": true, + "dependencies": { + "debug": "^4.3.4", + "eslint-scope": "^7.1.1", + "eslint-visitor-keys": "^3.3.0", + "espree": "^9.3.1", + "esquery": "^1.4.0", + "lodash": "^4.17.21", + "semver": "^7.3.6" + }, + "engines": { + "node": "^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/mysticatea" + }, + "peerDependencies": { + "eslint": ">=6.0.0" + } + }, + "node_modules/vue-eslint-parser/node_modules/eslint-scope": { + "version": "7.2.2", + "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.2.tgz", + "integrity": "sha512-dOt21O7lTMhDM+X9mB4GX+DZrZtCUJPL/wlcTqxyrx5IvO0IYtILdtrQGQp+8n5S0gwSVmOf9NQrjMOgfQZlIg==", + "dev": true, + "dependencies": { + "esrecurse": "^4.3.0", + "estraverse": "^5.2.0" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/vue-eslint-parser/node_modules/eslint-visitor-keys": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz", + "integrity": "sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==", + "dev": true, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/vue-eslint-parser/node_modules/espree": { + "version": "9.6.1", + "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.1.tgz", + "integrity": "sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==", + "dev": true, + "dependencies": { + "acorn": "^8.9.0", + "acorn-jsx": "^5.3.2", + "eslint-visitor-keys": "^3.4.1" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/vue-router": { + "version": "4.5.0", + "resolved": "https://registry.npmjs.org/vue-router/-/vue-router-4.5.0.tgz", + "integrity": "sha512-HDuk+PuH5monfNuY+ct49mNmkCRK4xJAV9Ts4z9UFc4rzdDnxQLyCMGGc8pKhZhHTVzfanpNwB/lwqevcBwI4w==", + "dependencies": { + "@vue/devtools-api": "^6.6.4" + }, + "funding": { + "url": "https://github.com/sponsors/posva" + }, + "peerDependencies": { + "vue": "^3.2.0" + } + }, + "node_modules/vue-router/node_modules/@vue/devtools-api": { + "version": "6.6.4", + "resolved": "https://registry.npmjs.org/@vue/devtools-api/-/devtools-api-6.6.4.tgz", + "integrity": "sha512-sGhTPMuXqZ1rVOk32RylztWkfXTRhuS7vgAKv0zjqk8gbsHkJ7xfFf+jbySxt7tWObEJwyKaHMikV/WGDiQm8g==" + }, + "node_modules/which": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", + "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", + "dev": true, + "dependencies": { + "isexe": "^2.0.0" + }, + "bin": { + "node-which": "bin/node-which" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/which-module": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/which-module/-/which-module-2.0.1.tgz", + "integrity": "sha512-iBdZ57RDvnOR9AGBhML2vFZf7h8vmBjhoaZqODJBFWHVtKkDmKuHai3cx5PgVMrX5YDNp27AofYbAwctSS+vhQ==", + "dev": true + }, + "node_modules/word-wrap": { + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/word-wrap/-/word-wrap-1.2.5.tgz", + "integrity": "sha512-BN22B5eaMMI9UMtjrGd5g5eCYPpCPDUy0FJXbYsaT5zYxjFOckS53SQDE3pWkVoWpHXVb3BrYcEN4Twa55B5cA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/wrap-ansi": { + "version": "6.2.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-6.2.0.tgz", + "integrity": "sha512-r6lPcBGxZXlIcymEu7InxDMhdW0KDxpLgoFLcguasxCaJ/SOIZwINatK9KY/tf+ZrlywOKU0UDj3ATXUBfxJXA==", + "dev": true, + "dependencies": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/xml-name-validator": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/xml-name-validator/-/xml-name-validator-4.0.0.tgz", + "integrity": "sha512-ICP2e+jsHvAj2E2lIHxa5tjXRlKDJo4IdvPvCXbXQGdzSfmSpNVyIKMvoZHjDY9DP0zV17iI85o90vRFXNccRw==", + "dev": true, + "engines": { + "node": ">=12" + } + }, + "node_modules/y18n": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/y18n/-/y18n-4.0.3.tgz", + "integrity": "sha512-JKhqTOwSrqNA1NY5lSztJ1GrBiUodLMmIZuLiDaMRJ+itFd+ABVE8XBjOvIWL+rSqNDC74LCSFmlb/U4UZ4hJQ==", + "dev": true + }, + "node_modules/yallist": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", + "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", + "dev": true + }, + "node_modules/yargs": { + "version": "15.4.1", + "resolved": "https://registry.npmjs.org/yargs/-/yargs-15.4.1.tgz", + "integrity": "sha512-aePbxDmcYW++PaqBsJ+HYUFwCdv4LVvdnhBy78E57PIor8/OVvhMrADFFEDh8DHDFRv/O9i3lPhsENjO7QX0+A==", + "dev": true, + "dependencies": { + "cliui": "^6.0.0", + "decamelize": "^1.2.0", + "find-up": "^4.1.0", + "get-caller-file": "^2.0.1", + "require-directory": "^2.1.1", + "require-main-filename": "^2.0.0", + "set-blocking": "^2.0.0", + "string-width": "^4.2.0", + "which-module": "^2.0.0", + "y18n": "^4.0.0", + "yargs-parser": "^18.1.2" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/yargs-parser": { + "version": "18.1.3", + "resolved": "https://registry.npmjs.org/yargs-parser/-/yargs-parser-18.1.3.tgz", + "integrity": "sha512-o50j0JeToy/4K6OZcaQmW6lyXXKhq7csREXcDwk2omFPJEwUNOVtJKvmDr9EI1fAJZUyZcRF7kxGBWmRXudrCQ==", + "dev": true, + "dependencies": { + "camelcase": "^5.0.0", + "decamelize": "^1.2.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/yargs/node_modules/find-up": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-4.1.0.tgz", + "integrity": "sha512-PpOwAdQ/YlXQ2vj8a3h8IipDuYRi3wceVQQGYWxNINccq40Anw7BlsEXCMbt1Zt+OLA6Fq9suIpIWD0OsnISlw==", + "dev": true, + "dependencies": { + "locate-path": "^5.0.0", + "path-exists": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/yargs/node_modules/locate-path": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-5.0.0.tgz", + "integrity": "sha512-t7hw9pI+WvuwNJXwk5zVHpyhIqzg2qTlklJOf0mVxGSbe3Fp2VieZcduNYjaLDoy6p9uGpQEGWG87WpMKlNq8g==", + "dev": true, + "dependencies": { + "p-locate": "^4.1.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/yargs/node_modules/p-limit": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-2.3.0.tgz", + "integrity": "sha512-//88mFWSJx8lxCzwdAABTJL2MyWB12+eIY7MDL2SqLmAkeKU9qxRvWuSyTjm3FUmpBEMuFfckAIqEaVGUDxb6w==", + "dev": true, + "dependencies": { + "p-try": "^2.0.0" + }, + "engines": { + "node": ">=6" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/yargs/node_modules/p-locate": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-4.1.0.tgz", + "integrity": "sha512-R79ZZ/0wAxKGu3oYMlz8jy/kbhsNrS7SKZ7PxEHBgJ5+F2mtFW2fK2cOtBh1cHYkQsbzFV7I+EoRKe6Yt0oK7A==", + "dev": true, + "dependencies": { + "p-limit": "^2.2.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/yocto-queue": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/yocto-queue/-/yocto-queue-0.1.0.tgz", + "integrity": "sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/yoctocolors": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/yoctocolors/-/yoctocolors-2.1.1.tgz", + "integrity": "sha512-GQHQqAopRhwU8Kt1DDM8NjibDXHC8eoh1erhGAJPEyveY9qqVeXvVikNKrDz69sHowPMorbPUrH/mx8c50eiBQ==", + "dev": true, + "engines": { + "node": ">=18" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + } + } +} diff --git a/fe/package.json b/fe/package.json new file mode 100644 index 0000000..f23dda3 --- /dev/null +++ b/fe/package.json @@ -0,0 +1,37 @@ +{ + "name": "fe", + "version": "0.0.0", + "private": true, + "type": "module", + "scripts": { + "dev": "vite --host", + "build": "vite build --emptyOutDir", + "preview": "vite preview", + "lint": "eslint . --fix", + "format": "prettier --write src/" + }, + "dependencies": { + "@tabler/icons-vue": "^3.30.0", + "@tailwindcss/vite": "^4.0.9", + "vue": "^3.5.13", + "vue-router": "^4.5.0" + }, + "devDependencies": { + "@basitcodeenv/vue3-device-detect": "^1.0.3", + "@eslint/js": "^9.20.0", + "@vitejs/plugin-vue": "^5.2.1", + "@vue/eslint-config-prettier": "^10.2.0", + "axios": "^1.8.3", + "crypto-js": "^4.2.0", + "eslint": "^9.20.1", + "eslint-plugin-vue": "^9.32.0", + "pinia": "^3.0.1", + "prettier": "^3.5.1", + "qrcode": "^1.5.4", + "sass-embedded": "^1.85.1", + "tailwindcss": "^4.0.9", + "uuid": "^11.1.0", + "vite": "^6.1.0", + "vite-plugin-vue-devtools": "^7.7.2" + } +} diff --git a/public/assets/index-CNkZ911J.js b/fe/public/assets/index-CNkZ911J.js similarity index 100% rename from public/assets/index-CNkZ911J.js rename to fe/public/assets/index-CNkZ911J.js diff --git a/public/assets/index-zqIqfzzx.css b/fe/public/assets/index-zqIqfzzx.css similarity index 100% rename from public/assets/index-zqIqfzzx.css rename to fe/public/assets/index-zqIqfzzx.css diff --git a/fe/public/index.html b/fe/public/index.html new file mode 100644 index 0000000..a29aefd --- /dev/null +++ b/fe/public/index.html @@ -0,0 +1,14 @@ + + + + + + + Vite + Vue + + + + +
+ + diff --git a/fe/src/App.vue b/fe/src/App.vue new file mode 100644 index 0000000..99eb1ba --- /dev/null +++ b/fe/src/App.vue @@ -0,0 +1,98 @@ + + + + + + + diff --git a/fe/src/assets/img/Macrame-Logo-duo.svg b/fe/src/assets/img/Macrame-Logo-duo.svg new file mode 100644 index 0000000..41b172e --- /dev/null +++ b/fe/src/assets/img/Macrame-Logo-duo.svg @@ -0,0 +1,34 @@ + + + + + + + + + + + + + + + + + diff --git a/fe/src/assets/img/Macrame-Logo-gradient.svg b/fe/src/assets/img/Macrame-Logo-gradient.svg new file mode 100644 index 0000000..af3a5fe --- /dev/null +++ b/fe/src/assets/img/Macrame-Logo-gradient.svg @@ -0,0 +1,60 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/fe/src/assets/img/Macrame-Logo-white.svg b/fe/src/assets/img/Macrame-Logo-white.svg new file mode 100644 index 0000000..5be1bf9 --- /dev/null +++ b/fe/src/assets/img/Macrame-Logo-white.svg @@ -0,0 +1,23 @@ + + + + + + + + + diff --git a/fe/src/assets/img/bg-gradient.svg b/fe/src/assets/img/bg-gradient.svg new file mode 100644 index 0000000..889a57e --- /dev/null +++ b/fe/src/assets/img/bg-gradient.svg @@ -0,0 +1,41 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/fe/src/assets/main.css b/fe/src/assets/main.css new file mode 100644 index 0000000..538c404 --- /dev/null +++ b/fe/src/assets/main.css @@ -0,0 +1,38 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +@import './style/_content.css'; +@import './style/_form.css'; +@import './style/_scrollbar.css'; +@import './style/_macro.css'; +@import './style/_mcrm-block.css'; +@import './style/_panel.css'; + +@import 'tailwindcss'; + +@variant dark (&:where(.dark, .dark *)); + +html, +body, +:not(#panel-html__body) { + --font-sans: 'Roboto', sans-serif; + --font-mono: 'Fira Code', monospace; +} diff --git a/fe/src/assets/style/_content.css b/fe/src/assets/style/_content.css new file mode 100644 index 0000000..83c798c --- /dev/null +++ b/fe/src/assets/style/_content.css @@ -0,0 +1,68 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +body { + @apply font-sans font-light tracking-wide bg-slate-900 text-slate-50; +} + +h1, +h2 { + @apply font-mono font-bold; +} + +h3, +h4, +h5, +h6 { + @apply font-semibold; +} + +h1 { + @apply text-4xl; +} + +h2 { + @apply text-3xl; +} + +h3 { + @apply text-2xl; +} + +h4 { + @apply text-xl; +} + +h5 { + @apply text-lg; +} + +ul { + @apply list-disc list-inside; +} + +strong { + @apply font-bold; +} + +a { + @apply underline text-amber-400 hover:text-amber-300; +} diff --git a/fe/src/assets/style/_form.css b/fe/src/assets/style/_form.css new file mode 100644 index 0000000..bc4fcf8 --- /dev/null +++ b/fe/src/assets/style/_form.css @@ -0,0 +1,49 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +.input-group { + @apply grid gap-2; +} + +input, +select { + @apply w-full px-2 py-1 text-white border rounded-md border-slate-400 bg-black/20; +} + +:has(> input + span) { + @apply flex; + + input { + @apply rounded-r-none; + } + + span { + @apply flex items-center px-2 text-white rounded-r-md bg-slate-400; + } +} + +select option { + @apply bg-slate-700; + + &:not([disabled]) { + @apply cursor-pointer; + } +} diff --git a/fe/src/assets/style/_macro.css b/fe/src/assets/style/_macro.css new file mode 100644 index 0000000..4a0b2e7 --- /dev/null +++ b/fe/src/assets/style/_macro.css @@ -0,0 +1,49 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +/* @reference "main"; */ +hr.spacer { + @apply relative + w-6 + border + border-gray-300 + opacity-80 + overflow-visible; + + &::before, + &::after { + @apply content-[''] + absolute + top-1/2 + -translate-y-1/2 + size-2 + bg-gray-300 + rounded-full; + } + + &::before { + @apply -left-1; + } + + &::after { + @apply -right-1; + } +} diff --git a/fe/src/assets/style/_mcrm-block.css b/fe/src/assets/style/_mcrm-block.css new file mode 100644 index 0000000..9620206 --- /dev/null +++ b/fe/src/assets/style/_mcrm-block.css @@ -0,0 +1,123 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +.mcrm-block { + @apply relative p-6 overflow-hidden gap-x-6 gap-y-2 backdrop-blur-lg rounded-2xl; + + &::before { + @apply content-[''] + absolute + inset-0 + p-px + rounded-2xl + size-full + bg-gradient-to-br + to-transparent + z-[10] + pointer-events-none; + + mask: + linear-gradient(#000 0 0) exclude, + linear-gradient(#000 0 0) content-box; + } + + &.block__light { + @apply bg-white/20; + + &::before { + @apply from-white/20; + } + } + + &.block__dark { + @apply bg-slate-900/70; + + &::before { + @apply from-slate-400/40; + } + } + + &.block__primary { + @apply bg-sky-300/20; + + &::before { + @apply from-sky-100/20; + } + } + + &.block__secondary { + @apply bg-amber-300/20; + + &::before { + @apply from-amber-100/20; + } + } + + &.block__success { + @apply bg-emerald-300/40; + + &::before { + @apply from-emerald-100/40; + } + } + + &.block__warning { + @apply bg-orange-300/40; + + &::before { + @apply from-orange-100/40; + } + } + + &.block__danger { + @apply bg-rose-300/40; + + &::before { + @apply from-rose-100/40; + } + } + + &.block-spacing__sm, + &.block-size__sm { + @apply p-4 gap-x-4 gap-y-2; + } + + &.block-size__sm { + @apply rounded-lg; + + &::before { + @apply rounded-lg; + } + } + + &.block-spacing__lg, + &.block-size__lg { + @apply p-8 gap-x-8 gap-y-4; + } + + &.block-size__lg { + @apply rounded-3xl; + + &::before { + @apply rounded-3xl; + } + } +} diff --git a/fe/src/assets/style/_panel.css b/fe/src/assets/style/_panel.css new file mode 100644 index 0000000..a2fbe29 --- /dev/null +++ b/fe/src/assets/style/_panel.css @@ -0,0 +1,56 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +.panel { + @apply grid + grid-rows-[auto_1fr] + fixed + top-2 + left-4 sm:left-16 + right-4 sm:right-16 + bottom-2 + overflow-hidden; + + > .panel__header, + > .panel__title { + @apply px-4 py-2; + + /* &:first-child { + @apply pt-4; + } + + &:last-child { + @apply pb-4; + } */ + } + + .panel__title { + @apply pt-3 pl-16 text-transparent bg-gradient-to-r w-fit from-amber-300 to-white/50 sm:pl-4 bg-clip-text; + } + + .panel__content { + @apply grid + h-[calc(100%-1rem)] + pt-4 sm:pt-0 + pl-0 sm:pl-4 + overflow-auto; + } +} diff --git a/fe/src/assets/style/_scrollbar.css b/fe/src/assets/style/_scrollbar.css new file mode 100644 index 0000000..c228668 --- /dev/null +++ b/fe/src/assets/style/_scrollbar.css @@ -0,0 +1,44 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +::-webkit-scrollbar { + @apply w-2; +} + +::-moz-scrollbar { + @apply w-2; +} + +::-webkit-scrollbar-thumb { + @apply rounded bg-slate-400/80; +} + +::-moz-scrollbar-thumb { + @apply rounded bg-slate-400/80; +} + +::-webkit-scrollbar-track { + @apply mr-1 rounded bg-slate-100/10; +} + +::-moz-scrollbar-track { + @apply mr-1 rounded bg-slate-100/10; +} diff --git a/fe/src/components/base/AccordionComp.vue b/fe/src/components/base/AccordionComp.vue new file mode 100644 index 0000000..6aa0126 --- /dev/null +++ b/fe/src/components/base/AccordionComp.vue @@ -0,0 +1,119 @@ + + + + + + + diff --git a/fe/src/components/base/AlertComp.vue b/fe/src/components/base/AlertComp.vue new file mode 100644 index 0000000..674eb8c --- /dev/null +++ b/fe/src/components/base/AlertComp.vue @@ -0,0 +1,100 @@ + + + + + + + diff --git a/fe/src/components/base/ButtonComp.vue b/fe/src/components/base/ButtonComp.vue new file mode 100644 index 0000000..f0cc766 --- /dev/null +++ b/fe/src/components/base/ButtonComp.vue @@ -0,0 +1,189 @@ + + + + + + + diff --git a/fe/src/components/base/ButtonGroup.vue b/fe/src/components/base/ButtonGroup.vue new file mode 100644 index 0000000..9fa5c60 --- /dev/null +++ b/fe/src/components/base/ButtonGroup.vue @@ -0,0 +1,36 @@ + + + + + + + diff --git a/fe/src/components/base/ContextMenu.vue b/fe/src/components/base/ContextMenu.vue new file mode 100644 index 0000000..d74d1b2 --- /dev/null +++ b/fe/src/components/base/ContextMenu.vue @@ -0,0 +1,103 @@ + + + + + + + diff --git a/fe/src/components/base/DialogComp.vue b/fe/src/components/base/DialogComp.vue new file mode 100644 index 0000000..d2d9eaa --- /dev/null +++ b/fe/src/components/base/DialogComp.vue @@ -0,0 +1,132 @@ + + + + + + + diff --git a/fe/src/components/base/LoadComp.vue b/fe/src/components/base/LoadComp.vue new file mode 100644 index 0000000..6461a24 --- /dev/null +++ b/fe/src/components/base/LoadComp.vue @@ -0,0 +1,59 @@ + + + + + + + diff --git a/fe/src/components/base/MainMenu.vue b/fe/src/components/base/MainMenu.vue new file mode 100644 index 0000000..4b91bf4 --- /dev/null +++ b/fe/src/components/base/MainMenu.vue @@ -0,0 +1,156 @@ + + + + + + + diff --git a/fe/src/components/dashboard/RemoteView.vue b/fe/src/components/dashboard/RemoteView.vue new file mode 100644 index 0000000..42f5660 --- /dev/null +++ b/fe/src/components/dashboard/RemoteView.vue @@ -0,0 +1,107 @@ + + + + + + + diff --git a/fe/src/components/dashboard/ServerView.vue b/fe/src/components/dashboard/ServerView.vue new file mode 100644 index 0000000..0e3caee --- /dev/null +++ b/fe/src/components/dashboard/ServerView.vue @@ -0,0 +1,154 @@ + + + + + + + diff --git a/fe/src/components/devices/RemoteView.vue b/fe/src/components/devices/RemoteView.vue new file mode 100644 index 0000000..4e3405e --- /dev/null +++ b/fe/src/components/devices/RemoteView.vue @@ -0,0 +1,225 @@ + + + + + + + diff --git a/fe/src/components/devices/ServerView.vue b/fe/src/components/devices/ServerView.vue new file mode 100644 index 0000000..0a3c0b0 --- /dev/null +++ b/fe/src/components/devices/ServerView.vue @@ -0,0 +1,254 @@ + + + + + + + diff --git a/fe/src/components/form/FormSelect.vue b/fe/src/components/form/FormSelect.vue new file mode 100644 index 0000000..52a6808 --- /dev/null +++ b/fe/src/components/form/FormSelect.vue @@ -0,0 +1,176 @@ + + + + + + + diff --git a/fe/src/components/icons/IconCommunity.vue b/fe/src/components/icons/IconCommunity.vue new file mode 100644 index 0000000..2dc8b05 --- /dev/null +++ b/fe/src/components/icons/IconCommunity.vue @@ -0,0 +1,7 @@ + diff --git a/fe/src/components/icons/IconDocumentation.vue b/fe/src/components/icons/IconDocumentation.vue new file mode 100644 index 0000000..6d4791c --- /dev/null +++ b/fe/src/components/icons/IconDocumentation.vue @@ -0,0 +1,7 @@ + diff --git a/fe/src/components/icons/IconEcosystem.vue b/fe/src/components/icons/IconEcosystem.vue new file mode 100644 index 0000000..c3a4f07 --- /dev/null +++ b/fe/src/components/icons/IconEcosystem.vue @@ -0,0 +1,7 @@ + diff --git a/fe/src/components/icons/IconSupport.vue b/fe/src/components/icons/IconSupport.vue new file mode 100644 index 0000000..7452834 --- /dev/null +++ b/fe/src/components/icons/IconSupport.vue @@ -0,0 +1,7 @@ + diff --git a/fe/src/components/icons/IconTooling.vue b/fe/src/components/icons/IconTooling.vue new file mode 100644 index 0000000..660598d --- /dev/null +++ b/fe/src/components/icons/IconTooling.vue @@ -0,0 +1,19 @@ + + diff --git a/fe/src/components/macros/MacroOverview.vue b/fe/src/components/macros/MacroOverview.vue new file mode 100644 index 0000000..ef71ed0 --- /dev/null +++ b/fe/src/components/macros/MacroOverview.vue @@ -0,0 +1,164 @@ + + + + + + + diff --git a/fe/src/components/macros/MacroRecorder.vue b/fe/src/components/macros/MacroRecorder.vue new file mode 100644 index 0000000..03e92cc --- /dev/null +++ b/fe/src/components/macros/MacroRecorder.vue @@ -0,0 +1,106 @@ + + + + + + + diff --git a/fe/src/components/macros/components/DelaySpan.vue b/fe/src/components/macros/components/DelaySpan.vue new file mode 100644 index 0000000..ef20255 --- /dev/null +++ b/fe/src/components/macros/components/DelaySpan.vue @@ -0,0 +1,78 @@ + + + + + + + diff --git a/fe/src/components/macros/components/DeleteKeyDialog.vue b/fe/src/components/macros/components/DeleteKeyDialog.vue new file mode 100644 index 0000000..c3418aa --- /dev/null +++ b/fe/src/components/macros/components/DeleteKeyDialog.vue @@ -0,0 +1,56 @@ + + + + + + + +' diff --git a/fe/src/components/macros/components/EditDelayDialog.vue b/fe/src/components/macros/components/EditDelayDialog.vue new file mode 100644 index 0000000..7877764 --- /dev/null +++ b/fe/src/components/macros/components/EditDelayDialog.vue @@ -0,0 +1,77 @@ + + + + + + + diff --git a/fe/src/components/macros/components/EditKeyDialog.vue b/fe/src/components/macros/components/EditKeyDialog.vue new file mode 100644 index 0000000..f7c1fac --- /dev/null +++ b/fe/src/components/macros/components/EditKeyDialog.vue @@ -0,0 +1,124 @@ + + + + + + + diff --git a/fe/src/components/macros/components/FixedDelayMenu.vue b/fe/src/components/macros/components/FixedDelayMenu.vue new file mode 100644 index 0000000..b123d16 --- /dev/null +++ b/fe/src/components/macros/components/FixedDelayMenu.vue @@ -0,0 +1,90 @@ + + + + + + + diff --git a/fe/src/components/macros/components/InsertKeyDialog.vue b/fe/src/components/macros/components/InsertKeyDialog.vue new file mode 100644 index 0000000..450263b --- /dev/null +++ b/fe/src/components/macros/components/InsertKeyDialog.vue @@ -0,0 +1,155 @@ + + + + + + + diff --git a/fe/src/components/macros/components/MacroKey.vue b/fe/src/components/macros/components/MacroKey.vue new file mode 100644 index 0000000..c258945 --- /dev/null +++ b/fe/src/components/macros/components/MacroKey.vue @@ -0,0 +1,130 @@ + + + + + + + diff --git a/fe/src/components/macros/components/ValidationErrorDialog.vue b/fe/src/components/macros/components/ValidationErrorDialog.vue new file mode 100644 index 0000000..55cbc10 --- /dev/null +++ b/fe/src/components/macros/components/ValidationErrorDialog.vue @@ -0,0 +1,80 @@ + + + + + + + diff --git a/fe/src/components/macros/parts/EditDialogs.vue b/fe/src/components/macros/parts/EditDialogs.vue new file mode 100644 index 0000000..d11c1d8 --- /dev/null +++ b/fe/src/components/macros/parts/EditDialogs.vue @@ -0,0 +1,142 @@ + + + + + + + diff --git a/fe/src/components/macros/parts/RecorderFooter.vue b/fe/src/components/macros/parts/RecorderFooter.vue new file mode 100644 index 0000000..a5d1b63 --- /dev/null +++ b/fe/src/components/macros/parts/RecorderFooter.vue @@ -0,0 +1,111 @@ + + + + + + + diff --git a/fe/src/components/macros/parts/RecorderHeader.vue b/fe/src/components/macros/parts/RecorderHeader.vue new file mode 100644 index 0000000..6258746 --- /dev/null +++ b/fe/src/components/macros/parts/RecorderHeader.vue @@ -0,0 +1,124 @@ + + + + + + + diff --git a/fe/src/components/macros/parts/RecorderInput.vue b/fe/src/components/macros/parts/RecorderInput.vue new file mode 100644 index 0000000..994acc6 --- /dev/null +++ b/fe/src/components/macros/parts/RecorderInput.vue @@ -0,0 +1,66 @@ + + + + + + + diff --git a/fe/src/components/macros/parts/RecorderOutput.vue b/fe/src/components/macros/parts/RecorderOutput.vue new file mode 100644 index 0000000..fb6612c --- /dev/null +++ b/fe/src/components/macros/parts/RecorderOutput.vue @@ -0,0 +1,79 @@ + + + + + + + diff --git a/fe/src/components/panels/PanelEdit.vue b/fe/src/components/panels/PanelEdit.vue new file mode 100644 index 0000000..43cd833 --- /dev/null +++ b/fe/src/components/panels/PanelEdit.vue @@ -0,0 +1,253 @@ + + + + + + + diff --git a/fe/src/components/panels/PanelView.vue b/fe/src/components/panels/PanelView.vue new file mode 100644 index 0000000..28a1b82 --- /dev/null +++ b/fe/src/components/panels/PanelView.vue @@ -0,0 +1,103 @@ + + + + + + + diff --git a/fe/src/components/panels/PanelsOverview.vue b/fe/src/components/panels/PanelsOverview.vue new file mode 100644 index 0000000..047b696 --- /dev/null +++ b/fe/src/components/panels/PanelsOverview.vue @@ -0,0 +1,183 @@ + + + + + + + diff --git a/fe/src/main.js b/fe/src/main.js new file mode 100644 index 0000000..2c0d3cc --- /dev/null +++ b/fe/src/main.js @@ -0,0 +1,37 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +// import './assets/jemx.scss' +import '@/assets/main.css' +import '@/assets/img/Macrame-Logo-gradient.svg' + +import { createApp } from 'vue' +import { createPinia } from 'pinia' + +import App from '@/App.vue' +import router from '@/router' + +const app = createApp(App) + +app.use(createPinia()) +app.use(router) + +app.mount('#app') diff --git a/fe/src/router/index.js b/fe/src/router/index.js new file mode 100644 index 0000000..83cabea --- /dev/null +++ b/fe/src/router/index.js @@ -0,0 +1,87 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +import { createRouter, createWebHistory } from 'vue-router' +import DashboardView from '../views/DashboardView.vue' +import { checkAuth, isLocal } from '@/services/ApiService' + +const router = createRouter({ + history: createWebHistory(import.meta.env.BASE_URL), + routes: [ + { + path: '/', + name: 'dashboard', + component: DashboardView, + }, + { + path: '/panels', + name: 'panels', + component: () => import('../views/PanelsView.vue'), + meta: { requiresAuth: true }, + }, + { + path: '/panel/edit/:dirname', + name: 'panel-edit', + component: () => import('../views/PanelsView.vue'), + meta: { requiresAuth: true }, + }, + { + path: '/panel/view/:dirname', + name: 'panel-view', + component: () => import('../views/PanelsView.vue'), + meta: { requiresAuth: true }, + }, + { + path: '/macros', + name: 'macros', + component: () => import('../views/MacrosView.vue'), + meta: { localOnly: true }, + }, + { + path: '/devices', + name: 'devices', + component: () => import('../views/DevicesView.vue'), + }, + // { + // path: '/settings', + // name: 'settings', + // component: () => import('../views/SettingsView.vue'), + // }, + // { + // path: '/about', + // name: 'about', + // // route level code-splitting + // // this generates a separate chunk (About.[hash].js) for this route + // // which is lazy-loaded when the route is visited. + // component: () => import('../views/AboutView.vue'), + // }, + ], +}) + +router.beforeEach(async (to, from, next) => { + const auth = await checkAuth() + + if (to.meta.requiresAuth && !auth && !isLocal()) next('/devices') + else if (to.meta.localOnly && !isLocal()) next('/') + else next() +}) + +export default router diff --git a/fe/src/services/ApiService.js b/fe/src/services/ApiService.js new file mode 100644 index 0000000..2652497 --- /dev/null +++ b/fe/src/services/ApiService.js @@ -0,0 +1,55 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +import { useDeviceStore } from '@/stores/device' +import CryptoJS from 'crypto-js' + +export const appUrl = () => { + const port = window.location.port == 5173 ? window.__CONFIG__.MCRM__PORT : window.location.port + + return `http://${window.location.hostname}:${port}` +} + +export const isLocal = () => { + return window.location.hostname === '127.0.0.1' || window.location.hostname === 'localhost' +} + +export const encrypt = (data, key = false) => { + const pk = !key ? localStorage.getItem('Macrame__pk') : key + + if (pk) { + return CryptoJS.RSA.encrypt(JSON.stringify(data), pk).toString() + } else { + return false + } +} + +export const checkAuth = async () => { + const device = useDeviceStore() + + const handshake = await device.remoteHandshake() + + if (handshake === true) return true + + if (device.key()) return true + + return false +} diff --git a/fe/src/services/EncryptService.js b/fe/src/services/EncryptService.js new file mode 100644 index 0000000..102182e --- /dev/null +++ b/fe/src/services/EncryptService.js @@ -0,0 +1,77 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +import { useDeviceStore } from '@/stores/device' +import { AES, enc, pad } from 'crypto-js' +import { isLocal } from './ApiService' + +export const encryptAES = (key, str) => { + key = keyPad(key) + + let iv = enc.Utf8.parse(window.__CONFIG__.MCRM__IV) + let encrypted = AES.encrypt(str, key, { + iv: iv, + padding: pad.Pkcs7, + }) + return encrypted.toString() +} + +export const decryptAES = (key, str) => { + key = keyPad(key) + + let iv = enc.Utf8.parse(window.__CONFIG__.MCRM__IV) + let encrypted = AES.decrypt(str.toString(), key, { + iv: iv, + padding: pad.Pkcs7, + }) + return encrypted.toString(enc.Utf8) +} + +export const AuthCall = (data = false) => { + if (isLocal()) return data + + if (!data) data = {empty: true} + + const device = useDeviceStore() + + return { + uuid: device.uuid(), + d: encryptAES(device.key(), JSON.stringify(data)), + } +} + +function keyPad(key) { + let returnKey = key + + if (key.length == 4) { + returnKey = key + window.__CONFIG__.MCRM__SALT + } + + return enc.Utf8.parse(returnKey) +} + +export const getDateStr = () => { + const date = new Date() + const year = date.getFullYear() + const month = String(date.getMonth() + 1).padStart(2, '0') + const day = String(date.getDate()).padStart(2, '0') + return `${year}${month}${day}` +} diff --git a/fe/src/services/MacroRecordService.js b/fe/src/services/MacroRecordService.js new file mode 100644 index 0000000..9fd61fd --- /dev/null +++ b/fe/src/services/MacroRecordService.js @@ -0,0 +1,192 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +const keyMap = { + // Modifier keys + Control: 'Ctrl', + Shift: 'Shift', + Alt: 'Alt', + Meta: 'Win', + CapsLock: 'Caps', + // Special keys + PageUp: 'PgUp', + PageDown: 'PgDn', + ScrollLock: 'Scr Lk', + Insert: 'Ins', + Delete: 'Del', + Escape: 'Esc', + Space: 'Space', + // Symbol keys + Backquote: '`', + Backslash: '\\', + BracketLeft: '[', + BracketRight: ']', + Comma: ',', + Equal: '=', + Minus: '-', + Period: '.', + Quote: "'", + Semicolon: ';', + Slash: '/', + // Arrow keys + ArrowUp: '▲', + ArrowRight: '▶', + ArrowDown: '▼', + ArrowLeft: '◀', + // Media keys + MediaPlayPause: 'Play', + MediaStop: 'Stop', + MediaTrackNext: 'Next', + MediaTrackPrevious: 'Prev', + MediaVolumeDown: 'Down', + MediaVolumeUp: 'Up', + AudioVolumeMute: 'Mute', + AudioVolumeDown: 'Down', + AudioVolumeUp: 'Up', +} + +/** + * Filters a keyboard event and returns an object with two properties: + * loc (optional) and str. + * loc is the location of the key (either 'left', 'right', or 'num'). + * str is the string representation of the key (e.g. 'a', 'A', 'Enter', etc.). + * If the key is a modifier key, it is represented by its name (e.g. 'Ctrl', 'Shift', etc.). + * If the key is not a modifier key, it is represented by its character (e.g. 'a', 'A', etc.). + * If the key is not a character key, it is represented by its symbol (e.g. ',', '.', etc.). + * @param {KeyboardEvent} e - The keyboard event to filter. + * @return {Object} An object with two properties: loc (optional) and str. + */ +export const filterKey = (e) => { + const k = {} // Object k (key) + + // If location is set, set loc (location) + if (e.location === 1) k.loc = 'left' + if (e.location === 2) k.loc = 'right' + if (e.location === 3) k.loc = 'num' + + if (e.key.includes('Media') || e.key.includes('Audio')) k.loc = mediaPrefix(e) + + // If code is in keyMap, set str by code + if (keyMap[e.code] || keyMap[e.key]) { + k.str = keyMap[e.code] || keyMap[e.key] + } else { + // If code is not in keyMap, set str by e.key + k.str = e.key.toLowerCase() + } + + // return k object + return k +} + +/** + * Returns a string prefix for the given media key. + * @param {KeyboardEvent} e - The keyboard event to get the prefix for. + * @return {string} The prefix for the key (either 'Media' or 'Volume'). + */ +const mediaPrefix = (e) => { + switch (e.key) { + case 'MediaPlayPause': + case 'MediaStop': + case 'MediaTrackNext': + case 'MediaTrackPrevious': + return 'Media' + case 'MediaVolumeDown': + case 'MediaVolumeUp': + case 'AudioVolumeDown': + case 'AudioVolumeUp': + case 'AudioVolumeMute': + return 'Volume' + } +} + +export const isRepeat = (lastStep, e, direction) => { + return ( + lastStep && + lastStep.type === 'key' && + lastStep.code === e.code && + lastStep.direction === direction + ) +} + +export const invalidMacro = (steps) => { + const downKeys = [] + const upKeys = [] + + Object.keys(steps).forEach((stepKey) => { + const step = steps[stepKey] + + if (step.type !== 'key') return + + if (step.direction == 'down') downKeys.push(step.key) + if (step.direction == 'up') { + if (!downKeys.includes(step.key)) upKeys.push(step.key) + else downKeys.splice(downKeys.indexOf(step.key), 1) + } + }) + + if (upKeys.length === 0 && downKeys.length === 0) return false + + return { down: downKeys, up: upKeys } +} + +export const translateJSON = (json) => { + const steps = [] + + json.forEach((step) => { + if (step.type === 'delay') steps.push(step) + if (step.type === 'key') steps.push(codeToStep(step.code, step.direction)) + }) + + return steps +} + +export const codeToStep = (code, direction) => { + let key = '' + let location = 0 + let codeStr = code + + if (code.includes('Left')) { + key = code.replace('Left', '') + location = 1 + } + if (code.includes('Right')) { + key = code.replace('Right', '') + location = 2 + } + if (code.includes('Numpad')) { + key = code.replace('Numpad', '') + location = 3 + } + + if (code.includes('Media')) codeStr = '' + + if (key === '') key = code + + const stepObj = { + type: 'key', + code: codeStr, + key: key, + location: location, + direction: direction, + } + + return { ...stepObj, keyObj: filterKey(stepObj) } +} diff --git a/fe/src/services/MacroService.js b/fe/src/services/MacroService.js new file mode 100644 index 0000000..c6cf8b2 --- /dev/null +++ b/fe/src/services/MacroService.js @@ -0,0 +1,47 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +import axios from 'axios' +import { appUrl, isLocal } from './ApiService' +import { AuthCall } from './EncryptService' + +export const GetMacroList = async (count = false) => { + const request = await axios.post(appUrl() + '/macro/list') + + if (!request.data) return 0 + + if (!count) return sortMacroList(request.data) + else return request.data.length +} + +const sortMacroList = (list) => { + return [...list].sort((a, b) => a.name.localeCompare(b.name)) +} + +export const RunMacro = async (macro) => { + const data = isLocal() ? { macro: macro } : AuthCall({ macro: macro }) + const request = await axios.post(appUrl() + '/macro/play', data) + return request.data +} + +export const CheckMacroListChange = (oldList, newList) => { + return oldList !== JSON.stringify(newList) +} diff --git a/fe/src/services/PanelService.js b/fe/src/services/PanelService.js new file mode 100644 index 0000000..0f78dab --- /dev/null +++ b/fe/src/services/PanelService.js @@ -0,0 +1,120 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +export const SetPanelStyle = (styleStr) => { + const styleEl = document.createElement('style') + styleEl.setAttribute('custom_panel_style', true) + styleEl.innerHTML = styleStr + document.head.appendChild(styleEl) +} + +export const RemovePanelStyle = () => { + const styleEl = document.querySelector('style[custom_panel_style]') + if (styleEl) { + styleEl.remove() + } +} + +export const StripPanelHTML = (html, aspectRatio) => { + const parser = new DOMParser() + const doc = parser.parseFromString(html, 'text/html') + let scripts = [] + + if (doc.querySelectorAll('script').length > 0) { + const stripped = StripPanelScripts(doc) + doc.body = stripped.body + scripts = stripped.scripts + } + + const body = doc.body + const bodyContents = body.innerHTML + + const panelBody = document.createElement('div') + panelBody.id = 'panel-html__body' + panelBody.style = `aspect-ratio: ${aspectRatio}` + panelBody.innerHTML = bodyContents + + if (scripts.length > 0) { + SetPanelScripts(scripts) + } + + return panelBody.outerHTML +} + +export const StripPanelScripts = (doc) => { + const scriptEls = doc.querySelectorAll('script') + const scripts = [] + + scriptEls.forEach((script) => { + if (script.getAttribute('no-compile') != '') scripts.push(script.innerHTML) + script.remove() + }) + + return { body: doc.body, scripts } +} + +export const SetPanelScripts = (scripts) => { + scripts.forEach((script) => { + const scriptEl = document.createElement('script') + scriptEl.setAttribute('custom_panel_script', true) + scriptEl.innerHTML = script + document.body.appendChild(scriptEl) + }) +} + +export const RemovePanelScripts = () => { + const scripts = document.querySelectorAll('script[custom_panel_script]') + scripts.forEach((script) => { + script.remove() + }) +} + +export const PanelButtonListeners = (panelEl, callback) => { + panelEl.querySelectorAll('[mcrm__button]').forEach((button) => { + button.addEventListener('click', () => { + callback(button) + }) + }) +} + +export const PanelDialogListeners = (panelEl) => { + panelEl.querySelectorAll('[mcrm__dialog-trigger]').forEach((dialogTrigger) => { + const dialogEl = document.querySelector(dialogTrigger.getAttribute('dialog-trigger')) + + if (dialogEl) { + dialogTrigger.addEventListener('click', () => { + dialogEl.show() + }) + } + }) + + document.querySelectorAll('dialog, dialog .dialog__close').forEach((dialogClose) => { + dialogClose.addEventListener('click', (e) => { + if ( + e.target.classList.contains('dialog__close') || + e.target.closest('.dialog__close') || + e.target.tagName == 'DIALOG' + ) { + dialogClose.closest('dialog').close() + } + }) + }) +} diff --git a/fe/src/services/RobotKeys.md b/fe/src/services/RobotKeys.md new file mode 100644 index 0000000..58f82de --- /dev/null +++ b/fe/src/services/RobotKeys.md @@ -0,0 +1,117 @@ + "A-Z a-z 0-9" + + "backspace" + "delete" + "enter" + "tab" + "esc" + "escape" + "up" Up arrow key + "down" Down arrow key + "right" Right arrow key + "left" Left arrow key + "home" + "end" + "pageup" + "pagedown" + + "f1" + "f2" + "f3" + "f4" + "f5" + "f6" + "f7" + "f8" + "f9" + "f10" + "f11" + "f12" + "f13" + "f14" + "f15" + "f16" + "f17" + "f18" + "f19" + "f20" + "f21" + "f22" + "f23" + "f24" + + "cmd" is the "win" key for windows + "lcmd" left command + "rcmd" right command + // "command" + "alt" + "lalt" left alt + "ralt" right alt + "ctrl" + "lctrl" left ctrl + "rctrl" right ctrl + "control" + "shift" + "lshift" left shift + "rshift" right shift + // "right_shift" + "capslock" + "space" + "print" + "printscreen" // No Mac support + "insert" + "menu" Windows only + + "audio_mute" Mute the volume + "audio_vol_down" Lower the volume + "audio_vol_up" Increase the volume + "audio_play" + "audio_stop" + "audio_pause" + "audio_prev" Previous Track + "audio_next" Next Track + "audio_rewind" Linux only + "audio_forward" Linux only + "audio_repeat" Linux only + "audio_random" Linux only + + + "num0" + "num1" + "num2" + "num3" + "num4" + "num5" + "num6" + "num7" + "num8" + "num9" + "num_lock" + + "num." + "num+" + "num-" + "num*" + "num/" + "num_clear" + "num_enter" + "num_equal" + + // // "numpad_0" No Linux support + // "numpad_0" + // "numpad_1" + // "numpad_2" + // "numpad_3" + // "numpad_4" + // "numpad_5" + // "numpad_6" + // "numpad_7" + // "numpad_8" + // "numpad_9" + // "numpad_lock" + + "lights_mon_up" Turn up monitor brightness No Windows support + "lights_mon_down" Turn down monitor brightness No Windows support + "lights_kbd_toggle" Toggle keyboard backlight on/off No Windows support + "lights_kbd_up" Turn up keyboard backlight brightness No Windows support + "lights_kbd_down" Turn down keyboard backlight brightness No Windows support diff --git a/fe/src/stores/counter.js b/fe/src/stores/counter.js new file mode 100644 index 0000000..52bf0c6 --- /dev/null +++ b/fe/src/stores/counter.js @@ -0,0 +1,33 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +import { ref, computed } from 'vue' +import { defineStore } from 'pinia' + +export const useCounterStore = defineStore('counter', () => { + const count = ref(0) + const doubleCount = computed(() => count.value * 2) + function increment() { + count.value++ + } + + return { count, doubleCount, increment } +}) diff --git a/fe/src/stores/device.js b/fe/src/stores/device.js new file mode 100644 index 0000000..bbf319a --- /dev/null +++ b/fe/src/stores/device.js @@ -0,0 +1,153 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +import { ref } from 'vue' +import { defineStore } from 'pinia' +import axios from 'axios' +import { appUrl, encrypt } from '@/services/ApiService' +import { v4 as uuidv4 } from 'uuid' +import { encryptAES, getDateStr } from '@/services/EncryptService' + +export const useDeviceStore = defineStore('device', () => { + // Properties - State values + const current = ref({ + uuid: false, + key: false, + }) + + const remote = ref([]) + const server = ref({ + status: false, + }) + + // Current device + const uuid = () => { + if (!current.value.uuid && localStorage.getItem('deviceId')) { + current.value.uuid = localStorage.getItem('deviceId') + } else if (!current.value.uuid) { + current.value.uuid = setDeviceId() + } + return current.value.uuid + } + + const setDeviceId = () => { + const uuid = uuidv4() + localStorage.setItem('deviceId', uuid) + return uuid + } + + const key = () => { + if (!current.value.key && localStorage.getItem('deviceKey')) { + current.value.key = localStorage.getItem('deviceKey') + } + return current.value.key + } + + const setDeviceKey = (key) => { + current.value.key = key + localStorage.setItem('deviceKey', key) + } + + const removeDeviceKey = () => { + current.value.key = false + localStorage.removeItem('deviceKey') + } + + const serverGetIP = async () => { + const request = await axios.post(appUrl() + '/device/server/ip') + return `http://${request.data}:${window.__CONFIG__.MCRM__PORT}` + } + + // Server application + const serverGetRemotes = async (count = false) => { + const request = await axios.post(appUrl() + '/device/list') + + if (!request.data.devices) return false + + remote.value = request.data.devices + + if (!count) return remote.value + else return Object.keys(remote.value).length + } + + const serverStartLink = async (deviceUuid) => { + const request = await axios.post(appUrl() + '/device/link/start', { uuid: deviceUuid }) + return request.data + } + + // Remote application + const remoteCheckServerAccess = async () => { + const check = await axios.post(appUrl() + '/device/access/check', { uuid: uuid() }) + server.value.access = check.data + return check.data + } + + const remoteRequestServerAccess = async (deviceName, deviceType) => { + const request = await axios.post(appUrl() + '/device/access/request', { + uuid: uuid(), + name: deviceName, + type: deviceType, + }) + return request + } + const remotePingLink = async (cb) => { + const pingInterval = setInterval(() => { + axios.post(appUrl() + '/device/link/ping', { uuid: uuid() }).then((data) => { + if (data.data) { + clearInterval(pingInterval) + cb(data.data) + } + }) + }, 1000) + } + + const remoteHandshake = async (keyStr = false) => { + if (!keyStr) keyStr = key() + + if (!keyStr) return false + + const handshake = await axios.post(appUrl() + '/device/handshake', { + uuid: uuid(), + shake: encryptAES(keyStr, getDateStr()), + }) + + if (!handshake.data) removeDeviceKey() + + return handshake.data + } + + return { + remote, + server, + uuid, + setDeviceId, + key, + setDeviceKey, + removeDeviceKey, + serverGetIP, + serverGetRemotes, + serverStartLink, + remoteCheckServerAccess, + remoteRequestServerAccess, + remotePingLink, + remoteHandshake, + } +}) diff --git a/fe/src/stores/macrorecorder.js b/fe/src/stores/macrorecorder.js new file mode 100644 index 0000000..29cee6b --- /dev/null +++ b/fe/src/stores/macrorecorder.js @@ -0,0 +1,260 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +import { ref } from 'vue' +import { defineStore } from 'pinia' + +import { filterKey, isRepeat, invalidMacro, translateJSON } from '../services/MacroRecordService' +import axios from 'axios' +import { appUrl } from '@/services/ApiService' + +export const useMacroRecorderStore = defineStore('macrorecorder', () => { + // Properties - State values + const state = ref({ + record: false, + edit: false, + editKey: false, + editDelay: false, + validationErrors: false, + }) + + const macroName = ref('') + + const steps = ref([]) + + const delay = ref({ + start: 0, + fixed: false, + }) + + // Getters - Computed values + const getEditKey = () => steps.value[state.value.editKey] + const getAdjacentKey = (pos, includeDelay = false) => { + let returnVal = false + + const mod = pos == 'before' ? -1 : 1 + const keyIndex = state.value.editKey + 2 * mod + const delayIndex = includeDelay ? state.value.editKey + 1 * mod : false + + if (steps.value[keyIndex]) returnVal = steps.value[keyIndex] + if (delayIndex && steps.value[delayIndex]) + returnVal = { + delay: steps.value[delayIndex], + key: steps.value[keyIndex], + delayIndex: delayIndex, + } + + return returnVal + } + + const getEditDelay = () => steps.value[state.value.editDelay] + + // Setters - Actions + const recordStep = (e, direction = false, key = false) => { + if ((e.ctrlKey, e.shiftKey, e.altKey, e.metaKey)) e.preventDefault() + + const lastStep = steps.value[steps.value.length - 1] + + let stepVal = {} + + if (typeof e === 'object' && !isRepeat(lastStep, e, direction)) { + if (key === false) recordDelay() + + stepVal = { + type: 'key', + key: e.key, + code: e.code, + location: e.location, + direction: direction, + keyObj: filterKey(e), + } + } else if (direction && key !== false) { + stepVal = steps.value[key] + stepVal.direction = direction + } else if (typeof e === 'number') { + stepVal = { type: 'delay', value: parseFloat(e.toFixed()) } + } + + if (key !== false) steps.value[key] = stepVal + else steps.value.push(stepVal) + } + + const recordDelay = () => { + if (delay.value.fixed !== false) + recordStep(delay.value.fixed) // Record fixed delay + else if (delay.value.start == 0) + delay.value.start = performance.now() // Record start of delay + else { + recordStep(performance.now() - delay.value.start) // Record end of delay + delay.value.start = performance.now() // Reset start + } + } + + const insertKey = (e, direction, adjacentDelayIndex) => { + let min, max, newKeyIndex, newDelayIndex + + if (adjacentDelayIndex === null) { + min = state.value.editKey == 0 ? 0 : state.value.editKey + max = state.value.editKey == 0 ? 1 : false + + newKeyIndex = max === false ? min + 2 : min + newDelayIndex = min + 1 + } else if (state.value.editKey < adjacentDelayIndex) { + min = state.value.editKey + max = adjacentDelayIndex + newKeyIndex = min + 2 + newDelayIndex = min + 1 + } else { + min = adjacentDelayIndex + max = state.value.editKey + newKeyIndex = min + 1 + newDelayIndex = min + 2 + } + + if (max !== false) { + for (let i = Object.keys(steps.value).length - 1; i >= max; i--) { + steps.value[i + 2] = steps.value[i] + } + } + + recordStep(e, direction, newKeyIndex) + recordStep(10, false, newDelayIndex) + + state.value.editKey = false + } + + const deleteEditKey = () => { + if (state.value.editKey === 0) steps.value.splice(state.value.editKey, 2) + else steps.value.splice(state.value.editKey - 1, 2) + state.value.editKey = false + } + + const restartDelay = () => { + delay.value.start = performance.now() + } + + const changeName = (name) => { + macroName.value = name + } + + const changeDelay = (fixed) => { + delay.value.fixed = fixed + + formatDelays() + } + + const formatDelays = () => { + steps.value = steps.value.map((step) => { + if (step.type === 'delay' && delay.value.fixed !== false) step.value = delay.value.fixed + return step + }) + } + + const toggleEdit = (type, key) => { + if (type === 'key') { + state.value.editKey = key + state.value.editDelay = false + } + + if (type === 'delay') { + state.value.editKey = false + state.value.editDelay = key + } + } + + const resetEdit = () => { + state.value.edit = false + state.value.editKey = false + state.value.editDelay = false + } + + const resetMacro = () => { + state.value.record = false + delay.value.start = 0 + macroName.value = '' + steps.value = [] + + if (state.value.edit) resetEdit() + } + + const checkMacro = async () => { + const resp = await axios.post(appUrl() + '/macro/check', { + macro: macroName.value, + }) + + return resp.data + } + + const saveMacro = async () => { + state.value.validationErrors = invalidMacro(steps.value) + + if (state.value.validationErrors) return false + + const resp = await axios.post(appUrl() + '/macro/record', { + name: macroName.value, + steps: steps.value, + }) + + return resp.status == 200 + } + + const deleteMacro = async (macroFilename) => { + const resp = await axios.post(appUrl() + '/macro/delete', { + macro: macroFilename, + }) + + if (resp.status == 200) return resp.data + else return false + } + + const openMacro = async (macroFileName, name) => { + const openResp = await axios.post(appUrl() + '/macro/open', { + macro: macroFileName, + }) + + if (openResp.data) steps.value = translateJSON(openResp.data) + + macroName.value = name + } + + return { + state, + macroName, + steps, + delay, + getEditKey, + getAdjacentKey, + getEditDelay, + recordStep, + insertKey, + deleteEditKey, + restartDelay, + changeName, + changeDelay, + toggleEdit, + resetEdit, + resetMacro, + checkMacro, + saveMacro, + deleteMacro, + openMacro, + } +}) diff --git a/fe/src/stores/panel.js b/fe/src/stores/panel.js new file mode 100644 index 0000000..9cfca54 --- /dev/null +++ b/fe/src/stores/panel.js @@ -0,0 +1,82 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +import { appUrl } from '@/services/ApiService' +import { AuthCall } from '@/services/EncryptService' +import axios from 'axios' +import { defineStore } from 'pinia' +import { ref } from 'vue' + +export const usePanelStore = defineStore('panel', () => { + const current = ref({ + dir: false, + name: false, + description: false, + aspectRatio: false, + macros: false, + thumb: false, + html: false, + style: false, + }) + + const list = ref([]) + + const get = async (dir) => { + const data = AuthCall({ dir: dir }) + + const resp = await axios.post(appUrl() + '/panel/get', data) + + if (!resp.data && !current.value.html) return false + + current.value.name = resp.data.name + current.value.description = resp.data.description + current.value.aspectRatio = resp.data.aspectRatio + current.value.macros = resp.data.macros + current.value.thumb = resp.data.thumb + current.value.html = resp.data.html + current.value.style = resp.data.style + + return current.value + } + + const getList = async (count = false) => { + if (list.value.length > 0 && !count) return list.value + else if (list.value.length > 0 && count) return list.value.length + + const data = AuthCall() + + const resp = await axios.post(appUrl() + '/panel/list', data) + list.value = resp.data + + if (!resp.data && !count) return false + else if (!resp.data && count) return 0 + + if (!count) return list.value + else return list.value.length + } + + return { + current, + list, + get, + getList, + } +}) diff --git a/fe/src/views/DashboardView.vue b/fe/src/views/DashboardView.vue new file mode 100644 index 0000000..2b614cc --- /dev/null +++ b/fe/src/views/DashboardView.vue @@ -0,0 +1,105 @@ + + + + + + + diff --git a/fe/src/views/DevicesView.vue b/fe/src/views/DevicesView.vue new file mode 100644 index 0000000..9e77279 --- /dev/null +++ b/fe/src/views/DevicesView.vue @@ -0,0 +1,42 @@ + + + + + + + diff --git a/fe/src/views/HomeView.vue b/fe/src/views/HomeView.vue new file mode 100644 index 0000000..c304a7a --- /dev/null +++ b/fe/src/views/HomeView.vue @@ -0,0 +1,7 @@ + + + + + diff --git a/fe/src/views/MacrosView.vue b/fe/src/views/MacrosView.vue new file mode 100644 index 0000000..11394ae --- /dev/null +++ b/fe/src/views/MacrosView.vue @@ -0,0 +1,48 @@ + + + + + + + diff --git a/fe/src/views/PanelsView.vue b/fe/src/views/PanelsView.vue new file mode 100644 index 0000000..b96e96f --- /dev/null +++ b/fe/src/views/PanelsView.vue @@ -0,0 +1,82 @@ + + + + + + + diff --git a/fe/src/views/SettingsView.vue b/fe/src/views/SettingsView.vue new file mode 100644 index 0000000..00094e7 --- /dev/null +++ b/fe/src/views/SettingsView.vue @@ -0,0 +1,28 @@ + + + + + + + diff --git a/fe/vite.config.js b/fe/vite.config.js new file mode 100644 index 0000000..6c382bd --- /dev/null +++ b/fe/vite.config.js @@ -0,0 +1,31 @@ +import { fileURLToPath, URL } from 'node:url' + +import { defineConfig } from 'vite' +import vue from '@vitejs/plugin-vue' +import vueDevTools from 'vite-plugin-vue-devtools' +import tailwindcss from '@tailwindcss/vite' + +// https://vite.dev/config/ +export default defineConfig({ + server: { + host: 'localhost', + port: 5173, + watch: { + usePolling: true, + }, + }, + plugins: [vue(), vueDevTools(), tailwindcss()], + envDir: '../', + assets: ['assets'], + resolve: { + alias: { + '@': fileURLToPath(new URL('./src', import.meta.url)), + }, + }, + base: '/', + build: { + outDir: '../public', + sourcemap: true, + minify: true, + }, +}) diff --git a/go.mod b/go.mod new file mode 100644 index 0000000..369a50c --- /dev/null +++ b/go.mod @@ -0,0 +1,46 @@ +module macrame + +go 1.24.1 + +require ( + github.com/getlantern/systray v1.2.2 + github.com/go-vgo/robotgo v0.110.7 +) + +require ( + github.com/dblohm7/wingoes v0.0.0-20240820181039-f2b84150679e // indirect + github.com/ebitengine/purego v0.8.2 // indirect + github.com/gen2brain/shm v0.1.1 // indirect + github.com/getlantern/context v0.0.0-20190109183933-c447772a6520 // indirect + github.com/getlantern/errors v0.0.0-20190325191628-abdb3e3e36f7 // indirect + github.com/getlantern/golog v0.0.0-20190830074920-4ef2e798c2d7 // indirect + github.com/getlantern/hex v0.0.0-20190417191902-c6586a6fe0b7 // indirect + github.com/getlantern/hidden v0.0.0-20190325191715-f02dbb02be55 // indirect + github.com/getlantern/ops v0.0.0-20190325191751-d70cb0d6f85f // indirect + github.com/go-ole/go-ole v1.3.0 // indirect + github.com/go-stack/stack v1.8.0 // indirect + github.com/godbus/dbus/v5 v5.1.0 // indirect + github.com/jezek/xgb v1.1.1 // indirect + github.com/kbinani/screenshot v0.0.0-20250118074034-a3924b7bbc8c // indirect + github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683 // indirect + github.com/lxn/win v0.0.0-20210218163916-a377121e959e // indirect + github.com/otiai10/gosseract v2.2.1+incompatible // indirect + github.com/otiai10/mint v1.6.3 // indirect + github.com/oxtoacart/bpool v0.0.0-20190530202638-03653db5a59c // indirect + github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55 // indirect + github.com/robotn/xgb v0.10.0 // indirect + github.com/robotn/xgbutil v0.10.0 // indirect + github.com/shirou/gopsutil/v4 v4.25.1 // indirect + github.com/tailscale/win v0.0.0-20250213223159-5992cb43ca35 // indirect + github.com/tklauser/go-sysconf v0.3.14 // indirect + github.com/tklauser/numcpus v0.9.0 // indirect + github.com/vcaesar/gops v0.40.0 // indirect + github.com/vcaesar/imgo v0.40.2 // indirect + github.com/vcaesar/keycode v0.10.1 // indirect + github.com/vcaesar/tt v0.20.1 // indirect + github.com/yusufpapurcu/wmi v1.2.4 // indirect + golang.org/x/exp v0.0.0-20250215185904-eff6e970281f // indirect + golang.org/x/image v0.24.0 // indirect + golang.org/x/net v0.39.0 // indirect + golang.org/x/sys v0.32.0 // indirect +) diff --git a/go.sum b/go.sum new file mode 100644 index 0000000..eca718f --- /dev/null +++ b/go.sum @@ -0,0 +1,102 @@ +github.com/BurntSushi/freetype-go v0.0.0-20160129220410-b763ddbfe298/go.mod h1:D+QujdIlUNfa0igpNMk6UIvlb6C252URs4yupRUV4lQ= +github.com/BurntSushi/graphics-go v0.0.0-20160129215708-b43f31a4a966/go.mod h1:Mid70uvE93zn9wgF92A/r5ixgnvX8Lh68fxp9KQBaI0= +github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= +github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= +github.com/dblohm7/wingoes v0.0.0-20240820181039-f2b84150679e h1:L+XrFvD0vBIBm+Wf9sFN6aU395t7JROoai0qXZraA4U= +github.com/dblohm7/wingoes v0.0.0-20240820181039-f2b84150679e/go.mod h1:SUxUaAK/0UG5lYyZR1L1nC4AaYYvSSYTWQSH3FPcxKU= +github.com/ebitengine/purego v0.8.2 h1:jPPGWs2sZ1UgOSgD2bClL0MJIqu58nOmIcBuXr62z1I= +github.com/ebitengine/purego v0.8.2/go.mod h1:iIjxzd6CiRiOG0UyXP+V1+jWqUXVjPKLAI0mRfJZTmQ= +github.com/gen2brain/shm v0.1.1 h1:1cTVA5qcsUFixnDHl14TmRoxgfWEEZlTezpUj1vm5uQ= +github.com/gen2brain/shm v0.1.1/go.mod h1:UgIcVtvmOu+aCJpqJX7GOtiN7X2ct+TKLg4RTxwPIUA= +github.com/getlantern/context v0.0.0-20190109183933-c447772a6520 h1:NRUJuo3v3WGC/g5YiyF790gut6oQr5f3FBI88Wv0dx4= +github.com/getlantern/context v0.0.0-20190109183933-c447772a6520/go.mod h1:L+mq6/vvYHKjCX2oez0CgEAJmbq1fbb/oNJIWQkBybY= +github.com/getlantern/errors v0.0.0-20190325191628-abdb3e3e36f7 h1:6uJ+sZ/e03gkbqZ0kUG6mfKoqDb4XMAzMIwlajq19So= +github.com/getlantern/errors v0.0.0-20190325191628-abdb3e3e36f7/go.mod h1:l+xpFBrCtDLpK9qNjxs+cHU6+BAdlBaxHqikB6Lku3A= +github.com/getlantern/golog v0.0.0-20190830074920-4ef2e798c2d7 h1:guBYzEaLz0Vfc/jv0czrr2z7qyzTOGC9hiQ0VC+hKjk= +github.com/getlantern/golog v0.0.0-20190830074920-4ef2e798c2d7/go.mod h1:zx/1xUUeYPy3Pcmet8OSXLbF47l+3y6hIPpyLWoR9oc= +github.com/getlantern/hex v0.0.0-20190417191902-c6586a6fe0b7 h1:micT5vkcr9tOVk1FiH8SWKID8ultN44Z+yzd2y/Vyb0= +github.com/getlantern/hex v0.0.0-20190417191902-c6586a6fe0b7/go.mod h1:dD3CgOrwlzca8ed61CsZouQS5h5jIzkK9ZWrTcf0s+o= +github.com/getlantern/hidden v0.0.0-20190325191715-f02dbb02be55 h1:XYzSdCbkzOC0FDNrgJqGRo8PCMFOBFL9py72DRs7bmc= +github.com/getlantern/hidden v0.0.0-20190325191715-f02dbb02be55/go.mod h1:6mmzY2kW1TOOrVy+r41Za2MxXM+hhqTtY3oBKd2AgFA= +github.com/getlantern/ops v0.0.0-20190325191751-d70cb0d6f85f h1:wrYrQttPS8FHIRSlsrcuKazukx/xqO/PpLZzZXsF+EA= +github.com/getlantern/ops v0.0.0-20190325191751-d70cb0d6f85f/go.mod h1:D5ao98qkA6pxftxoqzibIBBrLSUli+kYnJqrgBf9cIA= +github.com/getlantern/systray v1.2.2 h1:dCEHtfmvkJG7HZ8lS/sLklTH4RKUcIsKrAD9sThoEBE= +github.com/getlantern/systray v1.2.2/go.mod h1:pXFOI1wwqwYXEhLPm9ZGjS2u/vVELeIgNMY5HvhHhcE= +github.com/go-ole/go-ole v1.2.6/go.mod h1:pprOEPIfldk/42T2oK7lQ4v4JSDwmV0As9GaiUsvbm0= +github.com/go-ole/go-ole v1.3.0 h1:Dt6ye7+vXGIKZ7Xtk4s6/xVdGDQynvom7xCFEdWr6uE= +github.com/go-ole/go-ole v1.3.0/go.mod h1:5LS6F96DhAwUc7C+1HLexzMXY1xGRSryjyPPKW6zv78= +github.com/go-stack/stack v1.8.0 h1:5SgMzNM5HxrEjV0ww2lTmX6E2Izsfxas4+YHWRs3Lsk= +github.com/go-stack/stack v1.8.0/go.mod h1:v0f6uXyyMGvRgIKkXu+yp6POWl0qKG85gN/melR3HDY= +github.com/go-vgo/robotgo v0.110.7 h1:4scqQrJOBHoFCfcMROYEVFBxHvB3nF/UN6DWoRIFzBE= +github.com/go-vgo/robotgo v0.110.7/go.mod h1:eBUjTHY1HYjzdi1+UWJUbxB+b9gE+l4Ei7vQU/9SnLw= +github.com/godbus/dbus/v5 v5.1.0 h1:4KLkAxT3aOY8Li4FRJe/KvhoNFFxo0m6fNuFUO8QJUk= +github.com/godbus/dbus/v5 v5.1.0/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= +github.com/google/go-cmp v0.6.0 h1:ofyhxvXcZhMsU5ulbFiLKl/XBFqE1GSq7atu8tAmTRI= +github.com/google/go-cmp v0.6.0/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= +github.com/jezek/xgb v1.1.1 h1:bE/r8ZZtSv7l9gk6nU0mYx51aXrvnyb44892TwSaqS4= +github.com/jezek/xgb v1.1.1/go.mod h1:nrhwO0FX/enq75I7Y7G8iN1ubpSGZEiA3v9e9GyRFlk= +github.com/kbinani/screenshot v0.0.0-20250118074034-a3924b7bbc8c h1:1IlzDla/ZATV/FsRn1ETf7ir91PHS2mrd4VMunEtd9k= +github.com/kbinani/screenshot v0.0.0-20250118074034-a3924b7bbc8c/go.mod h1:Pmpz2BLf55auQZ67u3rvyI2vAQvNetkK/4zYUmpauZQ= +github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683 h1:7UMa6KCCMjZEMDtTVdcGu0B1GmmC7QJKiCCjyTAWQy0= +github.com/lufia/plan9stats v0.0.0-20240909124753-873cd0166683/go.mod h1:ilwx/Dta8jXAgpFYFvSWEMwxmbWXyiUHkd5FwyKhb5k= +github.com/lxn/walk v0.0.0-20210112085537-c389da54e794/go.mod h1:E23UucZGqpuUANJooIbHWCufXvOcT6E7Stq81gU+CSQ= +github.com/lxn/win v0.0.0-20210218163916-a377121e959e h1:H+t6A/QJMbhCSEH5rAuRxh+CtW96g0Or0Fxa9IKr4uc= +github.com/lxn/win v0.0.0-20210218163916-a377121e959e/go.mod h1:KxxjdtRkfNoYDCUP5ryK7XJJNTnpC8atvtmTheChOtk= +github.com/nfnt/resize v0.0.0-20180221191011-83c6a9932646 h1:zYyBkD/k9seD2A7fsi6Oo2LfFZAehjjQMERAvZLEDnQ= +github.com/nfnt/resize v0.0.0-20180221191011-83c6a9932646/go.mod h1:jpp1/29i3P1S/RLdc7JQKbRpFeM1dOBd8T9ki5s+AY8= +github.com/otiai10/gosseract v2.2.1+incompatible h1:Ry5ltVdpdp4LAa2bMjsSJH34XHVOV7XMi41HtzL8X2I= +github.com/otiai10/gosseract v2.2.1+incompatible/go.mod h1:XrzWItCzCpFRZ35n3YtVTgq5bLAhFIkascoRo8G32QE= +github.com/otiai10/mint v1.6.3 h1:87qsV/aw1F5as1eH1zS/yqHY85ANKVMgkDrf9rcxbQs= +github.com/otiai10/mint v1.6.3/go.mod h1:MJm72SBthJjz8qhefc4z1PYEieWmy8Bku7CjcAqyUSM= +github.com/oxtoacart/bpool v0.0.0-20190530202638-03653db5a59c h1:rp5dCmg/yLR3mgFuSOe4oEnDDmGLROTvMragMUXpTQw= +github.com/oxtoacart/bpool v0.0.0-20190530202638-03653db5a59c/go.mod h1:X07ZCGwUbLaax7L0S3Tw4hpejzu63ZrrQiUe6W0hcy0= +github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= +github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= +github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55 h1:o4JXh1EVt9k/+g42oCprj/FisM4qX9L3sZB3upGN2ZU= +github.com/power-devops/perfstat v0.0.0-20240221224432-82ca36839d55/go.mod h1:OmDBASR4679mdNQnz2pUhc2G8CO2JrUAVFDRBDP/hJE= +github.com/robotn/xgb v0.0.0-20190912153532-2cb92d044934/go.mod h1:SxQhJskUJ4rleVU44YvnrdvxQr0tKy5SRSigBrCgyyQ= +github.com/robotn/xgb v0.10.0 h1:O3kFbIwtwZ3pgLbp1h5slCQ4OpY8BdwugJLrUe6GPIM= +github.com/robotn/xgb v0.10.0/go.mod h1:SxQhJskUJ4rleVU44YvnrdvxQr0tKy5SRSigBrCgyyQ= +github.com/robotn/xgbutil v0.10.0 h1:gvf7mGQqCWQ68aHRtCxgdewRk+/KAJui6l3MJQQRCKw= +github.com/robotn/xgbutil v0.10.0/go.mod h1:svkDXUDQjUiWzLrA0OZgHc4lbOts3C+uRfP6/yjwYnU= +github.com/shirou/gopsutil/v4 v4.25.1 h1:QSWkTc+fu9LTAWfkZwZ6j8MSUk4A2LV7rbH0ZqmLjXs= +github.com/shirou/gopsutil/v4 v4.25.1/go.mod h1:RoUCUpndaJFtT+2zsZzzmhvbfGoDCJ7nFXKJf8GqJbI= +github.com/skratchdot/open-golang v0.0.0-20200116055534-eef842397966/go.mod h1:sUM3LWHvSMaG192sy56D9F7CNvL7jUJVXoqM1QKLnog= +github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= +github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= +github.com/stretchr/testify v1.10.0 h1:Xv5erBjTwe/5IxqUQTdXv5kgmIvbHo3QQyRwhJsOfJA= +github.com/stretchr/testify v1.10.0/go.mod h1:r2ic/lqez/lEtzL7wO/rwa5dbSLXVDPFyf8C91i36aY= +github.com/tailscale/win v0.0.0-20250213223159-5992cb43ca35 h1:wAZbkTZkqDzWsqxPh2qkBd3KvFU7tcxV0BP0Rnhkxog= +github.com/tailscale/win v0.0.0-20250213223159-5992cb43ca35/go.mod h1:aMd4yDHLjbOuYP6fMxj1d9ACDQlSWwYztcpybGHCQc8= +github.com/tc-hib/winres v0.2.1 h1:YDE0FiP0VmtRaDn7+aaChp1KiF4owBiJa5l964l5ujA= +github.com/tc-hib/winres v0.2.1/go.mod h1:C/JaNhH3KBvhNKVbvdlDWkbMDO9H4fKKDaN7/07SSuk= +github.com/tklauser/go-sysconf v0.3.14 h1:g5vzr9iPFFz24v2KZXs/pvpvh8/V9Fw6vQK5ZZb78yU= +github.com/tklauser/go-sysconf v0.3.14/go.mod h1:1ym4lWMLUOhuBOPGtRcJm7tEGX4SCYNEEEtghGG/8uY= +github.com/tklauser/numcpus v0.9.0 h1:lmyCHtANi8aRUgkckBgoDk1nHCux3n2cgkJLXdQGPDo= +github.com/tklauser/numcpus v0.9.0/go.mod h1:SN6Nq1O3VychhC1npsWostA+oW+VOQTxZrS604NSRyI= +github.com/vcaesar/gops v0.40.0 h1:I+1RCGiV+LkZJUYNzAd373xs0uM2UyeFdZBmow8HfCM= +github.com/vcaesar/gops v0.40.0/go.mod h1:3u/USW7JovqUK6i13VOD3qWfvXXd2TIIKE4PYIv4TOM= +github.com/vcaesar/imgo v0.40.2 h1:5GWScRLdBCMtO1v2I1bs+ZmDLZFINxYSMZ+mtUw5qPM= +github.com/vcaesar/imgo v0.40.2/go.mod h1:MVCl+FxHI2gTgmiHoi0n5xNCbYcfv9SVtdEOUC92+eo= +github.com/vcaesar/keycode v0.10.1 h1:0DesGmMAPWpYTCYddOFiCMKCDKgNnwiQa2QXindVUHw= +github.com/vcaesar/keycode v0.10.1/go.mod h1:JNlY7xbKsh+LAGfY2j4M3znVrGEm5W1R8s/Uv6BJcfQ= +github.com/vcaesar/tt v0.20.1 h1:D/jUeeVCNbq3ad8M7hhtB3J9x5RZ6I1n1eZ0BJp7M+4= +github.com/vcaesar/tt v0.20.1/go.mod h1:cH2+AwGAJm19Wa6xvEa+0r+sXDJBT0QgNQey6mwqLeU= +github.com/yusufpapurcu/wmi v1.2.4 h1:zFUKzehAFReQwLys1b/iSMl+JQGSCSjtVqQn9bBrPo0= +github.com/yusufpapurcu/wmi v1.2.4/go.mod h1:SBZ9tNy3G9/m5Oi98Zks0QjeHVDvuK0qfxQmPyzfmi0= +golang.org/x/exp v0.0.0-20250215185904-eff6e970281f h1:oFMYAjX0867ZD2jcNiLBrI9BdpmEkvPyi5YrBGXbamg= +golang.org/x/exp v0.0.0-20250215185904-eff6e970281f/go.mod h1:BHOTPb3L19zxehTsLoJXVaTktb06DFgmdW6Wb9s8jqk= +golang.org/x/image v0.24.0 h1:AN7zRgVsbvmTfNyqIbbOraYL8mSwcKncEj8ofjgzcMQ= +golang.org/x/image v0.24.0/go.mod h1:4b/ITuLfqYq1hqZcjofwctIhi7sZh2WaCjvsBNjjya8= +golang.org/x/net v0.39.0 h1:ZCu7HMWDxpXpaiKdhzIfaltL9Lp31x/3fCP11bc6/fY= +golang.org/x/net v0.39.0/go.mod h1:X7NRbYVEA+ewNkCNyJ513WmMdQ3BineSwVtN2zD/d+E= +golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201018230417-eeed37f84f13/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.0.0-20201204225414-ed752295db88/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= +golang.org/x/sys v0.1.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= +golang.org/x/sys v0.32.0 h1:s77OFDvIQeibCmezSnk/q6iAfkdiQaJi4VzroCFrN20= +golang.org/x/sys v0.32.0/go.mod h1:BJP2sWEmIv4KK5OTEluFJCKSidICx8ciO85XgH3Ak8k= +gopkg.in/Knetic/govaluate.v3 v3.0.0/go.mod h1:csKLBORsPbafmSCGTEh3U7Ozmsuq8ZSIlKk1bcqph0E= +gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA= +gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= diff --git a/macros/TEST-Close_Application.json b/macros/TEST-Close_Application.json deleted file mode 100644 index c481f1b..0000000 --- a/macros/TEST-Close_Application.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lalt", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "f4", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lalt", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "f4", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Close_Browser_Window.json b/macros/TEST-Close_Browser_Window.json deleted file mode 100644 index 63cb228..0000000 --- a/macros/TEST-Close_Browser_Window.json +++ /dev/null @@ -1,13 +0,0 @@ -[ - { "code": "lctrl", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lshift", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "w", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lctrl", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lshift", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "w", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Close_Tab.json b/macros/TEST-Close_Tab.json deleted file mode 100644 index 577aa88..0000000 --- a/macros/TEST-Close_Tab.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lctrl", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "w", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lctrl", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "w", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Displays.json b/macros/TEST-Displays.json deleted file mode 100644 index 80ba168..0000000 --- a/macros/TEST-Displays.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lcmd", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "p", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lcmd", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "p", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Files.json b/macros/TEST-Files.json deleted file mode 100644 index be664ab..0000000 --- a/macros/TEST-Files.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lcmd", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "e", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lcmd", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "e", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Fullscreen.json b/macros/TEST-Fullscreen.json deleted file mode 100644 index 16aa578..0000000 --- a/macros/TEST-Fullscreen.json +++ /dev/null @@ -1 +0,0 @@ -[{"code":"f11","direction":"down","type":"key"},{"type":"delay","value":15},{"code":"f11","direction":"up","type":"key"}] \ No newline at end of file diff --git a/macros/TEST-Home.json b/macros/TEST-Home.json deleted file mode 100644 index 4782647..0000000 --- a/macros/TEST-Home.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lalt", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "home", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "home", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lalt", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-New_Desktop.json b/macros/TEST-New_Desktop.json deleted file mode 100644 index 9ade4e0..0000000 --- a/macros/TEST-New_Desktop.json +++ /dev/null @@ -1,13 +0,0 @@ -[ - { "code": "lcmd", "direction": "down", "type": "key" }, - { "type": "delay", "value": 50 }, - { "code": "lctrl", "direction": "down", "type": "key" }, - { "type": "delay", "value": 50 }, - { "code": "d", "direction": "down", "type": "key" }, - { "type": "delay", "value": 50 }, - { "code": "lcmd", "direction": "up", "type": "key" }, - { "type": "delay", "value": 50 }, - { "code": "lctrl", "direction": "up", "type": "key" }, - { "type": "delay", "value": 50 }, - { "code": "d", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-New_Tab.json b/macros/TEST-New_Tab.json deleted file mode 100644 index f62acf0..0000000 --- a/macros/TEST-New_Tab.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lctrl", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "t", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lctrl", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "t", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-New_Window.json b/macros/TEST-New_Window.json deleted file mode 100644 index 8880f54..0000000 --- a/macros/TEST-New_Window.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lctrl", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "n", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lctrl", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "n", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Next_Tab.json b/macros/TEST-Next_Tab.json deleted file mode 100644 index 1ee9641..0000000 --- a/macros/TEST-Next_Tab.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lctrl", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "tab", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lctrl", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "tab", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-PlayPause.json b/macros/TEST-PlayPause.json deleted file mode 100644 index 5471bd1..0000000 --- a/macros/TEST-PlayPause.json +++ /dev/null @@ -1 +0,0 @@ -[{"code":"audio_play|audio_pause","direction":"down","type":"key"},{"type":"delay","value":15},{"code":"audio_play|audio_pause","direction":"up","type":"key"}] \ No newline at end of file diff --git a/macros/TEST-Previous_Tab.json b/macros/TEST-Previous_Tab.json deleted file mode 100644 index 57dfb44..0000000 --- a/macros/TEST-Previous_Tab.json +++ /dev/null @@ -1,13 +0,0 @@ -[ - { "code": "lctrl", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lshift", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "tab", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lctrl", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lshift", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "tab", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-RunDialog.json b/macros/TEST-RunDialog.json deleted file mode 100644 index 4b73502..0000000 --- a/macros/TEST-RunDialog.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lcmd", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "r", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lcmd", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "r", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Settings.json b/macros/TEST-Settings.json deleted file mode 100644 index fdc8f80..0000000 --- a/macros/TEST-Settings.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lcmd", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "i", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lcmd", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "i", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Task_manager.json b/macros/TEST-Task_manager.json deleted file mode 100644 index 732e5df..0000000 --- a/macros/TEST-Task_manager.json +++ /dev/null @@ -1,13 +0,0 @@ -[ - { "code": "lctrl", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lshift", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "esc", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "esc", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lshift", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lctrl", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-Task_view.json b/macros/TEST-Task_view.json deleted file mode 100644 index 65901ec..0000000 --- a/macros/TEST-Task_view.json +++ /dev/null @@ -1,9 +0,0 @@ -[ - { "code": "lcmd", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "tab", "direction": "down", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "lcmd", "direction": "up", "type": "key" }, - { "type": "delay", "value": 15 }, - { "code": "tab", "direction": "up", "type": "key" } -] diff --git a/macros/TEST-desktop.json b/macros/desktop.json similarity index 100% rename from macros/TEST-desktop.json rename to macros/desktop.json diff --git a/macros/task_manager.json b/macros/task_manager.json new file mode 100644 index 0000000..194fbc4 --- /dev/null +++ b/macros/task_manager.json @@ -0,0 +1 @@ +[{"type":"key","key":"Control","code":"ControlLeft","location":1,"direction":"down","value":0},{"type":"delay","key":"","code":"","location":0,"direction":"","value":15},{"type":"key","key":"Shift","code":"ShiftLeft","location":1,"direction":"down","value":0},{"type":"delay","key":"","code":"","location":0,"direction":"","value":15},{"type":"key","key":"Escape","code":"Escape","location":0,"direction":"down","value":0},{"type":"delay","key":"","code":"","location":0,"direction":"","value":15},{"type":"key","key":"Escape","code":"Escape","location":0,"direction":"up","value":0},{"type":"delay","key":"","code":"","location":0,"direction":"","value":15},{"type":"key","key":"Shift","code":"ShiftLeft","location":1,"direction":"up","value":0},{"type":"delay","key":"","code":"","location":0,"direction":"","value":15},{"type":"key","key":"Control","code":"ControlLeft","location":1,"direction":"up","value":0}] \ No newline at end of file diff --git a/main.go b/main.go new file mode 100644 index 0000000..fcbdd69 --- /dev/null +++ b/main.go @@ -0,0 +1,73 @@ +/* +Macrame is a program that enables the user to create keyboard macros and button panels. +The macros are saved as simple JSON files and can be linked to the button panels. The panels can +be created with HTML and CSS. + +Copyright (C) 2025 Jesse Malotaux + +This program is free software: you can redistribute it and/or modify +it under the terms of the GNU General Public License as published by +the Free Software Foundation, either version 3 of the License, or +(at your option) any later version. + +This program is distributed in the hope that it will be useful, +but WITHOUT ANY WARRANTY; without even the implied warranty of +MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +GNU General Public License for more details. + +You should have received a copy of the GNU General Public License +along with this program. If not, see . +*/ + +package main + +import ( + "log" + "net/http" + "os" + + "macrame/app" + "macrame/app/helper" +) + +func main() { + app.MCRMLogInit() + + switchDir() + + if helper.EnvGet("MCRM__PORT") == "" { + app.MCRMLog("Error: MCRM__PORT is not set") + } + + http.HandleFunc("/", func(w http.ResponseWriter, r *http.Request) { + apiInit(w, r) + }) + + helper.OpenBrowser("http://localhost:" + helper.EnvGet("MCRM__PORT")) + + app.MCRMLog("Listening on http://localhost:" + helper.EnvGet("MCRM__PORT")) + + app.InitSystray() + + app.MCRMLog(http.ListenAndServe(":"+helper.EnvGet("MCRM__PORT"), nil)) +} + +func switchDir() { + cwd, err := os.Getwd() + + if err != nil { + log.Fatal(err) + } + + log.Println(cwd) +} + +func apiInit(w http.ResponseWriter, r *http.Request) { + app.ApiCORS(w, r) + + if r.Method == "GET" { + app.ApiGet(w, r) + } else if r.Method == "POST" { + app.ApiPost(w, r) + } +} diff --git a/panels/Elite_Dangerous/index.html b/panels/Elite_Dangerous/index.html new file mode 100644 index 0000000..2d230d9 --- /dev/null +++ b/panels/Elite_Dangerous/index.html @@ -0,0 +1,913 @@ + + + + + + Document + + + +
+
+ + +
+

Maps

+
+
+ + + + + + + + + + + + + System +
+
+ + + + Galaxy +
+
+
+ +
+

Frame Shift Drive

+ +
+ Toggle FSD +
+ +
+
+ Super Cruise +
+
+ Hyper Space +
+
+
+ +
+
+

Mode

+ Analysis +
+
+
+
+
+ Combat +
+
+

Hardpoints

+ Retract +
+
+
+
+
+ Deploy +
+
+
+
+
+

Panels

+
+
+ External +
+
+ Comms +
+
+ Roles +
+
+ Internal +
+
+
+
+
+

Scanner

+
+
+ FSS +
+
+ Discovery +
+
+
+
+
+ Route: + Next System +
+
+
+
+ Speed: + 0% +
+
+
+
+

Fighters

+
+
+
+
+ + + + + Attack +
+
+ + + + + + + + + + + + + Engage +
+
+
+
+ + + + + + Defend +
+
+ + + + + + + + + + + + + + + + + Hold +
+
+
+
+ + + + + + + Follow +
+
+ + + + Recall +
+
+
+ +
+
+
+ Wingman + #1 +
+
+ Wingman + #2 +
+
+ Wingman + #3 +
+
+
+
+
+ +
+

Counter Measures

+
+
+ Heatsink +
+
+ Chaff +
+
+ ECM +
+
+ Shieldcell +
+
+
+
+ +
+
+

Flight Assist

+
+
+
+
+
+
+
+
+ Off + On +
+
+
+ Rotational Correction +
+
+
+ +
+
+

Lights

+
+
+
+
+
+
+ Off + On +
+
+
+

Night Vis.

+
+
+
+
+
+
+ Off + On +
+
+
+
+
+

Silent Running

+
+
+
+
+
+
+ Off + On +
+
+
+
+ + + + + JETTISON CARGO +
+
+
+ +
+
+ + + + + + + + + + + CAMERA +
+ +
+
+ + + + + +
+

Camera

+
+
+ + + + + + + Camera Suite +
+ +
+
+ + + + + +
+ + Previous + + Camera +
+
+
+
+ + Next + + Camera +
+ + + + + +
+
+
+ + + + + + + + + + + + Free Camera +
+
+
+ Position + #1 +
+
+ Position + #2 +
+
+
+
+ +
+
+
+
+ +
+
+
+
+ + + + diff --git a/panels/Elite_Dangerous/input.css b/panels/Elite_Dangerous/input.css new file mode 100644 index 0000000..6056744 --- /dev/null +++ b/panels/Elite_Dangerous/input.css @@ -0,0 +1,253 @@ +@import url(https://fonts.bunny.net/css?family=orbitron:400,600,800); +@layer theme, utilities; +@import "tailwindcss/theme.css" layer(theme); +@import "tailwindcss/utilities.css" layer(utilities); + +@layer theme { + /* :root { + } */ +} + +html, +body, +#panel-html__body { + @apply relative; +} + +#panel-html__body { + --font-sans: "Orbitron", sans-serif; + @apply font-sans text-sm font-light tracking-wide bg-gray-900 text-slate-50 size-full; + + * { + box-sizing: border-box; + } +} + +.group-left, +.group-middle, +.group-right { + @apply grid gap-2 h-fit; +} + +.ed-panel { + @apply w-full p-2 border h-fit rounded-b-xl; + + h3, + h4 { + @apply m-0 mb-1 font-extralight; + } + + h3 { + @apply text-base; + } + + h4 { + @apply text-sm; + } + + &.pnl__blue { + @apply border-sky-300 bg-sky-500/30; + + h3, + h4 { + @apply text-sky-100; + + text-shadow: 0 0 0.2em var(--color-sky-300); + } + } + + &.pnl__yellow { + @apply border-amber-300 bg-amber-500/30; + + h3, + h4 { + @apply text-amber-100; + + text-shadow: 0 0 0.2em var(--color-amber-300); + } + } + + &.pnl__orange { + @apply border-orange-300 bg-orange-500/30; + + h3, + h4 { + @apply text-orange-100; + + text-shadow: 0 0 0.2em var(--color-orange-300); + } + } + + &.pnl__red { + @apply border-rose-300 bg-rose-500/30; + + h3, + h4 { + @apply text-rose-100; + + text-shadow: 0 0 0.2em var(--color-rose-400); + } + } + + &.pnl__white { + @apply border-white bg-white/20; + + h3, + h4 { + @apply text-white; + + text-shadow: 0 0 0.2em var(--color-white); + } + } +} + +.ed-button { + @apply flex items-center justify-center px-4 py-2 text-base text-center rounded-lg border-3; + + svg { + @apply block !size-5; + } + + &.btn__vertical { + @apply flex-col; + } + + &.btn__filled { + @apply text-gray-900; + } + + &.btn__orange { + @apply text-orange-100 border-orange-400 bg-orange-500/50; + + &.btn__filled { + @apply bg-orange-400; + } + } + + &.btn__yellow { + @apply text-orange-100 border-amber-400 bg-amber-500/50; + + &.btn__filled { + @apply bg-amber-400; + } + } + + &.btn__blue { + @apply border-sky-400 bg-sky-500/50 text-sky-100; + + &.btn__filled { + @apply bg-sky-500; + } + } + + &.btn__red { + @apply border-rose-500 bg-rose-600/50 text-rose-100; + + &.btn__filled { + @apply bg-rose-600; + } + } + + &.btn__white { + @apply border-white bg-white/30; + + &.btn__filled { + @apply bg-white; + } + } +} + +.ed-button-group__horizontal { + @apply grid divide-x; + + .ed-button { + @apply rounded-none; + + &:first-child { + @apply rounded-l-lg; + } + + &:last-child { + @apply rounded-r-lg; + } + } +} + +.ed-button-group__vertical { + @apply grid divide-y; + + .ed-button { + @apply rounded-none; + + &:first-child { + @apply rounded-t-lg; + } + + &:last-child { + @apply rounded-b-lg; + } + } +} + +.ed-toggle { + .toggle__wrapper { + @apply relative p-1.5 border-2 rounded-full size-full; + } + + .toggle__indicator { + @apply absolute transition rounded-full aspect-square; + } + + &.toggle__horizontal { + @apply w-20 h-12; + + .toggle__indicator { + @apply left-1.5 translate-x-0 h-[calc(100%-.75rem)]; + } + + &[active] .toggle__indicator { + @apply translate-x-full; + } + } + + &.toggle__vertical { + @apply w-12 h-20; + + .toggle__indicator { + @apply top-1.5 translate-y-0 w-[calc(100%-.75rem)]; + } + &[active] .toggle__indicator { + @apply translate-y-full; + } + } +} + +dialog[open] { + @apply absolute -translate-x-1/2 -translate-y-1/2 bg-transparent border-0 outline-0 top-1/2 left-1/2; + @apply backdrop:absolute backdrop:bg-black/50; + + .dialog__close { + @apply absolute text-white top-3 right-3; + } +} + +#clock { + @apply relative flex pr-16 text-3xl w-fit; + + i { + @apply pl-1 not-italic; + } + + .hours-minutes, + .seconds { + @apply flex gap-1; + } + + span { + @apply inline-block w-[.75em] text-center; + } + + sup { + @apply absolute right-0 w-16 pl-2 text-lg text-left opacity-80; + } +} diff --git a/panels/Elite_Dangerous/output.css b/panels/Elite_Dangerous/output.css new file mode 100644 index 0000000..4446c1f --- /dev/null +++ b/panels/Elite_Dangerous/output.css @@ -0,0 +1,688 @@ +/*! tailwindcss v4.1.4 | MIT License | https://tailwindcss.com */ +@import url(https://fonts.bunny.net/css?family=orbitron:400,600,800); +@layer properties; +@layer theme, utilities; +@layer theme { + :root, :host { + --font-sans: ui-sans-serif, system-ui, sans-serif, 'Apple Color Emoji', 'Segoe UI Emoji', 'Segoe UI Symbol', + 'Noto Color Emoji'; + --color-red-400: oklch(70.4% 0.191 22.216); + --color-red-500: oklch(63.7% 0.237 25.331); + --color-red-600: oklch(57.7% 0.245 27.325); + --color-orange-100: oklch(95.4% 0.038 75.164); + --color-orange-300: oklch(83.7% 0.128 66.29); + --color-orange-400: oklch(75% 0.183 55.934); + --color-orange-500: oklch(70.5% 0.213 47.604); + --color-amber-100: oklch(96.2% 0.059 95.617); + --color-amber-300: oklch(87.9% 0.169 91.605); + --color-amber-400: oklch(82.8% 0.189 84.429); + --color-amber-500: oklch(76.9% 0.188 70.08); + --color-lime-400: oklch(84.1% 0.238 128.85); + --color-lime-600: oklch(64.8% 0.2 131.684); + --color-sky-100: oklch(95.1% 0.026 236.824); + --color-sky-300: oklch(82.8% 0.111 230.318); + --color-sky-400: oklch(74.6% 0.16 232.661); + --color-sky-500: oklch(68.5% 0.169 237.323); + --color-sky-600: oklch(58.8% 0.158 241.966); + --color-sky-900: oklch(39.1% 0.09 240.876); + --color-rose-100: oklch(94.1% 0.03 12.58); + --color-rose-300: oklch(81% 0.117 11.638); + --color-rose-400: oklch(71.2% 0.194 13.428); + --color-rose-500: oklch(64.5% 0.246 16.439); + --color-rose-600: oklch(58.6% 0.253 17.585); + --color-slate-50: oklch(98.4% 0.003 247.858); + --color-slate-950: oklch(12.9% 0.042 264.695); + --color-gray-800: oklch(27.8% 0.033 256.848); + --color-gray-900: oklch(21% 0.034 264.665); + --color-black: #000; + --color-white: #fff; + --spacing: 0.25rem; + --text-xs: 0.75rem; + --text-xs--line-height: calc(1 / 0.75); + --text-sm: 0.875rem; + --text-sm--line-height: calc(1.25 / 0.875); + --text-base: 1rem; + --text-base--line-height: calc(1.5 / 1); + --text-lg: 1.125rem; + --text-lg--line-height: calc(1.75 / 1.125); + --text-3xl: 1.875rem; + --text-3xl--line-height: calc(2.25 / 1.875); + --font-weight-extralight: 200; + --font-weight-light: 300; + --tracking-wide: 0.025em; + --radius-lg: 0.5rem; + --radius-xl: 0.75rem; + --default-transition-duration: 150ms; + --default-transition-timing-function: cubic-bezier(0.4, 0, 0.2, 1); + } +} +@layer utilities { + .absolute { + position: absolute; + } + .relative { + position: relative; + } + .inset-0 { + inset: calc(var(--spacing) * 0); + } + .right-0 { + right: calc(var(--spacing) * 0); + } + .bottom-full { + bottom: 100%; + } + .m-0 { + margin: calc(var(--spacing) * 0); + } + .mt-4 { + margin-top: calc(var(--spacing) * 4); + } + .flex { + display: flex; + } + .grid { + display: grid; + } + .aspect-square { + aspect-ratio: 1 / 1; + } + .size-8 { + width: calc(var(--spacing) * 8); + height: calc(var(--spacing) * 8); + } + .size-16 { + width: calc(var(--spacing) * 16); + height: calc(var(--spacing) * 16); + } + .size-full { + width: 100%; + height: 100%; + } + .h-28 { + height: calc(var(--spacing) * 28); + } + .h-full { + height: 100%; + } + .\!w-fit { + width: fit-content !important; + } + .w-28 { + width: calc(var(--spacing) * 28); + } + .w-fit { + width: fit-content; + } + .w-full { + width: 100%; + } + .grid-cols-2 { + grid-template-columns: repeat(2, minmax(0, 1fr)); + } + .grid-cols-4 { + grid-template-columns: repeat(4, minmax(0, 1fr)); + } + .grid-cols-\[1fr_2fr\] { + grid-template-columns: 1fr 2fr; + } + .grid-cols-\[1fr_2fr_1fr\] { + grid-template-columns: 1fr 2fr 1fr; + } + .grid-cols-\[2fr_1fr\] { + grid-template-columns: 2fr 1fr; + } + .grid-cols-\[3fr_1fr_1fr\] { + grid-template-columns: 3fr 1fr 1fr; + } + .grid-rows-3 { + grid-template-rows: repeat(3, minmax(0, 1fr)); + } + .flex-col { + flex-direction: column; + } + .items-center { + align-items: center; + } + .items-end { + align-items: flex-end; + } + .\!justify-start { + justify-content: flex-start !important; + } + .justify-between { + justify-content: space-between; + } + .justify-center { + justify-content: center; + } + .justify-end { + justify-content: flex-end; + } + .justify-items-center { + justify-items: center; + } + .gap-2 { + gap: calc(var(--spacing) * 2); + } + .divide-x { + :where(& > :not(:last-child)) { + --tw-divide-x-reverse: 0; + border-inline-style: var(--tw-border-style); + border-inline-start-width: calc(1px * var(--tw-divide-x-reverse)); + border-inline-end-width: calc(1px * calc(1 - var(--tw-divide-x-reverse))); + } + } + .rounded-full { + border-radius: calc(infinity * 1px); + } + .\!rounded-tl-none { + border-top-left-radius: 0 !important; + } + .\!rounded-tr-none { + border-top-right-radius: 0 !important; + } + .\!rounded-b-none { + border-bottom-right-radius: 0 !important; + border-bottom-left-radius: 0 !important; + } + .border-3 { + border-style: var(--tw-border-style); + border-width: 3px; + } + .border-lime-600 { + border-color: var(--color-lime-600); + } + .border-red-500 { + border-color: var(--color-red-500); + } + .border-red-600 { + border-color: var(--color-red-600); + } + .border-sky-600 { + border-color: var(--color-sky-600); + } + .border-white { + border-color: var(--color-white); + } + .\!bg-sky-900 { + background-color: var(--color-sky-900) !important; + } + .bg-lime-400 { + background-color: var(--color-lime-400); + } + .bg-lime-400\/30 { + background-color: color-mix(in srgb, oklch(84.1% 0.238 128.85) 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-lime-400) 30%, transparent); + } + } + .bg-red-400 { + background-color: var(--color-red-400); + } + .bg-red-400\/30 { + background-color: color-mix(in srgb, oklch(70.4% 0.191 22.216) 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-red-400) 30%, transparent); + } + } + .bg-red-500\/80 { + background-color: color-mix(in srgb, oklch(63.7% 0.237 25.331) 80%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-red-500) 80%, transparent); + } + } + .bg-sky-400 { + background-color: var(--color-sky-400); + } + .bg-sky-400\/30 { + background-color: color-mix(in srgb, oklch(74.6% 0.16 232.661) 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-sky-400) 30%, transparent); + } + } + .bg-slate-950 { + background-color: var(--color-slate-950); + } + .bg-white { + background-color: var(--color-white); + } + .bg-white\/30 { + background-color: color-mix(in srgb, #fff 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-white) 30%, transparent); + } + } + .\!p-0 { + padding: calc(var(--spacing) * 0) !important; + } + .\!p-4 { + padding: calc(var(--spacing) * 4) !important; + } + .p-2 { + padding: calc(var(--spacing) * 2); + } + .\!px-2 { + padding-inline: calc(var(--spacing) * 2) !important; + } + .\!pt-8 { + padding-top: calc(var(--spacing) * 8) !important; + } + .text-center { + text-align: center; + } + .text-left { + text-align: left; + } + .text-right { + text-align: right; + } + .text-base { + font-size: var(--text-base); + line-height: var(--tw-leading, var(--text-base--line-height)); + } + .text-xs { + font-size: var(--text-xs); + line-height: var(--tw-leading, var(--text-xs--line-height)); + } + .\!text-gray-800 { + color: var(--color-gray-800) !important; + } + .text-red-400 { + color: var(--color-red-400); + } + .text-white { + color: var(--color-white); + } + .opacity-80 { + opacity: 80%; + } + .opacity-90 { + opacity: 90%; + } +} +@layer theme; +html, body, #panel-html__body { + position: relative; +} +#panel-html__body { + --font-sans: "Orbitron", sans-serif; + width: 100%; + height: 100%; + background-color: var(--color-gray-900); + font-family: var(--font-sans); + font-size: var(--text-sm); + line-height: var(--tw-leading, var(--text-sm--line-height)); + --tw-font-weight: var(--font-weight-light); + font-weight: var(--font-weight-light); + --tw-tracking: var(--tracking-wide); + letter-spacing: var(--tracking-wide); + color: var(--color-slate-50); + * { + box-sizing: border-box; + } +} +.group-left, .group-middle, .group-right { + display: grid; + height: fit-content; + gap: calc(var(--spacing) * 2); +} +.ed-panel { + height: fit-content; + width: 100%; + border-bottom-right-radius: var(--radius-xl); + border-bottom-left-radius: var(--radius-xl); + border-style: var(--tw-border-style); + border-width: 1px; + padding: calc(var(--spacing) * 2); + h3, h4 { + margin: calc(var(--spacing) * 0); + margin-bottom: calc(var(--spacing) * 1); + --tw-font-weight: var(--font-weight-extralight); + font-weight: var(--font-weight-extralight); + } + h3 { + font-size: var(--text-base); + line-height: var(--tw-leading, var(--text-base--line-height)); + } + h4 { + font-size: var(--text-sm); + line-height: var(--tw-leading, var(--text-sm--line-height)); + } + &.pnl__blue { + border-color: var(--color-sky-300); + background-color: color-mix(in srgb, oklch(68.5% 0.169 237.323) 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-sky-500) 30%, transparent); + } + h3, h4 { + color: var(--color-sky-100); + text-shadow: 0 0 0.2em var(--color-sky-300); + } + } + &.pnl__yellow { + border-color: var(--color-amber-300); + background-color: color-mix(in srgb, oklch(76.9% 0.188 70.08) 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-amber-500) 30%, transparent); + } + h3, h4 { + color: var(--color-amber-100); + text-shadow: 0 0 0.2em var(--color-amber-300); + } + } + &.pnl__orange { + border-color: var(--color-orange-300); + background-color: color-mix(in srgb, oklch(70.5% 0.213 47.604) 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-orange-500) 30%, transparent); + } + h3, h4 { + color: var(--color-orange-100); + text-shadow: 0 0 0.2em var(--color-orange-300); + } + } + &.pnl__red { + border-color: var(--color-rose-300); + background-color: color-mix(in srgb, oklch(64.5% 0.246 16.439) 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-rose-500) 30%, transparent); + } + h3, h4 { + color: var(--color-rose-100); + text-shadow: 0 0 0.2em var(--color-rose-400); + } + } + &.pnl__white { + border-color: var(--color-white); + background-color: color-mix(in srgb, #fff 20%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-white) 20%, transparent); + } + h3, h4 { + color: var(--color-white); + text-shadow: 0 0 0.2em var(--color-white); + } + } +} +.ed-button { + display: flex; + align-items: center; + justify-content: center; + border-radius: var(--radius-lg); + border-style: var(--tw-border-style); + border-width: 3px; + padding-inline: calc(var(--spacing) * 4); + padding-block: calc(var(--spacing) * 2); + text-align: center; + font-size: var(--text-base); + line-height: var(--tw-leading, var(--text-base--line-height)); + svg { + display: block; + width: calc(var(--spacing) * 5) !important; + height: calc(var(--spacing) * 5) !important; + } + &.btn__vertical { + flex-direction: column; + } + &.btn__filled { + color: var(--color-gray-900); + } + &.btn__orange { + border-color: var(--color-orange-400); + background-color: color-mix(in srgb, oklch(70.5% 0.213 47.604) 50%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-orange-500) 50%, transparent); + } + color: var(--color-orange-100); + &.btn__filled { + background-color: var(--color-orange-400); + } + } + &.btn__yellow { + border-color: var(--color-amber-400); + background-color: color-mix(in srgb, oklch(76.9% 0.188 70.08) 50%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-amber-500) 50%, transparent); + } + color: var(--color-orange-100); + &.btn__filled { + background-color: var(--color-amber-400); + } + } + &.btn__blue { + border-color: var(--color-sky-400); + background-color: color-mix(in srgb, oklch(68.5% 0.169 237.323) 50%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-sky-500) 50%, transparent); + } + color: var(--color-sky-100); + &.btn__filled { + background-color: var(--color-sky-500); + } + } + &.btn__red { + border-color: var(--color-rose-500); + background-color: color-mix(in srgb, oklch(58.6% 0.253 17.585) 50%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-rose-600) 50%, transparent); + } + color: var(--color-rose-100); + &.btn__filled { + background-color: var(--color-rose-600); + } + } + &.btn__white { + border-color: var(--color-white); + background-color: color-mix(in srgb, #fff 30%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-white) 30%, transparent); + } + &.btn__filled { + background-color: var(--color-white); + } + } +} +.ed-button-group__horizontal { + display: grid; + :where(& > :not(:last-child)) { + --tw-divide-x-reverse: 0; + border-inline-style: var(--tw-border-style); + border-inline-start-width: calc(1px * var(--tw-divide-x-reverse)); + border-inline-end-width: calc(1px * calc(1 - var(--tw-divide-x-reverse))); + } + .ed-button { + border-radius: 0; + &:first-child { + border-top-left-radius: var(--radius-lg); + border-bottom-left-radius: var(--radius-lg); + } + &:last-child { + border-top-right-radius: var(--radius-lg); + border-bottom-right-radius: var(--radius-lg); + } + } +} +.ed-button-group__vertical { + display: grid; + :where(& > :not(:last-child)) { + --tw-divide-y-reverse: 0; + border-bottom-style: var(--tw-border-style); + border-top-style: var(--tw-border-style); + border-top-width: calc(1px * var(--tw-divide-y-reverse)); + border-bottom-width: calc(1px * calc(1 - var(--tw-divide-y-reverse))); + } + .ed-button { + border-radius: 0; + &:first-child { + border-top-left-radius: var(--radius-lg); + border-top-right-radius: var(--radius-lg); + } + &:last-child { + border-bottom-right-radius: var(--radius-lg); + border-bottom-left-radius: var(--radius-lg); + } + } +} +.ed-toggle { + .toggle__wrapper { + position: relative; + width: 100%; + height: 100%; + border-radius: calc(infinity * 1px); + border-style: var(--tw-border-style); + border-width: 2px; + padding: calc(var(--spacing) * 1.5); + } + .toggle__indicator { + position: absolute; + aspect-ratio: 1 / 1; + border-radius: calc(infinity * 1px); + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to, opacity, box-shadow, transform, translate, scale, rotate, filter, -webkit-backdrop-filter, backdrop-filter; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function)); + transition-duration: var(--tw-duration, var(--default-transition-duration)); + } + &.toggle__horizontal { + height: calc(var(--spacing) * 12); + width: calc(var(--spacing) * 20); + .toggle__indicator { + left: calc(var(--spacing) * 1.5); + height: calc(100% - .75rem); + --tw-translate-x: calc(var(--spacing) * 0); + translate: var(--tw-translate-x) var(--tw-translate-y); + } + &[active] .toggle__indicator { + --tw-translate-x: 100%; + translate: var(--tw-translate-x) var(--tw-translate-y); + } + } + &.toggle__vertical { + height: calc(var(--spacing) * 20); + width: calc(var(--spacing) * 12); + .toggle__indicator { + top: calc(var(--spacing) * 1.5); + width: calc(100% - .75rem); + --tw-translate-y: calc(var(--spacing) * 0); + translate: var(--tw-translate-x) var(--tw-translate-y); + } + &[active] .toggle__indicator { + --tw-translate-y: 100%; + translate: var(--tw-translate-x) var(--tw-translate-y); + } + } +} +dialog[open] { + position: absolute; + top: calc(1/2 * 100%); + left: calc(1/2 * 100%); + --tw-translate-x: calc(calc(1/2 * 100%) * -1); + translate: var(--tw-translate-x) var(--tw-translate-y); + --tw-translate-y: calc(calc(1/2 * 100%) * -1); + translate: var(--tw-translate-x) var(--tw-translate-y); + border-style: var(--tw-border-style); + border-width: 0px; + background-color: transparent; + outline-style: var(--tw-outline-style); + outline-width: 0px; + &::backdrop { + background-color: color-mix(in srgb, #000 50%, transparent); + @supports (color: color-mix(in lab, red, red)) { + background-color: color-mix(in oklab, var(--color-black) 50%, transparent); + } + } + .dialog__close { + position: absolute; + top: calc(var(--spacing) * 3); + right: calc(var(--spacing) * 3); + color: var(--color-white); + } +} +#clock { + position: relative; + display: flex; + width: fit-content; + padding-right: calc(var(--spacing) * 16); + font-size: var(--text-3xl); + line-height: var(--tw-leading, var(--text-3xl--line-height)); + i { + padding-left: calc(var(--spacing) * 1); + font-style: normal; + } + .hours-minutes, .seconds { + display: flex; + gap: calc(var(--spacing) * 1); + } + span { + display: inline-block; + width: .75em; + text-align: center; + } + sup { + position: absolute; + right: calc(var(--spacing) * 0); + width: calc(var(--spacing) * 16); + padding-left: calc(var(--spacing) * 2); + text-align: left; + font-size: var(--text-lg); + line-height: var(--tw-leading, var(--text-lg--line-height)); + opacity: 80%; + } +} +@property --tw-divide-x-reverse { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@property --tw-font-weight { + syntax: "*"; + inherits: false; +} +@property --tw-tracking { + syntax: "*"; + inherits: false; +} +@property --tw-divide-y-reverse { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-x { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-y { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-z { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-outline-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@layer properties { + @supports ((-webkit-hyphens: none) and (not (margin-trim: inline))) or ((-moz-orient: inline) and (not (color:rgb(from red r g b)))) { + *, ::before, ::after, ::backdrop { + --tw-divide-x-reverse: 0; + --tw-border-style: solid; + --tw-font-weight: initial; + --tw-tracking: initial; + --tw-divide-y-reverse: 0; + --tw-translate-x: 0; + --tw-translate-y: 0; + --tw-translate-z: 0; + --tw-outline-style: solid; + } + } +} diff --git a/panels/Elite_Dangerous/package-lock.json b/panels/Elite_Dangerous/package-lock.json new file mode 100644 index 0000000..1fb3ab8 --- /dev/null +++ b/panels/Elite_Dangerous/package-lock.json @@ -0,0 +1,974 @@ +{ + "name": "test_panel", + "version": "1.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "name": "test_panel", + "version": "1.0.0", + "license": "ISC", + "devDependencies": { + "@tailwindcss/cli": "^4.1.2", + "tailwindcss": "^4.1.2" + } + }, + "node_modules/@parcel/watcher": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher/-/watcher-2.5.1.tgz", + "integrity": "sha512-dfUnCxiN9H4ap84DvD2ubjw+3vUNpstxa0TneY/Paat8a3R4uQZDLSvWjmznAY/DoahqTHl9V46HF/Zs3F29pg==", + "dev": true, + "hasInstallScript": true, + "dependencies": { + "detect-libc": "^1.0.3", + "is-glob": "^4.0.3", + "micromatch": "^4.0.5", + "node-addon-api": "^7.0.0" + }, + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + }, + "optionalDependencies": { + "@parcel/watcher-android-arm64": "2.5.1", + "@parcel/watcher-darwin-arm64": "2.5.1", + "@parcel/watcher-darwin-x64": "2.5.1", + "@parcel/watcher-freebsd-x64": "2.5.1", + "@parcel/watcher-linux-arm-glibc": "2.5.1", + "@parcel/watcher-linux-arm-musl": "2.5.1", + "@parcel/watcher-linux-arm64-glibc": "2.5.1", + "@parcel/watcher-linux-arm64-musl": "2.5.1", + "@parcel/watcher-linux-x64-glibc": "2.5.1", + "@parcel/watcher-linux-x64-musl": "2.5.1", + "@parcel/watcher-win32-arm64": "2.5.1", + "@parcel/watcher-win32-ia32": "2.5.1", + "@parcel/watcher-win32-x64": "2.5.1" + } + }, + "node_modules/@parcel/watcher-android-arm64": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-android-arm64/-/watcher-android-arm64-2.5.1.tgz", + "integrity": "sha512-KF8+j9nNbUN8vzOFDpRMsaKBHZ/mcjEjMToVMJOhTozkDonQFFrRcfdLWn6yWKCmJKmdVxSgHiYvTCef4/qcBA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-darwin-arm64": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-darwin-arm64/-/watcher-darwin-arm64-2.5.1.tgz", + "integrity": "sha512-eAzPv5osDmZyBhou8PoF4i6RQXAfeKL9tjb3QzYuccXFMQU0ruIc/POh30ePnaOyD1UXdlKguHBmsTs53tVoPw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-darwin-x64": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-darwin-x64/-/watcher-darwin-x64-2.5.1.tgz", + "integrity": "sha512-1ZXDthrnNmwv10A0/3AJNZ9JGlzrF82i3gNQcWOzd7nJ8aj+ILyW1MTxVk35Db0u91oD5Nlk9MBiujMlwmeXZg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-freebsd-x64": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-freebsd-x64/-/watcher-freebsd-x64-2.5.1.tgz", + "integrity": "sha512-SI4eljM7Flp9yPuKi8W0ird8TI/JK6CSxju3NojVI6BjHsTyK7zxA9urjVjEKJ5MBYC+bLmMcbAWlZ+rFkLpJQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-linux-arm-glibc": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-linux-arm-glibc/-/watcher-linux-arm-glibc-2.5.1.tgz", + "integrity": "sha512-RCdZlEyTs8geyBkkcnPWvtXLY44BCeZKmGYRtSgtwwnHR4dxfHRG3gR99XdMEdQ7KeiDdasJwwvNSF5jKtDwdA==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-linux-arm-musl": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-linux-arm-musl/-/watcher-linux-arm-musl-2.5.1.tgz", + "integrity": "sha512-6E+m/Mm1t1yhB8X412stiKFG3XykmgdIOqhjWj+VL8oHkKABfu/gjFj8DvLrYVHSBNC+/u5PeNrujiSQ1zwd1Q==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-linux-arm64-glibc": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-linux-arm64-glibc/-/watcher-linux-arm64-glibc-2.5.1.tgz", + "integrity": "sha512-LrGp+f02yU3BN9A+DGuY3v3bmnFUggAITBGriZHUREfNEzZh/GO06FF5u2kx8x+GBEUYfyTGamol4j3m9ANe8w==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-linux-arm64-musl": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-linux-arm64-musl/-/watcher-linux-arm64-musl-2.5.1.tgz", + "integrity": "sha512-cFOjABi92pMYRXS7AcQv9/M1YuKRw8SZniCDw0ssQb/noPkRzA+HBDkwmyOJYp5wXcsTrhxO0zq1U11cK9jsFg==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-linux-x64-glibc": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-linux-x64-glibc/-/watcher-linux-x64-glibc-2.5.1.tgz", + "integrity": "sha512-GcESn8NZySmfwlTsIur+49yDqSny2IhPeZfXunQi48DMugKeZ7uy1FX83pO0X22sHntJ4Ub+9k34XQCX+oHt2A==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-linux-x64-musl": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-linux-x64-musl/-/watcher-linux-x64-musl-2.5.1.tgz", + "integrity": "sha512-n0E2EQbatQ3bXhcH2D1XIAANAcTZkQICBPVaxMeaCVBtOpBZpWJuf7LwyWPSBDITb7In8mqQgJ7gH8CILCURXg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-win32-arm64": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-win32-arm64/-/watcher-win32-arm64-2.5.1.tgz", + "integrity": "sha512-RFzklRvmc3PkjKjry3hLF9wD7ppR4AKcWNzH7kXR7GUe0Igb3Nz8fyPwtZCSquGrhU5HhUNDr/mKBqj7tqA2Vw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-win32-ia32": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-win32-ia32/-/watcher-win32-ia32-2.5.1.tgz", + "integrity": "sha512-c2KkcVN+NJmuA7CGlaGD1qJh1cLfDnQsHjE89E60vUEMlqduHGCdCLJCID5geFVM0dOtA3ZiIO8BoEQmzQVfpQ==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@parcel/watcher-win32-x64": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/@parcel/watcher-win32-x64/-/watcher-win32-x64-2.5.1.tgz", + "integrity": "sha512-9lHBdJITeNR++EvSQVUcaZoWupyHfXe1jZvGZ06O/5MflPcuPLtEphScIBL+AiCWBO46tDSHzWyD0uDmmZqsgA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/@tailwindcss/cli": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/cli/-/cli-4.1.4.tgz", + "integrity": "sha512-gP05Qihh+cZ2FqD5fa0WJXx3KEk2YWUYv/RBKAyiOg0V4vYVDr/xlLc0sacpnVEXM45BVUR9U2hsESufYs6YTA==", + "dev": true, + "dependencies": { + "@parcel/watcher": "^2.5.1", + "@tailwindcss/node": "4.1.4", + "@tailwindcss/oxide": "4.1.4", + "enhanced-resolve": "^5.18.1", + "mri": "^1.2.0", + "picocolors": "^1.1.1", + "tailwindcss": "4.1.4" + }, + "bin": { + "tailwindcss": "dist/index.mjs" + } + }, + "node_modules/@tailwindcss/node": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/node/-/node-4.1.4.tgz", + "integrity": "sha512-MT5118zaiO6x6hNA04OWInuAiP1YISXql8Z+/Y8iisV5nuhM8VXlyhRuqc2PEviPszcXI66W44bCIk500Oolhw==", + "dev": true, + "dependencies": { + "enhanced-resolve": "^5.18.1", + "jiti": "^2.4.2", + "lightningcss": "1.29.2", + "tailwindcss": "4.1.4" + } + }, + "node_modules/@tailwindcss/oxide": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide/-/oxide-4.1.4.tgz", + "integrity": "sha512-p5wOpXyOJx7mKh5MXh5oKk+kqcz8T+bA3z/5VWWeQwFrmuBItGwz8Y2CHk/sJ+dNb9B0nYFfn0rj/cKHZyjahQ==", + "dev": true, + "engines": { + "node": ">= 10" + }, + "optionalDependencies": { + "@tailwindcss/oxide-android-arm64": "4.1.4", + "@tailwindcss/oxide-darwin-arm64": "4.1.4", + "@tailwindcss/oxide-darwin-x64": "4.1.4", + "@tailwindcss/oxide-freebsd-x64": "4.1.4", + "@tailwindcss/oxide-linux-arm-gnueabihf": "4.1.4", + "@tailwindcss/oxide-linux-arm64-gnu": "4.1.4", + "@tailwindcss/oxide-linux-arm64-musl": "4.1.4", + "@tailwindcss/oxide-linux-x64-gnu": "4.1.4", + "@tailwindcss/oxide-linux-x64-musl": "4.1.4", + "@tailwindcss/oxide-wasm32-wasi": "4.1.4", + "@tailwindcss/oxide-win32-arm64-msvc": "4.1.4", + "@tailwindcss/oxide-win32-x64-msvc": "4.1.4" + } + }, + "node_modules/@tailwindcss/oxide-android-arm64": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-android-arm64/-/oxide-android-arm64-4.1.4.tgz", + "integrity": "sha512-xMMAe/SaCN/vHfQYui3fqaBDEXMu22BVwQ33veLc8ep+DNy7CWN52L+TTG9y1K397w9nkzv+Mw+mZWISiqhmlA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-darwin-arm64": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-darwin-arm64/-/oxide-darwin-arm64-4.1.4.tgz", + "integrity": "sha512-JGRj0SYFuDuAGilWFBlshcexev2hOKfNkoX+0QTksKYq2zgF9VY/vVMq9m8IObYnLna0Xlg+ytCi2FN2rOL0Sg==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-darwin-x64": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-darwin-x64/-/oxide-darwin-x64-4.1.4.tgz", + "integrity": "sha512-sdDeLNvs3cYeWsEJ4H1DvjOzaGios4QbBTNLVLVs0XQ0V95bffT3+scptzYGPMjm7xv4+qMhCDrkHwhnUySEzA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-freebsd-x64": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-freebsd-x64/-/oxide-freebsd-x64-4.1.4.tgz", + "integrity": "sha512-VHxAqxqdghM83HslPhRsNhHo91McsxRJaEnShJOMu8mHmEj9Ig7ToHJtDukkuLWLzLboh2XSjq/0zO6wgvykNA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm-gnueabihf": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm-gnueabihf/-/oxide-linux-arm-gnueabihf-4.1.4.tgz", + "integrity": "sha512-OTU/m/eV4gQKxy9r5acuesqaymyeSCnsx1cFto/I1WhPmi5HDxX1nkzb8KYBiwkHIGg7CTfo/AcGzoXAJBxLfg==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm64-gnu": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm64-gnu/-/oxide-linux-arm64-gnu-4.1.4.tgz", + "integrity": "sha512-hKlLNvbmUC6z5g/J4H+Zx7f7w15whSVImokLPmP6ff1QqTVE+TxUM9PGuNsjHvkvlHUtGTdDnOvGNSEUiXI1Ww==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-arm64-musl": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-arm64-musl/-/oxide-linux-arm64-musl-4.1.4.tgz", + "integrity": "sha512-X3As2xhtgPTY/m5edUtddmZ8rCruvBvtxYLMw9OsZdH01L2gS2icsHRwxdU0dMItNfVmrBezueXZCHxVeeb7Aw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-x64-gnu": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-x64-gnu/-/oxide-linux-x64-gnu-4.1.4.tgz", + "integrity": "sha512-2VG4DqhGaDSmYIu6C4ua2vSLXnJsb/C9liej7TuSO04NK+JJJgJucDUgmX6sn7Gw3Cs5ZJ9ZLrnI0QRDOjLfNQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-linux-x64-musl": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-linux-x64-musl/-/oxide-linux-x64-musl-4.1.4.tgz", + "integrity": "sha512-v+mxVgH2kmur/X5Mdrz9m7TsoVjbdYQT0b4Z+dr+I4RvreCNXyCFELZL/DO0M1RsidZTrm6O1eMnV6zlgEzTMQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-wasm32-wasi": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-wasm32-wasi/-/oxide-wasm32-wasi-4.1.4.tgz", + "integrity": "sha512-2TLe9ir+9esCf6Wm+lLWTMbgklIjiF0pbmDnwmhR9MksVOq+e8aP3TSsXySnBDDvTTVd/vKu1aNttEGj3P6l8Q==", + "bundleDependencies": [ + "@napi-rs/wasm-runtime", + "@emnapi/core", + "@emnapi/runtime", + "@tybys/wasm-util", + "@emnapi/wasi-threads", + "tslib" + ], + "cpu": [ + "wasm32" + ], + "dev": true, + "optional": true, + "dependencies": { + "@emnapi/core": "^1.4.0", + "@emnapi/runtime": "^1.4.0", + "@emnapi/wasi-threads": "^1.0.1", + "@napi-rs/wasm-runtime": "^0.2.8", + "@tybys/wasm-util": "^0.9.0", + "tslib": "^2.8.0" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@tailwindcss/oxide-win32-arm64-msvc": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-win32-arm64-msvc/-/oxide-win32-arm64-msvc-4.1.4.tgz", + "integrity": "sha512-VlnhfilPlO0ltxW9/BgfLI5547PYzqBMPIzRrk4W7uupgCt8z6Trw/tAj6QUtF2om+1MH281Pg+HHUJoLesmng==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/@tailwindcss/oxide-win32-x64-msvc": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/@tailwindcss/oxide-win32-x64-msvc/-/oxide-win32-x64-msvc-4.1.4.tgz", + "integrity": "sha512-+7S63t5zhYjslUGb8NcgLpFXD+Kq1F/zt5Xv5qTv7HaFTG/DHyHD9GA6ieNAxhgyA4IcKa/zy7Xx4Oad2/wuhw==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 10" + } + }, + "node_modules/braces": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.3.tgz", + "integrity": "sha512-yQbXgO/OSZVD2IsiLlro+7Hf6Q18EJrKSEsdoMzKePKXct3gvD8oLcOQdIzGupr5Fj+EDe8gO/lxc1BzfMpxvA==", + "dev": true, + "dependencies": { + "fill-range": "^7.1.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/detect-libc": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-1.0.3.tgz", + "integrity": "sha512-pGjwhsmsp4kL2RTz08wcOlGN83otlqHeD/Z5T8GXZB+/YcpQ/dgo+lbU8ZsGxV0HIvqqxo9l7mqYwyYMD9bKDg==", + "dev": true, + "bin": { + "detect-libc": "bin/detect-libc.js" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/enhanced-resolve": { + "version": "5.18.1", + "resolved": "https://registry.npmjs.org/enhanced-resolve/-/enhanced-resolve-5.18.1.tgz", + "integrity": "sha512-ZSW3ma5GkcQBIpwZTSRAI8N71Uuwgs93IezB7mf7R60tC8ZbJideoDNKjHn2O9KIlx6rkGTTEk1xUCK2E1Y2Yg==", + "dev": true, + "dependencies": { + "graceful-fs": "^4.2.4", + "tapable": "^2.2.0" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/fill-range": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.1.1.tgz", + "integrity": "sha512-YsGpe3WHLK8ZYi4tWDg2Jy3ebRz2rXowDxnld4bkQB00cc/1Zw9AWnC0i9ztDJitivtQvaI9KaLyKrc+hBW0yg==", + "dev": true, + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/graceful-fs": { + "version": "4.2.11", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.11.tgz", + "integrity": "sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ==", + "dev": true + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dev": true, + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/jiti": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/jiti/-/jiti-2.4.2.tgz", + "integrity": "sha512-rg9zJN+G4n2nfJl5MW3BMygZX56zKPNVEYYqq7adpmMh4Jn2QNEwhvQlFy6jPVdcod7txZtKHWnyZiA3a0zP7A==", + "dev": true, + "bin": { + "jiti": "lib/jiti-cli.mjs" + } + }, + "node_modules/lightningcss": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss/-/lightningcss-1.29.2.tgz", + "integrity": "sha512-6b6gd/RUXKaw5keVdSEtqFVdzWnU5jMxTUjA2bVcMNPLwSQ08Sv/UodBVtETLCn7k4S1Ibxwh7k68IwLZPgKaA==", + "dev": true, + "dependencies": { + "detect-libc": "^2.0.3" + }, + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + }, + "optionalDependencies": { + "lightningcss-darwin-arm64": "1.29.2", + "lightningcss-darwin-x64": "1.29.2", + "lightningcss-freebsd-x64": "1.29.2", + "lightningcss-linux-arm-gnueabihf": "1.29.2", + "lightningcss-linux-arm64-gnu": "1.29.2", + "lightningcss-linux-arm64-musl": "1.29.2", + "lightningcss-linux-x64-gnu": "1.29.2", + "lightningcss-linux-x64-musl": "1.29.2", + "lightningcss-win32-arm64-msvc": "1.29.2", + "lightningcss-win32-x64-msvc": "1.29.2" + } + }, + "node_modules/lightningcss-darwin-arm64": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-darwin-arm64/-/lightningcss-darwin-arm64-1.29.2.tgz", + "integrity": "sha512-cK/eMabSViKn/PG8U/a7aCorpeKLMlK0bQeNHmdb7qUnBkNPnL+oV5DjJUo0kqWsJUapZsM4jCfYItbqBDvlcA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-darwin-x64": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-darwin-x64/-/lightningcss-darwin-x64-1.29.2.tgz", + "integrity": "sha512-j5qYxamyQw4kDXX5hnnCKMf3mLlHvG44f24Qyi2965/Ycz829MYqjrVg2H8BidybHBp9kom4D7DR5VqCKDXS0w==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-freebsd-x64": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-freebsd-x64/-/lightningcss-freebsd-x64-1.29.2.tgz", + "integrity": "sha512-wDk7M2tM78Ii8ek9YjnY8MjV5f5JN2qNVO+/0BAGZRvXKtQrBC4/cn4ssQIpKIPP44YXw6gFdpUF+Ps+RGsCwg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm-gnueabihf": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm-gnueabihf/-/lightningcss-linux-arm-gnueabihf-1.29.2.tgz", + "integrity": "sha512-IRUrOrAF2Z+KExdExe3Rz7NSTuuJ2HvCGlMKoquK5pjvo2JY4Rybr+NrKnq0U0hZnx5AnGsuFHjGnNT14w26sg==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm64-gnu": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-gnu/-/lightningcss-linux-arm64-gnu-1.29.2.tgz", + "integrity": "sha512-KKCpOlmhdjvUTX/mBuaKemp0oeDIBBLFiU5Fnqxh1/DZ4JPZi4evEH7TKoSBFOSOV3J7iEmmBaw/8dpiUvRKlQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-arm64-musl": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-arm64-musl/-/lightningcss-linux-arm64-musl-1.29.2.tgz", + "integrity": "sha512-Q64eM1bPlOOUgxFmoPUefqzY1yV3ctFPE6d/Vt7WzLW4rKTv7MyYNky+FWxRpLkNASTnKQUaiMJ87zNODIrrKQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-x64-gnu": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-gnu/-/lightningcss-linux-x64-gnu-1.29.2.tgz", + "integrity": "sha512-0v6idDCPG6epLXtBH/RPkHvYx74CVziHo6TMYga8O2EiQApnUPZsbR9nFNrg2cgBzk1AYqEd95TlrsL7nYABQg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-linux-x64-musl": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-linux-x64-musl/-/lightningcss-linux-x64-musl-1.29.2.tgz", + "integrity": "sha512-rMpz2yawkgGT8RULc5S4WiZopVMOFWjiItBT7aSfDX4NQav6M44rhn5hjtkKzB+wMTRlLLqxkeYEtQ3dd9696w==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-win32-arm64-msvc": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-win32-arm64-msvc/-/lightningcss-win32-arm64-msvc-1.29.2.tgz", + "integrity": "sha512-nL7zRW6evGQqYVu/bKGK+zShyz8OVzsCotFgc7judbt6wnB2KbiKKJwBE4SGoDBQ1O94RjW4asrCjQL4i8Fhbw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss-win32-x64-msvc": { + "version": "1.29.2", + "resolved": "https://registry.npmjs.org/lightningcss-win32-x64-msvc/-/lightningcss-win32-x64-msvc-1.29.2.tgz", + "integrity": "sha512-EdIUW3B2vLuHmv7urfzMI/h2fmlnOQBk1xlsDxkN1tCWKjNFjfLhGxYk8C8mzpSfr+A6jFFIi8fU6LbQGsRWjA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">= 12.0.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/parcel" + } + }, + "node_modules/lightningcss/node_modules/detect-libc": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-2.0.3.tgz", + "integrity": "sha512-bwy0MGW55bG41VqxxypOsdSdGqLwXPI/focwgTYCFMbdUiBAxLg9CFzG08sz2aqzknwiX7Hkl0bQENjg8iLByw==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/micromatch": { + "version": "4.0.8", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.8.tgz", + "integrity": "sha512-PXwfBhYu0hBCPw8Dn0E+WDYb7af3dSLVWKi3HGv84IdF4TyFoC0ysxFd0Goxw7nSv4T/PzEJQxsYsEiFCKo2BA==", + "dev": true, + "dependencies": { + "braces": "^3.0.3", + "picomatch": "^2.3.1" + }, + "engines": { + "node": ">=8.6" + } + }, + "node_modules/mri": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/mri/-/mri-1.2.0.tgz", + "integrity": "sha512-tzzskb3bG8LvYGFF/mDTpq3jpI6Q9wc3LEmBaghu+DdCssd1FakN7Bc0hVNmEyGq1bq3RgfkCb3cmQLpNPOroA==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/node-addon-api": { + "version": "7.1.1", + "resolved": "https://registry.npmjs.org/node-addon-api/-/node-addon-api-7.1.1.tgz", + "integrity": "sha512-5m3bsyrjFWE1xf7nz7YXdN4udnVtXK6/Yfgn5qnahL6bCkf2yKt4k3nuTKAtT4r3IG8JNR2ncsIMdZuAzJjHQQ==", + "dev": true + }, + "node_modules/picocolors": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.1.1.tgz", + "integrity": "sha512-xceH2snhtb5M9liqDsmEw56le376mTZkEX/jEb/RxNFyegNul7eNslCXP9FDj/Lcu0X8KEyMceP2ntpaHrDEVA==", + "dev": true + }, + "node_modules/picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "dev": true, + "engines": { + "node": ">=8.6" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/tailwindcss": { + "version": "4.1.4", + "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-4.1.4.tgz", + "integrity": "sha512-1ZIUqtPITFbv/DxRmDr5/agPqJwF69d24m9qmM1939TJehgY539CtzeZRjbLt5G6fSy/7YqqYsfvoTEw9xUI2A==", + "dev": true + }, + "node_modules/tapable": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/tapable/-/tapable-2.2.1.tgz", + "integrity": "sha512-GNzQvQTOIP6RyTfE2Qxb8ZVlNmw0n88vp1szwWRimP02mnTsx3Wtn5qRdqY9w2XduFNUgvOwhNnQsjwCp+kqaQ==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + } + } +} diff --git a/panels/Elite_Dangerous/package.json b/panels/Elite_Dangerous/package.json new file mode 100644 index 0000000..cf85d0c --- /dev/null +++ b/panels/Elite_Dangerous/package.json @@ -0,0 +1,16 @@ +{ + "name": "test_panel", + "version": "1.0.0", + "description": "", + "main": "index.js", + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1", + "dev": "npx tailwindcss -i ./input.css -o ./output.css --watch" + }, + "author": "", + "license": "ISC", + "devDependencies": { + "@tailwindcss/cli": "^4.1.2", + "tailwindcss": "^4.1.2" + } +} diff --git a/panels/Elite_Dangerous/panel.json b/panels/Elite_Dangerous/panel.json new file mode 100644 index 0000000..54ebe8c --- /dev/null +++ b/panels/Elite_Dangerous/panel.json @@ -0,0 +1,48 @@ +{ + "dir": "", + "name": "Elite Dangerous", + "description": "A Semi Realistic button panel for Elite Dangerous, made by JaxxMoss.", + "aspectRatio": "16/10", + "macros": { + "CM__Chaff": "ED-CM-Chaff", + "CM__ECM": "ED-CM-ECM", + "CM__Heatsink": "ED-CM-Heat_Sink", + "CM__Shieldcell": "ED-CM-Schield_Cell", + "Camera__Pos1": "ED-Camera-Position1", + "Camera__Pos2": "ED-Camera-Position2", + "Camera__Suite": "ED-Camera-Suite", + "Comms__panel": "ED-Comms_Panel", + "External__panel": "ED-External_Panel", + "FSD__toggle": "ED-Toggle_FSD", + "Fighter__engage": "ED-Fighter-Engage", + "Fighter__hold": "ED-Fighter-Hold", + "Fighter__recall": "ED-Fighter-Recall", + "Fighter__wingman1": "ED-Fighter-Wingman1", + "Fighter__wingman2": "ED-Fighter-Wingman2", + "Fighter__wingman3": "ED-Fighter-Wingman3", + "Fighter_attack": "ED-Fighter-Attack", + "Fighter_defend": "ED-Fighter-Defend", + "Fighter_follow": "ED-Fighter-Follow", + "FlightAssist__toggle": "ED-Flight_Assist", + "Free__Camera": "ED-Camera-Free", + "Galaxy__map": "ED-Galaxy_Map", + "Hardpoints__toggle": "ED-Hardpoints_Switch", + "Hyper__Space": "ED-Hyperspace", + "Internal__panel": "ED-Internal_Panel", + "Jettison__Cargo": "ED-Jettison_Cargo", + "Lights__toggle": "ED-Flight_Assist", + "Mode__toggle": "ED-Mode_Switch", + "Next__Camera": "ED-Camera-Next", + "NightVis__toggle": "ED-Night_Vision", + "Previous__Camera": "ED-Camera-Previous", + "Roles__panel": "ED-Roles_Panel", + "Rotational__Correction": "ED-Rotational_Correction", + "Route__NextSystem": "ED-Route_Next_System", + "Scanner__DiscScan": "ED-Scanner_Discovery", + "Scanner__FSS": "ED-Scanner-FSS", + "SilentRunning__toggle": "ED-Silent_Running", + "Speed_0percent": "ED-0percent_Speed", + "Super__Cruise": "ED-Super_Cruise", + "System__map": "ED-System_Map" + } +} diff --git a/panels/Elite_Dangerous/tailwind.config.js b/panels/Elite_Dangerous/tailwind.config.js new file mode 100644 index 0000000..2c1a5aa --- /dev/null +++ b/panels/Elite_Dangerous/tailwind.config.js @@ -0,0 +1,17 @@ +/** @type {import('tailwindcss').Config} */ +module.exports = { + content: [ + "./index.html", // Ensure this path is correct + ], + theme: { + extend: {}, + }, + safelist: [ + { + pattern: /^(border|bg)-(blue|red|sky|orange|lime)-(200|400|300\/40)$/, + }, + ], + plugins: [], + preflight: false, + mode: "jit", +}; diff --git a/panels/test_panel/panel.json b/panels/test_panel/panel.json index fcfbfdd..27afffd 100644 --- a/panels/test_panel/panel.json +++ b/panels/test_panel/panel.json @@ -1,24 +1 @@ -{ - "dir": "", - "name": "Test Panel 1", - "description": "This is the very first panel to be created. It is a test panel for a mobile phone.", - "aspectRatio": "10/20", - "macros": { - "button_1": "TEST-Task_Manager", - "button_10": "TEST-Close_Browser_Window", - "button_11": "TEST-Previous_Tab", - "button_12": "TEST-Next_Tab", - "button_13": "TEST-Close_Tab", - "button_14": "TEST-New_Tab", - "button_15": "TEST-Fullscreen", - "button_16": "TEST-Home", - "button_2": "TEST-Close_Application", - "button_3": "TEST-RunDialog", - "button_4": "TEST-Files", - "button_5": "TEST-Settings", - "button_6": "TEST-New_Desktop", - "button_7": "TEST-Displays", - "button_8": "TEST-Task_view", - "button_9": "TEST-New_Window" - } -} +{"dir":"","name":"Test Panel 1","description":"This is the very first panel to be created. It is a test panel for a mobile phone.","aspectRatio":"10/20","macros":{"button_1":"Task_Manager","button_10":"Close_Browser_Window","button_11":"Previous_Tab","button_12":"Next_Tab","button_13":"Close_Tab","button_14":"New_Tab","button_15":"Fullscreen","button_16":"Home","button_2":"Close_Application","button_3":"RunDialog","button_4":"Files","button_5":"Settings","button_6":"New_Desktop","button_7":"Displays","button_8":"Task_view","button_9":"New_Window"}} \ No newline at end of file diff --git a/public/assets/AccordionComp-CsKCEntL.css b/public/assets/AccordionComp-CsKCEntL.css deleted file mode 100644 index c672627..0000000 --- a/public/assets/AccordionComp-CsKCEntL.css +++ /dev/null @@ -1 +0,0 @@ -/*! tailwindcss v4.1.2 | MIT License | https://tailwindcss.com */@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){[data-v-0c582c8a],[data-v-0c582c8a]:before,[data-v-0c582c8a]:after,[data-v-0c582c8a]::backdrop{--tw-border-style:solid;--tw-duration:initial;--tw-ease:initial}}}.accordion[data-v-0c582c8a]{display:grid}.accordion header[data-v-0c582c8a]{cursor:pointer;padding-inline:calc(var(--spacing,.25rem)*4);padding-block:calc(var(--spacing,.25rem)*2);grid-template-columns:1fr auto;display:grid}.accordion .accordion__wrapper[data-v-0c582c8a]{border-block-style:var(--tw-border-style);--tw-duration:.3s;--tw-ease:var(--ease-in-out,cubic-bezier(.4,0,.2,1));transition-duration:.3s;transition-timing-function:var(--ease-in-out,cubic-bezier(.4,0,.2,1));border-block-width:1px;border-top-color:#0000;border-bottom-color:#fff9;grid-template-rows:0fr;display:grid}@supports (color:color-mix(in lab,red,red)){.accordion .accordion__wrapper[data-v-0c582c8a]{border-bottom-color:color-mix(in oklab,var(--color-white,#fff)60%,transparent)}}.accordion .accordion__wrapper .accordion__content[data-v-0c582c8a]{opacity:0;transition-property:opacity;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));grid-template-rows:0fr;transition-delay:0s;display:grid;overflow:hidden}.accordion .accordion__wrapper.open[data-v-0c582c8a]{border-top-color:#fff3;grid-template-rows:1fr}@supports (color:color-mix(in lab,red,red)){.accordion .accordion__wrapper.open[data-v-0c582c8a]{border-top-color:color-mix(in oklab,var(--color-white,#fff)20%,transparent)}}.accordion .accordion__wrapper.open .accordion__content[data-v-0c582c8a]{opacity:1;grid-template-rows:1fr;transition-delay:.2s}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-duration{syntax:"*";inherits:false}@property --tw-ease{syntax:"*";inherits:false} diff --git a/public/assets/AccordionComp-D0eDAM6d.js b/public/assets/AccordionComp-D0eDAM6d.js deleted file mode 100644 index 37ef016..0000000 --- a/public/assets/AccordionComp-D0eDAM6d.js +++ /dev/null @@ -1,12 +0,0 @@ -import{c as d,_,a as f,o as h,b as m,d as g,e as c,g as a,k as C,t as k,j as w,h as i,u as p,l as x,L as y,E as B}from"./index-oAtpp-VZ.js";/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var I=d("outline","chevron-down","IconChevronDown",[["path",{d:"M6 9l6 6l6 -6",key:"svg-0"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var A=d("outline","chevron-up","IconChevronUp",[["path",{d:"M6 15l6 -6l6 6",key:"svg-0"}]]);const $={class:"accordion"},D={class:"accordion__content"},M={__name:"AccordionComp",props:{title:String,open:Boolean},emits:["onOpen","onClose","onToggle"],setup(l,{expose:u,emit:v}){const s=v;u({toggleAccordion:n});const o=l,e=f(!1);h(()=>{o.open&&n(o.open)}),m(()=>{o.open&&n(o.open)});function n(t=!1){t?(e.value=!0,s("onOpen")):(e.value=!1,s("onClose")),s("onToggle")}return(t,r)=>(c(),g("div",$,[a("header",{onClick:r[0]||(r[0]=O=>n(!e.value))},[a("h4",null,k(l.title),1),C(x,{variant:"ghost",size:"sm",class:"!px-1"},{default:w(()=>[e.value?(c(),i(p(A),{key:1})):(c(),i(p(I),{key:0}))]),_:1})]),a("section",{class:B(`accordion__wrapper ${e.value?"open":""}`)},[a("div",D,[y(t.$slots,"default",{},void 0,!0)])],2)]))}},U=_(M,[["__scopeId","data-v-0c582c8a"]]);export{U as A}; -//# sourceMappingURL=AccordionComp-D0eDAM6d.js.map diff --git a/public/assets/AccordionComp-D0eDAM6d.js.map b/public/assets/AccordionComp-D0eDAM6d.js.map deleted file mode 100644 index 7b91abc..0000000 --- a/public/assets/AccordionComp-D0eDAM6d.js.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"file":"AccordionComp-D0eDAM6d.js","sources":["../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconChevronDown.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconChevronUp.mjs","../../ui/src/components/base/AccordionComp.vue"],"sourcesContent":["/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconChevronDown = createVueComponent(\"outline\", \"chevron-down\", \"IconChevronDown\", [[\"path\", { \"d\": \"M6 9l6 6l6 -6\", \"key\": \"svg-0\" }]]);\n\nexport { IconChevronDown as default };\n//# sourceMappingURL=IconChevronDown.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconChevronUp = createVueComponent(\"outline\", \"chevron-up\", \"IconChevronUp\", [[\"path\", { \"d\": \"M6 15l6 -6l6 6\", \"key\": \"svg-0\" }]]);\n\nexport { IconChevronUp as default };\n//# sourceMappingURL=IconChevronUp.mjs.map\n","\n\n\n\n\n\n\n"],"names":["IconChevronDown","createVueComponent","IconChevronUp","emit","__emit","__expose","toggleAccordion","props","__props","accordionOpen","ref","onMounted","onUpdated","open"],"mappings":"4IAAA;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIA,EAAkBC,EAAmB,UAAW,eAAgB,kBAAmB,CAAC,CAAC,OAAQ,CAAE,EAAK,gBAAiB,IAAO,OAAO,CAAE,CAAC,CAAC,ECT3I;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIC,EAAgBD,EAAmB,UAAW,aAAc,gBAAiB,CAAC,CAAC,OAAQ,CAAE,EAAK,iBAAkB,IAAO,OAAO,CAAE,CAAC,CAAC,0LCkCtI,MAAME,EAAOC,EAEbC,EAAa,CAAE,gBAAAC,CAAiB,CAAA,EAEhC,MAAMC,EAAQC,EAKRC,EAAgBC,EAAI,EAAK,EAE/BC,EAAU,IAAM,CACVJ,EAAM,MAAMD,EAAgBC,EAAM,IAAI,CAC5C,CAAC,EAEDK,EAAU,IAAM,CACVL,EAAM,MAAMD,EAAgBC,EAAM,IAAI,CAC5C,CAAC,EAED,SAASD,EAAgBO,EAAO,GAAO,CACjCA,GACFJ,EAAc,MAAQ,GACtBN,EAAK,QAAQ,IAEbM,EAAc,MAAQ,GACtBN,EAAK,SAAS,GAGhBA,EAAK,UAAU,CACjB","x_google_ignoreList":[0,1]} \ No newline at end of file diff --git a/public/assets/DevicesView-BMkQ6MZ2.css b/public/assets/DevicesView-BMkQ6MZ2.css deleted file mode 100644 index b47a5b6..0000000 --- a/public/assets/DevicesView-BMkQ6MZ2.css +++ /dev/null @@ -1 +0,0 @@ -.device-overview[data-v-0a3f2b41],.server-overview[data-v-6973a9f0]{align-content:flex-start;gap:calc(var(--spacing,.25rem)*4);display:grid}/*! tailwindcss v4.1.2 | MIT License | https://tailwindcss.com */ diff --git a/public/assets/DevicesView-C9HVDkwf.js b/public/assets/DevicesView-C9HVDkwf.js deleted file mode 100644 index c09b127..0000000 --- a/public/assets/DevicesView-C9HVDkwf.js +++ /dev/null @@ -1,44 +0,0 @@ -import{c as pe,N as gn,_ as mt,O as en,a as xe,r as ft,o as tn,b as nn,d as re,e as z,k as O,g as B,j as V,t as J,u as F,A as ce,f as j,h as G,q,P as hn,l as we,F as Fe,i as wn,I as gt,s as ht,x as wt,Q as pn,K as mn,w as bn,v as vn,S as yn,T as kn,B as It}from"./index-oAtpp-VZ.js";import{_ as rn}from"./DialogComp-CyRyORDj.js";import{A as En}from"./AccordionComp-D0eDAM6d.js";/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var Cn=pe("outline","device-desktop","IconDeviceDesktop",[["path",{d:"M3 5a1 1 0 0 1 1 -1h16a1 1 0 0 1 1 1v10a1 1 0 0 1 -1 1h-16a1 1 0 0 1 -1 -1v-10z",key:"svg-0"}],["path",{d:"M7 20h10",key:"svg-1"}],["path",{d:"M9 16v4",key:"svg-2"}],["path",{d:"M15 16v4",key:"svg-3"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var In=pe("outline","device-mobile","IconDeviceMobile",[["path",{d:"M6 5a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v14a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2v-14z",key:"svg-0"}],["path",{d:"M11 4h2",key:"svg-1"}],["path",{d:"M12 17v.01",key:"svg-2"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var Sn=pe("outline","device-tablet","IconDeviceTablet",[["path",{d:"M5 4a1 1 0 0 1 1 -1h12a1 1 0 0 1 1 1v16a1 1 0 0 1 -1 1h-12a1 1 0 0 1 -1 -1v-16z",key:"svg-0"}],["path",{d:"M11 17a1 1 0 1 0 2 0a1 1 0 0 0 -2 0",key:"svg-1"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var An=pe("outline","device-unknown","IconDeviceUnknown",[["path",{d:"M5 5a2 2 0 0 1 2 -2h10a2 2 0 0 1 2 2v14a2 2 0 0 1 -2 2h-10a2 2 0 0 1 -2 -2z",key:"svg-0"}],["path",{d:"M12 16v.01",key:"svg-1"}],["path",{d:"M12 13a2 2 0 0 0 .914 -3.782a1.98 1.98 0 0 0 -2.414 .483",key:"svg-2"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var Mn=pe("outline","link-off","IconLinkOff",[["path",{d:"M9 15l3 -3m2 -2l1 -1",key:"svg-0"}],["path",{d:"M11 6l.463 -.536a5 5 0 0 1 7.071 7.072l-.534 .464",key:"svg-1"}],["path",{d:"M3 3l18 18",key:"svg-2"}],["path",{d:"M13 18l-.397 .534a5.068 5.068 0 0 1 -7.127 0a4.972 4.972 0 0 1 0 -7.071l.524 -.463",key:"svg-3"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var Bn=pe("outline","plug-connected-x","IconPlugConnectedX",[["path",{d:"M20 16l-4 4",key:"svg-0"}],["path",{d:"M7 12l5 5l-1.5 1.5a3.536 3.536 0 1 1 -5 -5l1.5 -1.5z",key:"svg-1"}],["path",{d:"M17 12l-5 -5l1.5 -1.5a3.536 3.536 0 1 1 5 5l-1.5 1.5z",key:"svg-2"}],["path",{d:"M3 21l2.5 -2.5",key:"svg-3"}],["path",{d:"M18.5 5.5l2.5 -2.5",key:"svg-4"}],["path",{d:"M10 11l-2 2",key:"svg-5"}],["path",{d:"M13 14l-2 2",key:"svg-6"}],["path",{d:"M16 16l4 4",key:"svg-7"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var Re=pe("outline","reload","IconReload",[["path",{d:"M19.933 13.041a8 8 0 1 1 -9.925 -8.788c3.899 -1 7.935 1.007 9.425 4.747",key:"svg-0"}],["path",{d:"M20 4v5h-5",key:"svg-1"}]]),Ie={},Ve,St;function _n(){return St||(St=1,Ve=function(){return typeof Promise=="function"&&Promise.prototype&&Promise.prototype.then}),Ve}var je={},le={},At;function me(){if(At)return le;At=1;let o;const r=[0,26,44,70,100,134,172,196,242,292,346,404,466,532,581,655,733,815,901,991,1085,1156,1258,1364,1474,1588,1706,1828,1921,2051,2185,2323,2465,2611,2761,2876,3034,3196,3362,3532,3706];return le.getSymbolSize=function(n){if(!n)throw new Error('"version" cannot be null or undefined');if(n<1||n>40)throw new Error('"version" should be in range from 1 to 40');return n*4+17},le.getSymbolTotalCodewords=function(n){return r[n]},le.getBCHDigit=function(s){let n=0;for(;s!==0;)n++,s>>>=1;return n},le.setToSJISFunction=function(n){if(typeof n!="function")throw new Error('"toSJISFunc" is not a valid function.');o=n},le.isKanjiModeEnabled=function(){return typeof o<"u"},le.toSJIS=function(n){return o(n)},le}var He={},Mt;function bt(){return Mt||(Mt=1,function(o){o.L={bit:1},o.M={bit:0},o.Q={bit:3},o.H={bit:2};function r(s){if(typeof s!="string")throw new Error("Param is not a string");switch(s.toLowerCase()){case"l":case"low":return o.L;case"m":case"medium":return o.M;case"q":case"quartile":return o.Q;case"h":case"high":return o.H;default:throw new Error("Unknown EC Level: "+s)}}o.isValid=function(n){return n&&typeof n.bit<"u"&&n.bit>=0&&n.bit<4},o.from=function(n,e){if(o.isValid(n))return n;try{return r(n)}catch{return e}}}(He)),He}var Ke,Bt;function Rn(){if(Bt)return Ke;Bt=1;function o(){this.buffer=[],this.length=0}return o.prototype={get:function(r){const s=Math.floor(r/8);return(this.buffer[s]>>>7-r%8&1)===1},put:function(r,s){for(let n=0;n>>s-n-1&1)===1)},getLengthInBits:function(){return this.length},putBit:function(r){const s=Math.floor(this.length/8);this.buffer.length<=s&&this.buffer.push(0),r&&(this.buffer[s]|=128>>>this.length%8),this.length++}},Ke=o,Ke}var $e,_t;function Tn(){if(_t)return $e;_t=1;function o(r){if(!r||r<1)throw new Error("BitMatrix size must be defined and greater than 0");this.size=r,this.data=new Uint8Array(r*r),this.reservedBit=new Uint8Array(r*r)}return o.prototype.set=function(r,s,n,e){const t=r*this.size+s;this.data[t]=n,e&&(this.reservedBit[t]=!0)},o.prototype.get=function(r,s){return this.data[r*this.size+s]},o.prototype.xor=function(r,s,n){this.data[r*this.size+s]^=n},o.prototype.isReserved=function(r,s){return this.reservedBit[r*this.size+s]},$e=o,$e}var Ge={},Rt;function Nn(){return Rt||(Rt=1,function(o){const r=me().getSymbolSize;o.getRowColCoords=function(n){if(n===1)return[];const e=Math.floor(n/7)+2,t=r(n),l=t===145?26:Math.ceil((t-13)/(2*e-2))*2,f=[t-7];for(let d=1;d=0&&e<=7},o.from=function(e){return o.isValid(e)?parseInt(e,10):void 0},o.getPenaltyN1=function(e){const t=e.size;let l=0,f=0,d=0,b=null,m=null;for(let g=0;g=5&&(l+=r.N1+(f-5)),b=u,f=1),u=e.get(i,g),u===m?d++:(d>=5&&(l+=r.N1+(d-5)),m=u,d=1)}f>=5&&(l+=r.N1+(f-5)),d>=5&&(l+=r.N1+(d-5))}return l},o.getPenaltyN2=function(e){const t=e.size;let l=0;for(let f=0;f=10&&(f===1488||f===93)&&l++,d=d<<1&2047|e.get(m,b),m>=10&&(d===1488||d===93)&&l++}return l*r.N3},o.getPenaltyN4=function(e){let t=0;const l=e.data.length;for(let d=0;d=0;){const l=t[0];for(let d=0;d0){const f=new Uint8Array(this.degree);return f.set(t,l),f}return t},Qe=r,Qe}var Xe={},Ze={},et={},Ut;function sn(){return Ut||(Ut=1,et.isValid=function(r){return!isNaN(r)&&r>=1&&r<=40}),et}var te={},qt;function an(){if(qt)return te;qt=1;const o="[0-9]+",r="[A-Z $%*+\\-./:]+";let s="(?:[u3000-u303F]|[u3040-u309F]|[u30A0-u30FF]|[uFF00-uFFEF]|[u4E00-u9FAF]|[u2605-u2606]|[u2190-u2195]|u203B|[u2010u2015u2018u2019u2025u2026u201Cu201Du2225u2260]|[u0391-u0451]|[u00A7u00A8u00B1u00B4u00D7u00F7])+";s=s.replace(/u/g,"\\u");const n="(?:(?![A-Z0-9 $%*+\\-./:]|"+s+`)(?:.|[\r -]))+`;te.KANJI=new RegExp(s,"g"),te.BYTE_KANJI=new RegExp("[^A-Z0-9 $%*+\\-./:]+","g"),te.BYTE=new RegExp(n,"g"),te.NUMERIC=new RegExp(o,"g"),te.ALPHANUMERIC=new RegExp(r,"g");const e=new RegExp("^"+s+"$"),t=new RegExp("^"+o+"$"),l=new RegExp("^[A-Z0-9 $%*+\\-./:]+$");return te.testKanji=function(d){return e.test(d)},te.testNumeric=function(d){return t.test(d)},te.testAlphanumeric=function(d){return l.test(d)},te}var Ot;function be(){return Ot||(Ot=1,function(o){const r=sn(),s=an();o.NUMERIC={id:"Numeric",bit:1,ccBits:[10,12,14]},o.ALPHANUMERIC={id:"Alphanumeric",bit:2,ccBits:[9,11,13]},o.BYTE={id:"Byte",bit:4,ccBits:[8,16,16]},o.KANJI={id:"Kanji",bit:8,ccBits:[8,10,12]},o.MIXED={bit:-1},o.getCharCountIndicator=function(t,l){if(!t.ccBits)throw new Error("Invalid mode: "+t);if(!r.isValid(l))throw new Error("Invalid version: "+l);return l>=1&&l<10?t.ccBits[0]:l<27?t.ccBits[1]:t.ccBits[2]},o.getBestModeForData=function(t){return s.testNumeric(t)?o.NUMERIC:s.testAlphanumeric(t)?o.ALPHANUMERIC:s.testKanji(t)?o.KANJI:o.BYTE},o.toString=function(t){if(t&&t.id)return t.id;throw new Error("Invalid mode")},o.isValid=function(t){return t&&t.bit&&t.ccBits};function n(e){if(typeof e!="string")throw new Error("Param is not a string");switch(e.toLowerCase()){case"numeric":return o.NUMERIC;case"alphanumeric":return o.ALPHANUMERIC;case"kanji":return o.KANJI;case"byte":return o.BYTE;default:throw new Error("Unknown mode: "+e)}}o.from=function(t,l){if(o.isValid(t))return t;try{return n(t)}catch{return l}}}(Ze)),Ze}var zt;function qn(){return zt||(zt=1,function(o){const r=me(),s=on(),n=bt(),e=be(),t=sn(),l=7973,f=r.getBCHDigit(l);function d(i,u,a){for(let c=1;c<=40;c++)if(u<=o.getCapacity(c,a,i))return c}function b(i,u){return e.getCharCountIndicator(i,u)+4}function m(i,u){let a=0;return i.forEach(function(c){const h=b(c.mode,u);a+=h+c.getBitsLength()}),a}function g(i,u){for(let a=1;a<=40;a++)if(m(i,a)<=o.getCapacity(a,u,e.MIXED))return a}o.from=function(u,a){return t.isValid(u)?parseInt(u,10):a},o.getCapacity=function(u,a,c){if(!t.isValid(u))throw new Error("Invalid QR Code version");typeof c>"u"&&(c=e.BYTE);const h=r.getSymbolTotalCodewords(u),E=s.getTotalCodewordsCount(u,a),N=(h-E)*8;if(c===e.MIXED)return N;const p=N-b(c,u);switch(c){case e.NUMERIC:return Math.floor(p/10*3);case e.ALPHANUMERIC:return Math.floor(p/11*2);case e.KANJI:return Math.floor(p/13);case e.BYTE:default:return Math.floor(p/8)}},o.getBestVersionForData=function(u,a){let c;const h=n.from(a,n.M);if(Array.isArray(u)){if(u.length>1)return g(u,h);if(u.length===0)return 1;c=u[0]}else c=u;return d(c.mode,c.getLength(),h)},o.getEncodedBits=function(u){if(!t.isValid(u)||u<7)throw new Error("Invalid QR Code version");let a=u<<12;for(;r.getBCHDigit(a)-f>=0;)a^=l<=0;)d^=r<0&&(t=this.data.substr(e),l=parseInt(t,10),n.put(l,f*3+1))},it=r,it}var rt,jt;function Fn(){if(jt)return rt;jt=1;const o=be(),r=["0","1","2","3","4","5","6","7","8","9","A","B","C","D","E","F","G","H","I","J","K","L","M","N","O","P","Q","R","S","T","U","V","W","X","Y","Z"," ","$","%","*","+","-",".","/",":"];function s(n){this.mode=o.ALPHANUMERIC,this.data=n}return s.getBitsLength=function(e){return 11*Math.floor(e/2)+6*(e%2)},s.prototype.getLength=function(){return this.data.length},s.prototype.getBitsLength=function(){return s.getBitsLength(this.data.length)},s.prototype.write=function(e){let t;for(t=0;t+2<=this.data.length;t+=2){let l=r.indexOf(this.data[t])*45;l+=r.indexOf(this.data[t+1]),e.put(l,11)}this.data.length%2&&e.put(r.indexOf(this.data[t]),6)},rt=s,rt}var ot,Ht;function Vn(){if(Ht)return ot;Ht=1;const o=be();function r(s){this.mode=o.BYTE,typeof s=="string"?this.data=new TextEncoder().encode(s):this.data=new Uint8Array(s)}return r.getBitsLength=function(n){return n*8},r.prototype.getLength=function(){return this.data.length},r.prototype.getBitsLength=function(){return r.getBitsLength(this.data.length)},r.prototype.write=function(s){for(let n=0,e=this.data.length;n=33088&&t<=40956)t-=33088;else if(t>=57408&&t<=60351)t-=49472;else throw new Error("Invalid SJIS character: "+this.data[e]+` -Make sure your charset is UTF-8`);t=(t>>>8&255)*192+(t&255),n.put(t,13)}},st=s,st}var at={exports:{}},$t;function Hn(){return $t||($t=1,function(o){var r={single_source_shortest_paths:function(s,n,e){var t={},l={};l[n]=0;var f=r.PriorityQueue.make();f.push(n,0);for(var d,b,m,g,i,u,a,c,h;!f.empty();){d=f.pop(),b=d.value,g=d.cost,i=s[b]||{};for(m in i)i.hasOwnProperty(m)&&(u=i[m],a=g+u,c=l[m],h=typeof l[m]>"u",(h||c>a)&&(l[m]=a,f.push(m,a),t[m]=b))}if(typeof e<"u"&&typeof l[e]>"u"){var E=["Could not find a path from ",n," to ",e,"."].join("");throw new Error(E)}return t},extract_shortest_path_from_predecessor_list:function(s,n){for(var e=[],t=n;t;)e.push(t),s[t],t=s[t];return e.reverse(),e},find_path:function(s,n,e){var t=r.single_source_shortest_paths(s,n,e);return r.extract_shortest_path_from_predecessor_list(t,e)},PriorityQueue:{make:function(s){var n=r.PriorityQueue,e={},t;s=s||{};for(t in n)n.hasOwnProperty(t)&&(e[t]=n[t]);return e.queue=[],e.sorter=s.sorter||n.default_sorter,e},default_sorter:function(s,n){return s.cost-n.cost},push:function(s,n){var e={value:s,cost:n};this.queue.push(e),this.queue.sort(this.sorter)},pop:function(){return this.queue.shift()},empty:function(){return this.queue.length===0}}};o.exports=r}(at)),at.exports}var Gt;function Kn(){return Gt||(Gt=1,function(o){const r=be(),s=zn(),n=Fn(),e=Vn(),t=jn(),l=an(),f=me(),d=Hn();function b(E){return unescape(encodeURIComponent(E)).length}function m(E,N,p){const w=[];let D;for(;(D=E.exec(p))!==null;)w.push({data:D[0],index:D.index,mode:N,length:D[0].length});return w}function g(E){const N=m(l.NUMERIC,r.NUMERIC,E),p=m(l.ALPHANUMERIC,r.ALPHANUMERIC,E);let w,D;return f.isKanjiModeEnabled()?(w=m(l.BYTE,r.BYTE,E),D=m(l.KANJI,r.KANJI,E)):(w=m(l.BYTE_KANJI,r.BYTE,E),D=[]),N.concat(p,w,D).sort(function(S,C){return S.index-C.index}).map(function(S){return{data:S.data,mode:S.mode,length:S.length}})}function i(E,N){switch(N){case r.NUMERIC:return s.getBitsLength(E);case r.ALPHANUMERIC:return n.getBitsLength(E);case r.KANJI:return t.getBitsLength(E);case r.BYTE:return e.getBitsLength(E)}}function u(E){return E.reduce(function(N,p){const w=N.length-1>=0?N[N.length-1]:null;return w&&w.mode===p.mode?(N[N.length-1].data+=p.data,N):(N.push(p),N)},[])}function a(E){const N=[];for(let p=0;p=0&&k<=6&&(_===0||_===6)||_>=0&&_<=6&&(k===0||k===6)||k>=2&&k<=4&&_>=2&&_<=4?v.set(I+k,M+_,!0,!0):v.set(I+k,M+_,!1,!0))}}function a(v){const S=v.size;for(let C=8;C>k&1)===1,v.set(A,I,M,!0),v.set(I,A,M,!0)}function E(v,S,C){const y=v.size,A=m.getEncodedBits(S,C);let I,M;for(I=0;I<15;I++)M=(A>>I&1)===1,I<6?v.set(I,8,M,!0):I<8?v.set(I+1,8,M,!0):v.set(y-15+I,8,M,!0),I<8?v.set(8,y-I-1,M,!0):I<9?v.set(8,15-I-1+1,M,!0):v.set(8,15-I-1,M,!0);v.set(y-8,8,1,!0)}function N(v,S){const C=v.size;let y=-1,A=C-1,I=7,M=0;for(let k=C-1;k>0;k-=2)for(k===6&&k--;;){for(let _=0;_<2;_++)if(!v.isReserved(A,k-_)){let X=!1;M>>I&1)===1),v.set(A,k-_,X),I--,I===-1&&(M++,I=7)}if(A+=y,A<0||C<=A){A-=y,y=-y;break}}}function p(v,S,C){const y=new s;C.forEach(function(_){y.put(_.mode.bit,4),y.put(_.getLength(),g.getCharCountIndicator(_.mode,v)),_.write(y)});const A=o.getSymbolTotalCodewords(v),I=f.getTotalCodewordsCount(v,S),M=(A-I)*8;for(y.getLengthInBits()+4<=M&&y.put(0,4);y.getLengthInBits()%8!==0;)y.putBit(0);const k=(M-y.getLengthInBits())/8;for(let _=0;_=7&&h(_,S),N(_,M),isNaN(y)&&(y=l.getBestMask(_,E.bind(null,_,C))),l.applyMask(y,_),E(_,C,y),{modules:_,version:S,errorCorrectionLevel:C,maskPattern:y,segments:A}}return je.create=function(S,C){if(typeof S>"u"||S==="")throw new Error("No input text");let y=r.M,A,I;return typeof C<"u"&&(y=r.from(C.errorCorrectionLevel,r.M),A=b.from(C.version),I=l.from(C.maskPattern),C.toSJISFunc&&o.setToSJISFunction(C.toSJISFunc)),D(S,A,y,I)},je}var ut={},lt={},Jt;function un(){return Jt||(Jt=1,function(o){function r(s){if(typeof s=="number"&&(s=s.toString()),typeof s!="string")throw new Error("Color should be defined as hex string");let n=s.slice().replace("#","").split("");if(n.length<3||n.length===5||n.length>8)throw new Error("Invalid hex color: "+s);(n.length===3||n.length===4)&&(n=Array.prototype.concat.apply([],n.map(function(t){return[t,t]}))),n.length===6&&n.push("F","F");const e=parseInt(n.join(""),16);return{r:e>>24&255,g:e>>16&255,b:e>>8&255,a:e&255,hex:"#"+n.slice(0,6).join("")}}o.getOptions=function(n){n||(n={}),n.color||(n.color={});const e=typeof n.margin>"u"||n.margin===null||n.margin<0?4:n.margin,t=n.width&&n.width>=21?n.width:void 0,l=n.scale||4;return{width:t,scale:t?4:l,margin:e,color:{dark:r(n.color.dark||"#000000ff"),light:r(n.color.light||"#ffffffff")},type:n.type,rendererOpts:n.rendererOpts||{}}},o.getScale=function(n,e){return e.width&&e.width>=n+e.margin*2?e.width/(n+e.margin*2):e.scale},o.getImageWidth=function(n,e){const t=o.getScale(n,e);return Math.floor((n+e.margin*2)*t)},o.qrToImageData=function(n,e,t){const l=e.modules.size,f=e.modules.data,d=o.getScale(l,t),b=Math.floor((l+t.margin*2)*d),m=t.margin*d,g=[t.color.light,t.color.dark];for(let i=0;i=m&&u>=m&&i"u"&&(!l||!l.getContext)&&(d=l,l=void 0),l||(b=n()),d=r.getOptions(d);const m=r.getImageWidth(t.modules.size,d),g=b.getContext("2d"),i=g.createImageData(m,m);return r.qrToImageData(i.data,t,d),s(g,b,m),g.putImageData(i,0,0),b},o.renderToDataURL=function(t,l,f){let d=f;typeof d>"u"&&(!l||!l.getContext)&&(d=l,l=void 0),d||(d={});const b=o.render(t,l,d),m=d.type||"image/png",g=d.rendererOpts||{};return b.toDataURL(m,g.quality)}}(ut)),ut}var ct={},Qt;function Yn(){if(Qt)return ct;Qt=1;const o=un();function r(e,t){const l=e.a/255,f=t+'="'+e.hex+'"';return l<1?f+" "+t+'-opacity="'+l.toFixed(2).slice(1)+'"':f}function s(e,t,l){let f=e+t;return typeof l<"u"&&(f+=" "+l),f}function n(e,t,l){let f="",d=0,b=!1,m=0;for(let g=0;g0&&i>0&&e[g-1]||(f+=b?s("M",i+l,.5+u+l):s("m",d,0),d=0,b=!1),i+1':"",u="',a='viewBox="0 0 '+g+" "+g+'"',h=''+i+u+` -`;return typeof f=="function"&&f(null,h),h},ct}var Xt;function Jn(){if(Xt)return Ie;Xt=1;const o=_n(),r=$n(),s=Gn(),n=Yn();function e(t,l,f,d,b){const m=[].slice.call(arguments,1),g=m.length,i=typeof m[g-1]=="function";if(!i&&!o())throw new Error("Callback required as last argument");if(i){if(g<2)throw new Error("Too few arguments provided");g===2?(b=f,f=l,l=d=void 0):g===3&&(l.getContext&&typeof b>"u"?(b=d,d=void 0):(b=d,d=f,f=l,l=void 0))}else{if(g<1)throw new Error("Too few arguments provided");return g===1?(f=l,l=d=void 0):g===2&&!l.getContext&&(d=f,f=l,l=void 0),new Promise(function(u,a){try{const c=r.create(f,d);u(t(c,l,d))}catch(c){a(c)}})}try{const u=r.create(f,d);b(null,t(u,l,d))}catch(u){b(u)}}return Ie.create=r.create,Ie.toCanvas=e.bind(null,s.render),Ie.toDataURL=e.bind(null,s.renderToDataURL),Ie.toString=e.bind(null,function(t,l,f){return n.render(t,f)}),Ie}var Wn=Jn();const Qn=gn(Wn),Xn={class:"device-overview"},Zn={class:"flex flex-wrap items-start gap-4 mcrm-block block__light"},ei={class:"flex items-center justify-between w-full gap-4 mb-4"},ti={class:"flex gap-4"},ni={class:"grid gap-2"},ii={class:"grid grid-cols-[auto_1fr] gap-2"},ri={class:"w-full truncate"},oi={class:"grid py-4"},si={class:"space-y-2"},ai={class:"grid gap-4 py-4 pl-6"},ui={key:0},li={class:"inline-flex items-center gap-2"},ci={class:"p-1 border rounded-sm"},di={class:"inline-flex flex-wrap items-center gap-2 w-fit"},fi={class:"flex items-center gap-1 p-1 text-sm border rounded-sm"},gi={class:"grid gap-4"},hi={class:"font-mono text-4xl tracking-wide"},wi={__name:"ServerView",setup(o){const r=en(),s=xe(),n=xe(),e=ft({ip:""}),t=ft({devices:[],pinlink:!1,poll:!1});tn(async()=>{r.serverGetRemotes(),r.$subscribe((g,i)=>{i.remote!==t.devices&&(t.devices=r.remote)}),l()}),nn(()=>{l(),Object.keys(t.devices).length==0&&!t.poll&&(t.poll=setInterval(()=>{r.serverGetRemotes()},1e3)),Object.keys(t.devices).length>0&&t.poll&&(clearInterval(t.poll),t.poll=!1)});async function l(){const g=await r.serverGetIP();e.ip=g,Qn.toCanvas(n.value,`${e.ip}/devices`,i=>{i&&console.log("QRCode error: ",i)})}async function f(g){const i=await r.serverStartLink(g);t.pinlink={uuid:g,pin:i},s.value.toggleDialog(!0),d(),setTimeout(()=>{b()},6e4)}function d(){const g=setInterval(()=>{ht.post(wt()+"/device/link/poll",{uuid:t.pinlink.uuid}).then(i=>{i.data||(clearInterval(g),b(),r.serverGetRemotes())})},1e3)}function b(){t.pinlink=!1,s.value&&s.value.toggleDialog(!1)}function m(g){ht.post(wt()+"/device/link/remove",{uuid:g}).then(i=>{i.data&&r.serverGetRemotes()})}return(g,i)=>(z(),re("div",Xn,[O(ce,{variant:"info"},{default:V(()=>[i[1]||(i[1]=B("strong",null,"This is a server!",-1)),B("em",null,"UUID: "+J(F(r).uuid()),1)]),_:1}),B("div",Zn,[B("h4",ei,[B("span",ti,[O(F(hn)),q(J(Object.keys(t.devices).length)+" "+J(Object.keys(t.devices).length==1?"Device":"Devices"),1)]),t.poll?j("",!0):(z(),G(we,{key:0,variant:"primary",onClick:i[0]||(i[0]=u=>F(r).serverGetRemotes())},{default:V(()=>[O(F(Re))]),_:1}))]),Object.keys(t.devices).length>0?(z(!0),re(Fe,{key:0},wn(t.devices,(u,a)=>(z(),re("div",{key:a,class:"mcrm-block block__dark block-size__sm w-64 grid !gap-4 content-start"},[B("div",ni,[B("h5",ii,[u.settings.type=="unknown"?(z(),G(F(An),{key:0})):j("",!0),u.settings.type=="mobile"?(z(),G(F(In),{key:1})):j("",!0),u.settings.type=="tablet"?(z(),G(F(Sn),{key:2})):j("",!0),u.settings.type=="desktop"?(z(),G(F(Cn),{key:3})):j("",!0),B("span",ri,J(u.settings.name),1)]),B("em",null,J(a),1)]),u.key?(z(),re(Fe,{key:0},[O(ce,{variant:"success"},{default:V(()=>i[2]||(i[2]=[q("Authorized")])),_:1}),O(we,{variant:"danger",onClick:c=>m(a)},{default:V(()=>[O(F(Mn)),i[3]||(i[3]=q("Unlink device "))]),_:2},1032,["onClick"])],64)):(z(),re(Fe,{key:1},[O(ce,{variant:"warning"},{default:V(()=>i[4]||(i[4]=[q("Unauthorized")])),_:1}),O(we,{variant:"primary",onClick:c=>f(a)},{default:V(()=>[O(F(gt)),i[5]||(i[5]=q("Link device "))]),_:2},1032,["onClick"])],64)),t.pinlink.uuid==a?(z(),G(ce,{key:2,variant:"info"},{default:V(()=>[q("One time pin: "+J(t.pinlink.pin),1)]),_:1})):j("",!0)]))),128)):j("",!0),O(En,{class:"w-full mt-8 border-t border-t-white/50",title:"How to connect a device?",open:Object.keys(t.devices).length==0},{default:V(()=>[B("div",oi,[B("ul",si,[B("li",null,[i[8]||(i[8]=q(" Scan the QR code with the remote device. ")),B("div",ai,[B("canvas",{ref_key:"serverQr",ref:n},null,512),B("p",null,[i[6]||(i[6]=q(" Or manually type the IP address: ")),i[7]||(i[7]=B("br",null,null,-1)),B("strong",null,J(e.ip)+"/devices",1)])])]),i[14]||(i[14]=B("li",null,' The device will automatically request access, if you see "Access requested" on the device. ',-1)),t.poll?j("",!0):(z(),re("li",ui,[B("div",li,[i[9]||(i[9]=q(" Click the ")),B("span",ci,[O(F(Re),{class:"size-4"})]),i[10]||(i[10]=q(" to reload the devices. "))])])),B("li",null,[B("div",di,[i[12]||(i[12]=q(" Click on ")),B("span",fi,[O(F(gt),{class:"size-4"}),i[11]||(i[11]=q(" Link device "))]),i[13]||(i[13]=q(" A one-time-pin will be shown in a dialog. "))])]),i[15]||(i[15]=B("li",null,"Enter the pin on the remote device.",-1)),i[16]||(i[16]=B("li",null," Congratulations! You have linked a device! You can now start using panels on that device. ",-1))])])]),_:1},8,["open"]),O(rn,{ref_key:"pinDialog",ref:s},{content:V(()=>[B("div",gi,[i[17]||(i[17]=B("h3",null,"Pin code",-1)),B("span",hi,J(t.pinlink.pin),1)])]),_:1},512)])]))}},pi=mt(wi,[["__scopeId","data-v-0a3f2b41"]]);var mi=typeof globalThis<"u"?globalThis:typeof window<"u"?window:typeof global<"u"?global:typeof self<"u"?self:{};function bi(o){return o&&o.__esModule&&Object.prototype.hasOwnProperty.call(o,"default")?o.default:o}var pt={exports:{}};(function(o,r){(function(s,n){var e="1.0.37",t="",l="?",f="function",d="undefined",b="object",m="string",g="major",i="model",u="name",a="type",c="vendor",h="version",E="architecture",N="console",p="mobile",w="tablet",D="smarttv",v="wearable",S="embedded",C=500,y="Amazon",A="Apple",I="ASUS",M="BlackBerry",k="Browser",_="Chrome",X="Edge",Z="Firefox",ye="Google",Se="Huawei",Ae="LG",fe="Microsoft",ge="Motorola",he="Opera",se="Samsung",Ne="Sharp",ae="Sony",ke="Xiaomi",$="Zebra",Y="Facebook",ne="Chromium OS",Ee="Mac OS",cn=function(P,x){var T={};for(var U in P)x[U]&&x[U].length%2===0?T[U]=x[U].concat(P[U]):T[U]=P[U];return T},Pe=function(P){for(var x={},T=0;T0?L.length===2?typeof L[1]==f?this[L[0]]=L[1].call(this,ie):this[L[0]]=L[1]:L.length===3?typeof L[1]===f&&!(L[1].exec&&L[1].test)?this[L[0]]=ie?L[1].call(this,ie,L[2]):n:this[L[0]]=ie?ie.replace(L[1],L[2]):n:L.length===4&&(this[L[0]]=ie?L[3].call(this,ie.replace(L[1],L[2])):n):this[L]=ie||n;T+=2}},Oe=function(P,x){for(var T in x)if(typeof x[T]===b&&x[T].length>0){for(var U=0;U2&&(R[i]="iPad",R[a]=w),R},this.getEngine=function(){var R={};return R[u]=n,R[h]=n,Be.call(R,U,ee.engine),R},this.getOS=function(){var R={};return R[u]=n,R[h]=n,Be.call(R,U,ee.os),L&&!R[u]&&ue&&ue.platform!="Unknown"&&(R[u]=ue.platform.replace(/chrome os/i,ne).replace(/macos/i,Ee)),R},this.getResult=function(){return{ua:this.getUA(),browser:this.getBrowser(),engine:this.getEngine(),os:this.getOS(),device:this.getDevice(),cpu:this.getCPU()}},this.getUA=function(){return U},this.setUA=function(R){return U=typeof R===m&&R.length>C?qe(R,C):R,this},this.setUA(U),this};Q.VERSION=e,Q.BROWSER=Pe([u,h,g]),Q.CPU=Pe([E]),Q.DEVICE=Pe([i,c,a,N,p,D,w,v,S]),Q.ENGINE=Q.OS=Pe([u,h]),o.exports&&(r=o.exports=Q),r.UAParser=Q;var Ce=typeof s!==d&&(s.jQuery||s.Zepto);if(Ce&&!Ce.ua){var De=new Q;Ce.ua=De.getResult(),Ce.ua.get=function(){return De.getUA()},Ce.ua.set=function(P){De.setUA(P);var x=De.getResult();for(var T in x)Ce.ua[T]=x[T]}}})(typeof window=="object"?window:mi)})(pt,pt.exports);var vi=pt.exports;const yi=bi(vi),oe={CONSOLE:"console",DESKTOP:void 0,EMBEDDED:"embedded",MOBILE:"mobile",SMART_TV:"smarttv",TABLET:"tablet",WEARABLE:"wearable"},ve={ANDROID:"Android",IOS:"iOS",LINUX:"Linux",MAC_OS:"Mac OS",WINDOWS_PHONE:"Windows Phone",WINDOWS:"Windows"},H={CHROME:"Chrome",CHROMIUM:"Chromium",EDGE:"Edge",FIREFOX:"Firefox",IE:"IE",INTERNET_EXPLORER:"Internet Explorer",MIUI:"MIUI Browser",MOBILE_SAFARI:"Mobile Safari",OPERA:"Opera",SAFARI:"Safari",SAMSUNG_BROWSER:"Samsung Browser",YANDEX:"Yandex"},Te=new yi,W=Te.getDevice(),de=Te.getOS(),K=Te.getBrowser();Te.getEngine();const vt=Te.getUA(),Ue=()=>/iPad/.test(vt),ln=()=>de.name===ve.WINDOWS&&de.version==="10"&&vt.indexOf("Edg/")!==-1;de.name,ve.ANDROID;K.name,H.CHROME;K.name,H.CHROMIUM;W.type,oe.CONSOLE;W.type,oe.DESKTOP;K.name===H.EDGE||ln();ln();K.name,H.EDGE;/electron/.test(vt.toLowerCase());W.type,oe.EMBEDDED;K.name,H.FIREFOX;K.name===H.INTERNET_EXPLORER||(K.name,H.IE);de.name===ve.IOS||Ue();de.name,ve.LINUX;de.name,ve.MAC_OS;K.name,H.MIUI;W.type===oe.MOBILE||W.type===oe.TABLET||Ue();W.type,oe.MOBILE;K.name===H.MOBILE_SAFARI||Ue();K.name,H.OPERA;K.name===H.SAFARI||(K.name,H.MOBILE_SAFARI);K.name,H.SAMSUNG_BROWSER;W.type,oe.SMART_TV;W.type===oe.TABLET||Ue();W.type,oe.WEARABLE;de.name,ve.WINDOWS;de.name,ve.WINDOWS_PHONE;K.name,H.YANDEX;const ki=()=>W.model,Zt=()=>W.type||"desktop",dt=()=>W.vendor,Ei={class:"server-overview"},Ci={class:"grid gap-4 mcrm-block block__light"},Ii={class:"flex items-center justify-between gap-4 text-lg"},Si={class:"flex gap-4"},Ai={class:"grid gap-2"},Mi={class:"mb-4"},Bi={class:"font-semibold"},_i={class:"inline-flex flex-wrap items-center gap-2 w-fit"},Ri={class:"flex items-center gap-1 p-1 text-sm border rounded-sm"},Ti={key:0,class:"grid grid-cols-[2rem_1fr] gap-2"},Ni={class:"grid w-64 gap-4"},Pi={__name:"RemoteView",setup(o){const r=en(),s=xe(),n=xe(),e=ft({host:"",port:window.__CONFIG__.MCRM__PORT,status:!1,link:!1,inputPin:"",encryptedKey:"",key:""});tn(async()=>{e.host=window.location.host}),nn(()=>{e.status||t(),e.status==="authorized"&&e.inputPin&&(e.inputPin="")});async function t(m=!0){const g=await r.remoteCheckServerAccess();return e.status=g,g==="unlinked"||g==="unauthorized"?(m&&l(),!0):r.key()?(await r.remoteHandshake(r.key())?e.key=r.key():(r.removeDeviceKey(),e.status="unlinked",m&&l()),!0):(e.status="unauthorized",!0)}function l(){let m=`${dt()?dt():"Unknown"} ${dt()?ki():Zt()}`;r.remoteRequestServerAccess(m,Zt()).then(g=>{g.data&&(e.status=g.data,f())})}function f(){e.link="checking",r.remotePingLink(m=>{e.link=!0,e.encryptedKey=m,s.value.toggleDialog(!0),n.value.focus()})}async function d(){const m=kn(e.inputPin,e.encryptedKey);await r.remoteHandshake(m)&&(r.setDeviceKey(m),e.key=m,s.value.toggleDialog(!1),e.status="authorized")}function b(){ht.post(wt()+"/device/link/remove",yn({uuid:r.uuid()})).then(m=>{m.data&&t(!1)})}return(m,g)=>(z(),re("div",Ei,[O(ce,{variant:"info"},{default:V(()=>[g[5]||(g[5]=B("strong",null,"This is a remote device.",-1)),B("em",null,"UUID: "+J(F(r).uuid()),1)]),_:1}),B("div",Ci,[B("h4",Ii,[B("span",Si,[O(F(pn)),g[6]||(g[6]=q("Server"))]),O(we,{variant:"primary",onClick:g[0]||(g[0]=i=>t())},{default:V(()=>[O(F(Re))]),_:1})]),B("p",null,[g[7]||(g[7]=q(" Connected to: ")),B("strong",null,J(e.host),1)]),e.status==="authorized"?(z(),G(ce,{key:0,variant:"success"},{default:V(()=>g[8]||(g[8]=[q("Authorized")])),_:1})):j("",!0),e.status==="unlinked"?(z(),G(ce,{key:1,variant:"warning"},{default:V(()=>g[9]||(g[9]=[q("Not linked")])),_:1})):j("",!0),e.status==="unauthorized"?(z(),G(ce,{key:2,variant:"info"},{default:V(()=>[B("div",Ai,[g[17]||(g[17]=B("strong",null,"Access requested",-1)),B("ul",Mi,[B("li",null,[g[10]||(g[10]=q(" Navigate to ")),B("em",Bi,"http://localhost:"+J(e.port)+"/devices",1),g[11]||(g[11]=q(". "))]),B("li",null,[B("div",_i,[g[13]||(g[13]=q(" Click on ")),B("span",Ri,[O(F(gt),{class:"size-4"}),g[12]||(g[12]=q(" Link device "))])])]),g[14]||(g[14]=B("li",null,"Enter the the pin shown on the desktop in the dialog that will appear.",-1))]),e.link=="checking"?(z(),re("div",Ti,[O(F(Re),{class:"animate-spin"}),g[15]||(g[15]=q(" Checking server for link... "))])):j("",!0),e.link===!1?(z(),G(we,{key:1,variant:"subtle",onClick:g[1]||(g[1]=i=>f()),class:"w-fit"},{default:V(()=>[O(F(Re)),g[16]||(g[16]=q("Check for server link "))]),_:1})):j("",!0)])]),_:1})):j("",!0),e.status==="authorized"?(z(),G(we,{key:3,variant:"danger",onClick:g[2]||(g[2]=i=>b())},{default:V(()=>[O(F(Bn)),g[18]||(g[18]=q(" Disconnect "))]),_:1})):j("",!0)]),O(rn,{ref_key:"linkPinDialog",ref:s},{content:V(()=>[B("div",Ni,[g[20]||(g[20]=B("h3",null,"Server link pin:",-1)),B("form",{class:"grid gap-4",onSubmit:g[4]||(g[4]=mn(i=>d(),["prevent"]))},[bn(B("input",{ref_key:"linkPinInput",ref:n,class:"input",id:"input-pin",type:"text",pattern:"[0-9]{4}","onUpdate:modelValue":g[3]||(g[3]=i=>e.inputPin=i),autocomplete:"off"},null,512),[[vn,e.inputPin]]),O(we,{variant:"primary"},{default:V(()=>g[19]||(g[19]=[q("Enter")])),_:1})],32)])]),_:1},512)]))}},Di=mt(Pi,[["__scopeId","data-v-6973a9f0"]]),Li={id:"devices-view",class:"panel"},xi={class:"panel__title"},Ui={class:"grid gap-8 pr-2 panel__content"},qi={__name:"DevicesView",setup(o){return(r,s)=>(z(),re("div",Li,[B("h1",xi,J(F(It)()?"Remote devices":"Server"),1),B("div",Ui,[F(It)()?(z(),G(pi,{key:0})):(z(),G(Di,{key:1}))])]))}},Vi=mt(qi,[["__scopeId","data-v-860af40f"]]);export{Vi as default}; -//# sourceMappingURL=DevicesView-C9HVDkwf.js.map diff --git a/public/assets/DevicesView-C9HVDkwf.js.map b/public/assets/DevicesView-C9HVDkwf.js.map deleted file mode 100644 index 64b106d..0000000 --- a/public/assets/DevicesView-C9HVDkwf.js.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"file":"DevicesView-C9HVDkwf.js","sources":["../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconDeviceDesktop.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconDeviceMobile.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconDeviceTablet.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconDeviceUnknown.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconLinkOff.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconPlugConnectedX.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconReload.mjs","../../ui/node_modules/qrcode/lib/can-promise.js","../../ui/node_modules/qrcode/lib/core/utils.js","../../ui/node_modules/qrcode/lib/core/error-correction-level.js","../../ui/node_modules/qrcode/lib/core/bit-buffer.js","../../ui/node_modules/qrcode/lib/core/bit-matrix.js","../../ui/node_modules/qrcode/lib/core/alignment-pattern.js","../../ui/node_modules/qrcode/lib/core/finder-pattern.js","../../ui/node_modules/qrcode/lib/core/mask-pattern.js","../../ui/node_modules/qrcode/lib/core/error-correction-code.js","../../ui/node_modules/qrcode/lib/core/galois-field.js","../../ui/node_modules/qrcode/lib/core/polynomial.js","../../ui/node_modules/qrcode/lib/core/reed-solomon-encoder.js","../../ui/node_modules/qrcode/lib/core/version-check.js","../../ui/node_modules/qrcode/lib/core/regex.js","../../ui/node_modules/qrcode/lib/core/mode.js","../../ui/node_modules/qrcode/lib/core/version.js","../../ui/node_modules/qrcode/lib/core/format-info.js","../../ui/node_modules/qrcode/lib/core/numeric-data.js","../../ui/node_modules/qrcode/lib/core/alphanumeric-data.js","../../ui/node_modules/qrcode/lib/core/byte-data.js","../../ui/node_modules/qrcode/lib/core/kanji-data.js","../../ui/node_modules/dijkstrajs/dijkstra.js","../../ui/node_modules/qrcode/lib/core/segments.js","../../ui/node_modules/qrcode/lib/core/qrcode.js","../../ui/node_modules/qrcode/lib/renderer/utils.js","../../ui/node_modules/qrcode/lib/renderer/canvas.js","../../ui/node_modules/qrcode/lib/renderer/svg-tag.js","../../ui/node_modules/qrcode/lib/browser.js","../../ui/src/components/devices/ServerView.vue","../../ui/node_modules/@basitcodeenv/vue3-device-detect/dist/vue3-device-detect.js","../../ui/src/components/devices/RemoteView.vue"],"sourcesContent":["/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconDeviceDesktop = createVueComponent(\"outline\", \"device-desktop\", \"IconDeviceDesktop\", [[\"path\", { \"d\": \"M3 5a1 1 0 0 1 1 -1h16a1 1 0 0 1 1 1v10a1 1 0 0 1 -1 1h-16a1 1 0 0 1 -1 -1v-10z\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M7 20h10\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M9 16v4\", \"key\": \"svg-2\" }], [\"path\", { \"d\": \"M15 16v4\", \"key\": \"svg-3\" }]]);\n\nexport { IconDeviceDesktop as default };\n//# sourceMappingURL=IconDeviceDesktop.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconDeviceMobile = createVueComponent(\"outline\", \"device-mobile\", \"IconDeviceMobile\", [[\"path\", { \"d\": \"M6 5a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v14a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2v-14z\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M11 4h2\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M12 17v.01\", \"key\": \"svg-2\" }]]);\n\nexport { IconDeviceMobile as default };\n//# sourceMappingURL=IconDeviceMobile.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconDeviceTablet = createVueComponent(\"outline\", \"device-tablet\", \"IconDeviceTablet\", [[\"path\", { \"d\": \"M5 4a1 1 0 0 1 1 -1h12a1 1 0 0 1 1 1v16a1 1 0 0 1 -1 1h-12a1 1 0 0 1 -1 -1v-16z\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M11 17a1 1 0 1 0 2 0a1 1 0 0 0 -2 0\", \"key\": \"svg-1\" }]]);\n\nexport { IconDeviceTablet as default };\n//# sourceMappingURL=IconDeviceTablet.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconDeviceUnknown = createVueComponent(\"outline\", \"device-unknown\", \"IconDeviceUnknown\", [[\"path\", { \"d\": \"M5 5a2 2 0 0 1 2 -2h10a2 2 0 0 1 2 2v14a2 2 0 0 1 -2 2h-10a2 2 0 0 1 -2 -2z\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M12 16v.01\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M12 13a2 2 0 0 0 .914 -3.782a1.98 1.98 0 0 0 -2.414 .483\", \"key\": \"svg-2\" }]]);\n\nexport { IconDeviceUnknown as default };\n//# sourceMappingURL=IconDeviceUnknown.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconLinkOff = createVueComponent(\"outline\", \"link-off\", \"IconLinkOff\", [[\"path\", { \"d\": \"M9 15l3 -3m2 -2l1 -1\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M11 6l.463 -.536a5 5 0 0 1 7.071 7.072l-.534 .464\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M3 3l18 18\", \"key\": \"svg-2\" }], [\"path\", { \"d\": \"M13 18l-.397 .534a5.068 5.068 0 0 1 -7.127 0a4.972 4.972 0 0 1 0 -7.071l.524 -.463\", \"key\": \"svg-3\" }]]);\n\nexport { IconLinkOff as default };\n//# sourceMappingURL=IconLinkOff.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconPlugConnectedX = createVueComponent(\"outline\", \"plug-connected-x\", \"IconPlugConnectedX\", [[\"path\", { \"d\": \"M20 16l-4 4\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M7 12l5 5l-1.5 1.5a3.536 3.536 0 1 1 -5 -5l1.5 -1.5z\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M17 12l-5 -5l1.5 -1.5a3.536 3.536 0 1 1 5 5l-1.5 1.5z\", \"key\": \"svg-2\" }], [\"path\", { \"d\": \"M3 21l2.5 -2.5\", \"key\": \"svg-3\" }], [\"path\", { \"d\": \"M18.5 5.5l2.5 -2.5\", \"key\": \"svg-4\" }], [\"path\", { \"d\": \"M10 11l-2 2\", \"key\": \"svg-5\" }], [\"path\", { \"d\": \"M13 14l-2 2\", \"key\": \"svg-6\" }], [\"path\", { \"d\": \"M16 16l4 4\", \"key\": \"svg-7\" }]]);\n\nexport { IconPlugConnectedX as default };\n//# sourceMappingURL=IconPlugConnectedX.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconReload = createVueComponent(\"outline\", \"reload\", \"IconReload\", [[\"path\", { \"d\": \"M19.933 13.041a8 8 0 1 1 -9.925 -8.788c3.899 -1 7.935 1.007 9.425 4.747\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M20 4v5h-5\", \"key\": \"svg-1\" }]]);\n\nexport { IconReload as default };\n//# sourceMappingURL=IconReload.mjs.map\n","// can-promise has a crash in some versions of react native that dont have\n// standard global objects\n// https://github.com/soldair/node-qrcode/issues/157\n\nmodule.exports = function () {\n return typeof Promise === 'function' && Promise.prototype && Promise.prototype.then\n}\n","let toSJISFunction\nconst CODEWORDS_COUNT = [\n 0, // Not used\n 26, 44, 70, 100, 134, 172, 196, 242, 292, 346,\n 404, 466, 532, 581, 655, 733, 815, 901, 991, 1085,\n 1156, 1258, 1364, 1474, 1588, 1706, 1828, 1921, 2051, 2185,\n 2323, 2465, 2611, 2761, 2876, 3034, 3196, 3362, 3532, 3706\n]\n\n/**\n * Returns the QR Code size for the specified version\n *\n * @param {Number} version QR Code version\n * @return {Number} size of QR code\n */\nexports.getSymbolSize = function getSymbolSize (version) {\n if (!version) throw new Error('\"version\" cannot be null or undefined')\n if (version < 1 || version > 40) throw new Error('\"version\" should be in range from 1 to 40')\n return version * 4 + 17\n}\n\n/**\n * Returns the total number of codewords used to store data and EC information.\n *\n * @param {Number} version QR Code version\n * @return {Number} Data length in bits\n */\nexports.getSymbolTotalCodewords = function getSymbolTotalCodewords (version) {\n return CODEWORDS_COUNT[version]\n}\n\n/**\n * Encode data with Bose-Chaudhuri-Hocquenghem\n *\n * @param {Number} data Value to encode\n * @return {Number} Encoded value\n */\nexports.getBCHDigit = function (data) {\n let digit = 0\n\n while (data !== 0) {\n digit++\n data >>>= 1\n }\n\n return digit\n}\n\nexports.setToSJISFunction = function setToSJISFunction (f) {\n if (typeof f !== 'function') {\n throw new Error('\"toSJISFunc\" is not a valid function.')\n }\n\n toSJISFunction = f\n}\n\nexports.isKanjiModeEnabled = function () {\n return typeof toSJISFunction !== 'undefined'\n}\n\nexports.toSJIS = function toSJIS (kanji) {\n return toSJISFunction(kanji)\n}\n","exports.L = { bit: 1 }\nexports.M = { bit: 0 }\nexports.Q = { bit: 3 }\nexports.H = { bit: 2 }\n\nfunction fromString (string) {\n if (typeof string !== 'string') {\n throw new Error('Param is not a string')\n }\n\n const lcStr = string.toLowerCase()\n\n switch (lcStr) {\n case 'l':\n case 'low':\n return exports.L\n\n case 'm':\n case 'medium':\n return exports.M\n\n case 'q':\n case 'quartile':\n return exports.Q\n\n case 'h':\n case 'high':\n return exports.H\n\n default:\n throw new Error('Unknown EC Level: ' + string)\n }\n}\n\nexports.isValid = function isValid (level) {\n return level && typeof level.bit !== 'undefined' &&\n level.bit >= 0 && level.bit < 4\n}\n\nexports.from = function from (value, defaultValue) {\n if (exports.isValid(value)) {\n return value\n }\n\n try {\n return fromString(value)\n } catch (e) {\n return defaultValue\n }\n}\n","function BitBuffer () {\n this.buffer = []\n this.length = 0\n}\n\nBitBuffer.prototype = {\n\n get: function (index) {\n const bufIndex = Math.floor(index / 8)\n return ((this.buffer[bufIndex] >>> (7 - index % 8)) & 1) === 1\n },\n\n put: function (num, length) {\n for (let i = 0; i < length; i++) {\n this.putBit(((num >>> (length - i - 1)) & 1) === 1)\n }\n },\n\n getLengthInBits: function () {\n return this.length\n },\n\n putBit: function (bit) {\n const bufIndex = Math.floor(this.length / 8)\n if (this.buffer.length <= bufIndex) {\n this.buffer.push(0)\n }\n\n if (bit) {\n this.buffer[bufIndex] |= (0x80 >>> (this.length % 8))\n }\n\n this.length++\n }\n}\n\nmodule.exports = BitBuffer\n","/**\n * Helper class to handle QR Code symbol modules\n *\n * @param {Number} size Symbol size\n */\nfunction BitMatrix (size) {\n if (!size || size < 1) {\n throw new Error('BitMatrix size must be defined and greater than 0')\n }\n\n this.size = size\n this.data = new Uint8Array(size * size)\n this.reservedBit = new Uint8Array(size * size)\n}\n\n/**\n * Set bit value at specified location\n * If reserved flag is set, this bit will be ignored during masking process\n *\n * @param {Number} row\n * @param {Number} col\n * @param {Boolean} value\n * @param {Boolean} reserved\n */\nBitMatrix.prototype.set = function (row, col, value, reserved) {\n const index = row * this.size + col\n this.data[index] = value\n if (reserved) this.reservedBit[index] = true\n}\n\n/**\n * Returns bit value at specified location\n *\n * @param {Number} row\n * @param {Number} col\n * @return {Boolean}\n */\nBitMatrix.prototype.get = function (row, col) {\n return this.data[row * this.size + col]\n}\n\n/**\n * Applies xor operator at specified location\n * (used during masking process)\n *\n * @param {Number} row\n * @param {Number} col\n * @param {Boolean} value\n */\nBitMatrix.prototype.xor = function (row, col, value) {\n this.data[row * this.size + col] ^= value\n}\n\n/**\n * Check if bit at specified location is reserved\n *\n * @param {Number} row\n * @param {Number} col\n * @return {Boolean}\n */\nBitMatrix.prototype.isReserved = function (row, col) {\n return this.reservedBit[row * this.size + col]\n}\n\nmodule.exports = BitMatrix\n","/**\n * Alignment pattern are fixed reference pattern in defined positions\n * in a matrix symbology, which enables the decode software to re-synchronise\n * the coordinate mapping of the image modules in the event of moderate amounts\n * of distortion of the image.\n *\n * Alignment patterns are present only in QR Code symbols of version 2 or larger\n * and their number depends on the symbol version.\n */\n\nconst getSymbolSize = require('./utils').getSymbolSize\n\n/**\n * Calculate the row/column coordinates of the center module of each alignment pattern\n * for the specified QR Code version.\n *\n * The alignment patterns are positioned symmetrically on either side of the diagonal\n * running from the top left corner of the symbol to the bottom right corner.\n *\n * Since positions are simmetrical only half of the coordinates are returned.\n * Each item of the array will represent in turn the x and y coordinate.\n * @see {@link getPositions}\n *\n * @param {Number} version QR Code version\n * @return {Array} Array of coordinate\n */\nexports.getRowColCoords = function getRowColCoords (version) {\n if (version === 1) return []\n\n const posCount = Math.floor(version / 7) + 2\n const size = getSymbolSize(version)\n const intervals = size === 145 ? 26 : Math.ceil((size - 13) / (2 * posCount - 2)) * 2\n const positions = [size - 7] // Last coord is always (size - 7)\n\n for (let i = 1; i < posCount - 1; i++) {\n positions[i] = positions[i - 1] - intervals\n }\n\n positions.push(6) // First coord is always 6\n\n return positions.reverse()\n}\n\n/**\n * Returns an array containing the positions of each alignment pattern.\n * Each array's element represent the center point of the pattern as (x, y) coordinates\n *\n * Coordinates are calculated expanding the row/column coordinates returned by {@link getRowColCoords}\n * and filtering out the items that overlaps with finder pattern\n *\n * @example\n * For a Version 7 symbol {@link getRowColCoords} returns values 6, 22 and 38.\n * The alignment patterns, therefore, are to be centered on (row, column)\n * positions (6,22), (22,6), (22,22), (22,38), (38,22), (38,38).\n * Note that the coordinates (6,6), (6,38), (38,6) are occupied by finder patterns\n * and are not therefore used for alignment patterns.\n *\n * let pos = getPositions(7)\n * // [[6,22], [22,6], [22,22], [22,38], [38,22], [38,38]]\n *\n * @param {Number} version QR Code version\n * @return {Array} Array of coordinates\n */\nexports.getPositions = function getPositions (version) {\n const coords = []\n const pos = exports.getRowColCoords(version)\n const posLength = pos.length\n\n for (let i = 0; i < posLength; i++) {\n for (let j = 0; j < posLength; j++) {\n // Skip if position is occupied by finder patterns\n if ((i === 0 && j === 0) || // top-left\n (i === 0 && j === posLength - 1) || // bottom-left\n (i === posLength - 1 && j === 0)) { // top-right\n continue\n }\n\n coords.push([pos[i], pos[j]])\n }\n }\n\n return coords\n}\n","const getSymbolSize = require('./utils').getSymbolSize\nconst FINDER_PATTERN_SIZE = 7\n\n/**\n * Returns an array containing the positions of each finder pattern.\n * Each array's element represent the top-left point of the pattern as (x, y) coordinates\n *\n * @param {Number} version QR Code version\n * @return {Array} Array of coordinates\n */\nexports.getPositions = function getPositions (version) {\n const size = getSymbolSize(version)\n\n return [\n // top-left\n [0, 0],\n // top-right\n [size - FINDER_PATTERN_SIZE, 0],\n // bottom-left\n [0, size - FINDER_PATTERN_SIZE]\n ]\n}\n","/**\n * Data mask pattern reference\n * @type {Object}\n */\nexports.Patterns = {\n PATTERN000: 0,\n PATTERN001: 1,\n PATTERN010: 2,\n PATTERN011: 3,\n PATTERN100: 4,\n PATTERN101: 5,\n PATTERN110: 6,\n PATTERN111: 7\n}\n\n/**\n * Weighted penalty scores for the undesirable features\n * @type {Object}\n */\nconst PenaltyScores = {\n N1: 3,\n N2: 3,\n N3: 40,\n N4: 10\n}\n\n/**\n * Check if mask pattern value is valid\n *\n * @param {Number} mask Mask pattern\n * @return {Boolean} true if valid, false otherwise\n */\nexports.isValid = function isValid (mask) {\n return mask != null && mask !== '' && !isNaN(mask) && mask >= 0 && mask <= 7\n}\n\n/**\n * Returns mask pattern from a value.\n * If value is not valid, returns undefined\n *\n * @param {Number|String} value Mask pattern value\n * @return {Number} Valid mask pattern or undefined\n */\nexports.from = function from (value) {\n return exports.isValid(value) ? parseInt(value, 10) : undefined\n}\n\n/**\n* Find adjacent modules in row/column with the same color\n* and assign a penalty value.\n*\n* Points: N1 + i\n* i is the amount by which the number of adjacent modules of the same color exceeds 5\n*/\nexports.getPenaltyN1 = function getPenaltyN1 (data) {\n const size = data.size\n let points = 0\n let sameCountCol = 0\n let sameCountRow = 0\n let lastCol = null\n let lastRow = null\n\n for (let row = 0; row < size; row++) {\n sameCountCol = sameCountRow = 0\n lastCol = lastRow = null\n\n for (let col = 0; col < size; col++) {\n let module = data.get(row, col)\n if (module === lastCol) {\n sameCountCol++\n } else {\n if (sameCountCol >= 5) points += PenaltyScores.N1 + (sameCountCol - 5)\n lastCol = module\n sameCountCol = 1\n }\n\n module = data.get(col, row)\n if (module === lastRow) {\n sameCountRow++\n } else {\n if (sameCountRow >= 5) points += PenaltyScores.N1 + (sameCountRow - 5)\n lastRow = module\n sameCountRow = 1\n }\n }\n\n if (sameCountCol >= 5) points += PenaltyScores.N1 + (sameCountCol - 5)\n if (sameCountRow >= 5) points += PenaltyScores.N1 + (sameCountRow - 5)\n }\n\n return points\n}\n\n/**\n * Find 2x2 blocks with the same color and assign a penalty value\n *\n * Points: N2 * (m - 1) * (n - 1)\n */\nexports.getPenaltyN2 = function getPenaltyN2 (data) {\n const size = data.size\n let points = 0\n\n for (let row = 0; row < size - 1; row++) {\n for (let col = 0; col < size - 1; col++) {\n const last = data.get(row, col) +\n data.get(row, col + 1) +\n data.get(row + 1, col) +\n data.get(row + 1, col + 1)\n\n if (last === 4 || last === 0) points++\n }\n }\n\n return points * PenaltyScores.N2\n}\n\n/**\n * Find 1:1:3:1:1 ratio (dark:light:dark:light:dark) pattern in row/column,\n * preceded or followed by light area 4 modules wide\n *\n * Points: N3 * number of pattern found\n */\nexports.getPenaltyN3 = function getPenaltyN3 (data) {\n const size = data.size\n let points = 0\n let bitsCol = 0\n let bitsRow = 0\n\n for (let row = 0; row < size; row++) {\n bitsCol = bitsRow = 0\n for (let col = 0; col < size; col++) {\n bitsCol = ((bitsCol << 1) & 0x7FF) | data.get(row, col)\n if (col >= 10 && (bitsCol === 0x5D0 || bitsCol === 0x05D)) points++\n\n bitsRow = ((bitsRow << 1) & 0x7FF) | data.get(col, row)\n if (col >= 10 && (bitsRow === 0x5D0 || bitsRow === 0x05D)) points++\n }\n }\n\n return points * PenaltyScores.N3\n}\n\n/**\n * Calculate proportion of dark modules in entire symbol\n *\n * Points: N4 * k\n *\n * k is the rating of the deviation of the proportion of dark modules\n * in the symbol from 50% in steps of 5%\n */\nexports.getPenaltyN4 = function getPenaltyN4 (data) {\n let darkCount = 0\n const modulesCount = data.data.length\n\n for (let i = 0; i < modulesCount; i++) darkCount += data.data[i]\n\n const k = Math.abs(Math.ceil((darkCount * 100 / modulesCount) / 5) - 10)\n\n return k * PenaltyScores.N4\n}\n\n/**\n * Return mask value at given position\n *\n * @param {Number} maskPattern Pattern reference value\n * @param {Number} i Row\n * @param {Number} j Column\n * @return {Boolean} Mask value\n */\nfunction getMaskAt (maskPattern, i, j) {\n switch (maskPattern) {\n case exports.Patterns.PATTERN000: return (i + j) % 2 === 0\n case exports.Patterns.PATTERN001: return i % 2 === 0\n case exports.Patterns.PATTERN010: return j % 3 === 0\n case exports.Patterns.PATTERN011: return (i + j) % 3 === 0\n case exports.Patterns.PATTERN100: return (Math.floor(i / 2) + Math.floor(j / 3)) % 2 === 0\n case exports.Patterns.PATTERN101: return (i * j) % 2 + (i * j) % 3 === 0\n case exports.Patterns.PATTERN110: return ((i * j) % 2 + (i * j) % 3) % 2 === 0\n case exports.Patterns.PATTERN111: return ((i * j) % 3 + (i + j) % 2) % 2 === 0\n\n default: throw new Error('bad maskPattern:' + maskPattern)\n }\n}\n\n/**\n * Apply a mask pattern to a BitMatrix\n *\n * @param {Number} pattern Pattern reference number\n * @param {BitMatrix} data BitMatrix data\n */\nexports.applyMask = function applyMask (pattern, data) {\n const size = data.size\n\n for (let col = 0; col < size; col++) {\n for (let row = 0; row < size; row++) {\n if (data.isReserved(row, col)) continue\n data.xor(row, col, getMaskAt(pattern, row, col))\n }\n }\n}\n\n/**\n * Returns the best mask pattern for data\n *\n * @param {BitMatrix} data\n * @return {Number} Mask pattern reference number\n */\nexports.getBestMask = function getBestMask (data, setupFormatFunc) {\n const numPatterns = Object.keys(exports.Patterns).length\n let bestPattern = 0\n let lowerPenalty = Infinity\n\n for (let p = 0; p < numPatterns; p++) {\n setupFormatFunc(p)\n exports.applyMask(p, data)\n\n // Calculate penalty\n const penalty =\n exports.getPenaltyN1(data) +\n exports.getPenaltyN2(data) +\n exports.getPenaltyN3(data) +\n exports.getPenaltyN4(data)\n\n // Undo previously applied mask\n exports.applyMask(p, data)\n\n if (penalty < lowerPenalty) {\n lowerPenalty = penalty\n bestPattern = p\n }\n }\n\n return bestPattern\n}\n","const ECLevel = require('./error-correction-level')\r\n\r\nconst EC_BLOCKS_TABLE = [\r\n// L M Q H\r\n 1, 1, 1, 1,\r\n 1, 1, 1, 1,\r\n 1, 1, 2, 2,\r\n 1, 2, 2, 4,\r\n 1, 2, 4, 4,\r\n 2, 4, 4, 4,\r\n 2, 4, 6, 5,\r\n 2, 4, 6, 6,\r\n 2, 5, 8, 8,\r\n 4, 5, 8, 8,\r\n 4, 5, 8, 11,\r\n 4, 8, 10, 11,\r\n 4, 9, 12, 16,\r\n 4, 9, 16, 16,\r\n 6, 10, 12, 18,\r\n 6, 10, 17, 16,\r\n 6, 11, 16, 19,\r\n 6, 13, 18, 21,\r\n 7, 14, 21, 25,\r\n 8, 16, 20, 25,\r\n 8, 17, 23, 25,\r\n 9, 17, 23, 34,\r\n 9, 18, 25, 30,\r\n 10, 20, 27, 32,\r\n 12, 21, 29, 35,\r\n 12, 23, 34, 37,\r\n 12, 25, 34, 40,\r\n 13, 26, 35, 42,\r\n 14, 28, 38, 45,\r\n 15, 29, 40, 48,\r\n 16, 31, 43, 51,\r\n 17, 33, 45, 54,\r\n 18, 35, 48, 57,\r\n 19, 37, 51, 60,\r\n 19, 38, 53, 63,\r\n 20, 40, 56, 66,\r\n 21, 43, 59, 70,\r\n 22, 45, 62, 74,\r\n 24, 47, 65, 77,\r\n 25, 49, 68, 81\r\n]\r\n\r\nconst EC_CODEWORDS_TABLE = [\r\n// L M Q H\r\n 7, 10, 13, 17,\r\n 10, 16, 22, 28,\r\n 15, 26, 36, 44,\r\n 20, 36, 52, 64,\r\n 26, 48, 72, 88,\r\n 36, 64, 96, 112,\r\n 40, 72, 108, 130,\r\n 48, 88, 132, 156,\r\n 60, 110, 160, 192,\r\n 72, 130, 192, 224,\r\n 80, 150, 224, 264,\r\n 96, 176, 260, 308,\r\n 104, 198, 288, 352,\r\n 120, 216, 320, 384,\r\n 132, 240, 360, 432,\r\n 144, 280, 408, 480,\r\n 168, 308, 448, 532,\r\n 180, 338, 504, 588,\r\n 196, 364, 546, 650,\r\n 224, 416, 600, 700,\r\n 224, 442, 644, 750,\r\n 252, 476, 690, 816,\r\n 270, 504, 750, 900,\r\n 300, 560, 810, 960,\r\n 312, 588, 870, 1050,\r\n 336, 644, 952, 1110,\r\n 360, 700, 1020, 1200,\r\n 390, 728, 1050, 1260,\r\n 420, 784, 1140, 1350,\r\n 450, 812, 1200, 1440,\r\n 480, 868, 1290, 1530,\r\n 510, 924, 1350, 1620,\r\n 540, 980, 1440, 1710,\r\n 570, 1036, 1530, 1800,\r\n 570, 1064, 1590, 1890,\r\n 600, 1120, 1680, 1980,\r\n 630, 1204, 1770, 2100,\r\n 660, 1260, 1860, 2220,\r\n 720, 1316, 1950, 2310,\r\n 750, 1372, 2040, 2430\r\n]\r\n\r\n/**\r\n * Returns the number of error correction block that the QR Code should contain\r\n * for the specified version and error correction level.\r\n *\r\n * @param {Number} version QR Code version\r\n * @param {Number} errorCorrectionLevel Error correction level\r\n * @return {Number} Number of error correction blocks\r\n */\r\nexports.getBlocksCount = function getBlocksCount (version, errorCorrectionLevel) {\r\n switch (errorCorrectionLevel) {\r\n case ECLevel.L:\r\n return EC_BLOCKS_TABLE[(version - 1) * 4 + 0]\r\n case ECLevel.M:\r\n return EC_BLOCKS_TABLE[(version - 1) * 4 + 1]\r\n case ECLevel.Q:\r\n return EC_BLOCKS_TABLE[(version - 1) * 4 + 2]\r\n case ECLevel.H:\r\n return EC_BLOCKS_TABLE[(version - 1) * 4 + 3]\r\n default:\r\n return undefined\r\n }\r\n}\r\n\r\n/**\r\n * Returns the number of error correction codewords to use for the specified\r\n * version and error correction level.\r\n *\r\n * @param {Number} version QR Code version\r\n * @param {Number} errorCorrectionLevel Error correction level\r\n * @return {Number} Number of error correction codewords\r\n */\r\nexports.getTotalCodewordsCount = function getTotalCodewordsCount (version, errorCorrectionLevel) {\r\n switch (errorCorrectionLevel) {\r\n case ECLevel.L:\r\n return EC_CODEWORDS_TABLE[(version - 1) * 4 + 0]\r\n case ECLevel.M:\r\n return EC_CODEWORDS_TABLE[(version - 1) * 4 + 1]\r\n case ECLevel.Q:\r\n return EC_CODEWORDS_TABLE[(version - 1) * 4 + 2]\r\n case ECLevel.H:\r\n return EC_CODEWORDS_TABLE[(version - 1) * 4 + 3]\r\n default:\r\n return undefined\r\n }\r\n}\r\n","const EXP_TABLE = new Uint8Array(512)\nconst LOG_TABLE = new Uint8Array(256)\n/**\n * Precompute the log and anti-log tables for faster computation later\n *\n * For each possible value in the galois field 2^8, we will pre-compute\n * the logarithm and anti-logarithm (exponential) of this value\n *\n * ref {@link https://en.wikiversity.org/wiki/Reed%E2%80%93Solomon_codes_for_coders#Introduction_to_mathematical_fields}\n */\n;(function initTables () {\n let x = 1\n for (let i = 0; i < 255; i++) {\n EXP_TABLE[i] = x\n LOG_TABLE[x] = i\n\n x <<= 1 // multiply by 2\n\n // The QR code specification says to use byte-wise modulo 100011101 arithmetic.\n // This means that when a number is 256 or larger, it should be XORed with 0x11D.\n if (x & 0x100) { // similar to x >= 256, but a lot faster (because 0x100 == 256)\n x ^= 0x11D\n }\n }\n\n // Optimization: double the size of the anti-log table so that we don't need to mod 255 to\n // stay inside the bounds (because we will mainly use this table for the multiplication of\n // two GF numbers, no more).\n // @see {@link mul}\n for (let i = 255; i < 512; i++) {\n EXP_TABLE[i] = EXP_TABLE[i - 255]\n }\n}())\n\n/**\n * Returns log value of n inside Galois Field\n *\n * @param {Number} n\n * @return {Number}\n */\nexports.log = function log (n) {\n if (n < 1) throw new Error('log(' + n + ')')\n return LOG_TABLE[n]\n}\n\n/**\n * Returns anti-log value of n inside Galois Field\n *\n * @param {Number} n\n * @return {Number}\n */\nexports.exp = function exp (n) {\n return EXP_TABLE[n]\n}\n\n/**\n * Multiplies two number inside Galois Field\n *\n * @param {Number} x\n * @param {Number} y\n * @return {Number}\n */\nexports.mul = function mul (x, y) {\n if (x === 0 || y === 0) return 0\n\n // should be EXP_TABLE[(LOG_TABLE[x] + LOG_TABLE[y]) % 255] if EXP_TABLE wasn't oversized\n // @see {@link initTables}\n return EXP_TABLE[LOG_TABLE[x] + LOG_TABLE[y]]\n}\n","const GF = require('./galois-field')\n\n/**\n * Multiplies two polynomials inside Galois Field\n *\n * @param {Uint8Array} p1 Polynomial\n * @param {Uint8Array} p2 Polynomial\n * @return {Uint8Array} Product of p1 and p2\n */\nexports.mul = function mul (p1, p2) {\n const coeff = new Uint8Array(p1.length + p2.length - 1)\n\n for (let i = 0; i < p1.length; i++) {\n for (let j = 0; j < p2.length; j++) {\n coeff[i + j] ^= GF.mul(p1[i], p2[j])\n }\n }\n\n return coeff\n}\n\n/**\n * Calculate the remainder of polynomials division\n *\n * @param {Uint8Array} divident Polynomial\n * @param {Uint8Array} divisor Polynomial\n * @return {Uint8Array} Remainder\n */\nexports.mod = function mod (divident, divisor) {\n let result = new Uint8Array(divident)\n\n while ((result.length - divisor.length) >= 0) {\n const coeff = result[0]\n\n for (let i = 0; i < divisor.length; i++) {\n result[i] ^= GF.mul(divisor[i], coeff)\n }\n\n // remove all zeros from buffer head\n let offset = 0\n while (offset < result.length && result[offset] === 0) offset++\n result = result.slice(offset)\n }\n\n return result\n}\n\n/**\n * Generate an irreducible generator polynomial of specified degree\n * (used by Reed-Solomon encoder)\n *\n * @param {Number} degree Degree of the generator polynomial\n * @return {Uint8Array} Buffer containing polynomial coefficients\n */\nexports.generateECPolynomial = function generateECPolynomial (degree) {\n let poly = new Uint8Array([1])\n for (let i = 0; i < degree; i++) {\n poly = exports.mul(poly, new Uint8Array([1, GF.exp(i)]))\n }\n\n return poly\n}\n","const Polynomial = require('./polynomial')\n\nfunction ReedSolomonEncoder (degree) {\n this.genPoly = undefined\n this.degree = degree\n\n if (this.degree) this.initialize(this.degree)\n}\n\n/**\n * Initialize the encoder.\n * The input param should correspond to the number of error correction codewords.\n *\n * @param {Number} degree\n */\nReedSolomonEncoder.prototype.initialize = function initialize (degree) {\n // create an irreducible generator polynomial\n this.degree = degree\n this.genPoly = Polynomial.generateECPolynomial(this.degree)\n}\n\n/**\n * Encodes a chunk of data\n *\n * @param {Uint8Array} data Buffer containing input data\n * @return {Uint8Array} Buffer containing encoded data\n */\nReedSolomonEncoder.prototype.encode = function encode (data) {\n if (!this.genPoly) {\n throw new Error('Encoder not initialized')\n }\n\n // Calculate EC for this data block\n // extends data size to data+genPoly size\n const paddedData = new Uint8Array(data.length + this.degree)\n paddedData.set(data)\n\n // The error correction codewords are the remainder after dividing the data codewords\n // by a generator polynomial\n const remainder = Polynomial.mod(paddedData, this.genPoly)\n\n // return EC data blocks (last n byte, where n is the degree of genPoly)\n // If coefficients number in remainder are less than genPoly degree,\n // pad with 0s to the left to reach the needed number of coefficients\n const start = this.degree - remainder.length\n if (start > 0) {\n const buff = new Uint8Array(this.degree)\n buff.set(remainder, start)\n\n return buff\n }\n\n return remainder\n}\n\nmodule.exports = ReedSolomonEncoder\n","/**\n * Check if QR Code version is valid\n *\n * @param {Number} version QR Code version\n * @return {Boolean} true if valid version, false otherwise\n */\nexports.isValid = function isValid (version) {\n return !isNaN(version) && version >= 1 && version <= 40\n}\n","const numeric = '[0-9]+'\nconst alphanumeric = '[A-Z $%*+\\\\-./:]+'\nlet kanji = '(?:[u3000-u303F]|[u3040-u309F]|[u30A0-u30FF]|' +\n '[uFF00-uFFEF]|[u4E00-u9FAF]|[u2605-u2606]|[u2190-u2195]|u203B|' +\n '[u2010u2015u2018u2019u2025u2026u201Cu201Du2225u2260]|' +\n '[u0391-u0451]|[u00A7u00A8u00B1u00B4u00D7u00F7])+'\nkanji = kanji.replace(/u/g, '\\\\u')\n\nconst byte = '(?:(?![A-Z0-9 $%*+\\\\-./:]|' + kanji + ')(?:.|[\\r\\n]))+'\n\nexports.KANJI = new RegExp(kanji, 'g')\nexports.BYTE_KANJI = new RegExp('[^A-Z0-9 $%*+\\\\-./:]+', 'g')\nexports.BYTE = new RegExp(byte, 'g')\nexports.NUMERIC = new RegExp(numeric, 'g')\nexports.ALPHANUMERIC = new RegExp(alphanumeric, 'g')\n\nconst TEST_KANJI = new RegExp('^' + kanji + '$')\nconst TEST_NUMERIC = new RegExp('^' + numeric + '$')\nconst TEST_ALPHANUMERIC = new RegExp('^[A-Z0-9 $%*+\\\\-./:]+$')\n\nexports.testKanji = function testKanji (str) {\n return TEST_KANJI.test(str)\n}\n\nexports.testNumeric = function testNumeric (str) {\n return TEST_NUMERIC.test(str)\n}\n\nexports.testAlphanumeric = function testAlphanumeric (str) {\n return TEST_ALPHANUMERIC.test(str)\n}\n","const VersionCheck = require('./version-check')\nconst Regex = require('./regex')\n\n/**\n * Numeric mode encodes data from the decimal digit set (0 - 9)\n * (byte values 30HEX to 39HEX).\n * Normally, 3 data characters are represented by 10 bits.\n *\n * @type {Object}\n */\nexports.NUMERIC = {\n id: 'Numeric',\n bit: 1 << 0,\n ccBits: [10, 12, 14]\n}\n\n/**\n * Alphanumeric mode encodes data from a set of 45 characters,\n * i.e. 10 numeric digits (0 - 9),\n * 26 alphabetic characters (A - Z),\n * and 9 symbols (SP, $, %, *, +, -, ., /, :).\n * Normally, two input characters are represented by 11 bits.\n *\n * @type {Object}\n */\nexports.ALPHANUMERIC = {\n id: 'Alphanumeric',\n bit: 1 << 1,\n ccBits: [9, 11, 13]\n}\n\n/**\n * In byte mode, data is encoded at 8 bits per character.\n *\n * @type {Object}\n */\nexports.BYTE = {\n id: 'Byte',\n bit: 1 << 2,\n ccBits: [8, 16, 16]\n}\n\n/**\n * The Kanji mode efficiently encodes Kanji characters in accordance with\n * the Shift JIS system based on JIS X 0208.\n * The Shift JIS values are shifted from the JIS X 0208 values.\n * JIS X 0208 gives details of the shift coded representation.\n * Each two-byte character value is compacted to a 13-bit binary codeword.\n *\n * @type {Object}\n */\nexports.KANJI = {\n id: 'Kanji',\n bit: 1 << 3,\n ccBits: [8, 10, 12]\n}\n\n/**\n * Mixed mode will contain a sequences of data in a combination of any of\n * the modes described above\n *\n * @type {Object}\n */\nexports.MIXED = {\n bit: -1\n}\n\n/**\n * Returns the number of bits needed to store the data length\n * according to QR Code specifications.\n *\n * @param {Mode} mode Data mode\n * @param {Number} version QR Code version\n * @return {Number} Number of bits\n */\nexports.getCharCountIndicator = function getCharCountIndicator (mode, version) {\n if (!mode.ccBits) throw new Error('Invalid mode: ' + mode)\n\n if (!VersionCheck.isValid(version)) {\n throw new Error('Invalid version: ' + version)\n }\n\n if (version >= 1 && version < 10) return mode.ccBits[0]\n else if (version < 27) return mode.ccBits[1]\n return mode.ccBits[2]\n}\n\n/**\n * Returns the most efficient mode to store the specified data\n *\n * @param {String} dataStr Input data string\n * @return {Mode} Best mode\n */\nexports.getBestModeForData = function getBestModeForData (dataStr) {\n if (Regex.testNumeric(dataStr)) return exports.NUMERIC\n else if (Regex.testAlphanumeric(dataStr)) return exports.ALPHANUMERIC\n else if (Regex.testKanji(dataStr)) return exports.KANJI\n else return exports.BYTE\n}\n\n/**\n * Return mode name as string\n *\n * @param {Mode} mode Mode object\n * @returns {String} Mode name\n */\nexports.toString = function toString (mode) {\n if (mode && mode.id) return mode.id\n throw new Error('Invalid mode')\n}\n\n/**\n * Check if input param is a valid mode object\n *\n * @param {Mode} mode Mode object\n * @returns {Boolean} True if valid mode, false otherwise\n */\nexports.isValid = function isValid (mode) {\n return mode && mode.bit && mode.ccBits\n}\n\n/**\n * Get mode object from its name\n *\n * @param {String} string Mode name\n * @returns {Mode} Mode object\n */\nfunction fromString (string) {\n if (typeof string !== 'string') {\n throw new Error('Param is not a string')\n }\n\n const lcStr = string.toLowerCase()\n\n switch (lcStr) {\n case 'numeric':\n return exports.NUMERIC\n case 'alphanumeric':\n return exports.ALPHANUMERIC\n case 'kanji':\n return exports.KANJI\n case 'byte':\n return exports.BYTE\n default:\n throw new Error('Unknown mode: ' + string)\n }\n}\n\n/**\n * Returns mode from a value.\n * If value is not a valid mode, returns defaultValue\n *\n * @param {Mode|String} value Encoding mode\n * @param {Mode} defaultValue Fallback value\n * @return {Mode} Encoding mode\n */\nexports.from = function from (value, defaultValue) {\n if (exports.isValid(value)) {\n return value\n }\n\n try {\n return fromString(value)\n } catch (e) {\n return defaultValue\n }\n}\n","const Utils = require('./utils')\nconst ECCode = require('./error-correction-code')\nconst ECLevel = require('./error-correction-level')\nconst Mode = require('./mode')\nconst VersionCheck = require('./version-check')\n\n// Generator polynomial used to encode version information\nconst G18 = (1 << 12) | (1 << 11) | (1 << 10) | (1 << 9) | (1 << 8) | (1 << 5) | (1 << 2) | (1 << 0)\nconst G18_BCH = Utils.getBCHDigit(G18)\n\nfunction getBestVersionForDataLength (mode, length, errorCorrectionLevel) {\n for (let currentVersion = 1; currentVersion <= 40; currentVersion++) {\n if (length <= exports.getCapacity(currentVersion, errorCorrectionLevel, mode)) {\n return currentVersion\n }\n }\n\n return undefined\n}\n\nfunction getReservedBitsCount (mode, version) {\n // Character count indicator + mode indicator bits\n return Mode.getCharCountIndicator(mode, version) + 4\n}\n\nfunction getTotalBitsFromDataArray (segments, version) {\n let totalBits = 0\n\n segments.forEach(function (data) {\n const reservedBits = getReservedBitsCount(data.mode, version)\n totalBits += reservedBits + data.getBitsLength()\n })\n\n return totalBits\n}\n\nfunction getBestVersionForMixedData (segments, errorCorrectionLevel) {\n for (let currentVersion = 1; currentVersion <= 40; currentVersion++) {\n const length = getTotalBitsFromDataArray(segments, currentVersion)\n if (length <= exports.getCapacity(currentVersion, errorCorrectionLevel, Mode.MIXED)) {\n return currentVersion\n }\n }\n\n return undefined\n}\n\n/**\n * Returns version number from a value.\n * If value is not a valid version, returns defaultValue\n *\n * @param {Number|String} value QR Code version\n * @param {Number} defaultValue Fallback value\n * @return {Number} QR Code version number\n */\nexports.from = function from (value, defaultValue) {\n if (VersionCheck.isValid(value)) {\n return parseInt(value, 10)\n }\n\n return defaultValue\n}\n\n/**\n * Returns how much data can be stored with the specified QR code version\n * and error correction level\n *\n * @param {Number} version QR Code version (1-40)\n * @param {Number} errorCorrectionLevel Error correction level\n * @param {Mode} mode Data mode\n * @return {Number} Quantity of storable data\n */\nexports.getCapacity = function getCapacity (version, errorCorrectionLevel, mode) {\n if (!VersionCheck.isValid(version)) {\n throw new Error('Invalid QR Code version')\n }\n\n // Use Byte mode as default\n if (typeof mode === 'undefined') mode = Mode.BYTE\n\n // Total codewords for this QR code version (Data + Error correction)\n const totalCodewords = Utils.getSymbolTotalCodewords(version)\n\n // Total number of error correction codewords\n const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n\n // Total number of data codewords\n const dataTotalCodewordsBits = (totalCodewords - ecTotalCodewords) * 8\n\n if (mode === Mode.MIXED) return dataTotalCodewordsBits\n\n const usableBits = dataTotalCodewordsBits - getReservedBitsCount(mode, version)\n\n // Return max number of storable codewords\n switch (mode) {\n case Mode.NUMERIC:\n return Math.floor((usableBits / 10) * 3)\n\n case Mode.ALPHANUMERIC:\n return Math.floor((usableBits / 11) * 2)\n\n case Mode.KANJI:\n return Math.floor(usableBits / 13)\n\n case Mode.BYTE:\n default:\n return Math.floor(usableBits / 8)\n }\n}\n\n/**\n * Returns the minimum version needed to contain the amount of data\n *\n * @param {Segment} data Segment of data\n * @param {Number} [errorCorrectionLevel=H] Error correction level\n * @param {Mode} mode Data mode\n * @return {Number} QR Code version\n */\nexports.getBestVersionForData = function getBestVersionForData (data, errorCorrectionLevel) {\n let seg\n\n const ecl = ECLevel.from(errorCorrectionLevel, ECLevel.M)\n\n if (Array.isArray(data)) {\n if (data.length > 1) {\n return getBestVersionForMixedData(data, ecl)\n }\n\n if (data.length === 0) {\n return 1\n }\n\n seg = data[0]\n } else {\n seg = data\n }\n\n return getBestVersionForDataLength(seg.mode, seg.getLength(), ecl)\n}\n\n/**\n * Returns version information with relative error correction bits\n *\n * The version information is included in QR Code symbols of version 7 or larger.\n * It consists of an 18-bit sequence containing 6 data bits,\n * with 12 error correction bits calculated using the (18, 6) Golay code.\n *\n * @param {Number} version QR Code version\n * @return {Number} Encoded version info bits\n */\nexports.getEncodedBits = function getEncodedBits (version) {\n if (!VersionCheck.isValid(version) || version < 7) {\n throw new Error('Invalid QR Code version')\n }\n\n let d = version << 12\n\n while (Utils.getBCHDigit(d) - G18_BCH >= 0) {\n d ^= (G18 << (Utils.getBCHDigit(d) - G18_BCH))\n }\n\n return (version << 12) | d\n}\n","const Utils = require('./utils')\n\nconst G15 = (1 << 10) | (1 << 8) | (1 << 5) | (1 << 4) | (1 << 2) | (1 << 1) | (1 << 0)\nconst G15_MASK = (1 << 14) | (1 << 12) | (1 << 10) | (1 << 4) | (1 << 1)\nconst G15_BCH = Utils.getBCHDigit(G15)\n\n/**\n * Returns format information with relative error correction bits\n *\n * The format information is a 15-bit sequence containing 5 data bits,\n * with 10 error correction bits calculated using the (15, 5) BCH code.\n *\n * @param {Number} errorCorrectionLevel Error correction level\n * @param {Number} mask Mask pattern\n * @return {Number} Encoded format information bits\n */\nexports.getEncodedBits = function getEncodedBits (errorCorrectionLevel, mask) {\n const data = ((errorCorrectionLevel.bit << 3) | mask)\n let d = data << 10\n\n while (Utils.getBCHDigit(d) - G15_BCH >= 0) {\n d ^= (G15 << (Utils.getBCHDigit(d) - G15_BCH))\n }\n\n // xor final data with mask pattern in order to ensure that\n // no combination of Error Correction Level and data mask pattern\n // will result in an all-zero data string\n return ((data << 10) | d) ^ G15_MASK\n}\n","const Mode = require('./mode')\n\nfunction NumericData (data) {\n this.mode = Mode.NUMERIC\n this.data = data.toString()\n}\n\nNumericData.getBitsLength = function getBitsLength (length) {\n return 10 * Math.floor(length / 3) + ((length % 3) ? ((length % 3) * 3 + 1) : 0)\n}\n\nNumericData.prototype.getLength = function getLength () {\n return this.data.length\n}\n\nNumericData.prototype.getBitsLength = function getBitsLength () {\n return NumericData.getBitsLength(this.data.length)\n}\n\nNumericData.prototype.write = function write (bitBuffer) {\n let i, group, value\n\n // The input data string is divided into groups of three digits,\n // and each group is converted to its 10-bit binary equivalent.\n for (i = 0; i + 3 <= this.data.length; i += 3) {\n group = this.data.substr(i, 3)\n value = parseInt(group, 10)\n\n bitBuffer.put(value, 10)\n }\n\n // If the number of input digits is not an exact multiple of three,\n // the final one or two digits are converted to 4 or 7 bits respectively.\n const remainingNum = this.data.length - i\n if (remainingNum > 0) {\n group = this.data.substr(i)\n value = parseInt(group, 10)\n\n bitBuffer.put(value, remainingNum * 3 + 1)\n }\n}\n\nmodule.exports = NumericData\n","const Mode = require('./mode')\n\n/**\n * Array of characters available in alphanumeric mode\n *\n * As per QR Code specification, to each character\n * is assigned a value from 0 to 44 which in this case coincides\n * with the array index\n *\n * @type {Array}\n */\nconst ALPHA_NUM_CHARS = [\n '0', '1', '2', '3', '4', '5', '6', '7', '8', '9',\n 'A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J', 'K', 'L', 'M',\n 'N', 'O', 'P', 'Q', 'R', 'S', 'T', 'U', 'V', 'W', 'X', 'Y', 'Z',\n ' ', '$', '%', '*', '+', '-', '.', '/', ':'\n]\n\nfunction AlphanumericData (data) {\n this.mode = Mode.ALPHANUMERIC\n this.data = data\n}\n\nAlphanumericData.getBitsLength = function getBitsLength (length) {\n return 11 * Math.floor(length / 2) + 6 * (length % 2)\n}\n\nAlphanumericData.prototype.getLength = function getLength () {\n return this.data.length\n}\n\nAlphanumericData.prototype.getBitsLength = function getBitsLength () {\n return AlphanumericData.getBitsLength(this.data.length)\n}\n\nAlphanumericData.prototype.write = function write (bitBuffer) {\n let i\n\n // Input data characters are divided into groups of two characters\n // and encoded as 11-bit binary codes.\n for (i = 0; i + 2 <= this.data.length; i += 2) {\n // The character value of the first character is multiplied by 45\n let value = ALPHA_NUM_CHARS.indexOf(this.data[i]) * 45\n\n // The character value of the second digit is added to the product\n value += ALPHA_NUM_CHARS.indexOf(this.data[i + 1])\n\n // The sum is then stored as 11-bit binary number\n bitBuffer.put(value, 11)\n }\n\n // If the number of input data characters is not a multiple of two,\n // the character value of the final character is encoded as a 6-bit binary number.\n if (this.data.length % 2) {\n bitBuffer.put(ALPHA_NUM_CHARS.indexOf(this.data[i]), 6)\n }\n}\n\nmodule.exports = AlphanumericData\n","const Mode = require('./mode')\n\nfunction ByteData (data) {\n this.mode = Mode.BYTE\n if (typeof (data) === 'string') {\n this.data = new TextEncoder().encode(data)\n } else {\n this.data = new Uint8Array(data)\n }\n}\n\nByteData.getBitsLength = function getBitsLength (length) {\n return length * 8\n}\n\nByteData.prototype.getLength = function getLength () {\n return this.data.length\n}\n\nByteData.prototype.getBitsLength = function getBitsLength () {\n return ByteData.getBitsLength(this.data.length)\n}\n\nByteData.prototype.write = function (bitBuffer) {\n for (let i = 0, l = this.data.length; i < l; i++) {\n bitBuffer.put(this.data[i], 8)\n }\n}\n\nmodule.exports = ByteData\n","const Mode = require('./mode')\nconst Utils = require('./utils')\n\nfunction KanjiData (data) {\n this.mode = Mode.KANJI\n this.data = data\n}\n\nKanjiData.getBitsLength = function getBitsLength (length) {\n return length * 13\n}\n\nKanjiData.prototype.getLength = function getLength () {\n return this.data.length\n}\n\nKanjiData.prototype.getBitsLength = function getBitsLength () {\n return KanjiData.getBitsLength(this.data.length)\n}\n\nKanjiData.prototype.write = function (bitBuffer) {\n let i\n\n // In the Shift JIS system, Kanji characters are represented by a two byte combination.\n // These byte values are shifted from the JIS X 0208 values.\n // JIS X 0208 gives details of the shift coded representation.\n for (i = 0; i < this.data.length; i++) {\n let value = Utils.toSJIS(this.data[i])\n\n // For characters with Shift JIS values from 0x8140 to 0x9FFC:\n if (value >= 0x8140 && value <= 0x9FFC) {\n // Subtract 0x8140 from Shift JIS value\n value -= 0x8140\n\n // For characters with Shift JIS values from 0xE040 to 0xEBBF\n } else if (value >= 0xE040 && value <= 0xEBBF) {\n // Subtract 0xC140 from Shift JIS value\n value -= 0xC140\n } else {\n throw new Error(\n 'Invalid SJIS character: ' + this.data[i] + '\\n' +\n 'Make sure your charset is UTF-8')\n }\n\n // Multiply most significant byte of result by 0xC0\n // and add least significant byte to product\n value = (((value >>> 8) & 0xff) * 0xC0) + (value & 0xff)\n\n // Convert result to a 13-bit binary string\n bitBuffer.put(value, 13)\n }\n}\n\nmodule.exports = KanjiData\n","'use strict';\n\n/******************************************************************************\n * Created 2008-08-19.\n *\n * Dijkstra path-finding functions. Adapted from the Dijkstar Python project.\n *\n * Copyright (C) 2008\n * Wyatt Baldwin \n * All rights reserved\n *\n * Licensed under the MIT license.\n *\n * http://www.opensource.org/licenses/mit-license.php\n *\n * THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN\n * THE SOFTWARE.\n *****************************************************************************/\nvar dijkstra = {\n single_source_shortest_paths: function(graph, s, d) {\n // Predecessor map for each node that has been encountered.\n // node ID => predecessor node ID\n var predecessors = {};\n\n // Costs of shortest paths from s to all nodes encountered.\n // node ID => cost\n var costs = {};\n costs[s] = 0;\n\n // Costs of shortest paths from s to all nodes encountered; differs from\n // `costs` in that it provides easy access to the node that currently has\n // the known shortest path from s.\n // XXX: Do we actually need both `costs` and `open`?\n var open = dijkstra.PriorityQueue.make();\n open.push(s, 0);\n\n var closest,\n u, v,\n cost_of_s_to_u,\n adjacent_nodes,\n cost_of_e,\n cost_of_s_to_u_plus_cost_of_e,\n cost_of_s_to_v,\n first_visit;\n while (!open.empty()) {\n // In the nodes remaining in graph that have a known cost from s,\n // find the node, u, that currently has the shortest path from s.\n closest = open.pop();\n u = closest.value;\n cost_of_s_to_u = closest.cost;\n\n // Get nodes adjacent to u...\n adjacent_nodes = graph[u] || {};\n\n // ...and explore the edges that connect u to those nodes, updating\n // the cost of the shortest paths to any or all of those nodes as\n // necessary. v is the node across the current edge from u.\n for (v in adjacent_nodes) {\n if (adjacent_nodes.hasOwnProperty(v)) {\n // Get the cost of the edge running from u to v.\n cost_of_e = adjacent_nodes[v];\n\n // Cost of s to u plus the cost of u to v across e--this is *a*\n // cost from s to v that may or may not be less than the current\n // known cost to v.\n cost_of_s_to_u_plus_cost_of_e = cost_of_s_to_u + cost_of_e;\n\n // If we haven't visited v yet OR if the current known cost from s to\n // v is greater than the new cost we just found (cost of s to u plus\n // cost of u to v across e), update v's cost in the cost list and\n // update v's predecessor in the predecessor list (it's now u).\n cost_of_s_to_v = costs[v];\n first_visit = (typeof costs[v] === 'undefined');\n if (first_visit || cost_of_s_to_v > cost_of_s_to_u_plus_cost_of_e) {\n costs[v] = cost_of_s_to_u_plus_cost_of_e;\n open.push(v, cost_of_s_to_u_plus_cost_of_e);\n predecessors[v] = u;\n }\n }\n }\n }\n\n if (typeof d !== 'undefined' && typeof costs[d] === 'undefined') {\n var msg = ['Could not find a path from ', s, ' to ', d, '.'].join('');\n throw new Error(msg);\n }\n\n return predecessors;\n },\n\n extract_shortest_path_from_predecessor_list: function(predecessors, d) {\n var nodes = [];\n var u = d;\n var predecessor;\n while (u) {\n nodes.push(u);\n predecessor = predecessors[u];\n u = predecessors[u];\n }\n nodes.reverse();\n return nodes;\n },\n\n find_path: function(graph, s, d) {\n var predecessors = dijkstra.single_source_shortest_paths(graph, s, d);\n return dijkstra.extract_shortest_path_from_predecessor_list(\n predecessors, d);\n },\n\n /**\n * A very naive priority queue implementation.\n */\n PriorityQueue: {\n make: function (opts) {\n var T = dijkstra.PriorityQueue,\n t = {},\n key;\n opts = opts || {};\n for (key in T) {\n if (T.hasOwnProperty(key)) {\n t[key] = T[key];\n }\n }\n t.queue = [];\n t.sorter = opts.sorter || T.default_sorter;\n return t;\n },\n\n default_sorter: function (a, b) {\n return a.cost - b.cost;\n },\n\n /**\n * Add a new item to the queue and ensure the highest priority element\n * is at the front of the queue.\n */\n push: function (value, cost) {\n var item = {value: value, cost: cost};\n this.queue.push(item);\n this.queue.sort(this.sorter);\n },\n\n /**\n * Return the highest priority element in the queue.\n */\n pop: function () {\n return this.queue.shift();\n },\n\n empty: function () {\n return this.queue.length === 0;\n }\n }\n};\n\n\n// node.js module exports\nif (typeof module !== 'undefined') {\n module.exports = dijkstra;\n}\n","const Mode = require('./mode')\nconst NumericData = require('./numeric-data')\nconst AlphanumericData = require('./alphanumeric-data')\nconst ByteData = require('./byte-data')\nconst KanjiData = require('./kanji-data')\nconst Regex = require('./regex')\nconst Utils = require('./utils')\nconst dijkstra = require('dijkstrajs')\n\n/**\n * Returns UTF8 byte length\n *\n * @param {String} str Input string\n * @return {Number} Number of byte\n */\nfunction getStringByteLength (str) {\n return unescape(encodeURIComponent(str)).length\n}\n\n/**\n * Get a list of segments of the specified mode\n * from a string\n *\n * @param {Mode} mode Segment mode\n * @param {String} str String to process\n * @return {Array} Array of object with segments data\n */\nfunction getSegments (regex, mode, str) {\n const segments = []\n let result\n\n while ((result = regex.exec(str)) !== null) {\n segments.push({\n data: result[0],\n index: result.index,\n mode: mode,\n length: result[0].length\n })\n }\n\n return segments\n}\n\n/**\n * Extracts a series of segments with the appropriate\n * modes from a string\n *\n * @param {String} dataStr Input string\n * @return {Array} Array of object with segments data\n */\nfunction getSegmentsFromString (dataStr) {\n const numSegs = getSegments(Regex.NUMERIC, Mode.NUMERIC, dataStr)\n const alphaNumSegs = getSegments(Regex.ALPHANUMERIC, Mode.ALPHANUMERIC, dataStr)\n let byteSegs\n let kanjiSegs\n\n if (Utils.isKanjiModeEnabled()) {\n byteSegs = getSegments(Regex.BYTE, Mode.BYTE, dataStr)\n kanjiSegs = getSegments(Regex.KANJI, Mode.KANJI, dataStr)\n } else {\n byteSegs = getSegments(Regex.BYTE_KANJI, Mode.BYTE, dataStr)\n kanjiSegs = []\n }\n\n const segs = numSegs.concat(alphaNumSegs, byteSegs, kanjiSegs)\n\n return segs\n .sort(function (s1, s2) {\n return s1.index - s2.index\n })\n .map(function (obj) {\n return {\n data: obj.data,\n mode: obj.mode,\n length: obj.length\n }\n })\n}\n\n/**\n * Returns how many bits are needed to encode a string of\n * specified length with the specified mode\n *\n * @param {Number} length String length\n * @param {Mode} mode Segment mode\n * @return {Number} Bit length\n */\nfunction getSegmentBitsLength (length, mode) {\n switch (mode) {\n case Mode.NUMERIC:\n return NumericData.getBitsLength(length)\n case Mode.ALPHANUMERIC:\n return AlphanumericData.getBitsLength(length)\n case Mode.KANJI:\n return KanjiData.getBitsLength(length)\n case Mode.BYTE:\n return ByteData.getBitsLength(length)\n }\n}\n\n/**\n * Merges adjacent segments which have the same mode\n *\n * @param {Array} segs Array of object with segments data\n * @return {Array} Array of object with segments data\n */\nfunction mergeSegments (segs) {\n return segs.reduce(function (acc, curr) {\n const prevSeg = acc.length - 1 >= 0 ? acc[acc.length - 1] : null\n if (prevSeg && prevSeg.mode === curr.mode) {\n acc[acc.length - 1].data += curr.data\n return acc\n }\n\n acc.push(curr)\n return acc\n }, [])\n}\n\n/**\n * Generates a list of all possible nodes combination which\n * will be used to build a segments graph.\n *\n * Nodes are divided by groups. Each group will contain a list of all the modes\n * in which is possible to encode the given text.\n *\n * For example the text '12345' can be encoded as Numeric, Alphanumeric or Byte.\n * The group for '12345' will contain then 3 objects, one for each\n * possible encoding mode.\n *\n * Each node represents a possible segment.\n *\n * @param {Array} segs Array of object with segments data\n * @return {Array} Array of object with segments data\n */\nfunction buildNodes (segs) {\n const nodes = []\n for (let i = 0; i < segs.length; i++) {\n const seg = segs[i]\n\n switch (seg.mode) {\n case Mode.NUMERIC:\n nodes.push([seg,\n { data: seg.data, mode: Mode.ALPHANUMERIC, length: seg.length },\n { data: seg.data, mode: Mode.BYTE, length: seg.length }\n ])\n break\n case Mode.ALPHANUMERIC:\n nodes.push([seg,\n { data: seg.data, mode: Mode.BYTE, length: seg.length }\n ])\n break\n case Mode.KANJI:\n nodes.push([seg,\n { data: seg.data, mode: Mode.BYTE, length: getStringByteLength(seg.data) }\n ])\n break\n case Mode.BYTE:\n nodes.push([\n { data: seg.data, mode: Mode.BYTE, length: getStringByteLength(seg.data) }\n ])\n }\n }\n\n return nodes\n}\n\n/**\n * Builds a graph from a list of nodes.\n * All segments in each node group will be connected with all the segments of\n * the next group and so on.\n *\n * At each connection will be assigned a weight depending on the\n * segment's byte length.\n *\n * @param {Array} nodes Array of object with segments data\n * @param {Number} version QR Code version\n * @return {Object} Graph of all possible segments\n */\nfunction buildGraph (nodes, version) {\n const table = {}\n const graph = { start: {} }\n let prevNodeIds = ['start']\n\n for (let i = 0; i < nodes.length; i++) {\n const nodeGroup = nodes[i]\n const currentNodeIds = []\n\n for (let j = 0; j < nodeGroup.length; j++) {\n const node = nodeGroup[j]\n const key = '' + i + j\n\n currentNodeIds.push(key)\n table[key] = { node: node, lastCount: 0 }\n graph[key] = {}\n\n for (let n = 0; n < prevNodeIds.length; n++) {\n const prevNodeId = prevNodeIds[n]\n\n if (table[prevNodeId] && table[prevNodeId].node.mode === node.mode) {\n graph[prevNodeId][key] =\n getSegmentBitsLength(table[prevNodeId].lastCount + node.length, node.mode) -\n getSegmentBitsLength(table[prevNodeId].lastCount, node.mode)\n\n table[prevNodeId].lastCount += node.length\n } else {\n if (table[prevNodeId]) table[prevNodeId].lastCount = node.length\n\n graph[prevNodeId][key] = getSegmentBitsLength(node.length, node.mode) +\n 4 + Mode.getCharCountIndicator(node.mode, version) // switch cost\n }\n }\n }\n\n prevNodeIds = currentNodeIds\n }\n\n for (let n = 0; n < prevNodeIds.length; n++) {\n graph[prevNodeIds[n]].end = 0\n }\n\n return { map: graph, table: table }\n}\n\n/**\n * Builds a segment from a specified data and mode.\n * If a mode is not specified, the more suitable will be used.\n *\n * @param {String} data Input data\n * @param {Mode | String} modesHint Data mode\n * @return {Segment} Segment\n */\nfunction buildSingleSegment (data, modesHint) {\n let mode\n const bestMode = Mode.getBestModeForData(data)\n\n mode = Mode.from(modesHint, bestMode)\n\n // Make sure data can be encoded\n if (mode !== Mode.BYTE && mode.bit < bestMode.bit) {\n throw new Error('\"' + data + '\"' +\n ' cannot be encoded with mode ' + Mode.toString(mode) +\n '.\\n Suggested mode is: ' + Mode.toString(bestMode))\n }\n\n // Use Mode.BYTE if Kanji support is disabled\n if (mode === Mode.KANJI && !Utils.isKanjiModeEnabled()) {\n mode = Mode.BYTE\n }\n\n switch (mode) {\n case Mode.NUMERIC:\n return new NumericData(data)\n\n case Mode.ALPHANUMERIC:\n return new AlphanumericData(data)\n\n case Mode.KANJI:\n return new KanjiData(data)\n\n case Mode.BYTE:\n return new ByteData(data)\n }\n}\n\n/**\n * Builds a list of segments from an array.\n * Array can contain Strings or Objects with segment's info.\n *\n * For each item which is a string, will be generated a segment with the given\n * string and the more appropriate encoding mode.\n *\n * For each item which is an object, will be generated a segment with the given\n * data and mode.\n * Objects must contain at least the property \"data\".\n * If property \"mode\" is not present, the more suitable mode will be used.\n *\n * @param {Array} array Array of objects with segments data\n * @return {Array} Array of Segments\n */\nexports.fromArray = function fromArray (array) {\n return array.reduce(function (acc, seg) {\n if (typeof seg === 'string') {\n acc.push(buildSingleSegment(seg, null))\n } else if (seg.data) {\n acc.push(buildSingleSegment(seg.data, seg.mode))\n }\n\n return acc\n }, [])\n}\n\n/**\n * Builds an optimized sequence of segments from a string,\n * which will produce the shortest possible bitstream.\n *\n * @param {String} data Input string\n * @param {Number} version QR Code version\n * @return {Array} Array of segments\n */\nexports.fromString = function fromString (data, version) {\n const segs = getSegmentsFromString(data, Utils.isKanjiModeEnabled())\n\n const nodes = buildNodes(segs)\n const graph = buildGraph(nodes, version)\n const path = dijkstra.find_path(graph.map, 'start', 'end')\n\n const optimizedSegs = []\n for (let i = 1; i < path.length - 1; i++) {\n optimizedSegs.push(graph.table[path[i]].node)\n }\n\n return exports.fromArray(mergeSegments(optimizedSegs))\n}\n\n/**\n * Splits a string in various segments with the modes which\n * best represent their content.\n * The produced segments are far from being optimized.\n * The output of this function is only used to estimate a QR Code version\n * which may contain the data.\n *\n * @param {string} data Input string\n * @return {Array} Array of segments\n */\nexports.rawSplit = function rawSplit (data) {\n return exports.fromArray(\n getSegmentsFromString(data, Utils.isKanjiModeEnabled())\n )\n}\n","const Utils = require('./utils')\nconst ECLevel = require('./error-correction-level')\nconst BitBuffer = require('./bit-buffer')\nconst BitMatrix = require('./bit-matrix')\nconst AlignmentPattern = require('./alignment-pattern')\nconst FinderPattern = require('./finder-pattern')\nconst MaskPattern = require('./mask-pattern')\nconst ECCode = require('./error-correction-code')\nconst ReedSolomonEncoder = require('./reed-solomon-encoder')\nconst Version = require('./version')\nconst FormatInfo = require('./format-info')\nconst Mode = require('./mode')\nconst Segments = require('./segments')\n\n/**\n * QRCode for JavaScript\n *\n * modified by Ryan Day for nodejs support\n * Copyright (c) 2011 Ryan Day\n *\n * Licensed under the MIT license:\n * http://www.opensource.org/licenses/mit-license.php\n *\n//---------------------------------------------------------------------\n// QRCode for JavaScript\n//\n// Copyright (c) 2009 Kazuhiko Arase\n//\n// URL: http://www.d-project.com/\n//\n// Licensed under the MIT license:\n// http://www.opensource.org/licenses/mit-license.php\n//\n// The word \"QR Code\" is registered trademark of\n// DENSO WAVE INCORPORATED\n// http://www.denso-wave.com/qrcode/faqpatent-e.html\n//\n//---------------------------------------------------------------------\n*/\n\n/**\n * Add finder patterns bits to matrix\n *\n * @param {BitMatrix} matrix Modules matrix\n * @param {Number} version QR Code version\n */\nfunction setupFinderPattern (matrix, version) {\n const size = matrix.size\n const pos = FinderPattern.getPositions(version)\n\n for (let i = 0; i < pos.length; i++) {\n const row = pos[i][0]\n const col = pos[i][1]\n\n for (let r = -1; r <= 7; r++) {\n if (row + r <= -1 || size <= row + r) continue\n\n for (let c = -1; c <= 7; c++) {\n if (col + c <= -1 || size <= col + c) continue\n\n if ((r >= 0 && r <= 6 && (c === 0 || c === 6)) ||\n (c >= 0 && c <= 6 && (r === 0 || r === 6)) ||\n (r >= 2 && r <= 4 && c >= 2 && c <= 4)) {\n matrix.set(row + r, col + c, true, true)\n } else {\n matrix.set(row + r, col + c, false, true)\n }\n }\n }\n }\n}\n\n/**\n * Add timing pattern bits to matrix\n *\n * Note: this function must be called before {@link setupAlignmentPattern}\n *\n * @param {BitMatrix} matrix Modules matrix\n */\nfunction setupTimingPattern (matrix) {\n const size = matrix.size\n\n for (let r = 8; r < size - 8; r++) {\n const value = r % 2 === 0\n matrix.set(r, 6, value, true)\n matrix.set(6, r, value, true)\n }\n}\n\n/**\n * Add alignment patterns bits to matrix\n *\n * Note: this function must be called after {@link setupTimingPattern}\n *\n * @param {BitMatrix} matrix Modules matrix\n * @param {Number} version QR Code version\n */\nfunction setupAlignmentPattern (matrix, version) {\n const pos = AlignmentPattern.getPositions(version)\n\n for (let i = 0; i < pos.length; i++) {\n const row = pos[i][0]\n const col = pos[i][1]\n\n for (let r = -2; r <= 2; r++) {\n for (let c = -2; c <= 2; c++) {\n if (r === -2 || r === 2 || c === -2 || c === 2 ||\n (r === 0 && c === 0)) {\n matrix.set(row + r, col + c, true, true)\n } else {\n matrix.set(row + r, col + c, false, true)\n }\n }\n }\n }\n}\n\n/**\n * Add version info bits to matrix\n *\n * @param {BitMatrix} matrix Modules matrix\n * @param {Number} version QR Code version\n */\nfunction setupVersionInfo (matrix, version) {\n const size = matrix.size\n const bits = Version.getEncodedBits(version)\n let row, col, mod\n\n for (let i = 0; i < 18; i++) {\n row = Math.floor(i / 3)\n col = i % 3 + size - 8 - 3\n mod = ((bits >> i) & 1) === 1\n\n matrix.set(row, col, mod, true)\n matrix.set(col, row, mod, true)\n }\n}\n\n/**\n * Add format info bits to matrix\n *\n * @param {BitMatrix} matrix Modules matrix\n * @param {ErrorCorrectionLevel} errorCorrectionLevel Error correction level\n * @param {Number} maskPattern Mask pattern reference value\n */\nfunction setupFormatInfo (matrix, errorCorrectionLevel, maskPattern) {\n const size = matrix.size\n const bits = FormatInfo.getEncodedBits(errorCorrectionLevel, maskPattern)\n let i, mod\n\n for (i = 0; i < 15; i++) {\n mod = ((bits >> i) & 1) === 1\n\n // vertical\n if (i < 6) {\n matrix.set(i, 8, mod, true)\n } else if (i < 8) {\n matrix.set(i + 1, 8, mod, true)\n } else {\n matrix.set(size - 15 + i, 8, mod, true)\n }\n\n // horizontal\n if (i < 8) {\n matrix.set(8, size - i - 1, mod, true)\n } else if (i < 9) {\n matrix.set(8, 15 - i - 1 + 1, mod, true)\n } else {\n matrix.set(8, 15 - i - 1, mod, true)\n }\n }\n\n // fixed module\n matrix.set(size - 8, 8, 1, true)\n}\n\n/**\n * Add encoded data bits to matrix\n *\n * @param {BitMatrix} matrix Modules matrix\n * @param {Uint8Array} data Data codewords\n */\nfunction setupData (matrix, data) {\n const size = matrix.size\n let inc = -1\n let row = size - 1\n let bitIndex = 7\n let byteIndex = 0\n\n for (let col = size - 1; col > 0; col -= 2) {\n if (col === 6) col--\n\n while (true) {\n for (let c = 0; c < 2; c++) {\n if (!matrix.isReserved(row, col - c)) {\n let dark = false\n\n if (byteIndex < data.length) {\n dark = (((data[byteIndex] >>> bitIndex) & 1) === 1)\n }\n\n matrix.set(row, col - c, dark)\n bitIndex--\n\n if (bitIndex === -1) {\n byteIndex++\n bitIndex = 7\n }\n }\n }\n\n row += inc\n\n if (row < 0 || size <= row) {\n row -= inc\n inc = -inc\n break\n }\n }\n }\n}\n\n/**\n * Create encoded codewords from data input\n *\n * @param {Number} version QR Code version\n * @param {ErrorCorrectionLevel} errorCorrectionLevel Error correction level\n * @param {ByteData} data Data input\n * @return {Uint8Array} Buffer containing encoded codewords\n */\nfunction createData (version, errorCorrectionLevel, segments) {\n // Prepare data buffer\n const buffer = new BitBuffer()\n\n segments.forEach(function (data) {\n // prefix data with mode indicator (4 bits)\n buffer.put(data.mode.bit, 4)\n\n // Prefix data with character count indicator.\n // The character count indicator is a string of bits that represents the\n // number of characters that are being encoded.\n // The character count indicator must be placed after the mode indicator\n // and must be a certain number of bits long, depending on the QR version\n // and data mode\n // @see {@link Mode.getCharCountIndicator}.\n buffer.put(data.getLength(), Mode.getCharCountIndicator(data.mode, version))\n\n // add binary data sequence to buffer\n data.write(buffer)\n })\n\n // Calculate required number of bits\n const totalCodewords = Utils.getSymbolTotalCodewords(version)\n const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n const dataTotalCodewordsBits = (totalCodewords - ecTotalCodewords) * 8\n\n // Add a terminator.\n // If the bit string is shorter than the total number of required bits,\n // a terminator of up to four 0s must be added to the right side of the string.\n // If the bit string is more than four bits shorter than the required number of bits,\n // add four 0s to the end.\n if (buffer.getLengthInBits() + 4 <= dataTotalCodewordsBits) {\n buffer.put(0, 4)\n }\n\n // If the bit string is fewer than four bits shorter, add only the number of 0s that\n // are needed to reach the required number of bits.\n\n // After adding the terminator, if the number of bits in the string is not a multiple of 8,\n // pad the string on the right with 0s to make the string's length a multiple of 8.\n while (buffer.getLengthInBits() % 8 !== 0) {\n buffer.putBit(0)\n }\n\n // Add pad bytes if the string is still shorter than the total number of required bits.\n // Extend the buffer to fill the data capacity of the symbol corresponding to\n // the Version and Error Correction Level by adding the Pad Codewords 11101100 (0xEC)\n // and 00010001 (0x11) alternately.\n const remainingByte = (dataTotalCodewordsBits - buffer.getLengthInBits()) / 8\n for (let i = 0; i < remainingByte; i++) {\n buffer.put(i % 2 ? 0x11 : 0xEC, 8)\n }\n\n return createCodewords(buffer, version, errorCorrectionLevel)\n}\n\n/**\n * Encode input data with Reed-Solomon and return codewords with\n * relative error correction bits\n *\n * @param {BitBuffer} bitBuffer Data to encode\n * @param {Number} version QR Code version\n * @param {ErrorCorrectionLevel} errorCorrectionLevel Error correction level\n * @return {Uint8Array} Buffer containing encoded codewords\n */\nfunction createCodewords (bitBuffer, version, errorCorrectionLevel) {\n // Total codewords for this QR code version (Data + Error correction)\n const totalCodewords = Utils.getSymbolTotalCodewords(version)\n\n // Total number of error correction codewords\n const ecTotalCodewords = ECCode.getTotalCodewordsCount(version, errorCorrectionLevel)\n\n // Total number of data codewords\n const dataTotalCodewords = totalCodewords - ecTotalCodewords\n\n // Total number of blocks\n const ecTotalBlocks = ECCode.getBlocksCount(version, errorCorrectionLevel)\n\n // Calculate how many blocks each group should contain\n const blocksInGroup2 = totalCodewords % ecTotalBlocks\n const blocksInGroup1 = ecTotalBlocks - blocksInGroup2\n\n const totalCodewordsInGroup1 = Math.floor(totalCodewords / ecTotalBlocks)\n\n const dataCodewordsInGroup1 = Math.floor(dataTotalCodewords / ecTotalBlocks)\n const dataCodewordsInGroup2 = dataCodewordsInGroup1 + 1\n\n // Number of EC codewords is the same for both groups\n const ecCount = totalCodewordsInGroup1 - dataCodewordsInGroup1\n\n // Initialize a Reed-Solomon encoder with a generator polynomial of degree ecCount\n const rs = new ReedSolomonEncoder(ecCount)\n\n let offset = 0\n const dcData = new Array(ecTotalBlocks)\n const ecData = new Array(ecTotalBlocks)\n let maxDataSize = 0\n const buffer = new Uint8Array(bitBuffer.buffer)\n\n // Divide the buffer into the required number of blocks\n for (let b = 0; b < ecTotalBlocks; b++) {\n const dataSize = b < blocksInGroup1 ? dataCodewordsInGroup1 : dataCodewordsInGroup2\n\n // extract a block of data from buffer\n dcData[b] = buffer.slice(offset, offset + dataSize)\n\n // Calculate EC codewords for this data block\n ecData[b] = rs.encode(dcData[b])\n\n offset += dataSize\n maxDataSize = Math.max(maxDataSize, dataSize)\n }\n\n // Create final data\n // Interleave the data and error correction codewords from each block\n const data = new Uint8Array(totalCodewords)\n let index = 0\n let i, r\n\n // Add data codewords\n for (i = 0; i < maxDataSize; i++) {\n for (r = 0; r < ecTotalBlocks; r++) {\n if (i < dcData[r].length) {\n data[index++] = dcData[r][i]\n }\n }\n }\n\n // Apped EC codewords\n for (i = 0; i < ecCount; i++) {\n for (r = 0; r < ecTotalBlocks; r++) {\n data[index++] = ecData[r][i]\n }\n }\n\n return data\n}\n\n/**\n * Build QR Code symbol\n *\n * @param {String} data Input string\n * @param {Number} version QR Code version\n * @param {ErrorCorretionLevel} errorCorrectionLevel Error level\n * @param {MaskPattern} maskPattern Mask pattern\n * @return {Object} Object containing symbol data\n */\nfunction createSymbol (data, version, errorCorrectionLevel, maskPattern) {\n let segments\n\n if (Array.isArray(data)) {\n segments = Segments.fromArray(data)\n } else if (typeof data === 'string') {\n let estimatedVersion = version\n\n if (!estimatedVersion) {\n const rawSegments = Segments.rawSplit(data)\n\n // Estimate best version that can contain raw splitted segments\n estimatedVersion = Version.getBestVersionForData(rawSegments, errorCorrectionLevel)\n }\n\n // Build optimized segments\n // If estimated version is undefined, try with the highest version\n segments = Segments.fromString(data, estimatedVersion || 40)\n } else {\n throw new Error('Invalid data')\n }\n\n // Get the min version that can contain data\n const bestVersion = Version.getBestVersionForData(segments, errorCorrectionLevel)\n\n // If no version is found, data cannot be stored\n if (!bestVersion) {\n throw new Error('The amount of data is too big to be stored in a QR Code')\n }\n\n // If not specified, use min version as default\n if (!version) {\n version = bestVersion\n\n // Check if the specified version can contain the data\n } else if (version < bestVersion) {\n throw new Error('\\n' +\n 'The chosen QR Code version cannot contain this amount of data.\\n' +\n 'Minimum version required to store current data is: ' + bestVersion + '.\\n'\n )\n }\n\n const dataBits = createData(version, errorCorrectionLevel, segments)\n\n // Allocate matrix buffer\n const moduleCount = Utils.getSymbolSize(version)\n const modules = new BitMatrix(moduleCount)\n\n // Add function modules\n setupFinderPattern(modules, version)\n setupTimingPattern(modules)\n setupAlignmentPattern(modules, version)\n\n // Add temporary dummy bits for format info just to set them as reserved.\n // This is needed to prevent these bits from being masked by {@link MaskPattern.applyMask}\n // since the masking operation must be performed only on the encoding region.\n // These blocks will be replaced with correct values later in code.\n setupFormatInfo(modules, errorCorrectionLevel, 0)\n\n if (version >= 7) {\n setupVersionInfo(modules, version)\n }\n\n // Add data codewords\n setupData(modules, dataBits)\n\n if (isNaN(maskPattern)) {\n // Find best mask pattern\n maskPattern = MaskPattern.getBestMask(modules,\n setupFormatInfo.bind(null, modules, errorCorrectionLevel))\n }\n\n // Apply mask pattern\n MaskPattern.applyMask(maskPattern, modules)\n\n // Replace format info bits with correct values\n setupFormatInfo(modules, errorCorrectionLevel, maskPattern)\n\n return {\n modules: modules,\n version: version,\n errorCorrectionLevel: errorCorrectionLevel,\n maskPattern: maskPattern,\n segments: segments\n }\n}\n\n/**\n * QR Code\n *\n * @param {String | Array} data Input data\n * @param {Object} options Optional configurations\n * @param {Number} options.version QR Code version\n * @param {String} options.errorCorrectionLevel Error correction level\n * @param {Function} options.toSJISFunc Helper func to convert utf8 to sjis\n */\nexports.create = function create (data, options) {\n if (typeof data === 'undefined' || data === '') {\n throw new Error('No input text')\n }\n\n let errorCorrectionLevel = ECLevel.M\n let version\n let mask\n\n if (typeof options !== 'undefined') {\n // Use higher error correction level as default\n errorCorrectionLevel = ECLevel.from(options.errorCorrectionLevel, ECLevel.M)\n version = Version.from(options.version)\n mask = MaskPattern.from(options.maskPattern)\n\n if (options.toSJISFunc) {\n Utils.setToSJISFunction(options.toSJISFunc)\n }\n }\n\n return createSymbol(data, version, errorCorrectionLevel, mask)\n}\n","function hex2rgba (hex) {\n if (typeof hex === 'number') {\n hex = hex.toString()\n }\n\n if (typeof hex !== 'string') {\n throw new Error('Color should be defined as hex string')\n }\n\n let hexCode = hex.slice().replace('#', '').split('')\n if (hexCode.length < 3 || hexCode.length === 5 || hexCode.length > 8) {\n throw new Error('Invalid hex color: ' + hex)\n }\n\n // Convert from short to long form (fff -> ffffff)\n if (hexCode.length === 3 || hexCode.length === 4) {\n hexCode = Array.prototype.concat.apply([], hexCode.map(function (c) {\n return [c, c]\n }))\n }\n\n // Add default alpha value\n if (hexCode.length === 6) hexCode.push('F', 'F')\n\n const hexValue = parseInt(hexCode.join(''), 16)\n\n return {\n r: (hexValue >> 24) & 255,\n g: (hexValue >> 16) & 255,\n b: (hexValue >> 8) & 255,\n a: hexValue & 255,\n hex: '#' + hexCode.slice(0, 6).join('')\n }\n}\n\nexports.getOptions = function getOptions (options) {\n if (!options) options = {}\n if (!options.color) options.color = {}\n\n const margin = typeof options.margin === 'undefined' ||\n options.margin === null ||\n options.margin < 0\n ? 4\n : options.margin\n\n const width = options.width && options.width >= 21 ? options.width : undefined\n const scale = options.scale || 4\n\n return {\n width: width,\n scale: width ? 4 : scale,\n margin: margin,\n color: {\n dark: hex2rgba(options.color.dark || '#000000ff'),\n light: hex2rgba(options.color.light || '#ffffffff')\n },\n type: options.type,\n rendererOpts: options.rendererOpts || {}\n }\n}\n\nexports.getScale = function getScale (qrSize, opts) {\n return opts.width && opts.width >= qrSize + opts.margin * 2\n ? opts.width / (qrSize + opts.margin * 2)\n : opts.scale\n}\n\nexports.getImageWidth = function getImageWidth (qrSize, opts) {\n const scale = exports.getScale(qrSize, opts)\n return Math.floor((qrSize + opts.margin * 2) * scale)\n}\n\nexports.qrToImageData = function qrToImageData (imgData, qr, opts) {\n const size = qr.modules.size\n const data = qr.modules.data\n const scale = exports.getScale(size, opts)\n const symbolSize = Math.floor((size + opts.margin * 2) * scale)\n const scaledMargin = opts.margin * scale\n const palette = [opts.color.light, opts.color.dark]\n\n for (let i = 0; i < symbolSize; i++) {\n for (let j = 0; j < symbolSize; j++) {\n let posDst = (i * symbolSize + j) * 4\n let pxColor = opts.color.light\n\n if (i >= scaledMargin && j >= scaledMargin &&\n i < symbolSize - scaledMargin && j < symbolSize - scaledMargin) {\n const iSrc = Math.floor((i - scaledMargin) / scale)\n const jSrc = Math.floor((j - scaledMargin) / scale)\n pxColor = palette[data[iSrc * size + jSrc] ? 1 : 0]\n }\n\n imgData[posDst++] = pxColor.r\n imgData[posDst++] = pxColor.g\n imgData[posDst++] = pxColor.b\n imgData[posDst] = pxColor.a\n }\n }\n}\n","const Utils = require('./utils')\n\nfunction clearCanvas (ctx, canvas, size) {\n ctx.clearRect(0, 0, canvas.width, canvas.height)\n\n if (!canvas.style) canvas.style = {}\n canvas.height = size\n canvas.width = size\n canvas.style.height = size + 'px'\n canvas.style.width = size + 'px'\n}\n\nfunction getCanvasElement () {\n try {\n return document.createElement('canvas')\n } catch (e) {\n throw new Error('You need to specify a canvas element')\n }\n}\n\nexports.render = function render (qrData, canvas, options) {\n let opts = options\n let canvasEl = canvas\n\n if (typeof opts === 'undefined' && (!canvas || !canvas.getContext)) {\n opts = canvas\n canvas = undefined\n }\n\n if (!canvas) {\n canvasEl = getCanvasElement()\n }\n\n opts = Utils.getOptions(opts)\n const size = Utils.getImageWidth(qrData.modules.size, opts)\n\n const ctx = canvasEl.getContext('2d')\n const image = ctx.createImageData(size, size)\n Utils.qrToImageData(image.data, qrData, opts)\n\n clearCanvas(ctx, canvasEl, size)\n ctx.putImageData(image, 0, 0)\n\n return canvasEl\n}\n\nexports.renderToDataURL = function renderToDataURL (qrData, canvas, options) {\n let opts = options\n\n if (typeof opts === 'undefined' && (!canvas || !canvas.getContext)) {\n opts = canvas\n canvas = undefined\n }\n\n if (!opts) opts = {}\n\n const canvasEl = exports.render(qrData, canvas, opts)\n\n const type = opts.type || 'image/png'\n const rendererOpts = opts.rendererOpts || {}\n\n return canvasEl.toDataURL(type, rendererOpts.quality)\n}\n","const Utils = require('./utils')\n\nfunction getColorAttrib (color, attrib) {\n const alpha = color.a / 255\n const str = attrib + '=\"' + color.hex + '\"'\n\n return alpha < 1\n ? str + ' ' + attrib + '-opacity=\"' + alpha.toFixed(2).slice(1) + '\"'\n : str\n}\n\nfunction svgCmd (cmd, x, y) {\n let str = cmd + x\n if (typeof y !== 'undefined') str += ' ' + y\n\n return str\n}\n\nfunction qrToPath (data, size, margin) {\n let path = ''\n let moveBy = 0\n let newRow = false\n let lineLength = 0\n\n for (let i = 0; i < data.length; i++) {\n const col = Math.floor(i % size)\n const row = Math.floor(i / size)\n\n if (!col && !newRow) newRow = true\n\n if (data[i]) {\n lineLength++\n\n if (!(i > 0 && col > 0 && data[i - 1])) {\n path += newRow\n ? svgCmd('M', col + margin, 0.5 + row + margin)\n : svgCmd('m', moveBy, 0)\n\n moveBy = 0\n newRow = false\n }\n\n if (!(col + 1 < size && data[i + 1])) {\n path += svgCmd('h', lineLength)\n lineLength = 0\n }\n } else {\n moveBy++\n }\n }\n\n return path\n}\n\nexports.render = function render (qrData, options, cb) {\n const opts = Utils.getOptions(options)\n const size = qrData.modules.size\n const data = qrData.modules.data\n const qrcodesize = size + opts.margin * 2\n\n const bg = !opts.color.light.a\n ? ''\n : ''\n\n const path =\n ''\n\n const viewBox = 'viewBox=\"' + '0 0 ' + qrcodesize + ' ' + qrcodesize + '\"'\n\n const width = !opts.width ? '' : 'width=\"' + opts.width + '\" height=\"' + opts.width + '\" '\n\n const svgTag = '' + bg + path + '\\n'\n\n if (typeof cb === 'function') {\n cb(null, svgTag)\n }\n\n return svgTag\n}\n","\nconst canPromise = require('./can-promise')\n\nconst QRCode = require('./core/qrcode')\nconst CanvasRenderer = require('./renderer/canvas')\nconst SvgRenderer = require('./renderer/svg-tag.js')\n\nfunction renderCanvas (renderFunc, canvas, text, opts, cb) {\n const args = [].slice.call(arguments, 1)\n const argsNum = args.length\n const isLastArgCb = typeof args[argsNum - 1] === 'function'\n\n if (!isLastArgCb && !canPromise()) {\n throw new Error('Callback required as last argument')\n }\n\n if (isLastArgCb) {\n if (argsNum < 2) {\n throw new Error('Too few arguments provided')\n }\n\n if (argsNum === 2) {\n cb = text\n text = canvas\n canvas = opts = undefined\n } else if (argsNum === 3) {\n if (canvas.getContext && typeof cb === 'undefined') {\n cb = opts\n opts = undefined\n } else {\n cb = opts\n opts = text\n text = canvas\n canvas = undefined\n }\n }\n } else {\n if (argsNum < 1) {\n throw new Error('Too few arguments provided')\n }\n\n if (argsNum === 1) {\n text = canvas\n canvas = opts = undefined\n } else if (argsNum === 2 && !canvas.getContext) {\n opts = text\n text = canvas\n canvas = undefined\n }\n\n return new Promise(function (resolve, reject) {\n try {\n const data = QRCode.create(text, opts)\n resolve(renderFunc(data, canvas, opts))\n } catch (e) {\n reject(e)\n }\n })\n }\n\n try {\n const data = QRCode.create(text, opts)\n cb(null, renderFunc(data, canvas, opts))\n } catch (e) {\n cb(e)\n }\n}\n\nexports.create = QRCode.create\nexports.toCanvas = renderCanvas.bind(null, CanvasRenderer.render)\nexports.toDataURL = renderCanvas.bind(null, CanvasRenderer.renderToDataURL)\n\n// only svg for now.\nexports.toString = renderCanvas.bind(null, function (data, _, opts) {\n return SvgRenderer.render(data, opts)\n})\n","\n\n\n\n\n\n\n","import { defineComponent as Ii, h as Ri } from \"vue\";\nvar Ni = typeof globalThis < \"u\" ? globalThis : typeof window < \"u\" ? window : typeof global < \"u\" ? global : typeof self < \"u\" ? self : {};\nfunction Ci(E) {\n return E && E.__esModule && Object.prototype.hasOwnProperty.call(E, \"default\") ? E.default : E;\n}\nvar wi = { exports: {} };\n(function(E, q) {\n (function(A, m) {\n var F = \"1.0.37\", M = \"\", I = \"?\", R = \"function\", V = \"undefined\", ii = \"object\", j = \"string\", li = \"major\", e = \"model\", a = \"name\", i = \"type\", o = \"vendor\", t = \"version\", v = \"architecture\", B = \"console\", n = \"mobile\", b = \"tablet\", h = \"smarttv\", N = \"wearable\", ei = \"embedded\", oi = 500, G = \"Amazon\", D = \"Apple\", di = \"ASUS\", mi = \"BlackBerry\", T = \"Browser\", H = \"Chrome\", yi = \"Edge\", X = \"Firefox\", Y = \"Google\", ui = \"Huawei\", ai = \"LG\", ti = \"Microsoft\", pi = \"Motorola\", K = \"Opera\", Z = \"Samsung\", hi = \"Sharp\", J = \"Sony\", ri = \"Xiaomi\", si = \"Zebra\", fi = \"Facebook\", vi = \"Chromium OS\", gi = \"Mac OS\", Ti = function(c, l) {\n var s = {};\n for (var d in c)\n l[d] && l[d].length % 2 === 0 ? s[d] = l[d].concat(c[d]) : s[d] = c[d];\n return s;\n }, Q = function(c) {\n for (var l = {}, s = 0; s < c.length; s++)\n l[c[s].toUpperCase()] = c[s];\n return l;\n }, Ei = function(c, l) {\n return typeof c === j ? U(l).indexOf(U(c)) !== -1 : !1;\n }, U = function(c) {\n return c.toLowerCase();\n }, _i = function(c) {\n return typeof c === j ? c.replace(/[^\\d\\.]/g, M).split(\".\")[0] : m;\n }, ni = function(c, l) {\n if (typeof c === j)\n return c = c.replace(/^\\s\\s*/, M), typeof l === V ? c : c.substring(0, oi);\n }, L = function(c, l) {\n for (var s = 0, d, y, O, w, r, k; s < l.length && !r; ) {\n var ci = l[s], xi = l[s + 1];\n for (d = y = 0; d < ci.length && !r && ci[d]; )\n if (r = ci[d++].exec(c), r)\n for (O = 0; O < xi.length; O++)\n k = r[++y], w = xi[O], typeof w === ii && w.length > 0 ? w.length === 2 ? typeof w[1] == R ? this[w[0]] = w[1].call(this, k) : this[w[0]] = w[1] : w.length === 3 ? typeof w[1] === R && !(w[1].exec && w[1].test) ? this[w[0]] = k ? w[1].call(this, k, w[2]) : m : this[w[0]] = k ? k.replace(w[1], w[2]) : m : w.length === 4 && (this[w[0]] = k ? w[3].call(this, k.replace(w[1], w[2])) : m) : this[w] = k || m;\n s += 2;\n }\n }, bi = function(c, l) {\n for (var s in l)\n if (typeof l[s] === ii && l[s].length > 0) {\n for (var d = 0; d < l[s].length; d++)\n if (Ei(l[s][d], c))\n return s === I ? m : s;\n } else if (Ei(l[s], c))\n return s === I ? m : s;\n return c;\n }, Mi = {\n \"1.0\": \"/8\",\n \"1.2\": \"/1\",\n \"1.3\": \"/3\",\n \"2.0\": \"/412\",\n \"2.0.2\": \"/416\",\n \"2.0.3\": \"/417\",\n \"2.0.4\": \"/419\",\n \"?\": \"/\"\n }, Oi = {\n ME: \"4.90\",\n \"NT 3.11\": \"NT3.51\",\n \"NT 4.0\": \"NT4.0\",\n 2e3: \"NT 5.0\",\n XP: [\"NT 5.1\", \"NT 5.2\"],\n Vista: \"NT 6.0\",\n 7: \"NT 6.1\",\n 8: \"NT 6.2\",\n \"8.1\": \"NT 6.3\",\n 10: [\"NT 6.4\", \"NT 10.0\"],\n RT: \"ARM\"\n }, ki = {\n browser: [\n [\n /\\b(?:crmo|crios)\\/([\\w\\.]+)/i\n // Chrome for Android/iOS\n ],\n [t, [a, \"Chrome\"]],\n [\n /edg(?:e|ios|a)?\\/([\\w\\.]+)/i\n // Microsoft Edge\n ],\n [t, [a, \"Edge\"]],\n [\n // Presto based\n /(opera mini)\\/([-\\w\\.]+)/i,\n // Opera Mini\n /(opera [mobiletab]{3,6})\\b.+version\\/([-\\w\\.]+)/i,\n // Opera Mobi/Tablet\n /(opera)(?:.+version\\/|[\\/ ]+)([\\w\\.]+)/i\n // Opera\n ],\n [a, t],\n [\n /opios[\\/ ]+([\\w\\.]+)/i\n // Opera mini on iphone >= 8.0\n ],\n [t, [a, K + \" Mini\"]],\n [\n /\\bopr\\/([\\w\\.]+)/i\n // Opera Webkit\n ],\n [t, [a, K]],\n [\n // Mixed\n /\\bb[ai]*d(?:uhd|[ub]*[aekoprswx]{5,6})[\\/ ]?([\\w\\.]+)/i\n // Baidu\n ],\n [t, [a, \"Baidu\"]],\n [\n /(kindle)\\/([\\w\\.]+)/i,\n // Kindle\n /(lunascape|maxthon|netfront|jasmine|blazer)[\\/ ]?([\\w\\.]*)/i,\n // Lunascape/Maxthon/Netfront/Jasmine/Blazer\n // Trident based\n /(avant|iemobile|slim)\\s?(?:browser)?[\\/ ]?([\\w\\.]*)/i,\n // Avant/IEMobile/SlimBrowser\n /(?:ms|\\()(ie) ([\\w\\.]+)/i,\n // Internet Explorer\n // Webkit/KHTML based // Flock/RockMelt/Midori/Epiphany/Silk/Skyfire/Bolt/Iron/Iridium/PhantomJS/Bowser/QupZilla/Falkon\n /(flock|rockmelt|midori|epiphany|silk|skyfire|bolt|iron|vivaldi|iridium|phantomjs|bowser|quark|qupzilla|falkon|rekonq|puffin|brave|whale(?!.+naver)|qqbrowserlite|qq|duckduckgo)\\/([-\\w\\.]+)/i,\n // Rekonq/Puffin/Brave/Whale/QQBrowserLite/QQ, aka ShouQ\n /(heytap|ovi)browser\\/([\\d\\.]+)/i,\n // Heytap/Ovi\n /(weibo)__([\\d\\.]+)/i\n // Weibo\n ],\n [a, t],\n [\n /(?:\\buc? ?browser|(?:juc.+)ucweb)[\\/ ]?([\\w\\.]+)/i\n // UCBrowser\n ],\n [t, [a, \"UC\" + T]],\n [\n /microm.+\\bqbcore\\/([\\w\\.]+)/i,\n // WeChat Desktop for Windows Built-in Browser\n /\\bqbcore\\/([\\w\\.]+).+microm/i,\n /micromessenger\\/([\\w\\.]+)/i\n // WeChat\n ],\n [t, [a, \"WeChat\"]],\n [\n /konqueror\\/([\\w\\.]+)/i\n // Konqueror\n ],\n [t, [a, \"Konqueror\"]],\n [\n /trident.+rv[: ]([\\w\\.]{1,9})\\b.+like gecko/i\n // IE11\n ],\n [t, [a, \"IE\"]],\n [\n /ya(?:search)?browser\\/([\\w\\.]+)/i\n // Yandex\n ],\n [t, [a, \"Yandex\"]],\n [\n /slbrowser\\/([\\w\\.]+)/i\n // Smart Lenovo Browser\n ],\n [t, [a, \"Smart Lenovo \" + T]],\n [\n /(avast|avg)\\/([\\w\\.]+)/i\n // Avast/AVG Secure Browser\n ],\n [[a, /(.+)/, \"$1 Secure \" + T], t],\n [\n /\\bfocus\\/([\\w\\.]+)/i\n // Firefox Focus\n ],\n [t, [a, X + \" Focus\"]],\n [\n /\\bopt\\/([\\w\\.]+)/i\n // Opera Touch\n ],\n [t, [a, K + \" Touch\"]],\n [\n /coc_coc\\w+\\/([\\w\\.]+)/i\n // Coc Coc Browser\n ],\n [t, [a, \"Coc Coc\"]],\n [\n /dolfin\\/([\\w\\.]+)/i\n // Dolphin\n ],\n [t, [a, \"Dolphin\"]],\n [\n /coast\\/([\\w\\.]+)/i\n // Opera Coast\n ],\n [t, [a, K + \" Coast\"]],\n [\n /miuibrowser\\/([\\w\\.]+)/i\n // MIUI Browser\n ],\n [t, [a, \"MIUI \" + T]],\n [\n /fxios\\/([-\\w\\.]+)/i\n // Firefox for iOS\n ],\n [t, [a, X]],\n [\n /\\bqihu|(qi?ho?o?|360)browser/i\n // 360\n ],\n [[a, \"360 \" + T]],\n [\n /(oculus|sailfish|huawei|vivo)browser\\/([\\w\\.]+)/i\n ],\n [[a, /(.+)/, \"$1 \" + T], t],\n [\n // Oculus/Sailfish/HuaweiBrowser/VivoBrowser\n /samsungbrowser\\/([\\w\\.]+)/i\n // Samsung Internet\n ],\n [t, [a, Z + \" Internet\"]],\n [\n /(comodo_dragon)\\/([\\w\\.]+)/i\n // Comodo Dragon\n ],\n [[a, /_/g, \" \"], t],\n [\n /metasr[\\/ ]?([\\d\\.]+)/i\n // Sogou Explorer\n ],\n [t, [a, \"Sogou Explorer\"]],\n [\n /(sogou)mo\\w+\\/([\\d\\.]+)/i\n // Sogou Mobile\n ],\n [[a, \"Sogou Mobile\"], t],\n [\n /(electron)\\/([\\w\\.]+) safari/i,\n // Electron-based App\n /(tesla)(?: qtcarbrowser|\\/(20\\d\\d\\.[-\\w\\.]+))/i,\n // Tesla\n /m?(qqbrowser|2345Explorer)[\\/ ]?([\\w\\.]+)/i\n // QQBrowser/2345 Browser\n ],\n [a, t],\n [\n /(lbbrowser)/i,\n // LieBao Browser\n /\\[(linkedin)app\\]/i\n // LinkedIn App for iOS & Android\n ],\n [a],\n [\n // WebView\n /((?:fban\\/fbios|fb_iab\\/fb4a)(?!.+fbav)|;fbav\\/([\\w\\.]+);)/i\n // Facebook App for iOS & Android\n ],\n [[a, fi], t],\n [\n /(Klarna)\\/([\\w\\.]+)/i,\n // Klarna Shopping Browser for iOS & Android\n /(kakao(?:talk|story))[\\/ ]([\\w\\.]+)/i,\n // Kakao App\n /(naver)\\(.*?(\\d+\\.[\\w\\.]+).*\\)/i,\n // Naver InApp\n /safari (line)\\/([\\w\\.]+)/i,\n // Line App for iOS\n /\\b(line)\\/([\\w\\.]+)\\/iab/i,\n // Line App for Android\n /(alipay)client\\/([\\w\\.]+)/i,\n // Alipay\n /(chromium|instagram|snapchat)[\\/ ]([-\\w\\.]+)/i\n // Chromium/Instagram/Snapchat\n ],\n [a, t],\n [\n /\\bgsa\\/([\\w\\.]+) .*safari\\//i\n // Google Search Appliance on iOS\n ],\n [t, [a, \"GSA\"]],\n [\n /musical_ly(?:.+app_?version\\/|_)([\\w\\.]+)/i\n // TikTok\n ],\n [t, [a, \"TikTok\"]],\n [\n /headlesschrome(?:\\/([\\w\\.]+)| )/i\n // Chrome Headless\n ],\n [t, [a, H + \" Headless\"]],\n [\n / wv\\).+(chrome)\\/([\\w\\.]+)/i\n // Chrome WebView\n ],\n [[a, H + \" WebView\"], t],\n [\n /droid.+ version\\/([\\w\\.]+)\\b.+(?:mobile safari|safari)/i\n // Android Browser\n ],\n [t, [a, \"Android \" + T]],\n [\n /(chrome|omniweb|arora|[tizenoka]{5} ?browser)\\/v?([\\w\\.]+)/i\n // Chrome/OmniWeb/Arora/Tizen/Nokia\n ],\n [a, t],\n [\n /version\\/([\\w\\.\\,]+) .*mobile\\/\\w+ (safari)/i\n // Mobile Safari\n ],\n [t, [a, \"Mobile Safari\"]],\n [\n /version\\/([\\w(\\.|\\,)]+) .*(mobile ?safari|safari)/i\n // Safari & Safari Mobile\n ],\n [t, a],\n [\n /webkit.+?(mobile ?safari|safari)(\\/[\\w\\.]+)/i\n // Safari < 3.0\n ],\n [a, [t, bi, Mi]],\n [\n /(webkit|khtml)\\/([\\w\\.]+)/i\n ],\n [a, t],\n [\n // Gecko based\n /(navigator|netscape\\d?)\\/([-\\w\\.]+)/i\n // Netscape\n ],\n [[a, \"Netscape\"], t],\n [\n /mobile vr; rv:([\\w\\.]+)\\).+firefox/i\n // Firefox Reality\n ],\n [t, [a, X + \" Reality\"]],\n [\n /ekiohf.+(flow)\\/([\\w\\.]+)/i,\n // Flow\n /(swiftfox)/i,\n // Swiftfox\n /(icedragon|iceweasel|camino|chimera|fennec|maemo browser|minimo|conkeror|klar)[\\/ ]?([\\w\\.\\+]+)/i,\n // IceDragon/Iceweasel/Camino/Chimera/Fennec/Maemo/Minimo/Conkeror/Klar\n /(seamonkey|k-meleon|icecat|iceape|firebird|phoenix|palemoon|basilisk|waterfox)\\/([-\\w\\.]+)$/i,\n // Firefox/SeaMonkey/K-Meleon/IceCat/IceApe/Firebird/Phoenix\n /(firefox)\\/([\\w\\.]+)/i,\n // Other Firefox-based\n /(mozilla)\\/([\\w\\.]+) .+rv\\:.+gecko\\/\\d+/i,\n // Mozilla\n // Other\n /(polaris|lynx|dillo|icab|doris|amaya|w3m|netsurf|sleipnir|obigo|mosaic|(?:go|ice|up)[\\. ]?browser)[-\\/ ]?v?([\\w\\.]+)/i,\n // Polaris/Lynx/Dillo/iCab/Doris/Amaya/w3m/NetSurf/Sleipnir/Obigo/Mosaic/Go/ICE/UP.Browser\n /(links) \\(([\\w\\.]+)/i,\n // Links\n /panasonic;(viera)/i\n // Panasonic Viera\n ],\n [a, t],\n [\n /(cobalt)\\/([\\w\\.]+)/i\n // Cobalt\n ],\n [a, [t, /master.|lts./, \"\"]]\n ],\n cpu: [\n [\n /(?:(amd|x(?:(?:86|64)[-_])?|wow|win)64)[;\\)]/i\n // AMD64 (x64)\n ],\n [[v, \"amd64\"]],\n [\n /(ia32(?=;))/i\n // IA32 (quicktime)\n ],\n [[v, U]],\n [\n /((?:i[346]|x)86)[;\\)]/i\n // IA32 (x86)\n ],\n [[v, \"ia32\"]],\n [\n /\\b(aarch64|arm(v?8e?l?|_?64))\\b/i\n // ARM64\n ],\n [[v, \"arm64\"]],\n [\n /\\b(arm(?:v[67])?ht?n?[fl]p?)\\b/i\n // ARMHF\n ],\n [[v, \"armhf\"]],\n [\n // PocketPC mistakenly identified as PowerPC\n /windows (ce|mobile); ppc;/i\n ],\n [[v, \"arm\"]],\n [\n /((?:ppc|powerpc)(?:64)?)(?: mac|;|\\))/i\n // PowerPC\n ],\n [[v, /ower/, M, U]],\n [\n /(sun4\\w)[;\\)]/i\n // SPARC\n ],\n [[v, \"sparc\"]],\n [\n /((?:avr32|ia64(?=;))|68k(?=\\))|\\barm(?=v(?:[1-7]|[5-7]1)l?|;|eabi)|(?=atmel )avr|(?:irix|mips|sparc)(?:64)?\\b|pa-risc)/i\n // IA64, 68K, ARM/64, AVR/32, IRIX/64, MIPS/64, SPARC/64, PA-RISC\n ],\n [[v, U]]\n ],\n device: [\n [\n //////////////////////////\n // MOBILES & TABLETS\n /////////////////////////\n // Samsung\n /\\b(sch-i[89]0\\d|shw-m380s|sm-[ptx]\\w{2,4}|gt-[pn]\\d{2,4}|sgh-t8[56]9|nexus 10)/i\n ],\n [e, [o, Z], [i, b]],\n [\n /\\b((?:s[cgp]h|gt|sm)-\\w+|sc[g-]?[\\d]+a?|galaxy nexus)/i,\n /samsung[- ]([-\\w]+)/i,\n /sec-(sgh\\w+)/i\n ],\n [e, [o, Z], [i, n]],\n [\n // Apple\n /(?:\\/|\\()(ip(?:hone|od)[\\w, ]*)(?:\\/|;)/i\n // iPod/iPhone\n ],\n [e, [o, D], [i, n]],\n [\n /\\((ipad);[-\\w\\),; ]+apple/i,\n // iPad\n /applecoremedia\\/[\\w\\.]+ \\((ipad)/i,\n /\\b(ipad)\\d\\d?,\\d\\d?[;\\]].+ios/i\n ],\n [e, [o, D], [i, b]],\n [\n /(macintosh);/i\n ],\n [e, [o, D]],\n [\n // Sharp\n /\\b(sh-?[altvz]?\\d\\d[a-ekm]?)/i\n ],\n [e, [o, hi], [i, n]],\n [\n // Huawei\n /\\b((?:ag[rs][23]?|bah2?|sht?|btv)-a?[lw]\\d{2})\\b(?!.+d\\/s)/i\n ],\n [e, [o, ui], [i, b]],\n [\n /(?:huawei|honor)([-\\w ]+)[;\\)]/i,\n /\\b(nexus 6p|\\w{2,4}e?-[atu]?[ln][\\dx][012359c][adn]?)\\b(?!.+d\\/s)/i\n ],\n [e, [o, ui], [i, n]],\n [\n // Xiaomi\n /\\b(poco[\\w ]+|m2\\d{3}j\\d\\d[a-z]{2})(?: bui|\\))/i,\n // Xiaomi POCO\n /\\b; (\\w+) build\\/hm\\1/i,\n // Xiaomi Hongmi 'numeric' models\n /\\b(hm[-_ ]?note?[_ ]?(?:\\d\\w)?) bui/i,\n // Xiaomi Hongmi\n /\\b(redmi[\\-_ ]?(?:note|k)?[\\w_ ]+)(?: bui|\\))/i,\n // Xiaomi Redmi\n /oid[^\\)]+; (m?[12][0-389][01]\\w{3,6}[c-y])( bui|; wv|\\))/i,\n // Xiaomi Redmi 'numeric' models\n /\\b(mi[-_ ]?(?:a\\d|one|one[_ ]plus|note lte|max|cc)?[_ ]?(?:\\d?\\w?)[_ ]?(?:plus|se|lite)?)(?: bui|\\))/i\n // Xiaomi Mi\n ],\n [[e, /_/g, \" \"], [o, ri], [i, n]],\n [\n /oid[^\\)]+; (2\\d{4}(283|rpbf)[cgl])( bui|\\))/i,\n // Redmi Pad\n /\\b(mi[-_ ]?(?:pad)(?:[\\w_ ]+))(?: bui|\\))/i\n // Mi Pad tablets\n ],\n [[e, /_/g, \" \"], [o, ri], [i, b]],\n [\n // OPPO\n /; (\\w+) bui.+ oppo/i,\n /\\b(cph[12]\\d{3}|p(?:af|c[al]|d\\w|e[ar])[mt]\\d0|x9007|a101op)\\b/i\n ],\n [e, [o, \"OPPO\"], [i, n]],\n [\n // Vivo\n /vivo (\\w+)(?: bui|\\))/i,\n /\\b(v[12]\\d{3}\\w?[at])(?: bui|;)/i\n ],\n [e, [o, \"Vivo\"], [i, n]],\n [\n // Realme\n /\\b(rmx[1-3]\\d{3})(?: bui|;|\\))/i\n ],\n [e, [o, \"Realme\"], [i, n]],\n [\n // Motorola\n /\\b(milestone|droid(?:[2-4x]| (?:bionic|x2|pro|razr))?:?( 4g)?)\\b[\\w ]+build\\//i,\n /\\bmot(?:orola)?[- ](\\w*)/i,\n /((?:moto[\\w\\(\\) ]+|xt\\d{3,4}|nexus 6)(?= bui|\\)))/i\n ],\n [e, [o, pi], [i, n]],\n [\n /\\b(mz60\\d|xoom[2 ]{0,2}) build\\//i\n ],\n [e, [o, pi], [i, b]],\n [\n // LG\n /((?=lg)?[vl]k\\-?\\d{3}) bui| 3\\.[-\\w; ]{10}lg?-([06cv9]{3,4})/i\n ],\n [e, [o, ai], [i, b]],\n [\n /(lm(?:-?f100[nv]?|-[\\w\\.]+)(?= bui|\\))|nexus [45])/i,\n /\\blg[-e;\\/ ]+((?!browser|netcast|android tv)\\w+)/i,\n /\\blg-?([\\d\\w]+) bui/i\n ],\n [e, [o, ai], [i, n]],\n [\n // Lenovo\n /(ideatab[-\\w ]+)/i,\n /lenovo ?(s[56]000[-\\w]+|tab(?:[\\w ]+)|yt[-\\d\\w]{6}|tb[-\\d\\w]{6})/i\n ],\n [e, [o, \"Lenovo\"], [i, b]],\n [\n // Nokia\n /(?:maemo|nokia).*(n900|lumia \\d+)/i,\n /nokia[-_ ]?([-\\w\\.]*)/i\n ],\n [[e, /_/g, \" \"], [o, \"Nokia\"], [i, n]],\n [\n // Google\n /(pixel c)\\b/i\n // Google Pixel C\n ],\n [e, [o, Y], [i, b]],\n [\n /droid.+; (pixel[\\daxl ]{0,6})(?: bui|\\))/i\n // Google Pixel\n ],\n [e, [o, Y], [i, n]],\n [\n // Sony\n /droid.+ (a?\\d[0-2]{2}so|[c-g]\\d{4}|so[-gl]\\w+|xq-a\\w[4-7][12])(?= bui|\\).+chrome\\/(?![1-6]{0,1}\\d\\.))/i\n ],\n [e, [o, J], [i, n]],\n [\n /sony tablet [ps]/i,\n /\\b(?:sony)?sgp\\w+(?: bui|\\))/i\n ],\n [[e, \"Xperia Tablet\"], [o, J], [i, b]],\n [\n // OnePlus\n / (kb2005|in20[12]5|be20[12][59])\\b/i,\n /(?:one)?(?:plus)? (a\\d0\\d\\d)(?: b|\\))/i\n ],\n [e, [o, \"OnePlus\"], [i, n]],\n [\n // Amazon\n /(alexa)webm/i,\n /(kf[a-z]{2}wi|aeo[c-r]{2})( bui|\\))/i,\n // Kindle Fire without Silk / Echo Show\n /(kf[a-z]+)( bui|\\)).+silk\\//i\n // Kindle Fire HD\n ],\n [e, [o, G], [i, b]],\n [\n /((?:sd|kf)[0349hijorstuw]+)( bui|\\)).+silk\\//i\n // Fire Phone\n ],\n [[e, /(.+)/g, \"Fire Phone $1\"], [o, G], [i, n]],\n [\n // BlackBerry\n /(playbook);[-\\w\\),; ]+(rim)/i\n // BlackBerry PlayBook\n ],\n [e, o, [i, b]],\n [\n /\\b((?:bb[a-f]|st[hv])100-\\d)/i,\n /\\(bb10; (\\w+)/i\n // BlackBerry 10\n ],\n [e, [o, mi], [i, n]],\n [\n // Asus\n /(?:\\b|asus_)(transfo[prime ]{4,10} \\w+|eeepc|slider \\w+|nexus 7|padfone|p00[cj])/i\n ],\n [e, [o, di], [i, b]],\n [\n / (z[bes]6[027][012][km][ls]|zenfone \\d\\w?)\\b/i\n ],\n [e, [o, di], [i, n]],\n [\n // HTC\n /(nexus 9)/i\n // HTC Nexus 9\n ],\n [e, [o, \"HTC\"], [i, b]],\n [\n /(htc)[-;_ ]{1,2}([\\w ]+(?=\\)| bui)|\\w+)/i,\n // HTC\n // ZTE\n /(zte)[- ]([\\w ]+?)(?: bui|\\/|\\))/i,\n /(alcatel|geeksphone|nexian|panasonic(?!(?:;|\\.))|sony(?!-bra))[-_ ]?([-\\w]*)/i\n // Alcatel/GeeksPhone/Nexian/Panasonic/Sony\n ],\n [o, [e, /_/g, \" \"], [i, n]],\n [\n // Acer\n /droid.+; ([ab][1-7]-?[0178a]\\d\\d?)/i\n ],\n [e, [o, \"Acer\"], [i, b]],\n [\n // Meizu\n /droid.+; (m[1-5] note) bui/i,\n /\\bmz-([-\\w]{2,})/i\n ],\n [e, [o, \"Meizu\"], [i, n]],\n [\n // Ulefone\n /; ((?:power )?armor(?:[\\w ]{0,8}))(?: bui|\\))/i\n ],\n [e, [o, \"Ulefone\"], [i, n]],\n [\n // MIXED\n /(blackberry|benq|palm(?=\\-)|sonyericsson|acer|asus|dell|meizu|motorola|polytron|infinix|tecno)[-_ ]?([-\\w]*)/i,\n // BlackBerry/BenQ/Palm/Sony-Ericsson/Acer/Asus/Dell/Meizu/Motorola/Polytron\n /(hp) ([\\w ]+\\w)/i,\n // HP iPAQ\n /(asus)-?(\\w+)/i,\n // Asus\n /(microsoft); (lumia[\\w ]+)/i,\n // Microsoft Lumia\n /(lenovo)[-_ ]?([-\\w]+)/i,\n // Lenovo\n /(jolla)/i,\n // Jolla\n /(oppo) ?([\\w ]+) bui/i\n // OPPO\n ],\n [o, e, [i, n]],\n [\n /(kobo)\\s(ereader|touch)/i,\n // Kobo\n /(archos) (gamepad2?)/i,\n // Archos\n /(hp).+(touchpad(?!.+tablet)|tablet)/i,\n // HP TouchPad\n /(kindle)\\/([\\w\\.]+)/i,\n // Kindle\n /(nook)[\\w ]+build\\/(\\w+)/i,\n // Nook\n /(dell) (strea[kpr\\d ]*[\\dko])/i,\n // Dell Streak\n /(le[- ]+pan)[- ]+(\\w{1,9}) bui/i,\n // Le Pan Tablets\n /(trinity)[- ]*(t\\d{3}) bui/i,\n // Trinity Tablets\n /(gigaset)[- ]+(q\\w{1,9}) bui/i,\n // Gigaset Tablets\n /(vodafone) ([\\w ]+)(?:\\)| bui)/i\n // Vodafone\n ],\n [o, e, [i, b]],\n [\n /(surface duo)/i\n // Surface Duo\n ],\n [e, [o, ti], [i, b]],\n [\n /droid [\\d\\.]+; (fp\\du?)(?: b|\\))/i\n // Fairphone\n ],\n [e, [o, \"Fairphone\"], [i, n]],\n [\n /(u304aa)/i\n // AT&T\n ],\n [e, [o, \"AT&T\"], [i, n]],\n [\n /\\bsie-(\\w*)/i\n // Siemens\n ],\n [e, [o, \"Siemens\"], [i, n]],\n [\n /\\b(rct\\w+) b/i\n // RCA Tablets\n ],\n [e, [o, \"RCA\"], [i, b]],\n [\n /\\b(venue[\\d ]{2,7}) b/i\n // Dell Venue Tablets\n ],\n [e, [o, \"Dell\"], [i, b]],\n [\n /\\b(q(?:mv|ta)\\w+) b/i\n // Verizon Tablet\n ],\n [e, [o, \"Verizon\"], [i, b]],\n [\n /\\b(?:barnes[& ]+noble |bn[rt])([\\w\\+ ]*) b/i\n // Barnes & Noble Tablet\n ],\n [e, [o, \"Barnes & Noble\"], [i, b]],\n [\n /\\b(tm\\d{3}\\w+) b/i\n ],\n [e, [o, \"NuVision\"], [i, b]],\n [\n /\\b(k88) b/i\n // ZTE K Series Tablet\n ],\n [e, [o, \"ZTE\"], [i, b]],\n [\n /\\b(nx\\d{3}j) b/i\n // ZTE Nubia\n ],\n [e, [o, \"ZTE\"], [i, n]],\n [\n /\\b(gen\\d{3}) b.+49h/i\n // Swiss GEN Mobile\n ],\n [e, [o, \"Swiss\"], [i, n]],\n [\n /\\b(zur\\d{3}) b/i\n // Swiss ZUR Tablet\n ],\n [e, [o, \"Swiss\"], [i, b]],\n [\n /\\b((zeki)?tb.*\\b) b/i\n // Zeki Tablets\n ],\n [e, [o, \"Zeki\"], [i, b]],\n [\n /\\b([yr]\\d{2}) b/i,\n /\\b(dragon[- ]+touch |dt)(\\w{5}) b/i\n // Dragon Touch Tablet\n ],\n [[o, \"Dragon Touch\"], e, [i, b]],\n [\n /\\b(ns-?\\w{0,9}) b/i\n // Insignia Tablets\n ],\n [e, [o, \"Insignia\"], [i, b]],\n [\n /\\b((nxa|next)-?\\w{0,9}) b/i\n // NextBook Tablets\n ],\n [e, [o, \"NextBook\"], [i, b]],\n [\n /\\b(xtreme\\_)?(v(1[045]|2[015]|[3469]0|7[05])) b/i\n // Voice Xtreme Phones\n ],\n [[o, \"Voice\"], e, [i, n]],\n [\n /\\b(lvtel\\-)?(v1[12]) b/i\n // LvTel Phones\n ],\n [[o, \"LvTel\"], e, [i, n]],\n [\n /\\b(ph-1) /i\n // Essential PH-1\n ],\n [e, [o, \"Essential\"], [i, n]],\n [\n /\\b(v(100md|700na|7011|917g).*\\b) b/i\n // Envizen Tablets\n ],\n [e, [o, \"Envizen\"], [i, b]],\n [\n /\\b(trio[-\\w\\. ]+) b/i\n // MachSpeed Tablets\n ],\n [e, [o, \"MachSpeed\"], [i, b]],\n [\n /\\btu_(1491) b/i\n // Rotor Tablets\n ],\n [e, [o, \"Rotor\"], [i, b]],\n [\n /(shield[\\w ]+) b/i\n // Nvidia Shield Tablets\n ],\n [e, [o, \"Nvidia\"], [i, b]],\n [\n /(sprint) (\\w+)/i\n // Sprint Phones\n ],\n [o, e, [i, n]],\n [\n /(kin\\.[onetw]{3})/i\n // Microsoft Kin\n ],\n [[e, /\\./g, \" \"], [o, ti], [i, n]],\n [\n /droid.+; (cc6666?|et5[16]|mc[239][23]x?|vc8[03]x?)\\)/i\n // Zebra\n ],\n [e, [o, si], [i, b]],\n [\n /droid.+; (ec30|ps20|tc[2-8]\\d[kx])\\)/i\n ],\n [e, [o, si], [i, n]],\n [\n ///////////////////\n // SMARTTVS\n ///////////////////\n /smart-tv.+(samsung)/i\n // Samsung\n ],\n [o, [i, h]],\n [\n /hbbtv.+maple;(\\d+)/i\n ],\n [[e, /^/, \"SmartTV\"], [o, Z], [i, h]],\n [\n /(nux; netcast.+smarttv|lg (netcast\\.tv-201\\d|android tv))/i\n // LG SmartTV\n ],\n [[o, ai], [i, h]],\n [\n /(apple) ?tv/i\n // Apple TV\n ],\n [o, [e, D + \" TV\"], [i, h]],\n [\n /crkey/i\n // Google Chromecast\n ],\n [[e, H + \"cast\"], [o, Y], [i, h]],\n [\n /droid.+aft(\\w+)( bui|\\))/i\n // Fire TV\n ],\n [e, [o, G], [i, h]],\n [\n /\\(dtv[\\);].+(aquos)/i,\n /(aquos-tv[\\w ]+)\\)/i\n // Sharp\n ],\n [e, [o, hi], [i, h]],\n [\n /(bravia[\\w ]+)( bui|\\))/i\n // Sony\n ],\n [e, [o, J], [i, h]],\n [\n /(mitv-\\w{5}) bui/i\n // Xiaomi\n ],\n [e, [o, ri], [i, h]],\n [\n /Hbbtv.*(technisat) (.*);/i\n // TechniSAT\n ],\n [o, e, [i, h]],\n [\n /\\b(roku)[\\dx]*[\\)\\/]((?:dvp-)?[\\d\\.]*)/i,\n // Roku\n /hbbtv\\/\\d+\\.\\d+\\.\\d+ +\\([\\w\\+ ]*; *([\\w\\d][^;]*);([^;]*)/i\n // HbbTV devices\n ],\n [[o, ni], [e, ni], [i, h]],\n [\n /\\b(android tv|smart[- ]?tv|opera tv|tv; rv:)\\b/i\n // SmartTV from Unidentified Vendors\n ],\n [[i, h]],\n [\n ///////////////////\n // CONSOLES\n ///////////////////\n /(ouya)/i,\n // Ouya\n /(nintendo) ([wids3utch]+)/i\n // Nintendo\n ],\n [o, e, [i, B]],\n [\n /droid.+; (shield) bui/i\n // Nvidia\n ],\n [e, [o, \"Nvidia\"], [i, B]],\n [\n /(playstation [345portablevi]+)/i\n // Playstation\n ],\n [e, [o, J], [i, B]],\n [\n /\\b(xbox(?: one)?(?!; xbox))[\\); ]/i\n // Microsoft Xbox\n ],\n [e, [o, ti], [i, B]],\n [\n ///////////////////\n // WEARABLES\n ///////////////////\n /((pebble))app/i\n // Pebble\n ],\n [o, e, [i, N]],\n [\n /(watch)(?: ?os[,\\/]|\\d,\\d\\/)[\\d\\.]+/i\n // Apple Watch\n ],\n [e, [o, D], [i, N]],\n [\n /droid.+; (glass) \\d/i\n // Google Glass\n ],\n [e, [o, Y], [i, N]],\n [\n /droid.+; (wt63?0{2,3})\\)/i\n ],\n [e, [o, si], [i, N]],\n [\n /(quest( 2| pro)?)/i\n // Oculus Quest\n ],\n [e, [o, fi], [i, N]],\n [\n ///////////////////\n // EMBEDDED\n ///////////////////\n /(tesla)(?: qtcarbrowser|\\/[-\\w\\.]+)/i\n // Tesla\n ],\n [o, [i, ei]],\n [\n /(aeobc)\\b/i\n // Echo Dot\n ],\n [e, [o, G], [i, ei]],\n [\n ////////////////////\n // MIXED (GENERIC)\n ///////////////////\n /droid .+?; ([^;]+?)(?: bui|; wv\\)|\\) applew).+? mobile safari/i\n // Android Phones from Unidentified Vendors\n ],\n [e, [i, n]],\n [\n /droid .+?; ([^;]+?)(?: bui|\\) applew).+?(?! mobile) safari/i\n // Android Tablets from Unidentified Vendors\n ],\n [e, [i, b]],\n [\n /\\b((tablet|tab)[;\\/]|focus\\/\\d(?!.+mobile))/i\n // Unidentifiable Tablet\n ],\n [[i, b]],\n [\n /(phone|mobile(?:[;\\/]| [ \\w\\/\\.]*safari)|pda(?=.+windows ce))/i\n // Unidentifiable Mobile\n ],\n [[i, n]],\n [\n /(android[-\\w\\. ]{0,9});.+buil/i\n // Generic Android Device\n ],\n [e, [o, \"Generic\"]]\n ],\n engine: [\n [\n /windows.+ edge\\/([\\w\\.]+)/i\n // EdgeHTML\n ],\n [t, [a, yi + \"HTML\"]],\n [\n /webkit\\/537\\.36.+chrome\\/(?!27)([\\w\\.]+)/i\n // Blink\n ],\n [t, [a, \"Blink\"]],\n [\n /(presto)\\/([\\w\\.]+)/i,\n // Presto\n /(webkit|trident|netfront|netsurf|amaya|lynx|w3m|goanna)\\/([\\w\\.]+)/i,\n // WebKit/Trident/NetFront/NetSurf/Amaya/Lynx/w3m/Goanna\n /ekioh(flow)\\/([\\w\\.]+)/i,\n // Flow\n /(khtml|tasman|links)[\\/ ]\\(?([\\w\\.]+)/i,\n // KHTML/Tasman/Links\n /(icab)[\\/ ]([23]\\.[\\d\\.]+)/i,\n // iCab\n /\\b(libweb)/i\n ],\n [a, t],\n [\n /rv\\:([\\w\\.]{1,9})\\b.+(gecko)/i\n // Gecko\n ],\n [t, a]\n ],\n os: [\n [\n // Windows\n /microsoft (windows) (vista|xp)/i\n // Windows (iTunes)\n ],\n [a, t],\n [\n /(windows (?:phone(?: os)?|mobile))[\\/ ]?([\\d\\.\\w ]*)/i\n // Windows Phone\n ],\n [a, [t, bi, Oi]],\n [\n /windows nt 6\\.2; (arm)/i,\n // Windows RT\n /windows[\\/ ]?([ntce\\d\\. ]+\\w)(?!.+xbox)/i,\n /(?:win(?=3|9|n)|win 9x )([nt\\d\\.]+)/i\n ],\n [[t, bi, Oi], [a, \"Windows\"]],\n [\n // iOS/macOS\n /ip[honead]{2,4}\\b(?:.*os ([\\w]+) like mac|; opera)/i,\n // iOS\n /(?:ios;fbsv\\/|iphone.+ios[\\/ ])([\\d\\.]+)/i,\n /cfnetwork\\/.+darwin/i\n ],\n [[t, /_/g, \".\"], [a, \"iOS\"]],\n [\n /(mac os x) ?([\\w\\. ]*)/i,\n /(macintosh|mac_powerpc\\b)(?!.+haiku)/i\n // Mac OS\n ],\n [[a, gi], [t, /_/g, \".\"]],\n [\n // Mobile OSes\n /droid ([\\w\\.]+)\\b.+(android[- ]x86|harmonyos)/i\n // Android-x86/HarmonyOS\n ],\n [t, a],\n [\n // Android/WebOS/QNX/Bada/RIM/Maemo/MeeGo/Sailfish OS\n /(android|webos|qnx|bada|rim tablet os|maemo|meego|sailfish)[-\\/ ]?([\\w\\.]*)/i,\n /(blackberry)\\w*\\/([\\w\\.]*)/i,\n // Blackberry\n /(tizen|kaios)[\\/ ]([\\w\\.]+)/i,\n // Tizen/KaiOS\n /\\((series40);/i\n // Series 40\n ],\n [a, t],\n [\n /\\(bb(10);/i\n // BlackBerry 10\n ],\n [t, [a, mi]],\n [\n /(?:symbian ?os|symbos|s60(?=;)|series60)[-\\/ ]?([\\w\\.]*)/i\n // Symbian\n ],\n [t, [a, \"Symbian\"]],\n [\n /mozilla\\/[\\d\\.]+ \\((?:mobile|tablet|tv|mobile; [\\w ]+); rv:.+ gecko\\/([\\w\\.]+)/i\n // Firefox OS\n ],\n [t, [a, X + \" OS\"]],\n [\n /web0s;.+rt(tv)/i,\n /\\b(?:hp)?wos(?:browser)?\\/([\\w\\.]+)/i\n // WebOS\n ],\n [t, [a, \"webOS\"]],\n [\n /watch(?: ?os[,\\/]|\\d,\\d\\/)([\\d\\.]+)/i\n // watchOS\n ],\n [t, [a, \"watchOS\"]],\n [\n // Google Chromecast\n /crkey\\/([\\d\\.]+)/i\n // Google Chromecast\n ],\n [t, [a, H + \"cast\"]],\n [\n /(cros) [\\w]+(?:\\)| ([\\w\\.]+)\\b)/i\n // Chromium OS\n ],\n [[a, vi], t],\n [\n // Smart TVs\n /panasonic;(viera)/i,\n // Panasonic Viera\n /(netrange)mmh/i,\n // Netrange\n /(nettv)\\/(\\d+\\.[\\w\\.]+)/i,\n // NetTV\n // Console\n /(nintendo|playstation) ([wids345portablevuch]+)/i,\n // Nintendo/Playstation\n /(xbox); +xbox ([^\\);]+)/i,\n // Microsoft Xbox (360, One, X, S, Series X, Series S)\n // Other\n /\\b(joli|palm)\\b ?(?:os)?\\/?([\\w\\.]*)/i,\n // Joli/Palm\n /(mint)[\\/\\(\\) ]?(\\w*)/i,\n // Mint\n /(mageia|vectorlinux)[; ]/i,\n // Mageia/VectorLinux\n /([kxln]?ubuntu|debian|suse|opensuse|gentoo|arch(?= linux)|slackware|fedora|mandriva|centos|pclinuxos|red ?hat|zenwalk|linpus|raspbian|plan 9|minix|risc os|contiki|deepin|manjaro|elementary os|sabayon|linspire)(?: gnu\\/linux)?(?: enterprise)?(?:[- ]linux)?(?:-gnu)?[-\\/ ]?(?!chrom|package)([-\\w\\.]*)/i,\n // Ubuntu/Debian/SUSE/Gentoo/Arch/Slackware/Fedora/Mandriva/CentOS/PCLinuxOS/RedHat/Zenwalk/Linpus/Raspbian/Plan9/Minix/RISCOS/Contiki/Deepin/Manjaro/elementary/Sabayon/Linspire\n /(hurd|linux) ?([\\w\\.]*)/i,\n // Hurd/Linux\n /(gnu) ?([\\w\\.]*)/i,\n // GNU\n /\\b([-frentopcghs]{0,5}bsd|dragonfly)[\\/ ]?(?!amd|[ix346]{1,2}86)([\\w\\.]*)/i,\n // FreeBSD/NetBSD/OpenBSD/PC-BSD/GhostBSD/DragonFly\n /(haiku) (\\w+)/i\n // Haiku\n ],\n [a, t],\n [\n /(sunos) ?([\\w\\.\\d]*)/i\n // Solaris\n ],\n [[a, \"Solaris\"], t],\n [\n /((?:open)?solaris)[-\\/ ]?([\\w\\.]*)/i,\n // Solaris\n /(aix) ((\\d)(?=\\.|\\)| )[\\w\\.])*/i,\n // AIX\n /\\b(beos|os\\/2|amigaos|morphos|openvms|fuchsia|hp-ux|serenityos)/i,\n // BeOS/OS2/AmigaOS/MorphOS/OpenVMS/Fuchsia/HP-UX/SerenityOS\n /(unix) ?([\\w\\.]*)/i\n // UNIX\n ],\n [a, t]\n ]\n }, g = function(c, l) {\n if (typeof c === ii && (l = c, c = m), !(this instanceof g))\n return new g(c, l).getResult();\n var s = typeof A !== V && A.navigator ? A.navigator : m, d = c || (s && s.userAgent ? s.userAgent : M), y = s && s.userAgentData ? s.userAgentData : m, O = l ? Ti(ki, l) : ki, w = s && s.userAgent == d;\n return this.getBrowser = function() {\n var r = {};\n return r[a] = m, r[t] = m, L.call(r, d, O.browser), r[li] = _i(r[t]), w && s && s.brave && typeof s.brave.isBrave == R && (r[a] = \"Brave\"), r;\n }, this.getCPU = function() {\n var r = {};\n return r[v] = m, L.call(r, d, O.cpu), r;\n }, this.getDevice = function() {\n var r = {};\n return r[o] = m, r[e] = m, r[i] = m, L.call(r, d, O.device), w && !r[i] && y && y.mobile && (r[i] = n), w && r[e] == \"Macintosh\" && s && typeof s.standalone !== V && s.maxTouchPoints && s.maxTouchPoints > 2 && (r[e] = \"iPad\", r[i] = b), r;\n }, this.getEngine = function() {\n var r = {};\n return r[a] = m, r[t] = m, L.call(r, d, O.engine), r;\n }, this.getOS = function() {\n var r = {};\n return r[a] = m, r[t] = m, L.call(r, d, O.os), w && !r[a] && y && y.platform != \"Unknown\" && (r[a] = y.platform.replace(/chrome os/i, vi).replace(/macos/i, gi)), r;\n }, this.getResult = function() {\n return {\n ua: this.getUA(),\n browser: this.getBrowser(),\n engine: this.getEngine(),\n os: this.getOS(),\n device: this.getDevice(),\n cpu: this.getCPU()\n };\n }, this.getUA = function() {\n return d;\n }, this.setUA = function(r) {\n return d = typeof r === j && r.length > oi ? ni(r, oi) : r, this;\n }, this.setUA(d), this;\n };\n g.VERSION = F, g.BROWSER = Q([a, t, li]), g.CPU = Q([v]), g.DEVICE = Q([e, o, i, B, n, h, b, N, ei]), g.ENGINE = g.OS = Q([a, t]), E.exports && (q = E.exports = g), q.UAParser = g;\n var C = typeof A !== V && (A.jQuery || A.Zepto);\n if (C && !C.ua) {\n var $ = new g();\n C.ua = $.getResult(), C.ua.get = function() {\n return $.getUA();\n }, C.ua.set = function(c) {\n $.setUA(c);\n var l = $.getResult();\n for (var s in l)\n C.ua[s] = l[s];\n };\n }\n })(typeof window == \"object\" ? window : Ni);\n})(wi, wi.exports);\nvar Pi = wi.exports;\nconst Bi = /* @__PURE__ */ Ci(Pi), S = {\n CONSOLE: \"console\",\n DESKTOP: void 0,\n EMBEDDED: \"embedded\",\n MOBILE: \"mobile\",\n SMART_TV: \"smarttv\",\n TABLET: \"tablet\",\n WEARABLE: \"wearable\"\n}, _ = {\n ANDROID: \"Android\",\n IOS: \"iOS\",\n LINUX: \"Linux\",\n MAC_OS: \"Mac OS\",\n WINDOWS_PHONE: \"Windows Phone\",\n WINDOWS: \"Windows\"\n}, p = {\n CHROME: \"Chrome\",\n CHROMIUM: \"Chromium\",\n EDGE_CHROMIUM: \"Edge Chromium\",\n EDGE: \"Edge\",\n FIREFOX: \"Firefox\",\n IE: \"IE\",\n INTERNET_EXPLORER: \"Internet Explorer\",\n MIUI: \"MIUI Browser\",\n MOBILE_SAFARI: \"Mobile Safari\",\n OPERA: \"Opera\",\n SAFARI: \"Safari\",\n SAMSUNG_BROWSER: \"Samsung Browser\",\n YANDEX: \"Yandex\"\n}, z = new Bi(), f = z.getDevice(), x = z.getOS(), u = z.getBrowser(), Si = z.getEngine(), P = z.getUA(), W = () => /iPad/.test(P), Ai = () => x.name === _.WINDOWS && x.version === \"10\" && P.indexOf(\"Edg/\") !== -1, Di = x.name === _.ANDROID, Ui = u.name === p.CHROME, Li = u.name === p.CHROMIUM, zi = f.type === S.CONSOLE, Wi = f.type === S.DESKTOP, qi = u.name === p.EDGE || Ai(), Fi = Ai(), Vi = u.name === p.EDGE, ji = /electron/.test(P.toLowerCase()), Gi = f.type === S.EMBEDDED, Hi = u.name === p.FIREFOX, Xi = u.name === p.INTERNET_EXPLORER || u.name === p.IE, Yi = x.name === _.IOS || W(), Ki = W(), Zi = /iPhone/.test(P), Ji = /iPod/.test(P), Qi = x.name === _.LINUX, $i = x.name === _.MAC_OS, ie = u.name === p.MIUI, ee = f.type === S.MOBILE || f.type === S.TABLET || W(), oe = f.type === S.MOBILE, ae = u.name === p.MOBILE_SAFARI || W(), te = u.name === p.OPERA, re = u.name === p.SAFARI || u.name === p.MOBILE_SAFARI, se = u.name === p.SAMSUNG_BROWSER, ne = f.type === S.SMART_TV, be = f.type === S.TABLET || W(), ce = f.type === S.WEARABLE, we = x.name === _.WINDOWS, le = x.name === _.WINDOWS_PHONE, de = u.name === p.YANDEX, pe = () => u.name, he = () => u.version, fe = () => f.model, ve = () => f.type || \"desktop\", ge = () => f.vendor, Ee = () => Si.name, Oe = () => Si.version, ke = () => P, xe = () => x.name, Se = () => x.version, me = {\n isAndroid: Di,\n isChrome: Ui,\n isChromium: Li,\n isConsole: zi,\n isDesktop: Wi,\n isEdge: qi,\n isEdgeChromium: Fi,\n isEdgeLegacy: Vi,\n isElectron: ji,\n isEmbedded: Gi,\n isFirefox: Hi,\n isIE: Xi,\n isIOS: Yi,\n isIPad: Ki,\n isIPhone: Zi,\n isIPod: Ji,\n isLinux: Qi,\n isMacOS: $i,\n isMIUI: ie,\n isMobile: ee,\n isMobileOnly: oe,\n isMobileSafari: ae,\n isOpera: te,\n isSafari: re,\n isSamsungBrowser: se,\n isSmartTV: ne,\n isTablet: be,\n isWearable: ce,\n isWindows: we,\n isWinPhone: le,\n isYandex: de\n}, Ae = {\n install: (E) => {\n for (const [q, A] of Object.entries(me)) {\n const m = `${q.substring(2)}View`, F = Ii({\n name: m,\n props: {\n tagName: { type: String, default: \"div\" }\n },\n setup(M, { slots: I }) {\n return () => {\n var R;\n return A ? Ri(M.tagName, (R = I.default) == null ? void 0 : R.call(I)) : null;\n };\n }\n });\n E.component(F.name, F);\n }\n }\n};\nexport {\n pe as browserName,\n he as browserVersion,\n Ae as default,\n fe as deviceModel,\n ve as deviceType,\n ge as deviceVendor,\n Ee as engineName,\n Oe as engineVersion,\n ke as getUA,\n Di as isAndroid,\n Ui as isChrome,\n Li as isChromium,\n zi as isConsole,\n Wi as isDesktop,\n qi as isEdge,\n Fi as isEdgeChromium,\n Vi as isEdgeLegacy,\n ji as isElectron,\n Gi as isEmbedded,\n Hi as isFirefox,\n Xi as isIE,\n Yi as isIOS,\n Ki as isIPad,\n Zi as isIPhone,\n Ji as isIPod,\n Qi as isLinux,\n ie as isMIUI,\n $i as isMacOS,\n ee as isMobile,\n oe as isMobileOnly,\n ae as isMobileSafari,\n te as isOpera,\n re as isSafari,\n se as isSamsungBrowser,\n ne as isSmartTV,\n be as isTablet,\n ce as isWearable,\n le as isWinPhone,\n we as isWindows,\n de as isYandex,\n xe as osName,\n Se as osVersion\n};\n","\n\n\n\n\n\n\n"],"names":["IconDeviceDesktop","createVueComponent","IconDeviceMobile","IconDeviceTablet","IconDeviceUnknown","IconLinkOff","IconPlugConnectedX","IconReload","canPromise","toSJISFunction","CODEWORDS_COUNT","utils","version","data","digit","f","kanji","exports","fromString","string","level","value","defaultValue","BitBuffer","index","bufIndex","num","length","i","bit","bitBuffer","BitMatrix","size","row","col","reserved","bitMatrix","getSymbolSize","require$$0","posCount","intervals","positions","coords","pos","posLength","j","FINDER_PATTERN_SIZE","finderPattern","PenaltyScores","mask","points","sameCountCol","sameCountRow","lastCol","lastRow","module","last","bitsCol","bitsRow","darkCount","modulesCount","getMaskAt","maskPattern","pattern","setupFormatFunc","numPatterns","bestPattern","lowerPenalty","p","penalty","ECLevel","EC_BLOCKS_TABLE","EC_CODEWORDS_TABLE","errorCorrectionCode","errorCorrectionLevel","EXP_TABLE","LOG_TABLE","x","galoisField","y","GF","p1","p2","coeff","divident","divisor","result","offset","degree","poly","Polynomial","ReedSolomonEncoder","paddedData","remainder","start","buff","reedSolomonEncoder","versionCheck","numeric","alphanumeric","byte","regex","TEST_KANJI","TEST_NUMERIC","TEST_ALPHANUMERIC","str","VersionCheck","Regex","require$$1","mode","dataStr","Utils","ECCode","require$$2","Mode","require$$3","require$$4","G18","G18_BCH","getBestVersionForDataLength","currentVersion","getReservedBitsCount","getTotalBitsFromDataArray","segments","totalBits","reservedBits","getBestVersionForMixedData","totalCodewords","ecTotalCodewords","dataTotalCodewordsBits","usableBits","seg","ecl","d","G15","G15_MASK","G15_BCH","formatInfo","NumericData","group","remainingNum","numericData","ALPHA_NUM_CHARS","AlphanumericData","alphanumericData","ByteData","l","byteData","KanjiData","kanjiData","dijkstra","graph","s","predecessors","costs","open","closest","u","v","cost_of_s_to_u","adjacent_nodes","cost_of_e","cost_of_s_to_u_plus_cost_of_e","cost_of_s_to_v","first_visit","msg","nodes","opts","T","t","key","a","b","cost","item","require$$5","require$$6","require$$7","getStringByteLength","getSegments","getSegmentsFromString","numSegs","alphaNumSegs","byteSegs","kanjiSegs","s1","s2","obj","getSegmentBitsLength","mergeSegments","segs","acc","curr","prevSeg","buildNodes","buildGraph","table","prevNodeIds","nodeGroup","currentNodeIds","node","n","prevNodeId","buildSingleSegment","modesHint","bestMode","array","path","optimizedSegs","AlignmentPattern","FinderPattern","MaskPattern","require$$8","Version","require$$9","FormatInfo","require$$10","require$$11","Segments","require$$12","setupFinderPattern","matrix","r","c","setupTimingPattern","setupAlignmentPattern","setupVersionInfo","bits","mod","setupFormatInfo","setupData","inc","bitIndex","byteIndex","dark","createData","buffer","remainingByte","createCodewords","dataTotalCodewords","ecTotalBlocks","blocksInGroup2","blocksInGroup1","totalCodewordsInGroup1","dataCodewordsInGroup1","dataCodewordsInGroup2","ecCount","rs","dcData","ecData","maxDataSize","dataSize","createSymbol","estimatedVersion","rawSegments","bestVersion","dataBits","moduleCount","modules","qrcode","options","hex2rgba","hex","hexCode","hexValue","margin","width","scale","qrSize","imgData","qr","symbolSize","scaledMargin","palette","posDst","pxColor","iSrc","jSrc","clearCanvas","ctx","canvas","getCanvasElement","qrData","canvasEl","image","type","rendererOpts","getColorAttrib","color","attrib","alpha","svgCmd","cmd","qrToPath","moveBy","newRow","lineLength","svgTag","cb","qrcodesize","bg","viewBox","QRCode","CanvasRenderer","SvgRenderer","renderCanvas","renderFunc","text","args","argsNum","isLastArgCb","resolve","reject","e","browser","_","device","useDeviceStore","pinDialog","ref","serverQr","server","reactive","remote","onMounted","mutation","state","getIp","onUpdated","serverIP","error","startLink","deviceUuid","pin","pollLink","resetPinLink","pollInterval","axios","appUrl","unlinkDevice","id","Ni","Ci","E","wi","q","A","m","F","M","I","R","V","ii","li","o","B","h","N","ei","oi","G","D","di","mi","H","yi","X","Y","ui","ai","ti","pi","K","Z","hi","J","ri","si","fi","vi","gi","Ti","Q","Ei","U","_i","ni","L","O","w","k","ci","xi","bi","Mi","Oi","ki","g","C","$","Pi","Bi","S","z","P","W","Ai","fe","ve","ge","linkPinDialog","linkPinInput","checkServerStatus","request","status","requestAccess","deviceName","deviceVendor","deviceModel","deviceType","pingLink","encryptedKey","decryptKey","decryptedKey","decryptAES","disonnectFromServer","AuthCall"],"mappings":"0XAAA;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIA,GAAoBC,GAAmB,UAAW,iBAAkB,oBAAqB,CAAC,CAAC,OAAQ,CAAE,EAAK,kFAAmF,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,WAAY,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,UAAW,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,WAAY,IAAO,OAAS,CAAA,CAAC,CAAC,ECT/V;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIC,GAAmBD,GAAmB,UAAW,gBAAiB,mBAAoB,CAAC,CAAC,OAAQ,CAAE,EAAK,gFAAiF,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,UAAW,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAO,CAAE,CAAC,CAAC,ECT7S;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIE,GAAmBF,GAAmB,UAAW,gBAAiB,mBAAoB,CAAC,CAAC,OAAQ,CAAE,EAAK,kFAAmF,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,sCAAuC,IAAO,OAAS,CAAA,CAAC,CAAC,ECT1R;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIG,GAAoBH,GAAmB,UAAW,iBAAkB,oBAAqB,CAAC,CAAC,OAAQ,CAAE,EAAK,8EAA+E,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,2DAA4D,IAAO,OAAO,CAAE,CAAC,CAAC,ECT/V;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAII,GAAcJ,GAAmB,UAAW,WAAY,cAAe,CAAC,CAAC,OAAQ,CAAE,EAAK,uBAAwB,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,oDAAqD,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,qFAAsF,IAAO,OAAS,CAAA,CAAC,CAAC,ECTxY;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIK,GAAqBL,GAAmB,UAAW,mBAAoB,qBAAsB,CAAC,CAAC,OAAQ,CAAE,EAAK,cAAe,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,uDAAwD,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,wDAAyD,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,iBAAkB,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,qBAAsB,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,cAAe,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,cAAe,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAO,CAAE,CAAC,CAAC,ECT7kB;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIM,GAAaN,GAAmB,UAAW,SAAU,aAAc,CAAC,CAAC,OAAQ,CAAE,EAAK,0EAA2E,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,CAAC,CAAC,6CCLtOO,GAAiB,UAAY,CAC3B,OAAO,OAAO,SAAY,YAAc,QAAQ,WAAa,QAAQ,UAAU,IACjF,4DCNA,IAAIC,EACJ,MAAMC,EAAkB,CACtB,EACA,GAAI,GAAI,GAAI,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC1C,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,KAC7C,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KACtD,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,KAAM,IACxD,EAQAC,OAAAA,GAAA,cAAwB,SAAwBC,EAAS,CACvD,GAAI,CAACA,EAAS,MAAM,IAAI,MAAM,uCAAuC,EACrE,GAAIA,EAAU,GAAKA,EAAU,GAAI,MAAM,IAAI,MAAM,2CAA2C,EAC5F,OAAOA,EAAU,EAAI,EACvB,EAQAD,GAAA,wBAAkC,SAAkCC,EAAS,CAC3E,OAAOF,EAAgBE,CAAO,CAChC,EAQmBD,GAAA,YAAG,SAAUE,EAAM,CACpC,IAAIC,EAAQ,EAEZ,KAAOD,IAAS,GACdC,IACAD,KAAU,EAGZ,OAAOC,CACT,EAEAH,GAAA,kBAA4B,SAA4BI,EAAG,CACzD,GAAI,OAAOA,GAAM,WACf,MAAM,IAAI,MAAM,uCAAuC,EAGzDN,EAAiBM,CACnB,EAEAJ,GAAA,mBAA6B,UAAY,CACvC,OAAO,OAAOF,EAAmB,GACnC,EAEAE,GAAA,OAAiB,SAAiBK,EAAO,CACvC,OAAOP,EAAeO,CAAK,CAC7B,6DC9DAC,EAAY,EAAA,CAAE,IAAK,CAAC,EACpBA,EAAY,EAAA,CAAE,IAAK,CAAC,EACpBA,EAAY,EAAA,CAAE,IAAK,CAAC,EACpBA,EAAY,EAAA,CAAE,IAAK,CAAC,EAEpB,SAASC,EAAYC,EAAQ,CAC3B,GAAI,OAAOA,GAAW,SACpB,MAAM,IAAI,MAAM,uBAAuB,EAKzC,OAFcA,EAAO,YAAW,EAEnB,CACX,IAAK,IACL,IAAK,MACH,OAAOF,EAAQ,EAEjB,IAAK,IACL,IAAK,SACH,OAAOA,EAAQ,EAEjB,IAAK,IACL,IAAK,WACH,OAAOA,EAAQ,EAEjB,IAAK,IACL,IAAK,OACH,OAAOA,EAAQ,EAEjB,QACE,MAAM,IAAI,MAAM,qBAAuBE,CAAM,CACnD,CACA,CAEAF,EAAA,QAAkB,SAAkBG,EAAO,CACzC,OAAOA,GAAS,OAAOA,EAAM,IAAQ,KACnCA,EAAM,KAAO,GAAKA,EAAM,IAAM,CAClC,EAEAH,EAAA,KAAe,SAAeI,EAAOC,EAAc,CACjD,GAAIL,EAAQ,QAAQI,CAAK,EACvB,OAAOA,EAGT,GAAI,CACF,OAAOH,EAAWG,CAAK,CACxB,MAAW,CACV,OAAOC,CACX,CACA,wDCjDA,SAASC,GAAa,CACpB,KAAK,OAAS,CAAA,EACd,KAAK,OAAS,CAChB,CAEA,OAAAA,EAAU,UAAY,CAEpB,IAAK,SAAUC,EAAO,CACpB,MAAMC,EAAW,KAAK,MAAMD,EAAQ,CAAC,EACrC,OAAS,KAAK,OAAOC,CAAQ,IAAO,EAAID,EAAQ,EAAM,KAAO,CAC9D,EAED,IAAK,SAAUE,EAAKC,EAAQ,CAC1B,QAASC,EAAI,EAAGA,EAAID,EAAQC,IAC1B,KAAK,QAASF,IAASC,EAASC,EAAI,EAAM,KAAO,CAAC,CAErD,EAED,gBAAiB,UAAY,CAC3B,OAAO,KAAK,MACb,EAED,OAAQ,SAAUC,EAAK,CACrB,MAAMJ,EAAW,KAAK,MAAM,KAAK,OAAS,CAAC,EACvC,KAAK,OAAO,QAAUA,GACxB,KAAK,OAAO,KAAK,CAAC,EAGhBI,IACF,KAAK,OAAOJ,CAAQ,GAAM,MAAU,KAAK,OAAS,GAGpD,KAAK,QACT,CACA,EAEAK,GAAiBP,kDC/BjB,SAASQ,EAAWC,EAAM,CACxB,GAAI,CAACA,GAAQA,EAAO,EAClB,MAAM,IAAI,MAAM,mDAAmD,EAGrE,KAAK,KAAOA,EACZ,KAAK,KAAO,IAAI,WAAWA,EAAOA,CAAI,EACtC,KAAK,YAAc,IAAI,WAAWA,EAAOA,CAAI,CAC/C,CAWA,OAAAD,EAAU,UAAU,IAAM,SAAUE,EAAKC,EAAKb,EAAOc,EAAU,CAC7D,MAAMX,EAAQS,EAAM,KAAK,KAAOC,EAChC,KAAK,KAAKV,CAAK,EAAIH,EACfc,IAAU,KAAK,YAAYX,CAAK,EAAI,GAC1C,EASAO,EAAU,UAAU,IAAM,SAAUE,EAAKC,EAAK,CAC5C,OAAO,KAAK,KAAKD,EAAM,KAAK,KAAOC,CAAG,CACxC,EAUAH,EAAU,UAAU,IAAM,SAAUE,EAAKC,EAAKb,EAAO,CACnD,KAAK,KAAKY,EAAM,KAAK,KAAOC,CAAG,GAAKb,CACtC,EASAU,EAAU,UAAU,WAAa,SAAUE,EAAKC,EAAK,CACnD,OAAO,KAAK,YAAYD,EAAM,KAAK,KAAOC,CAAG,CAC/C,EAEAE,GAAiBL,6DCtDjB,MAAMM,EAAgBC,KAAmB,cAgBzCrB,EAAA,gBAA0B,SAA0BL,EAAS,CAC3D,GAAIA,IAAY,EAAG,MAAO,CAAA,EAE1B,MAAM2B,EAAW,KAAK,MAAM3B,EAAU,CAAC,EAAI,EACrCoB,EAAOK,EAAczB,CAAO,EAC5B4B,EAAYR,IAAS,IAAM,GAAK,KAAK,MAAMA,EAAO,KAAO,EAAIO,EAAW,EAAE,EAAI,EAC9EE,EAAY,CAACT,EAAO,CAAC,EAE3B,QAASJ,EAAI,EAAGA,EAAIW,EAAW,EAAGX,IAChCa,EAAUb,CAAC,EAAIa,EAAUb,EAAI,CAAC,EAAIY,EAGpC,OAAAC,EAAU,KAAK,CAAC,EAETA,EAAU,QAAO,CAC1B,EAsBAxB,EAAA,aAAuB,SAAuBL,EAAS,CACrD,MAAM8B,EAAS,CAAA,EACTC,EAAM1B,EAAQ,gBAAgBL,CAAO,EACrCgC,EAAYD,EAAI,OAEtB,QAASf,EAAI,EAAGA,EAAIgB,EAAWhB,IAC7B,QAASiB,EAAI,EAAGA,EAAID,EAAWC,IAExBjB,IAAM,GAAKiB,IAAM,GACjBjB,IAAM,GAAKiB,IAAMD,EAAY,GAC7BhB,IAAMgB,EAAY,GAAKC,IAAM,GAIlCH,EAAO,KAAK,CAACC,EAAIf,CAAC,EAAGe,EAAIE,CAAC,CAAC,CAAC,EAIhC,OAAOH,CACT,2DClFA,MAAML,EAAgBC,KAAmB,cACnCQ,EAAsB,EAS5B,OAAAC,GAAA,aAAuB,SAAuBnC,EAAS,CACrD,MAAMoB,EAAOK,EAAczB,CAAO,EAElC,MAAO,CAEL,CAAC,EAAG,CAAC,EAEL,CAACoB,EAAOc,EAAqB,CAAC,EAE9B,CAAC,EAAGd,EAAOc,CAAmB,CAClC,CACA,6DCjBA7B,EAAmB,SAAA,CACjB,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,EACZ,WAAY,CACd,EAMA,MAAM+B,EAAgB,CACpB,GAAI,EACJ,GAAI,EACJ,GAAI,GACJ,GAAI,EACN,EAQA/B,EAAA,QAAkB,SAAkBgC,EAAM,CACxC,OAAOA,GAAQ,MAAQA,IAAS,IAAM,CAAC,MAAMA,CAAI,GAAKA,GAAQ,GAAKA,GAAQ,CAC7E,EASAhC,EAAA,KAAe,SAAeI,EAAO,CACnC,OAAOJ,EAAQ,QAAQI,CAAK,EAAI,SAASA,EAAO,EAAE,EAAI,MACxD,EASAJ,EAAA,aAAuB,SAAuBJ,EAAM,CAClD,MAAMmB,EAAOnB,EAAK,KAClB,IAAIqC,EAAS,EACTC,EAAe,EACfC,EAAe,EACfC,EAAU,KACVC,EAAU,KAEd,QAASrB,EAAM,EAAGA,EAAMD,EAAMC,IAAO,CACnCkB,EAAeC,EAAe,EAC9BC,EAAUC,EAAU,KAEpB,QAASpB,EAAM,EAAGA,EAAMF,EAAME,IAAO,CACnC,IAAIqB,EAAS1C,EAAK,IAAIoB,EAAKC,CAAG,EAC1BqB,IAAWF,EACbF,KAEIA,GAAgB,IAAGD,GAAUF,EAAc,IAAMG,EAAe,IACpEE,EAAUE,EACVJ,EAAe,GAGjBI,EAAS1C,EAAK,IAAIqB,EAAKD,CAAG,EACtBsB,IAAWD,EACbF,KAEIA,GAAgB,IAAGF,GAAUF,EAAc,IAAMI,EAAe,IACpEE,EAAUC,EACVH,EAAe,EAEvB,CAEQD,GAAgB,IAAGD,GAAUF,EAAc,IAAMG,EAAe,IAChEC,GAAgB,IAAGF,GAAUF,EAAc,IAAMI,EAAe,GACxE,CAEE,OAAOF,CACT,EAOAjC,EAAA,aAAuB,SAAuBJ,EAAM,CAClD,MAAMmB,EAAOnB,EAAK,KAClB,IAAIqC,EAAS,EAEb,QAASjB,EAAM,EAAGA,EAAMD,EAAO,EAAGC,IAChC,QAASC,EAAM,EAAGA,EAAMF,EAAO,EAAGE,IAAO,CACvC,MAAMsB,EAAO3C,EAAK,IAAIoB,EAAKC,CAAG,EAC5BrB,EAAK,IAAIoB,EAAKC,EAAM,CAAC,EACrBrB,EAAK,IAAIoB,EAAM,EAAGC,CAAG,EACrBrB,EAAK,IAAIoB,EAAM,EAAGC,EAAM,CAAC,GAEvBsB,IAAS,GAAKA,IAAS,IAAGN,GACpC,CAGE,OAAOA,EAASF,EAAc,EAChC,EAQA/B,EAAA,aAAuB,SAAuBJ,EAAM,CAClD,MAAMmB,EAAOnB,EAAK,KAClB,IAAIqC,EAAS,EACTO,EAAU,EACVC,EAAU,EAEd,QAASzB,EAAM,EAAGA,EAAMD,EAAMC,IAAO,CACnCwB,EAAUC,EAAU,EACpB,QAASxB,EAAM,EAAGA,EAAMF,EAAME,IAC5BuB,EAAYA,GAAW,EAAK,KAAS5C,EAAK,IAAIoB,EAAKC,CAAG,EAClDA,GAAO,KAAOuB,IAAY,MAASA,IAAY,KAAQP,IAE3DQ,EAAYA,GAAW,EAAK,KAAS7C,EAAK,IAAIqB,EAAKD,CAAG,EAClDC,GAAO,KAAOwB,IAAY,MAASA,IAAY,KAAQR,GAEjE,CAEE,OAAOA,EAASF,EAAc,EAChC,EAUA/B,EAAA,aAAuB,SAAuBJ,EAAM,CAClD,IAAI8C,EAAY,EAChB,MAAMC,EAAe/C,EAAK,KAAK,OAE/B,QAASe,EAAI,EAAGA,EAAIgC,EAAchC,IAAK+B,GAAa9C,EAAK,KAAKe,CAAC,EAI/D,OAFU,KAAK,IAAI,KAAK,KAAM+B,EAAY,IAAMC,EAAgB,CAAC,EAAI,EAAE,EAE5DZ,EAAc,EAC3B,EAUA,SAASa,EAAWC,EAAalC,EAAGiB,EAAG,CACrC,OAAQiB,EAAW,CACjB,KAAK7C,EAAQ,SAAS,WAAY,OAAQW,EAAIiB,GAAK,IAAM,EACzD,KAAK5B,EAAQ,SAAS,WAAY,OAAOW,EAAI,IAAM,EACnD,KAAKX,EAAQ,SAAS,WAAY,OAAO4B,EAAI,IAAM,EACnD,KAAK5B,EAAQ,SAAS,WAAY,OAAQW,EAAIiB,GAAK,IAAM,EACzD,KAAK5B,EAAQ,SAAS,WAAY,OAAQ,KAAK,MAAMW,EAAI,CAAC,EAAI,KAAK,MAAMiB,EAAI,CAAC,GAAK,IAAM,EACzF,KAAK5B,EAAQ,SAAS,WAAY,OAAQW,EAAIiB,EAAK,EAAKjB,EAAIiB,EAAK,IAAM,EACvE,KAAK5B,EAAQ,SAAS,WAAY,OAASW,EAAIiB,EAAK,EAAKjB,EAAIiB,EAAK,GAAK,IAAM,EAC7E,KAAK5B,EAAQ,SAAS,WAAY,OAASW,EAAIiB,EAAK,GAAKjB,EAAIiB,GAAK,GAAK,IAAM,EAE7E,QAAS,MAAM,IAAI,MAAM,mBAAqBiB,CAAW,CAC7D,CACA,CAQA7C,EAAA,UAAoB,SAAoB8C,EAASlD,EAAM,CACrD,MAAMmB,EAAOnB,EAAK,KAElB,QAASqB,EAAM,EAAGA,EAAMF,EAAME,IAC5B,QAASD,EAAM,EAAGA,EAAMD,EAAMC,IACxBpB,EAAK,WAAWoB,EAAKC,CAAG,GAC5BrB,EAAK,IAAIoB,EAAKC,EAAK2B,EAAUE,EAAS9B,EAAKC,CAAG,CAAC,CAGrD,EAQAjB,EAAA,YAAsB,SAAsBJ,EAAMmD,EAAiB,CACjE,MAAMC,EAAc,OAAO,KAAKhD,EAAQ,QAAQ,EAAE,OAClD,IAAIiD,EAAc,EACdC,EAAe,IAEnB,QAASC,EAAI,EAAGA,EAAIH,EAAaG,IAAK,CACpCJ,EAAgBI,CAAC,EACjBnD,EAAQ,UAAUmD,EAAGvD,CAAI,EAGzB,MAAMwD,EACJpD,EAAQ,aAAaJ,CAAI,EACzBI,EAAQ,aAAaJ,CAAI,EACzBI,EAAQ,aAAaJ,CAAI,EACzBI,EAAQ,aAAaJ,CAAI,EAG3BI,EAAQ,UAAUmD,EAAGvD,CAAI,EAErBwD,EAAUF,IACZA,EAAeE,EACfH,EAAcE,EAEpB,CAEE,OAAOF,CACT,2DCzOA,MAAMI,EAAUhC,GAAmC,EAE7CiC,EAAkB,CAEtB,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,EACT,EAAG,EAAG,EAAG,GACT,EAAG,EAAG,GAAI,GACV,EAAG,EAAG,GAAI,GACV,EAAG,EAAG,GAAI,GACV,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,EAAG,GAAI,GAAI,GACX,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,EACb,EAEKC,EAAqB,CAEzB,EAAG,GAAI,GAAI,GACX,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,GACZ,GAAI,GAAI,GAAI,IACZ,GAAI,GAAI,IAAK,IACb,GAAI,GAAI,IAAK,IACb,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,GAAI,IAAK,IAAK,IACd,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,IACf,IAAK,IAAK,IAAK,KACf,IAAK,IAAK,IAAK,KACf,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,IAAK,KAAM,KAChB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,KACjB,IAAK,KAAM,KAAM,IAClB,EAUD,OAAAC,GAAA,eAAyB,SAAyB7D,EAAS8D,EAAsB,CAC/E,OAAQA,EAAoB,CAC1B,KAAKJ,EAAQ,EACX,OAAOC,GAAiB3D,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAK0D,EAAQ,EACX,OAAOC,GAAiB3D,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAK0D,EAAQ,EACX,OAAOC,GAAiB3D,EAAU,GAAK,EAAI,CAAC,EAC9C,KAAK0D,EAAQ,EACX,OAAOC,GAAiB3D,EAAU,GAAK,EAAI,CAAC,EAC9C,QACE,MACH,CACF,EAUD6D,GAAA,uBAAiC,SAAiC7D,EAAS8D,EAAsB,CAC/F,OAAQA,EAAoB,CAC1B,KAAKJ,EAAQ,EACX,OAAOE,GAAoB5D,EAAU,GAAK,EAAI,CAAC,EACjD,KAAK0D,EAAQ,EACX,OAAOE,GAAoB5D,EAAU,GAAK,EAAI,CAAC,EACjD,KAAK0D,EAAQ,EACX,OAAOE,GAAoB5D,EAAU,GAAK,EAAI,CAAC,EACjD,KAAK0D,EAAQ,EACX,OAAOE,GAAoB5D,EAAU,GAAK,EAAI,CAAC,EACjD,QACE,MACH,CACH,2DCtIA,MAAM+D,EAAY,IAAI,WAAW,GAAG,EAC9BC,EAAY,IAAI,WAAW,GAAG,EASnC,OAAC,UAAuB,CACvB,IAAIC,EAAI,EACR,QAASjD,EAAI,EAAGA,EAAI,IAAKA,IACvB+C,EAAU/C,CAAC,EAAIiD,EACfD,EAAUC,CAAC,EAAIjD,EAEfiD,IAAM,EAIFA,EAAI,MACNA,GAAK,KAQT,QAASjD,EAAI,IAAKA,EAAI,IAAKA,IACzB+C,EAAU/C,CAAC,EAAI+C,EAAU/C,EAAI,GAAG,CAEpC,EAAG,EAQHkD,GAAA,IAAc,SAAc,EAAG,CAC7B,GAAI,EAAI,EAAG,MAAM,IAAI,MAAM,OAAS,EAAI,GAAG,EAC3C,OAAOF,EAAU,CAAC,CACpB,EAQAE,GAAA,IAAc,SAAc,EAAG,CAC7B,OAAOH,EAAU,CAAC,CACpB,EASAG,GAAA,IAAc,SAAcD,EAAGE,EAAG,CAChC,OAAIF,IAAM,GAAKE,IAAM,EAAU,EAIxBJ,EAAUC,EAAUC,CAAC,EAAID,EAAUG,CAAC,CAAC,CAC9C,uDCpEA,MAAMC,EAAK1C,GAAA,EASXrB,EAAA,IAAc,SAAcgE,EAAIC,EAAI,CAClC,MAAMC,EAAQ,IAAI,WAAWF,EAAG,OAASC,EAAG,OAAS,CAAC,EAEtD,QAAStD,EAAI,EAAGA,EAAIqD,EAAG,OAAQrD,IAC7B,QAASiB,EAAI,EAAGA,EAAIqC,EAAG,OAAQrC,IAC7BsC,EAAMvD,EAAIiB,CAAC,GAAKmC,EAAG,IAAIC,EAAGrD,CAAC,EAAGsD,EAAGrC,CAAC,CAAC,EAIvC,OAAOsC,CACT,EASAlE,EAAA,IAAc,SAAcmE,EAAUC,EAAS,CAC7C,IAAIC,EAAS,IAAI,WAAWF,CAAQ,EAEpC,KAAQE,EAAO,OAASD,EAAQ,QAAW,GAAG,CAC5C,MAAMF,EAAQG,EAAO,CAAC,EAEtB,QAAS1D,EAAI,EAAGA,EAAIyD,EAAQ,OAAQzD,IAClC0D,EAAO1D,CAAC,GAAKoD,EAAG,IAAIK,EAAQzD,CAAC,EAAGuD,CAAK,EAIvC,IAAII,EAAS,EACb,KAAOA,EAASD,EAAO,QAAUA,EAAOC,CAAM,IAAM,GAAGA,IACvDD,EAASA,EAAO,MAAMC,CAAM,CAChC,CAEE,OAAOD,CACT,EASArE,EAAA,qBAA+B,SAA+BuE,EAAQ,CACpE,IAAIC,EAAO,IAAI,WAAW,CAAC,CAAC,CAAC,EAC7B,QAAS7D,EAAI,EAAGA,EAAI4D,EAAQ5D,IAC1B6D,EAAOxE,EAAQ,IAAIwE,EAAM,IAAI,WAAW,CAAC,EAAGT,EAAG,IAAIpD,CAAC,CAAC,CAAC,CAAC,EAGzD,OAAO6D,CACT,wDC7DA,MAAMC,EAAapD,GAAA,EAEnB,SAASqD,EAAoBH,EAAQ,CACnC,KAAK,QAAU,OACf,KAAK,OAASA,EAEV,KAAK,QAAQ,KAAK,WAAW,KAAK,MAAM,CAC9C,CAQA,OAAAG,EAAmB,UAAU,WAAa,SAAqBH,EAAQ,CAErE,KAAK,OAASA,EACd,KAAK,QAAUE,EAAW,qBAAqB,KAAK,MAAM,CAC5D,EAQAC,EAAmB,UAAU,OAAS,SAAiB9E,EAAM,CAC3D,GAAI,CAAC,KAAK,QACR,MAAM,IAAI,MAAM,yBAAyB,EAK3C,MAAM+E,EAAa,IAAI,WAAW/E,EAAK,OAAS,KAAK,MAAM,EAC3D+E,EAAW,IAAI/E,CAAI,EAInB,MAAMgF,EAAYH,EAAW,IAAIE,EAAY,KAAK,OAAO,EAKnDE,EAAQ,KAAK,OAASD,EAAU,OACtC,GAAIC,EAAQ,EAAG,CACb,MAAMC,EAAO,IAAI,WAAW,KAAK,MAAM,EACvC,OAAAA,EAAK,IAAIF,EAAWC,CAAK,EAElBC,CACX,CAEE,OAAOF,CACT,EAEAG,GAAiBL,6DCjDjBM,GAAA,QAAkB,SAAkBrF,EAAS,CAC3C,MAAO,CAAC,MAAMA,CAAO,GAAKA,GAAW,GAAKA,GAAW,EACvD,sDCRA,MAAMsF,EAAU,SACVC,EAAe,oBACrB,IAAInF,EAAQ,mNAIZA,EAAQA,EAAM,QAAQ,KAAM,KAAK,EAEjC,MAAMoF,EAAO,6BAA+BpF,EAAQ;AAAA,MAEpDqF,GAAA,MAAgB,IAAI,OAAOrF,EAAO,GAAG,EACrCqF,GAAA,WAAqB,IAAI,OAAO,wBAAyB,GAAG,EAC5DA,GAAA,KAAe,IAAI,OAAOD,EAAM,GAAG,EACnCC,GAAA,QAAkB,IAAI,OAAOH,EAAS,GAAG,EACzCG,GAAA,aAAuB,IAAI,OAAOF,EAAc,GAAG,EAEnD,MAAMG,EAAa,IAAI,OAAO,IAAMtF,EAAQ,GAAG,EACzCuF,EAAe,IAAI,OAAO,IAAML,EAAU,GAAG,EAC7CM,EAAoB,IAAI,OAAO,wBAAwB,EAE7D,OAAAH,GAAA,UAAoB,SAAoBI,EAAK,CAC3C,OAAOH,EAAW,KAAKG,CAAG,CAC5B,EAEAJ,GAAA,YAAsB,SAAsBI,EAAK,CAC/C,OAAOF,EAAa,KAAKE,CAAG,CAC9B,EAEAJ,GAAA,iBAA2B,SAA2BI,EAAK,CACzD,OAAOD,EAAkB,KAAKC,CAAG,CACnC,uDC9BA,MAAMC,EAAepE,GAAA,EACfqE,EAAQC,GAAA,EASd3F,EAAkB,QAAA,CAChB,GAAI,UACJ,IAAK,EACL,OAAQ,CAAC,GAAI,GAAI,EAAE,CACrB,EAWAA,EAAuB,aAAA,CACrB,GAAI,eACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAOAA,EAAe,KAAA,CACb,GAAI,OACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAWAA,EAAgB,MAAA,CACd,GAAI,QACJ,IAAK,EACL,OAAQ,CAAC,EAAG,GAAI,EAAE,CACpB,EAQAA,EAAgB,MAAA,CACd,IAAK,EACP,EAUAA,EAAA,sBAAgC,SAAgC4F,EAAMjG,EAAS,CAC7E,GAAI,CAACiG,EAAK,OAAQ,MAAM,IAAI,MAAM,iBAAmBA,CAAI,EAEzD,GAAI,CAACH,EAAa,QAAQ9F,CAAO,EAC/B,MAAM,IAAI,MAAM,oBAAsBA,CAAO,EAG/C,OAAIA,GAAW,GAAKA,EAAU,GAAWiG,EAAK,OAAO,CAAC,EAC7CjG,EAAU,GAAWiG,EAAK,OAAO,CAAC,EACpCA,EAAK,OAAO,CAAC,CACtB,EAQA5F,EAAA,mBAA6B,SAA6B6F,EAAS,CACjE,OAAIH,EAAM,YAAYG,CAAO,EAAU7F,EAAQ,QACtC0F,EAAM,iBAAiBG,CAAO,EAAU7F,EAAQ,aAChD0F,EAAM,UAAUG,CAAO,EAAU7F,EAAQ,MACtCA,EAAQ,IACtB,EAQAA,EAAA,SAAmB,SAAmB4F,EAAM,CAC1C,GAAIA,GAAQA,EAAK,GAAI,OAAOA,EAAK,GACjC,MAAM,IAAI,MAAM,cAAc,CAChC,EAQA5F,EAAA,QAAkB,SAAkB4F,EAAM,CACxC,OAAOA,GAAQA,EAAK,KAAOA,EAAK,MAClC,EAQA,SAAS3F,EAAYC,EAAQ,CAC3B,GAAI,OAAOA,GAAW,SACpB,MAAM,IAAI,MAAM,uBAAuB,EAKzC,OAFcA,EAAO,YAAW,EAEnB,CACX,IAAK,UACH,OAAOF,EAAQ,QACjB,IAAK,eACH,OAAOA,EAAQ,aACjB,IAAK,QACH,OAAOA,EAAQ,MACjB,IAAK,OACH,OAAOA,EAAQ,KACjB,QACE,MAAM,IAAI,MAAM,iBAAmBE,CAAM,CAC/C,CACA,CAUAF,EAAA,KAAe,SAAeI,EAAOC,EAAc,CACjD,GAAIL,EAAQ,QAAQI,CAAK,EACvB,OAAOA,EAGT,GAAI,CACF,OAAOH,EAAWG,CAAK,CACxB,MAAW,CACV,OAAOC,CACX,CACA,6DCtKA,MAAMyF,EAAQzE,GAAA,EACR0E,EAASJ,GAAA,EACTtC,EAAU2C,GAAA,EACVC,EAAOC,GAAA,EACPT,EAAeU,GAAA,EAGfC,EAAO,KACPC,EAAUP,EAAM,YAAYM,CAAG,EAErC,SAASE,EAA6BV,EAAMlF,EAAQ+C,EAAsB,CACxE,QAAS8C,EAAiB,EAAGA,GAAkB,GAAIA,IACjD,GAAI7F,GAAUV,EAAQ,YAAYuG,EAAgB9C,EAAsBmC,CAAI,EAC1E,OAAOW,CAKb,CAEA,SAASC,EAAsBZ,EAAMjG,EAAS,CAE5C,OAAOsG,EAAK,sBAAsBL,EAAMjG,CAAO,EAAI,CACrD,CAEA,SAAS8G,EAA2BC,EAAU/G,EAAS,CACrD,IAAIgH,EAAY,EAEhB,OAAAD,EAAS,QAAQ,SAAU9G,EAAM,CAC/B,MAAMgH,EAAeJ,EAAqB5G,EAAK,KAAMD,CAAO,EAC5DgH,GAAaC,EAAehH,EAAK,cAAa,CAC/C,CAAA,EAEM+G,CACT,CAEA,SAASE,EAA4BH,EAAUjD,EAAsB,CACnE,QAAS8C,EAAiB,EAAGA,GAAkB,GAAIA,IAEjD,GADeE,EAA0BC,EAAUH,CAAc,GACnDvG,EAAQ,YAAYuG,EAAgB9C,EAAsBwC,EAAK,KAAK,EAChF,OAAOM,CAKb,CAUAvG,EAAA,KAAe,SAAeI,EAAOC,EAAc,CACjD,OAAIoF,EAAa,QAAQrF,CAAK,EACrB,SAASA,EAAO,EAAE,EAGpBC,CACT,EAWAL,EAAsB,YAAA,SAAsBL,EAAS8D,EAAsBmC,EAAM,CAC/E,GAAI,CAACH,EAAa,QAAQ9F,CAAO,EAC/B,MAAM,IAAI,MAAM,yBAAyB,EAIvC,OAAOiG,EAAS,MAAaA,EAAOK,EAAK,MAG7C,MAAMa,EAAiBhB,EAAM,wBAAwBnG,CAAO,EAGtDoH,EAAmBhB,EAAO,uBAAuBpG,EAAS8D,CAAoB,EAG9EuD,GAA0BF,EAAiBC,GAAoB,EAErE,GAAInB,IAASK,EAAK,MAAO,OAAOe,EAEhC,MAAMC,EAAaD,EAAyBR,EAAqBZ,EAAMjG,CAAO,EAG9E,OAAQiG,EAAI,CACV,KAAKK,EAAK,QACR,OAAO,KAAK,MAAOgB,EAAa,GAAM,CAAC,EAEzC,KAAKhB,EAAK,aACR,OAAO,KAAK,MAAOgB,EAAa,GAAM,CAAC,EAEzC,KAAKhB,EAAK,MACR,OAAO,KAAK,MAAMgB,EAAa,EAAE,EAEnC,KAAKhB,EAAK,KACV,QACE,OAAO,KAAK,MAAMgB,EAAa,CAAC,CACtC,CACA,EAUAjH,EAAA,sBAAgC,SAAgCJ,EAAM6D,EAAsB,CAC1F,IAAIyD,EAEJ,MAAMC,EAAM9D,EAAQ,KAAKI,EAAsBJ,EAAQ,CAAC,EAExD,GAAI,MAAM,QAAQzD,CAAI,EAAG,CACvB,GAAIA,EAAK,OAAS,EAChB,OAAOiH,EAA2BjH,EAAMuH,CAAG,EAG7C,GAAIvH,EAAK,SAAW,EAClB,MAAO,GAGTsH,EAAMtH,EAAK,CAAC,CAChB,MACIsH,EAAMtH,EAGR,OAAO0G,EAA4BY,EAAI,KAAMA,EAAI,UAAW,EAAEC,CAAG,CACnE,EAYAnH,EAAA,eAAyB,SAAyBL,EAAS,CACzD,GAAI,CAAC8F,EAAa,QAAQ9F,CAAO,GAAKA,EAAU,EAC9C,MAAM,IAAI,MAAM,yBAAyB,EAG3C,IAAIyH,EAAIzH,GAAW,GAEnB,KAAOmG,EAAM,YAAYsB,CAAC,EAAIf,GAAW,GACvCe,GAAMhB,GAAQN,EAAM,YAAYsB,CAAC,EAAIf,EAGvC,OAAQ1G,GAAW,GAAMyH,CAC3B,2DClKA,MAAMtB,EAAQzE,GAAA,EAERgG,EAAO,KACPC,EAAY,MACZC,EAAUzB,EAAM,YAAYuB,CAAG,EAYrC,OAAAG,GAAA,eAAyB,SAAyB/D,EAAsBzB,EAAM,CAC5E,MAAMpC,EAAS6D,EAAqB,KAAO,EAAKzB,EAChD,IAAI,EAAIpC,GAAQ,GAEhB,KAAOkG,EAAM,YAAY,CAAC,EAAIyB,GAAW,GACvC,GAAMF,GAAQvB,EAAM,YAAY,CAAC,EAAIyB,EAMvC,OAAS3H,GAAQ,GAAM,GAAK0H,CAC9B,wDC5BA,MAAMrB,EAAO5E,GAAA,EAEb,SAASoG,EAAa7H,EAAM,CAC1B,KAAK,KAAOqG,EAAK,QACjB,KAAK,KAAOrG,EAAK,SAAQ,CAC3B,CAEA,OAAA6H,EAAY,cAAgB,SAAwB/G,EAAQ,CAC1D,MAAO,IAAK,KAAK,MAAMA,EAAS,CAAC,GAAMA,EAAS,EAAOA,EAAS,EAAK,EAAI,EAAK,EAChF,EAEA+G,EAAY,UAAU,UAAY,UAAsB,CACtD,OAAO,KAAK,KAAK,MACnB,EAEAA,EAAY,UAAU,cAAgB,UAA0B,CAC9D,OAAOA,EAAY,cAAc,KAAK,KAAK,MAAM,CACnD,EAEAA,EAAY,UAAU,MAAQ,SAAgB5G,EAAW,CACvD,IAAIF,EAAG+G,EAAOtH,EAId,IAAKO,EAAI,EAAGA,EAAI,GAAK,KAAK,KAAK,OAAQA,GAAK,EAC1C+G,EAAQ,KAAK,KAAK,OAAO/G,EAAG,CAAC,EAC7BP,EAAQ,SAASsH,EAAO,EAAE,EAE1B7G,EAAU,IAAIT,EAAO,EAAE,EAKzB,MAAMuH,EAAe,KAAK,KAAK,OAAShH,EACpCgH,EAAe,IACjBD,EAAQ,KAAK,KAAK,OAAO/G,CAAC,EAC1BP,EAAQ,SAASsH,EAAO,EAAE,EAE1B7G,EAAU,IAAIT,EAAOuH,EAAe,EAAI,CAAC,EAE7C,EAEAC,GAAiBH,kDC1CjB,MAAMxB,EAAO5E,GAAA,EAWPwG,EAAkB,CACtB,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC7C,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC5D,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAC5D,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,IAAK,GAC1C,EAEA,SAASC,EAAkBlI,EAAM,CAC/B,KAAK,KAAOqG,EAAK,aACjB,KAAK,KAAOrG,CACd,CAEA,OAAAkI,EAAiB,cAAgB,SAAwBpH,EAAQ,CAC/D,MAAO,IAAK,KAAK,MAAMA,EAAS,CAAC,EAAI,GAAKA,EAAS,EACrD,EAEAoH,EAAiB,UAAU,UAAY,UAAsB,CAC3D,OAAO,KAAK,KAAK,MACnB,EAEAA,EAAiB,UAAU,cAAgB,UAA0B,CACnE,OAAOA,EAAiB,cAAc,KAAK,KAAK,MAAM,CACxD,EAEAA,EAAiB,UAAU,MAAQ,SAAgBjH,EAAW,CAC5D,IAAIF,EAIJ,IAAKA,EAAI,EAAGA,EAAI,GAAK,KAAK,KAAK,OAAQA,GAAK,EAAG,CAE7C,IAAIP,EAAQyH,EAAgB,QAAQ,KAAK,KAAKlH,CAAC,CAAC,EAAI,GAGpDP,GAASyH,EAAgB,QAAQ,KAAK,KAAKlH,EAAI,CAAC,CAAC,EAGjDE,EAAU,IAAIT,EAAO,EAAE,CAC3B,CAIM,KAAK,KAAK,OAAS,GACrBS,EAAU,IAAIgH,EAAgB,QAAQ,KAAK,KAAKlH,CAAC,CAAC,EAAG,CAAC,CAE1D,EAEAoH,GAAiBD,kDC1DjB,MAAM7B,EAAO5E,GAAA,EAEb,SAAS2G,EAAUpI,EAAM,CACvB,KAAK,KAAOqG,EAAK,KACb,OAAQrG,GAAU,SACpB,KAAK,KAAO,IAAI,YAAa,EAAC,OAAOA,CAAI,EAEzC,KAAK,KAAO,IAAI,WAAWA,CAAI,CAEnC,CAEA,OAAAoI,EAAS,cAAgB,SAAwBtH,EAAQ,CACvD,OAAOA,EAAS,CAClB,EAEAsH,EAAS,UAAU,UAAY,UAAsB,CACnD,OAAO,KAAK,KAAK,MACnB,EAEAA,EAAS,UAAU,cAAgB,UAA0B,CAC3D,OAAOA,EAAS,cAAc,KAAK,KAAK,MAAM,CAChD,EAEAA,EAAS,UAAU,MAAQ,SAAUnH,EAAW,CAC9C,QAASF,EAAI,EAAGsH,EAAI,KAAK,KAAK,OAAQtH,EAAIsH,EAAGtH,IAC3CE,EAAU,IAAI,KAAK,KAAKF,CAAC,EAAG,CAAC,CAEjC,EAEAuH,GAAiBF,kDC7BjB,MAAM/B,EAAO5E,GAAA,EACPyE,EAAQH,GAAA,EAEd,SAASwC,EAAWvI,EAAM,CACxB,KAAK,KAAOqG,EAAK,MACjB,KAAK,KAAOrG,CACd,CAEA,OAAAuI,EAAU,cAAgB,SAAwBzH,EAAQ,CACxD,OAAOA,EAAS,EAClB,EAEAyH,EAAU,UAAU,UAAY,UAAsB,CACpD,OAAO,KAAK,KAAK,MACnB,EAEAA,EAAU,UAAU,cAAgB,UAA0B,CAC5D,OAAOA,EAAU,cAAc,KAAK,KAAK,MAAM,CACjD,EAEAA,EAAU,UAAU,MAAQ,SAAUtH,EAAW,CAC/C,IAAIF,EAKJ,IAAKA,EAAI,EAAGA,EAAI,KAAK,KAAK,OAAQA,IAAK,CACrC,IAAIP,EAAQ0F,EAAM,OAAO,KAAK,KAAKnF,CAAC,CAAC,EAGrC,GAAIP,GAAS,OAAUA,GAAS,MAE9BA,GAAS,cAGAA,GAAS,OAAUA,GAAS,MAErCA,GAAS,UAET,OAAM,IAAI,MACR,2BAA6B,KAAK,KAAKO,CAAC,EAAI;AAAA,gCACX,EAKrCP,GAAWA,IAAU,EAAK,KAAQ,KAASA,EAAQ,KAGnDS,EAAU,IAAIT,EAAO,EAAE,CAC3B,CACA,EAEAgI,GAAiBD,uEC9BjB,IAAIE,EAAW,CACb,6BAA8B,SAASC,EAAOC,EAAGnB,EAAG,CAGlD,IAAIoB,EAAe,CAAE,EAIjBC,EAAQ,CAAE,EACdA,EAAMF,CAAC,EAAI,EAMX,IAAIG,EAAOL,EAAS,cAAc,KAAM,EACxCK,EAAK,KAAKH,EAAG,CAAC,EAUd,QARII,EACAC,EAAGC,EACHC,EACAC,EACAC,EACAC,EACAC,EACAC,EACG,CAACT,EAAK,SAAS,CAGpBC,EAAUD,EAAK,IAAK,EACpBE,EAAID,EAAQ,MACZG,EAAiBH,EAAQ,KAGzBI,EAAiBT,EAAMM,CAAC,GAAK,CAAE,EAK/B,IAAKC,KAAKE,EACJA,EAAe,eAAeF,CAAC,IAEjCG,EAAYD,EAAeF,CAAC,EAK5BI,EAAgCH,EAAiBE,EAMjDE,EAAiBT,EAAMI,CAAC,EACxBM,EAAe,OAAOV,EAAMI,CAAC,EAAM,KAC/BM,GAAeD,EAAiBD,KAClCR,EAAMI,CAAC,EAAII,EACXP,EAAK,KAAKG,EAAGI,CAA6B,EAC1CT,EAAaK,CAAC,EAAID,GAI9B,CAEI,GAAI,OAAOxB,EAAM,KAAe,OAAOqB,EAAMrB,CAAC,EAAM,IAAa,CAC/D,IAAIgC,EAAM,CAAC,8BAA+Bb,EAAG,OAAQnB,EAAG,GAAG,EAAE,KAAK,EAAE,EACpE,MAAM,IAAI,MAAMgC,CAAG,CACzB,CAEI,OAAOZ,CACR,EAED,4CAA6C,SAASA,EAAcpB,EAAG,CAIrE,QAHIiC,EAAQ,CAAE,EACVT,EAAIxB,EAEDwB,GACLS,EAAM,KAAKT,CAAC,EACEJ,EAAaI,CAAC,EAC5BA,EAAIJ,EAAaI,CAAC,EAEpB,OAAAS,EAAM,QAAS,EACRA,CACR,EAED,UAAW,SAASf,EAAOC,EAAGnB,EAAG,CAC/B,IAAIoB,EAAeH,EAAS,6BAA6BC,EAAOC,EAAGnB,CAAC,EACpE,OAAOiB,EAAS,4CACdG,EAAcpB,CAAC,CAClB,EAKD,cAAe,CACb,KAAM,SAAUkC,EAAM,CACpB,IAAIC,EAAIlB,EAAS,cACbmB,EAAI,CAAE,EACNC,EACJH,EAAOA,GAAQ,CAAE,EACjB,IAAKG,KAAOF,EACNA,EAAE,eAAeE,CAAG,IACtBD,EAAEC,CAAG,EAAIF,EAAEE,CAAG,GAGlB,OAAAD,EAAE,MAAQ,CAAE,EACZA,EAAE,OAASF,EAAK,QAAUC,EAAE,eACrBC,CACR,EAED,eAAgB,SAAUE,EAAGC,EAAG,CAC9B,OAAOD,EAAE,KAAOC,EAAE,IACnB,EAMD,KAAM,SAAUvJ,EAAOwJ,EAAM,CAC3B,IAAIC,EAAO,CAAC,MAAOzJ,EAAO,KAAMwJ,CAAI,EACpC,KAAK,MAAM,KAAKC,CAAI,EACpB,KAAK,MAAM,KAAK,KAAK,MAAM,CAC5B,EAKD,IAAK,UAAY,CACf,OAAO,KAAK,MAAM,MAAO,CAC1B,EAED,MAAO,UAAY,CACjB,OAAO,KAAK,MAAM,SAAW,CACnC,CACA,CACC,EAKCvH,UAAiB+F,qECnKnB,MAAMpC,EAAO5E,GAAA,EACPoG,EAAc9B,GAAA,EACdmC,EAAmB9B,GAAA,EACnBgC,EAAW9B,GAAA,EACXiC,EAAYhC,GAAA,EACZT,EAAQoE,GAAA,EACRhE,EAAQiE,GAAA,EACR1B,EAAW2B,GAAA,EAQjB,SAASC,EAAqBzE,EAAK,CACjC,OAAO,SAAS,mBAAmBA,CAAG,CAAC,EAAE,MAC3C,CAUA,SAAS0E,EAAa9E,EAAOQ,EAAMJ,EAAK,CACtC,MAAMkB,EAAW,CAAA,EACjB,IAAIrC,EAEJ,MAAQA,EAASe,EAAM,KAAKI,CAAG,KAAO,MACpCkB,EAAS,KAAK,CACZ,KAAMrC,EAAO,CAAC,EACd,MAAOA,EAAO,MACd,KAAMuB,EACN,OAAQvB,EAAO,CAAC,EAAE,MACnB,CAAA,EAGH,OAAOqC,CACT,CASA,SAASyD,EAAuBtE,EAAS,CACvC,MAAMuE,EAAUF,EAAYxE,EAAM,QAASO,EAAK,QAASJ,CAAO,EAC1DwE,EAAeH,EAAYxE,EAAM,aAAcO,EAAK,aAAcJ,CAAO,EAC/E,IAAIyE,EACAC,EAEJ,OAAIzE,EAAM,sBACRwE,EAAWJ,EAAYxE,EAAM,KAAMO,EAAK,KAAMJ,CAAO,EACrD0E,EAAYL,EAAYxE,EAAM,MAAOO,EAAK,MAAOJ,CAAO,IAExDyE,EAAWJ,EAAYxE,EAAM,WAAYO,EAAK,KAAMJ,CAAO,EAC3D0E,EAAY,CAAA,GAGDH,EAAQ,OAAOC,EAAcC,EAAUC,CAAS,EAG1D,KAAK,SAAUC,EAAIC,EAAI,CACtB,OAAOD,EAAG,MAAQC,EAAG,KACtB,CAAA,EACA,IAAI,SAAUC,EAAK,CAClB,MAAO,CACL,KAAMA,EAAI,KACV,KAAMA,EAAI,KACV,OAAQA,EAAI,MACpB,CACK,CAAA,CACL,CAUA,SAASC,EAAsBjK,EAAQkF,EAAM,CAC3C,OAAQA,EAAI,CACV,KAAKK,EAAK,QACR,OAAOwB,EAAY,cAAc/G,CAAM,EACzC,KAAKuF,EAAK,aACR,OAAO6B,EAAiB,cAAcpH,CAAM,EAC9C,KAAKuF,EAAK,MACR,OAAOkC,EAAU,cAAczH,CAAM,EACvC,KAAKuF,EAAK,KACR,OAAO+B,EAAS,cAActH,CAAM,CAC1C,CACA,CAQA,SAASkK,EAAeC,EAAM,CAC5B,OAAOA,EAAK,OAAO,SAAUC,EAAKC,EAAM,CACtC,MAAMC,EAAUF,EAAI,OAAS,GAAK,EAAIA,EAAIA,EAAI,OAAS,CAAC,EAAI,KAC5D,OAAIE,GAAWA,EAAQ,OAASD,EAAK,MACnCD,EAAIA,EAAI,OAAS,CAAC,EAAE,MAAQC,EAAK,KAC1BD,IAGTA,EAAI,KAAKC,CAAI,EACND,EACX,EAAK,CAAE,CAAA,CACP,CAkBA,SAASG,EAAYJ,EAAM,CACzB,MAAMxB,EAAQ,CAAA,EACd,QAAS1I,EAAI,EAAGA,EAAIkK,EAAK,OAAQlK,IAAK,CACpC,MAAMuG,EAAM2D,EAAKlK,CAAC,EAElB,OAAQuG,EAAI,KAAI,CACd,KAAKjB,EAAK,QACRoD,EAAM,KAAK,CAACnC,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMjB,EAAK,aAAc,OAAQiB,EAAI,MAAQ,EAC/D,CAAE,KAAMA,EAAI,KAAM,KAAMjB,EAAK,KAAM,OAAQiB,EAAI,MAAM,CACtD,CAAA,EACD,MACF,KAAKjB,EAAK,aACRoD,EAAM,KAAK,CAACnC,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMjB,EAAK,KAAM,OAAQiB,EAAI,MAAM,CACtD,CAAA,EACD,MACF,KAAKjB,EAAK,MACRoD,EAAM,KAAK,CAACnC,EACV,CAAE,KAAMA,EAAI,KAAM,KAAMjB,EAAK,KAAM,OAAQgE,EAAoB/C,EAAI,IAAI,CAAC,CACzE,CAAA,EACD,MACF,KAAKjB,EAAK,KACRoD,EAAM,KAAK,CACT,CAAE,KAAMnC,EAAI,KAAM,KAAMjB,EAAK,KAAM,OAAQgE,EAAoB/C,EAAI,IAAI,CAAC,CACzE,CAAA,CACT,CACA,CAEE,OAAOmC,CACT,CAcA,SAAS6B,EAAY7B,EAAO1J,EAAS,CACnC,MAAMwL,EAAQ,CAAA,EACR7C,EAAQ,CAAE,MAAO,CAAE,CAAA,EACzB,IAAI8C,EAAc,CAAC,OAAO,EAE1B,QAASzK,EAAI,EAAGA,EAAI0I,EAAM,OAAQ1I,IAAK,CACrC,MAAM0K,EAAYhC,EAAM1I,CAAC,EACnB2K,EAAiB,CAAA,EAEvB,QAAS1J,EAAI,EAAGA,EAAIyJ,EAAU,OAAQzJ,IAAK,CACzC,MAAM2J,EAAOF,EAAUzJ,CAAC,EAClB6H,EAAM,GAAK9I,EAAIiB,EAErB0J,EAAe,KAAK7B,CAAG,EACvB0B,EAAM1B,CAAG,EAAI,CAAE,KAAM8B,EAAM,UAAW,CAAC,EACvCjD,EAAMmB,CAAG,EAAI,CAAA,EAEb,QAAS+B,EAAI,EAAGA,EAAIJ,EAAY,OAAQI,IAAK,CAC3C,MAAMC,EAAaL,EAAYI,CAAC,EAE5BL,EAAMM,CAAU,GAAKN,EAAMM,CAAU,EAAE,KAAK,OAASF,EAAK,MAC5DjD,EAAMmD,CAAU,EAAEhC,CAAG,EACnBkB,EAAqBQ,EAAMM,CAAU,EAAE,UAAYF,EAAK,OAAQA,EAAK,IAAI,EACzEZ,EAAqBQ,EAAMM,CAAU,EAAE,UAAWF,EAAK,IAAI,EAE7DJ,EAAMM,CAAU,EAAE,WAAaF,EAAK,SAEhCJ,EAAMM,CAAU,IAAGN,EAAMM,CAAU,EAAE,UAAYF,EAAK,QAE1DjD,EAAMmD,CAAU,EAAEhC,CAAG,EAAIkB,EAAqBY,EAAK,OAAQA,EAAK,IAAI,EAClE,EAAItF,EAAK,sBAAsBsF,EAAK,KAAM5L,CAAO,EAE7D,CACA,CAEIyL,EAAcE,CAClB,CAEE,QAASE,EAAI,EAAGA,EAAIJ,EAAY,OAAQI,IACtClD,EAAM8C,EAAYI,CAAC,CAAC,EAAE,IAAM,EAG9B,MAAO,CAAE,IAAKlD,EAAO,MAAO6C,CAAK,CACnC,CAUA,SAASO,EAAoB9L,EAAM+L,EAAW,CAC5C,IAAI/F,EACJ,MAAMgG,EAAW3F,EAAK,mBAAmBrG,CAAI,EAK7C,GAHAgG,EAAOK,EAAK,KAAK0F,EAAWC,CAAQ,EAGhChG,IAASK,EAAK,MAAQL,EAAK,IAAMgG,EAAS,IAC5C,MAAM,IAAI,MAAM,IAAMhM,EAAO,iCACOqG,EAAK,SAASL,CAAI,EACpD;AAAA,sBAA4BK,EAAK,SAAS2F,CAAQ,CAAC,EAQvD,OAJIhG,IAASK,EAAK,OAAS,CAACH,EAAM,mBAAkB,IAClDF,EAAOK,EAAK,MAGNL,EAAI,CACV,KAAKK,EAAK,QACR,OAAO,IAAIwB,EAAY7H,CAAI,EAE7B,KAAKqG,EAAK,aACR,OAAO,IAAI6B,EAAiBlI,CAAI,EAElC,KAAKqG,EAAK,MACR,OAAO,IAAIkC,EAAUvI,CAAI,EAE3B,KAAKqG,EAAK,KACR,OAAO,IAAI+B,EAASpI,CAAI,CAC9B,CACA,CAiBAI,EAAA,UAAoB,SAAoB6L,EAAO,CAC7C,OAAOA,EAAM,OAAO,SAAUf,EAAK5D,EAAK,CACtC,OAAI,OAAOA,GAAQ,SACjB4D,EAAI,KAAKY,EAAmBxE,EAAK,IAAI,CAAC,EAC7BA,EAAI,MACb4D,EAAI,KAAKY,EAAmBxE,EAAI,KAAMA,EAAI,IAAI,CAAC,EAG1C4D,CACX,EAAK,CAAE,CAAA,CACP,EAUA9K,EAAA,WAAqB,SAAqBJ,EAAMD,EAAS,CACvD,MAAMkL,EAAOV,EAAsBvK,EAAMkG,EAAM,mBAAoB,CAAA,EAE7DuD,EAAQ4B,EAAWJ,CAAI,EACvBvC,EAAQ4C,EAAW7B,EAAO1J,CAAO,EACjCmM,EAAOzD,EAAS,UAAUC,EAAM,IAAK,QAAS,KAAK,EAEnDyD,EAAgB,CAAA,EACtB,QAASpL,EAAI,EAAGA,EAAImL,EAAK,OAAS,EAAGnL,IACnCoL,EAAc,KAAKzD,EAAM,MAAMwD,EAAKnL,CAAC,CAAC,EAAE,IAAI,EAG9C,OAAOX,EAAQ,UAAU4K,EAAcmB,CAAa,CAAC,CACvD,EAYA/L,EAAA,SAAmB,SAAmBJ,EAAM,CAC1C,OAAOI,EAAQ,UACbmK,EAAsBvK,EAAMkG,EAAM,mBAAoB,CAAA,CAC1D,CACA,qDCzUA,MAAMA,EAAQzE,GAAA,EACRgC,EAAUsC,GAAA,EACVrF,EAAY0F,GAAA,EACZlF,EAAYoF,GAAA,EACZ8F,EAAmB7F,GAAA,EACnB8F,EAAgBnC,GAAA,EAChBoC,EAAcnC,GAAA,EACdhE,EAASiE,GAAA,EACTtF,EAAqByH,GAAA,EACrBC,EAAUC,GAAA,EACVC,EAAaC,GAAA,EACbtG,EAAOuG,GAAA,EACPC,EAAWC,GAAA,EAkCjB,SAASC,EAAoBC,EAAQjN,EAAS,CAC5C,MAAMoB,EAAO6L,EAAO,KACdlL,EAAMuK,EAAc,aAAatM,CAAO,EAE9C,QAASgB,EAAI,EAAGA,EAAIe,EAAI,OAAQf,IAAK,CACnC,MAAMK,EAAMU,EAAIf,CAAC,EAAE,CAAC,EACdM,EAAMS,EAAIf,CAAC,EAAE,CAAC,EAEpB,QAASkM,EAAI,GAAIA,GAAK,EAAGA,IACvB,GAAI,EAAA7L,EAAM6L,GAAK,IAAM9L,GAAQC,EAAM6L,GAEnC,QAASC,EAAI,GAAIA,GAAK,EAAGA,IACnB7L,EAAM6L,GAAK,IAAM/L,GAAQE,EAAM6L,IAE9BD,GAAK,GAAKA,GAAK,IAAMC,IAAM,GAAKA,IAAM,IACxCA,GAAK,GAAKA,GAAK,IAAMD,IAAM,GAAKA,IAAM,IACtCA,GAAK,GAAKA,GAAK,GAAKC,GAAK,GAAKA,GAAK,EACpCF,EAAO,IAAI5L,EAAM6L,EAAG5L,EAAM6L,EAAG,GAAM,EAAI,EAEvCF,EAAO,IAAI5L,EAAM6L,EAAG5L,EAAM6L,EAAG,GAAO,EAAI,EAIlD,CACA,CASA,SAASC,EAAoBH,EAAQ,CACnC,MAAM7L,EAAO6L,EAAO,KAEpB,QAASC,EAAI,EAAGA,EAAI9L,EAAO,EAAG8L,IAAK,CACjC,MAAMzM,EAAQyM,EAAI,IAAM,EACxBD,EAAO,IAAIC,EAAG,EAAGzM,EAAO,EAAI,EAC5BwM,EAAO,IAAI,EAAGC,EAAGzM,EAAO,EAAI,CAChC,CACA,CAUA,SAAS4M,EAAuBJ,EAAQjN,EAAS,CAC/C,MAAM+B,EAAMsK,EAAiB,aAAarM,CAAO,EAEjD,QAASgB,EAAI,EAAGA,EAAIe,EAAI,OAAQf,IAAK,CACnC,MAAMK,EAAMU,EAAIf,CAAC,EAAE,CAAC,EACdM,EAAMS,EAAIf,CAAC,EAAE,CAAC,EAEpB,QAASkM,EAAI,GAAIA,GAAK,EAAGA,IACvB,QAASC,EAAI,GAAIA,GAAK,EAAGA,IACnBD,IAAM,IAAMA,IAAM,GAAKC,IAAM,IAAMA,IAAM,GAC1CD,IAAM,GAAKC,IAAM,EAClBF,EAAO,IAAI5L,EAAM6L,EAAG5L,EAAM6L,EAAG,GAAM,EAAI,EAEvCF,EAAO,IAAI5L,EAAM6L,EAAG5L,EAAM6L,EAAG,GAAO,EAAI,CAIlD,CACA,CAQA,SAASG,EAAkBL,EAAQjN,EAAS,CAC1C,MAAMoB,EAAO6L,EAAO,KACdM,EAAOd,EAAQ,eAAezM,CAAO,EAC3C,IAAIqB,EAAKC,EAAKkM,EAEd,QAASxM,EAAI,EAAGA,EAAI,GAAIA,IACtBK,EAAM,KAAK,MAAML,EAAI,CAAC,EACtBM,EAAMN,EAAI,EAAII,EAAO,EAAI,EACzBoM,GAAQD,GAAQvM,EAAK,KAAO,EAE5BiM,EAAO,IAAI5L,EAAKC,EAAKkM,EAAK,EAAI,EAC9BP,EAAO,IAAI3L,EAAKD,EAAKmM,EAAK,EAAI,CAElC,CASA,SAASC,EAAiBR,EAAQnJ,EAAsBZ,EAAa,CACnE,MAAM9B,EAAO6L,EAAO,KACdM,EAAOZ,EAAW,eAAe7I,EAAsBZ,CAAW,EACxE,IAAIlC,EAAGwM,EAEP,IAAKxM,EAAI,EAAGA,EAAI,GAAIA,IAClBwM,GAAQD,GAAQvM,EAAK,KAAO,EAGxBA,EAAI,EACNiM,EAAO,IAAIjM,EAAG,EAAGwM,EAAK,EAAI,EACjBxM,EAAI,EACbiM,EAAO,IAAIjM,EAAI,EAAG,EAAGwM,EAAK,EAAI,EAE9BP,EAAO,IAAI7L,EAAO,GAAKJ,EAAG,EAAGwM,EAAK,EAAI,EAIpCxM,EAAI,EACNiM,EAAO,IAAI,EAAG7L,EAAOJ,EAAI,EAAGwM,EAAK,EAAI,EAC5BxM,EAAI,EACbiM,EAAO,IAAI,EAAG,GAAKjM,EAAI,EAAI,EAAGwM,EAAK,EAAI,EAEvCP,EAAO,IAAI,EAAG,GAAKjM,EAAI,EAAGwM,EAAK,EAAI,EAKvCP,EAAO,IAAI7L,EAAO,EAAG,EAAG,EAAG,EAAI,CACjC,CAQA,SAASsM,EAAWT,EAAQhN,EAAM,CAChC,MAAMmB,EAAO6L,EAAO,KACpB,IAAIU,EAAM,GACNtM,EAAMD,EAAO,EACbwM,EAAW,EACXC,EAAY,EAEhB,QAASvM,EAAMF,EAAO,EAAGE,EAAM,EAAGA,GAAO,EAGvC,IAFIA,IAAQ,GAAGA,MAEF,CACX,QAAS6L,EAAI,EAAGA,EAAI,EAAGA,IACrB,GAAI,CAACF,EAAO,WAAW5L,EAAKC,EAAM6L,CAAC,EAAG,CACpC,IAAIW,EAAO,GAEPD,EAAY5N,EAAK,SACnB6N,GAAU7N,EAAK4N,CAAS,IAAMD,EAAY,KAAO,GAGnDX,EAAO,IAAI5L,EAAKC,EAAM6L,EAAGW,CAAI,EAC7BF,IAEIA,IAAa,KACfC,IACAD,EAAW,EAEvB,CAKM,GAFAvM,GAAOsM,EAEHtM,EAAM,GAAKD,GAAQC,EAAK,CAC1BA,GAAOsM,EACPA,EAAM,CAACA,EACP,KACR,CACA,CAEA,CAUA,SAASI,EAAY/N,EAAS8D,EAAsBiD,EAAU,CAE5D,MAAMiH,EAAS,IAAIrN,EAEnBoG,EAAS,QAAQ,SAAU9G,EAAM,CAE/B+N,EAAO,IAAI/N,EAAK,KAAK,IAAK,CAAC,EAS3B+N,EAAO,IAAI/N,EAAK,UAAW,EAAEqG,EAAK,sBAAsBrG,EAAK,KAAMD,CAAO,CAAC,EAG3EC,EAAK,MAAM+N,CAAM,CAClB,CAAA,EAGD,MAAM7G,EAAiBhB,EAAM,wBAAwBnG,CAAO,EACtDoH,EAAmBhB,EAAO,uBAAuBpG,EAAS8D,CAAoB,EAC9EuD,GAA0BF,EAAiBC,GAAoB,EAgBrE,IATI4G,EAAO,kBAAoB,GAAK3G,GAClC2G,EAAO,IAAI,EAAG,CAAC,EAQVA,EAAO,kBAAoB,IAAM,GACtCA,EAAO,OAAO,CAAC,EAOjB,MAAMC,GAAiB5G,EAAyB2G,EAAO,gBAAe,GAAM,EAC5E,QAAShN,EAAI,EAAGA,EAAIiN,EAAejN,IACjCgN,EAAO,IAAIhN,EAAI,EAAI,GAAO,IAAM,CAAC,EAGnC,OAAOkN,EAAgBF,EAAQhO,EAAS8D,CAAoB,CAC9D,CAWA,SAASoK,EAAiBhN,EAAWlB,EAAS8D,EAAsB,CAElE,MAAMqD,EAAiBhB,EAAM,wBAAwBnG,CAAO,EAGtDoH,EAAmBhB,EAAO,uBAAuBpG,EAAS8D,CAAoB,EAG9EqK,EAAqBhH,EAAiBC,EAGtCgH,EAAgBhI,EAAO,eAAepG,EAAS8D,CAAoB,EAGnEuK,EAAiBlH,EAAiBiH,EAClCE,EAAiBF,EAAgBC,EAEjCE,EAAyB,KAAK,MAAMpH,EAAiBiH,CAAa,EAElEI,EAAwB,KAAK,MAAML,EAAqBC,CAAa,EACrEK,GAAwBD,EAAwB,EAGhDE,GAAUH,EAAyBC,EAGnCG,GAAK,IAAI5J,EAAmB2J,EAAO,EAEzC,IAAI/J,GAAS,EACb,MAAMiK,GAAS,IAAI,MAAMR,CAAa,EAChCS,GAAS,IAAI,MAAMT,CAAa,EACtC,IAAIU,GAAc,EAClB,MAAMd,GAAS,IAAI,WAAW9M,EAAU,MAAM,EAG9C,QAAS8I,GAAI,EAAGA,GAAIoE,EAAepE,KAAK,CACtC,MAAM+E,GAAW/E,GAAIsE,EAAiBE,EAAwBC,GAG9DG,GAAO5E,EAAC,EAAIgE,GAAO,MAAMrJ,GAAQA,GAASoK,EAAQ,EAGlDF,GAAO7E,EAAC,EAAI2E,GAAG,OAAOC,GAAO5E,EAAC,CAAC,EAE/BrF,IAAUoK,GACVD,GAAc,KAAK,IAAIA,GAAaC,EAAQ,CAChD,CAIE,MAAM9O,GAAO,IAAI,WAAWkH,CAAc,EAC1C,IAAIvG,GAAQ,EACRI,EAAGkM,EAGP,IAAKlM,EAAI,EAAGA,EAAI8N,GAAa9N,IAC3B,IAAKkM,EAAI,EAAGA,EAAIkB,EAAelB,IACzBlM,EAAI4N,GAAO1B,CAAC,EAAE,SAChBjN,GAAKW,IAAO,EAAIgO,GAAO1B,CAAC,EAAElM,CAAC,GAMjC,IAAKA,EAAI,EAAGA,EAAI0N,GAAS1N,IACvB,IAAKkM,EAAI,EAAGA,EAAIkB,EAAelB,IAC7BjN,GAAKW,IAAO,EAAIiO,GAAO3B,CAAC,EAAElM,CAAC,EAI/B,OAAOf,EACT,CAWA,SAAS+O,EAAc/O,EAAMD,EAAS8D,EAAsBZ,EAAa,CACvE,IAAI6D,EAEJ,GAAI,MAAM,QAAQ9G,CAAI,EACpB8G,EAAW+F,EAAS,UAAU7M,CAAI,UACzB,OAAOA,GAAS,SAAU,CACnC,IAAIgP,EAAmBjP,EAEvB,GAAI,CAACiP,EAAkB,CACrB,MAAMC,EAAcpC,EAAS,SAAS7M,CAAI,EAG1CgP,EAAmBxC,EAAQ,sBAAsByC,EAAapL,CAAoB,CACxF,CAIIiD,EAAW+F,EAAS,WAAW7M,EAAMgP,GAAoB,EAAE,CAC/D,KACI,OAAM,IAAI,MAAM,cAAc,EAIhC,MAAME,EAAc1C,EAAQ,sBAAsB1F,EAAUjD,CAAoB,EAGhF,GAAI,CAACqL,EACH,MAAM,IAAI,MAAM,yDAAyD,EAI3E,GAAI,CAACnP,EACHA,EAAUmP,UAGDnP,EAAUmP,EACnB,MAAM,IAAI,MAAM;AAAA;AAAA,qDAE0CA,EAAc;AAAA,CAC5E,EAGE,MAAMC,EAAWrB,EAAW/N,EAAS8D,EAAsBiD,CAAQ,EAG7DsI,EAAclJ,EAAM,cAAcnG,CAAO,EACzCsP,EAAU,IAAInO,EAAUkO,CAAW,EAGzC,OAAArC,EAAmBsC,EAAStP,CAAO,EACnCoN,EAAmBkC,CAAO,EAC1BjC,EAAsBiC,EAAStP,CAAO,EAMtCyN,EAAgB6B,EAASxL,EAAsB,CAAC,EAE5C9D,GAAW,GACbsN,EAAiBgC,EAAStP,CAAO,EAInC0N,EAAU4B,EAASF,CAAQ,EAEvB,MAAMlM,CAAW,IAEnBA,EAAcqJ,EAAY,YAAY+C,EACpC7B,EAAgB,KAAK,KAAM6B,EAASxL,CAAoB,CAAC,GAI7DyI,EAAY,UAAUrJ,EAAaoM,CAAO,EAG1C7B,EAAgB6B,EAASxL,EAAsBZ,CAAW,EAEnD,CACL,QAASoM,EACT,QAAStP,EACT,qBAAsB8D,EACtB,YAAaZ,EACb,SAAU6D,CACd,CACA,CAWA,OAAAwI,GAAA,OAAiB,SAAiBtP,EAAMuP,EAAS,CAC/C,GAAI,OAAOvP,EAAS,KAAeA,IAAS,GAC1C,MAAM,IAAI,MAAM,eAAe,EAGjC,IAAI6D,EAAuBJ,EAAQ,EAC/B1D,EACAqC,EAEJ,OAAI,OAAOmN,EAAY,MAErB1L,EAAuBJ,EAAQ,KAAK8L,EAAQ,qBAAsB9L,EAAQ,CAAC,EAC3E1D,EAAUyM,EAAQ,KAAK+C,EAAQ,OAAO,EACtCnN,EAAOkK,EAAY,KAAKiD,EAAQ,WAAW,EAEvCA,EAAQ,YACVrJ,EAAM,kBAAkBqJ,EAAQ,UAAU,GAIvCR,EAAa/O,EAAMD,EAAS8D,EAAsBzB,CAAI,CAC/D,mEC9eA,SAASoN,EAAUC,EAAK,CAKtB,GAJI,OAAOA,GAAQ,WACjBA,EAAMA,EAAI,SAAQ,GAGhB,OAAOA,GAAQ,SACjB,MAAM,IAAI,MAAM,uCAAuC,EAGzD,IAAIC,EAAUD,EAAI,MAAO,EAAC,QAAQ,IAAK,EAAE,EAAE,MAAM,EAAE,EACnD,GAAIC,EAAQ,OAAS,GAAKA,EAAQ,SAAW,GAAKA,EAAQ,OAAS,EACjE,MAAM,IAAI,MAAM,sBAAwBD,CAAG,GAIzCC,EAAQ,SAAW,GAAKA,EAAQ,SAAW,KAC7CA,EAAU,MAAM,UAAU,OAAO,MAAM,CAAA,EAAIA,EAAQ,IAAI,SAAUxC,EAAG,CAClE,MAAO,CAACA,EAAGA,CAAC,CAClB,CAAK,CAAC,GAIAwC,EAAQ,SAAW,GAAGA,EAAQ,KAAK,IAAK,GAAG,EAE/C,MAAMC,EAAW,SAASD,EAAQ,KAAK,EAAE,EAAG,EAAE,EAE9C,MAAO,CACL,EAAIC,GAAY,GAAM,IACtB,EAAIA,GAAY,GAAM,IACtB,EAAIA,GAAY,EAAK,IACrB,EAAGA,EAAW,IACd,IAAK,IAAMD,EAAQ,MAAM,EAAG,CAAC,EAAE,KAAK,EAAE,CAC1C,CACA,CAEAtP,EAAA,WAAqB,SAAqBmP,EAAS,CAC5CA,IAASA,EAAU,CAAA,GACnBA,EAAQ,QAAOA,EAAQ,MAAQ,CAAA,GAEpC,MAAMK,EAAS,OAAOL,EAAQ,OAAW,KACvCA,EAAQ,SAAW,MACnBA,EAAQ,OAAS,EACf,EACAA,EAAQ,OAENM,EAAQN,EAAQ,OAASA,EAAQ,OAAS,GAAKA,EAAQ,MAAQ,OAC/DO,EAAQP,EAAQ,OAAS,EAE/B,MAAO,CACL,MAAOM,EACP,MAAOA,EAAQ,EAAIC,EACnB,OAAQF,EACR,MAAO,CACL,KAAMJ,EAASD,EAAQ,MAAM,MAAQ,WAAW,EAChD,MAAOC,EAASD,EAAQ,MAAM,OAAS,WAAW,CACnD,EACD,KAAMA,EAAQ,KACd,aAAcA,EAAQ,cAAgB,CAAA,CAC1C,CACA,EAEAnP,EAAA,SAAmB,SAAmB2P,EAAQrG,EAAM,CAClD,OAAOA,EAAK,OAASA,EAAK,OAASqG,EAASrG,EAAK,OAAS,EACtDA,EAAK,OAASqG,EAASrG,EAAK,OAAS,GACrCA,EAAK,KACX,EAEAtJ,EAAA,cAAwB,SAAwB2P,EAAQrG,EAAM,CAC5D,MAAMoG,EAAQ1P,EAAQ,SAAS2P,EAAQrG,CAAI,EAC3C,OAAO,KAAK,OAAOqG,EAASrG,EAAK,OAAS,GAAKoG,CAAK,CACtD,EAEA1P,EAAwB,cAAA,SAAwB4P,EAASC,EAAIvG,EAAM,CACjE,MAAMvI,EAAO8O,EAAG,QAAQ,KAClBjQ,EAAOiQ,EAAG,QAAQ,KAClBH,EAAQ1P,EAAQ,SAASe,EAAMuI,CAAI,EACnCwG,EAAa,KAAK,OAAO/O,EAAOuI,EAAK,OAAS,GAAKoG,CAAK,EACxDK,EAAezG,EAAK,OAASoG,EAC7BM,EAAU,CAAC1G,EAAK,MAAM,MAAOA,EAAK,MAAM,IAAI,EAElD,QAAS,EAAI,EAAG,EAAIwG,EAAY,IAC9B,QAASlO,EAAI,EAAGA,EAAIkO,EAAYlO,IAAK,CACnC,IAAIqO,GAAU,EAAIH,EAAalO,GAAK,EAChCsO,EAAU5G,EAAK,MAAM,MAEzB,GAAI,GAAKyG,GAAgBnO,GAAKmO,GAC5B,EAAID,EAAaC,GAAgBnO,EAAIkO,EAAaC,EAAc,CAChE,MAAMI,EAAO,KAAK,OAAO,EAAIJ,GAAgBL,CAAK,EAC5CU,EAAO,KAAK,OAAOxO,EAAImO,GAAgBL,CAAK,EAClDQ,EAAUF,EAAQpQ,EAAKuQ,EAAOpP,EAAOqP,CAAI,EAAI,EAAI,CAAC,CAC1D,CAEMR,EAAQK,GAAQ,EAAIC,EAAQ,EAC5BN,EAAQK,GAAQ,EAAIC,EAAQ,EAC5BN,EAAQK,GAAQ,EAAIC,EAAQ,EAC5BN,EAAQK,CAAM,EAAIC,EAAQ,CAChC,CAEA,6DClGA,MAAMpK,EAAQzE,GAAA,EAEd,SAASgP,EAAaC,EAAKC,EAAQxP,EAAM,CACvCuP,EAAI,UAAU,EAAG,EAAGC,EAAO,MAAOA,EAAO,MAAM,EAE1CA,EAAO,QAAOA,EAAO,MAAQ,CAAA,GAClCA,EAAO,OAASxP,EAChBwP,EAAO,MAAQxP,EACfwP,EAAO,MAAM,OAASxP,EAAO,KAC7BwP,EAAO,MAAM,MAAQxP,EAAO,IAC9B,CAEA,SAASyP,GAAoB,CAC3B,GAAI,CACF,OAAO,SAAS,cAAc,QAAQ,CACvC,MAAW,CACV,MAAM,IAAI,MAAM,sCAAsC,CAC1D,CACA,CAEAxQ,EAAiB,OAAA,SAAiByQ,EAAQF,EAAQpB,EAAS,CACzD,IAAI7F,EAAO6F,EACPuB,EAAWH,EAEX,OAAOjH,EAAS,MAAgB,CAACiH,GAAU,CAACA,EAAO,cACrDjH,EAAOiH,EACPA,EAAS,QAGNA,IACHG,EAAWF,EAAgB,GAG7BlH,EAAOxD,EAAM,WAAWwD,CAAI,EAC5B,MAAMvI,EAAO+E,EAAM,cAAc2K,EAAO,QAAQ,KAAMnH,CAAI,EAEpDgH,EAAMI,EAAS,WAAW,IAAI,EAC9BC,EAAQL,EAAI,gBAAgBvP,EAAMA,CAAI,EAC5C,OAAA+E,EAAM,cAAc6K,EAAM,KAAMF,EAAQnH,CAAI,EAE5C+G,EAAYC,EAAKI,EAAU3P,CAAI,EAC/BuP,EAAI,aAAaK,EAAO,EAAG,CAAC,EAErBD,CACT,EAEA1Q,EAA0B,gBAAA,SAA0ByQ,EAAQF,EAAQpB,EAAS,CAC3E,IAAI7F,EAAO6F,EAEP,OAAO7F,EAAS,MAAgB,CAACiH,GAAU,CAACA,EAAO,cACrDjH,EAAOiH,EACPA,EAAS,QAGNjH,IAAMA,EAAO,CAAA,GAElB,MAAMoH,EAAW1Q,EAAQ,OAAOyQ,EAAQF,EAAQjH,CAAI,EAE9CsH,EAAOtH,EAAK,MAAQ,YACpBuH,EAAevH,EAAK,cAAgB,CAAA,EAE1C,OAAOoH,EAAS,UAAUE,EAAMC,EAAa,OAAO,CACtD,2DC9DA,MAAM/K,EAAQzE,GAAA,EAEd,SAASyP,EAAgBC,EAAOC,EAAQ,CACtC,MAAMC,EAAQF,EAAM,EAAI,IAClBvL,EAAMwL,EAAS,KAAOD,EAAM,IAAM,IAExC,OAAOE,EAAQ,EACXzL,EAAM,IAAMwL,EAAS,aAAeC,EAAM,QAAQ,CAAC,EAAE,MAAM,CAAC,EAAI,IAChEzL,CACN,CAEA,SAAS0L,EAAQC,EAAKvN,EAAGE,EAAG,CAC1B,IAAI0B,EAAM2L,EAAMvN,EAChB,OAAI,OAAOE,EAAM,MAAa0B,GAAO,IAAM1B,GAEpC0B,CACT,CAEA,SAAS4L,EAAUxR,EAAMmB,EAAMyO,EAAQ,CACrC,IAAI1D,EAAO,GACPuF,EAAS,EACTC,EAAS,GACTC,EAAa,EAEjB,QAAS5Q,EAAI,EAAGA,EAAIf,EAAK,OAAQe,IAAK,CACpC,MAAMM,EAAM,KAAK,MAAMN,EAAII,CAAI,EACzBC,EAAM,KAAK,MAAML,EAAII,CAAI,EAE3B,CAACE,GAAO,CAACqQ,IAAQA,EAAS,IAE1B1R,EAAKe,CAAC,GACR4Q,IAEM5Q,EAAI,GAAKM,EAAM,GAAKrB,EAAKe,EAAI,CAAC,IAClCmL,GAAQwF,EACJJ,EAAO,IAAKjQ,EAAMuO,EAAQ,GAAMxO,EAAMwO,CAAM,EAC5C0B,EAAO,IAAKG,EAAQ,CAAC,EAEzBA,EAAS,EACTC,EAAS,IAGLrQ,EAAM,EAAIF,GAAQnB,EAAKe,EAAI,CAAC,IAChCmL,GAAQoF,EAAO,IAAKK,CAAU,EAC9BA,EAAa,IAGfF,GAEN,CAEE,OAAOvF,CACT,CAEc,OAAA0F,GAAA,OAAG,SAAiBf,EAAQtB,EAASsC,EAAI,CACrD,MAAMnI,EAAOxD,EAAM,WAAWqJ,CAAO,EAC/BpO,EAAO0P,EAAO,QAAQ,KACtB7Q,EAAO6Q,EAAO,QAAQ,KACtBiB,EAAa3Q,EAAOuI,EAAK,OAAS,EAElCqI,EAAMrI,EAAK,MAAM,MAAM,EAEzB,SAAWwH,EAAexH,EAAK,MAAM,MAAO,MAAM,EAClD,YAAcoI,EAAa,IAAMA,EAAa,SAF9C,GAIE5F,EACJ,SAAWgF,EAAexH,EAAK,MAAM,KAAM,QAAQ,EACnD,OAAS8H,EAASxR,EAAMmB,EAAMuI,EAAK,MAAM,EAAI,MAEzCsI,EAAU,gBAAuBF,EAAa,IAAMA,EAAa,IAIjEF,EAAS,4CAFAlI,EAAK,MAAa,UAAYA,EAAK,MAAQ,aAAeA,EAAK,MAAQ,KAA1D,IAEwCsI,EAAU,iCAAmCD,EAAK7F,EAAO;AAAA,EAE7H,OAAI,OAAO2F,GAAO,YAChBA,EAAG,KAAMD,CAAM,EAGVA,CACT,+CC/EA,MAAMjS,EAAa8B,GAAA,EAEbwQ,EAASlM,GAAA,EACTmM,EAAiB9L,GAAA,EACjB+L,EAAc7L,GAAA,EAEpB,SAAS8L,EAAcC,EAAY1B,EAAQ2B,EAAM5I,EAAMmI,EAAI,CACzD,MAAMU,EAAO,CAAE,EAAC,MAAM,KAAK,UAAW,CAAC,EACjCC,EAAUD,EAAK,OACfE,EAAc,OAAOF,EAAKC,EAAU,CAAC,GAAM,WAEjD,GAAI,CAACC,GAAe,CAAC9S,IACnB,MAAM,IAAI,MAAM,oCAAoC,EAGtD,GAAI8S,EAAa,CACf,GAAID,EAAU,EACZ,MAAM,IAAI,MAAM,4BAA4B,EAG1CA,IAAY,GACdX,EAAKS,EACLA,EAAO3B,EACPA,EAASjH,EAAO,QACP8I,IAAY,IACjB7B,EAAO,YAAc,OAAOkB,EAAO,KACrCA,EAAKnI,EACLA,EAAO,SAEPmI,EAAKnI,EACLA,EAAO4I,EACPA,EAAO3B,EACPA,EAAS,QAGjB,KAAS,CACL,GAAI6B,EAAU,EACZ,MAAM,IAAI,MAAM,4BAA4B,EAG9C,OAAIA,IAAY,GACdF,EAAO3B,EACPA,EAASjH,EAAO,QACP8I,IAAY,GAAK,CAAC7B,EAAO,aAClCjH,EAAO4I,EACPA,EAAO3B,EACPA,EAAS,QAGJ,IAAI,QAAQ,SAAU+B,EAASC,EAAQ,CAC5C,GAAI,CACF,MAAM3S,EAAOiS,EAAO,OAAOK,EAAM5I,CAAI,EACrCgJ,EAAQL,EAAWrS,EAAM2Q,EAAQjH,CAAI,CAAC,CACvC,OAAQkJ,EAAG,CACVD,EAAOC,CAAC,CAChB,CACK,CAAA,CACL,CAEE,GAAI,CACF,MAAM5S,EAAOiS,EAAO,OAAOK,EAAM5I,CAAI,EACrCmI,EAAG,KAAMQ,EAAWrS,EAAM2Q,EAAQjH,CAAI,CAAC,CACxC,OAAQkJ,EAAG,CACVf,EAAGe,CAAC,CACR,CACA,CAEc,OAAAC,GAAA,OAAGZ,EAAO,OACRY,GAAA,SAAGT,EAAa,KAAK,KAAMF,EAAe,MAAM,EAC/CW,GAAA,UAAGT,EAAa,KAAK,KAAMF,EAAe,eAAe,EAG1EW,GAAA,SAAmBT,EAAa,KAAK,KAAM,SAAUpS,EAAM8S,EAAGpJ,EAAM,CAClE,OAAOyI,EAAY,OAAOnS,EAAM0J,CAAI,CACrC,CAAA,+sBCsFD,MAAMqJ,EAASC,GAAc,EAEvBC,EAAYC,GAAG,EACfC,EAAWD,GAAG,EAEdE,EAASC,GAAS,CACtB,GAAI,EACN,CAAC,EAEKC,EAASD,GAAS,CAAE,QAAS,CAAA,EAAI,QAAS,GAAO,KAAM,EAAO,CAAA,EAEpEE,GAAU,SAAY,CACpBR,EAAO,iBAAgB,EAEvBA,EAAO,WAAW,CAACS,EAAUC,IAAU,CACjCA,EAAM,SAAWH,EAAO,UAASA,EAAO,QAAUP,EAAO,OAC9D,CAAA,EAEDW,EAAK,CACP,CAAC,EAEDC,GAAU,IAAM,CACdD,EAAK,EAED,OAAO,KAAKJ,EAAO,OAAO,EAAE,QAAU,GAAK,CAACA,EAAO,OACrDA,EAAO,KAAO,YAAY,IAAM,CAC9BP,EAAO,iBAAgB,CAC7B,EAAO,GAAI,GAGL,OAAO,KAAKO,EAAO,OAAO,EAAE,OAAS,GAAKA,EAAO,OACnD,cAAcA,EAAO,IAAI,EACzBA,EAAO,KAAO,GAElB,CAAC,EAED,eAAeI,GAAQ,CACrB,MAAME,EAAW,MAAMb,EAAO,YAAW,EACzCK,EAAO,GAAKQ,EAEZ3B,GAAO,SAASkB,EAAS,MAAO,GAAGC,EAAO,EAAE,WAAaS,GAAU,CAC7DA,GAAO,QAAQ,IAAI,iBAAkBA,CAAK,CAC/C,CAAA,CACH,CAEA,eAAeC,EAAUC,EAAY,CACnC,MAAMC,EAAM,MAAMjB,EAAO,gBAAgBgB,CAAU,EAEnDT,EAAO,QAAU,CAAE,KAAMS,EAAY,IAAKC,CAAG,EAC7Cf,EAAU,MAAM,aAAa,EAAI,EAEjCgB,EAAQ,EAER,WAAW,IAAM,CACfC,EAAY,CAChB,EAAK,GAAK,CACV,CAEA,SAASD,GAAW,CAClB,MAAME,EAAe,YAAY,IAAM,CACrCC,GAAM,KAAKC,KAAW,oBAAqB,CAAE,KAAMf,EAAO,QAAQ,IAAM,CAAA,EAAE,KAAMtT,GAAS,CAClFA,EAAK,OACR,cAAcmU,CAAY,EAC1BD,EAAY,EACZnB,EAAO,iBAAgB,EAE1B,CAAA,CACL,EAAK,GAAI,CACT,CAEA,SAASmB,GAAe,CACtBZ,EAAO,QAAU,GACbL,EAAU,OAAOA,EAAU,MAAM,aAAa,EAAK,CACzD,CAEA,SAASqB,EAAaC,EAAI,CACxBH,GAAM,KAAKC,GAAQ,EAAG,sBAAuB,CAAE,KAAME,EAAI,EAAE,KAAMvU,GAAS,CACpEA,EAAK,MACP+S,EAAO,iBAAgB,CAE1B,CAAA,CACH,20FCjPA,IAAIyB,GAAK,OAAO,WAAa,IAAM,WAAa,OAAO,OAAS,IAAM,OAAS,OAAO,OAAS,IAAM,OAAS,OAAO,KAAO,IAAM,KAAO,CAAE,EAC3I,SAASC,GAAGC,EAAG,CACb,OAAOA,GAAKA,EAAE,YAAc,OAAO,UAAU,eAAe,KAAKA,EAAG,SAAS,EAAIA,EAAE,QAAUA,CAC/F,CACA,IAAIC,GAAK,CAAE,QAAS,EAAI,GACvB,SAASD,EAAGE,EAAG,EACb,SAASC,EAAGC,EAAG,CACd,IAAIC,EAAI,SAAUC,EAAI,GAAIC,EAAI,IAAKC,EAAI,WAAYC,EAAI,YAAaC,EAAK,SAAUpT,EAAI,SAAUqT,EAAK,QAASzC,EAAI,QAAS9I,EAAI,OAAQ/I,EAAI,OAAQuU,EAAI,SAAU1L,EAAI,UAAWX,EAAI,eAAgBsM,EAAI,UAAW3J,EAAI,SAAU7B,EAAI,SAAUyL,EAAI,UAAWC,EAAI,WAAYC,EAAK,WAAYC,EAAK,IAAKC,EAAI,SAAUC,EAAI,QAASC,EAAK,OAAQC,EAAK,aAAcpM,EAAI,UAAWqM,EAAI,SAAUC,EAAK,OAAQC,EAAI,UAAWC,GAAI,SAAUC,GAAK,SAAUC,GAAK,KAAMC,GAAK,YAAaC,GAAK,WAAYC,GAAI,QAASC,GAAI,UAAWC,GAAK,QAASC,GAAI,OAAQC,GAAK,SAAUC,EAAK,QAASC,EAAK,WAAYC,GAAK,cAAeC,GAAK,SAAUC,GAAK,SAAS/J,EAAG7E,EAAG,CACloB,IAAIM,EAAI,CAAE,EACV,QAASnB,KAAK0F,EACZ7E,EAAEb,CAAC,GAAKa,EAAEb,CAAC,EAAE,OAAS,IAAM,EAAImB,EAAEnB,CAAC,EAAIa,EAAEb,CAAC,EAAE,OAAO0F,EAAE1F,CAAC,CAAC,EAAImB,EAAEnB,CAAC,EAAI0F,EAAE1F,CAAC,EACvE,OAAOmB,CACb,EAAOuO,GAAI,SAAShK,EAAG,CACjB,QAAS7E,EAAI,CAAA,EAAIM,EAAI,EAAGA,EAAIuE,EAAE,OAAQvE,IACpCN,EAAE6E,EAAEvE,CAAC,EAAE,YAAW,CAAE,EAAIuE,EAAEvE,CAAC,EAC7B,OAAON,CACb,EAAO8O,GAAK,SAASjK,EAAG7E,EAAG,CACrB,OAAO,OAAO6E,IAAMlL,EAAIoV,GAAE/O,CAAC,EAAE,QAAQ+O,GAAElK,CAAC,CAAC,IAAM,GAAK,EAC1D,EAAOkK,GAAI,SAASlK,EAAG,CACjB,OAAOA,EAAE,YAAa,CAC5B,EAAOmK,GAAK,SAASnK,EAAG,CAClB,OAAO,OAAOA,IAAMlL,EAAIkL,EAAE,QAAQ,WAAY8H,CAAC,EAAE,MAAM,GAAG,EAAE,CAAC,EAAIF,CACvE,EAAOwC,GAAK,SAASpK,EAAG7E,EAAG,CACrB,GAAI,OAAO6E,IAAMlL,EACf,OAAOkL,EAAIA,EAAE,QAAQ,SAAU8H,CAAC,EAAG,OAAO3M,IAAM8M,EAAIjI,EAAIA,EAAE,UAAU,EAAGyI,CAAE,CACjF,EAAO4B,GAAI,SAASrK,EAAG7E,EAAG,CACpB,QAASM,EAAI,EAAGnB,EAAGtD,GAAGsT,GAAGC,EAAGxK,EAAGyK,GAAG/O,EAAIN,EAAE,QAAU,CAAC4E,GAAK,CACtD,IAAI0K,GAAKtP,EAAEM,CAAC,EAAGiP,GAAKvP,EAAEM,EAAI,CAAC,EAC3B,IAAKnB,EAAItD,GAAI,EAAGsD,EAAImQ,GAAG,QAAU,CAAC1K,GAAK0K,GAAGnQ,CAAC,GACzC,GAAIyF,EAAI0K,GAAGnQ,GAAG,EAAE,KAAK0F,CAAC,EAAGD,EACvB,IAAKuK,GAAI,EAAGA,GAAII,GAAG,OAAQJ,KACzBE,GAAIzK,EAAE,EAAE/I,EAAC,EAAGuT,EAAIG,GAAGJ,EAAC,EAAG,OAAOC,IAAMrC,GAAMqC,EAAE,OAAS,EAAIA,EAAE,SAAW,EAAI,OAAOA,EAAE,CAAC,GAAKvC,EAAI,KAAKuC,EAAE,CAAC,CAAC,EAAIA,EAAE,CAAC,EAAE,KAAK,KAAMC,EAAC,EAAI,KAAKD,EAAE,CAAC,CAAC,EAAIA,EAAE,CAAC,EAAIA,EAAE,SAAW,EAAI,OAAOA,EAAE,CAAC,IAAMvC,GAAK,EAAEuC,EAAE,CAAC,EAAE,MAAQA,EAAE,CAAC,EAAE,MAAQ,KAAKA,EAAE,CAAC,CAAC,EAAIC,GAAID,EAAE,CAAC,EAAE,KAAK,KAAMC,GAAGD,EAAE,CAAC,CAAC,EAAI3C,EAAI,KAAK2C,EAAE,CAAC,CAAC,EAAIC,GAAIA,GAAE,QAAQD,EAAE,CAAC,EAAGA,EAAE,CAAC,CAAC,EAAI3C,EAAI2C,EAAE,SAAW,IAAM,KAAKA,EAAE,CAAC,CAAC,EAAIC,GAAID,EAAE,CAAC,EAAE,KAAK,KAAMC,GAAE,QAAQD,EAAE,CAAC,EAAGA,EAAE,CAAC,CAAC,CAAC,EAAI3C,GAAK,KAAK2C,CAAC,EAAIC,IAAK5C,EACzZnM,GAAK,CACb,CACA,EAAOkP,GAAK,SAAS3K,EAAG7E,EAAG,CACrB,QAASM,KAAKN,EACZ,GAAI,OAAOA,EAAEM,CAAC,IAAMyM,GAAM/M,EAAEM,CAAC,EAAE,OAAS,GACtC,QAASnB,EAAI,EAAGA,EAAIa,EAAEM,CAAC,EAAE,OAAQnB,IAC/B,GAAI2P,GAAG9O,EAAEM,CAAC,EAAEnB,CAAC,EAAG0F,CAAC,EACf,OAAOvE,IAAMsM,EAAIH,EAAInM,UAChBwO,GAAG9O,EAAEM,CAAC,EAAGuE,CAAC,EACnB,OAAOvE,IAAMsM,EAAIH,EAAInM,EACzB,OAAOuE,CACR,EAAE4K,GAAK,CACN,MAAO,KACP,MAAO,KACP,MAAO,KACP,MAAO,OACP,QAAS,OACT,QAAS,OACT,QAAS,OACT,IAAK,GACN,EAAEC,GAAK,CACN,GAAI,OACJ,UAAW,SACX,SAAU,QACV,IAAK,SACL,GAAI,CAAC,SAAU,QAAQ,EACvB,MAAO,SACP,EAAG,SACH,EAAG,SACH,MAAO,SACP,GAAI,CAAC,SAAU,SAAS,EACxB,GAAI,KACL,EAAEC,GAAK,CACN,QAAS,CACP,CACE,8BAED,EACD,CAACpO,EAAG,CAACE,EAAG,QAAQ,CAAC,EACjB,CACE,6BAED,EACD,CAACF,EAAG,CAACE,EAAG,MAAM,CAAC,EACf,CAEE,4BAEA,mDAEA,yCAED,EACD,CAACA,EAAGF,CAAC,EACL,CACE,uBAED,EACD,CAACA,EAAG,CAACE,EAAG0M,GAAI,OAAO,CAAC,EACpB,CACE,mBAED,EACD,CAAC5M,EAAG,CAACE,EAAG0M,EAAC,CAAC,EACV,CAEE,wDAED,EACD,CAAC5M,EAAG,CAACE,EAAG,OAAO,CAAC,EAChB,CACE,uBAEA,8DAGA,uDAEA,2BAGA,+LAEA,kCAEA,qBAED,EACD,CAACA,EAAGF,CAAC,EACL,CACE,mDAED,EACD,CAACA,EAAG,CAACE,EAAG,KAAOH,CAAC,CAAC,EACjB,CACE,+BAEA,+BACA,4BAED,EACD,CAACC,EAAG,CAACE,EAAG,QAAQ,CAAC,EACjB,CACE,uBAED,EACD,CAACF,EAAG,CAACE,EAAG,WAAW,CAAC,EACpB,CACE,6CAED,EACD,CAACF,EAAG,CAACE,EAAG,IAAI,CAAC,EACb,CACE,kCAED,EACD,CAACF,EAAG,CAACE,EAAG,QAAQ,CAAC,EACjB,CACE,uBAED,EACD,CAACF,EAAG,CAACE,EAAG,gBAAkBH,CAAC,CAAC,EAC5B,CACE,yBAED,EACD,CAAC,CAACG,EAAG,OAAQ,aAAeH,CAAC,EAAGC,CAAC,EACjC,CACE,qBAED,EACD,CAACA,EAAG,CAACE,EAAGoM,EAAI,QAAQ,CAAC,EACrB,CACE,mBAED,EACD,CAACtM,EAAG,CAACE,EAAG0M,GAAI,QAAQ,CAAC,EACrB,CACE,wBAED,EACD,CAAC5M,EAAG,CAACE,EAAG,SAAS,CAAC,EAClB,CACE,oBAED,EACD,CAACF,EAAG,CAACE,EAAG,SAAS,CAAC,EAClB,CACE,mBAED,EACD,CAACF,EAAG,CAACE,EAAG0M,GAAI,QAAQ,CAAC,EACrB,CACE,yBAED,EACD,CAAC5M,EAAG,CAACE,EAAG,QAAUH,CAAC,CAAC,EACpB,CACE,oBAED,EACD,CAACC,EAAG,CAACE,EAAGoM,CAAC,CAAC,EACV,CACE,+BAED,EACD,CAAC,CAACpM,EAAG,OAASH,CAAC,CAAC,EAChB,CACE,kDACD,EACD,CAAC,CAACG,EAAG,OAAQ,MAAQH,CAAC,EAAGC,CAAC,EAC1B,CAEE,4BAED,EACD,CAACA,EAAG,CAACE,EAAG2M,GAAI,WAAW,CAAC,EACxB,CACE,6BAED,EACD,CAAC,CAAC3M,EAAG,KAAM,GAAG,EAAGF,CAAC,EAClB,CACE,wBAED,EACD,CAACA,EAAG,CAACE,EAAG,gBAAgB,CAAC,EACzB,CACE,0BAED,EACD,CAAC,CAACA,EAAG,cAAc,EAAGF,CAAC,EACvB,CACE,gCAEA,iDAEA,4CAED,EACD,CAACE,EAAGF,CAAC,EACL,CACE,eAEA,oBAED,EACD,CAACE,CAAC,EACF,CAEE,6DAED,EACD,CAAC,CAACA,EAAGgN,CAAE,EAAGlN,CAAC,EACX,CACE,uBAEA,uCAEA,kCAEA,4BAEA,4BAEA,6BAEA,+CAED,EACD,CAACE,EAAGF,CAAC,EACL,CACE,8BAED,EACD,CAACA,EAAG,CAACE,EAAG,KAAK,CAAC,EACd,CACE,4CAED,EACD,CAACF,EAAG,CAACE,EAAG,QAAQ,CAAC,EACjB,CACE,kCAED,EACD,CAACF,EAAG,CAACE,EAAGkM,EAAI,WAAW,CAAC,EACxB,CACE,6BAED,EACD,CAAC,CAAClM,EAAGkM,EAAI,UAAU,EAAGpM,CAAC,EACvB,CACE,yDAED,EACD,CAACA,EAAG,CAACE,EAAG,WAAaH,CAAC,CAAC,EACvB,CACE,6DAED,EACD,CAACG,EAAGF,CAAC,EACL,CACE,8CAED,EACD,CAACA,EAAG,CAACE,EAAG,eAAe,CAAC,EACxB,CACE,oDAED,EACD,CAACF,EAAGE,CAAC,EACL,CACE,8CAED,EACD,CAACA,EAAG,CAACF,EAAGiO,GAAIC,EAAE,CAAC,EACf,CACE,4BACD,EACD,CAAChO,EAAGF,CAAC,EACL,CAEE,sCAED,EACD,CAAC,CAACE,EAAG,UAAU,EAAGF,CAAC,EACnB,CACE,qCAED,EACD,CAACA,EAAG,CAACE,EAAGoM,EAAI,UAAU,CAAC,EACvB,CACE,6BAEA,cAEA,mGAEA,+FAEA,wBAEA,2CAGA,wHAEA,uBAEA,oBAED,EACD,CAACpM,EAAGF,CAAC,EACL,CACE,sBAED,EACD,CAACE,EAAG,CAACF,EAAG,eAAgB,EAAE,CAAC,CAC5B,EACD,IAAK,CACH,CACE,+CAED,EACD,CAAC,CAACX,EAAG,OAAO,CAAC,EACb,CACE,cAED,EACD,CAAC,CAACA,EAAGmO,EAAC,CAAC,EACP,CACE,wBAED,EACD,CAAC,CAACnO,EAAG,MAAM,CAAC,EACZ,CACE,kCAED,EACD,CAAC,CAACA,EAAG,OAAO,CAAC,EACb,CACE,iCAED,EACD,CAAC,CAACA,EAAG,OAAO,CAAC,EACb,CAEE,4BACD,EACD,CAAC,CAACA,EAAG,KAAK,CAAC,EACX,CACE,wCAED,EACD,CAAC,CAACA,EAAG,OAAQ+L,EAAGoC,EAAC,CAAC,EAClB,CACE,gBAED,EACD,CAAC,CAACnO,EAAG,OAAO,CAAC,EACb,CACE,yHAED,EACD,CAAC,CAACA,EAAGmO,EAAC,CAAC,CACR,EACD,OAAQ,CACN,CAKE,iFACD,EACD,CAACxE,EAAG,CAAC0C,EAAGmB,EAAC,EAAG,CAAC1V,EAAGgJ,CAAC,CAAC,EAClB,CACE,yDACA,uBACA,eACD,EACD,CAAC6I,EAAG,CAAC0C,EAAGmB,EAAC,EAAG,CAAC1V,EAAG6K,CAAC,CAAC,EAClB,CAEE,0CAED,EACD,CAACgH,EAAG,CAAC0C,EAAGO,CAAC,EAAG,CAAC9U,EAAG6K,CAAC,CAAC,EAClB,CACE,6BAEA,oCACA,gCACD,EACD,CAACgH,EAAG,CAAC0C,EAAGO,CAAC,EAAG,CAAC9U,EAAGgJ,CAAC,CAAC,EAClB,CACE,eACD,EACD,CAAC6I,EAAG,CAAC0C,EAAGO,CAAC,CAAC,EACV,CAEE,+BACD,EACD,CAACjD,EAAG,CAAC0C,EAAGoB,EAAE,EAAG,CAAC3V,EAAG6K,CAAC,CAAC,EACnB,CAEE,6DACD,EACD,CAACgH,EAAG,CAAC0C,EAAGc,EAAE,EAAG,CAACrV,EAAGgJ,CAAC,CAAC,EACnB,CACE,kCACA,oEACD,EACD,CAAC6I,EAAG,CAAC0C,EAAGc,EAAE,EAAG,CAACrV,EAAG6K,CAAC,CAAC,EACnB,CAEE,kDAEA,yBAEA,uCAEA,iDAEA,4DAEA,uGAED,EACD,CAAC,CAACgH,EAAG,KAAM,GAAG,EAAG,CAAC0C,EAAGsB,EAAE,EAAG,CAAC7V,EAAG6K,CAAC,CAAC,EAChC,CACE,+CAEA,4CAED,EACD,CAAC,CAACgH,EAAG,KAAM,GAAG,EAAG,CAAC0C,EAAGsB,EAAE,EAAG,CAAC7V,EAAGgJ,CAAC,CAAC,EAChC,CAEE,sBACA,iEACD,EACD,CAAC6I,EAAG,CAAC0C,EAAG,MAAM,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EACvB,CAEE,yBACA,kCACD,EACD,CAACgH,EAAG,CAAC0C,EAAG,MAAM,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EACvB,CAEE,iCACD,EACD,CAACgH,EAAG,CAAC0C,EAAG,QAAQ,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EACzB,CAEE,iFACA,4BACA,oDACD,EACD,CAACgH,EAAG,CAAC0C,EAAGiB,EAAE,EAAG,CAACxV,EAAG6K,CAAC,CAAC,EACnB,CACE,mCACD,EACD,CAACgH,EAAG,CAAC0C,EAAGiB,EAAE,EAAG,CAACxV,EAAGgJ,CAAC,CAAC,EACnB,CAEE,+DACD,EACD,CAAC6I,EAAG,CAAC0C,EAAGe,EAAE,EAAG,CAACtV,EAAGgJ,CAAC,CAAC,EACnB,CACE,sDACA,oDACA,sBACD,EACD,CAAC6I,EAAG,CAAC0C,EAAGe,EAAE,EAAG,CAACtV,EAAG6K,CAAC,CAAC,EACnB,CAEE,oBACA,mEACD,EACD,CAACgH,EAAG,CAAC0C,EAAG,QAAQ,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACzB,CAEE,qCACA,wBACD,EACD,CAAC,CAAC6I,EAAG,KAAM,GAAG,EAAG,CAAC0C,EAAG,OAAO,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EACrC,CAEE,cAED,EACD,CAACgH,EAAG,CAAC0C,EAAGa,EAAC,EAAG,CAACpV,EAAGgJ,CAAC,CAAC,EAClB,CACE,2CAED,EACD,CAAC6I,EAAG,CAAC0C,EAAGa,EAAC,EAAG,CAACpV,EAAG6K,CAAC,CAAC,EAClB,CAEE,wGACD,EACD,CAACgH,EAAG,CAAC0C,EAAGqB,EAAC,EAAG,CAAC5V,EAAG6K,CAAC,CAAC,EAClB,CACE,oBACA,+BACD,EACD,CAAC,CAACgH,EAAG,eAAe,EAAG,CAAC0C,EAAGqB,EAAC,EAAG,CAAC5V,EAAGgJ,CAAC,CAAC,EACrC,CAEE,sCACA,wCACD,EACD,CAAC6I,EAAG,CAAC0C,EAAG,SAAS,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EAC1B,CAEE,eACA,uCAEA,8BAED,EACD,CAACgH,EAAG,CAAC0C,EAAGM,CAAC,EAAG,CAAC7U,EAAGgJ,CAAC,CAAC,EAClB,CACE,+CAED,EACD,CAAC,CAAC6I,EAAG,QAAS,eAAe,EAAG,CAAC0C,EAAGM,CAAC,EAAG,CAAC7U,EAAG6K,CAAC,CAAC,EAC9C,CAEE,8BAED,EACD,CAACgH,EAAG0C,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACb,CACE,gCACA,gBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAGS,CAAE,EAAG,CAAChV,EAAG6K,CAAC,CAAC,EACnB,CAEE,mFACD,EACD,CAACgH,EAAG,CAAC0C,EAAGQ,CAAE,EAAG,CAAC/U,EAAGgJ,CAAC,CAAC,EACnB,CACE,+CACD,EACD,CAAC6I,EAAG,CAAC0C,EAAGQ,CAAE,EAAG,CAAC/U,EAAG6K,CAAC,CAAC,EACnB,CAEE,YAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,KAAK,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACtB,CACE,2CAGA,oCACA,+EAED,EACD,CAACuL,EAAG,CAAC1C,EAAG,KAAM,GAAG,EAAG,CAAC7R,EAAG6K,CAAC,CAAC,EAC1B,CAEE,qCACD,EACD,CAACgH,EAAG,CAAC0C,EAAG,MAAM,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACvB,CAEE,8BACA,mBACD,EACD,CAAC6I,EAAG,CAAC0C,EAAG,OAAO,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EACxB,CAEE,gDACD,EACD,CAACgH,EAAG,CAAC0C,EAAG,SAAS,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EAC1B,CAEE,gHAEA,mBAEA,iBAEA,8BAEA,0BAEA,WAEA,uBAED,EACD,CAAC0J,EAAG1C,EAAG,CAAC7R,EAAG6K,CAAC,CAAC,EACb,CACE,2BAEA,wBAEA,uCAEA,uBAEA,4BAEA,iCAEA,kCAEA,8BAEA,gCAEA,iCAED,EACD,CAAC0J,EAAG1C,EAAG,CAAC7R,EAAGgJ,CAAC,CAAC,EACb,CACE,gBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAGgB,EAAE,EAAG,CAACvV,EAAGgJ,CAAC,CAAC,EACnB,CACE,mCAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,WAAW,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EAC5B,CACE,WAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,MAAM,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EACvB,CACE,cAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,SAAS,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EAC1B,CACE,eAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,KAAK,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACtB,CACE,wBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,MAAM,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACvB,CACE,sBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,SAAS,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EAC1B,CACE,6CAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,gBAAgB,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACjC,CACE,mBACD,EACD,CAAC6I,EAAG,CAAC0C,EAAG,UAAU,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EAC3B,CACE,YAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,KAAK,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACtB,CACE,iBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,KAAK,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EACtB,CACE,sBAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,OAAO,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EACxB,CACE,iBAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,OAAO,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACxB,CACE,sBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,MAAM,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACvB,CACE,mBACA,oCAED,EACD,CAAC,CAACuL,EAAG,cAAc,EAAG1C,EAAG,CAAC7R,EAAGgJ,CAAC,CAAC,EAC/B,CACE,oBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,UAAU,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EAC3B,CACE,4BAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,UAAU,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EAC3B,CACE,kDAED,EACD,CAAC,CAACuL,EAAG,OAAO,EAAG1C,EAAG,CAAC7R,EAAG6K,CAAC,CAAC,EACxB,CACE,yBAED,EACD,CAAC,CAAC0J,EAAG,OAAO,EAAG1C,EAAG,CAAC7R,EAAG6K,CAAC,CAAC,EACxB,CACE,YAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,WAAW,EAAG,CAACvU,EAAG6K,CAAC,CAAC,EAC5B,CACE,qCAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,SAAS,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EAC1B,CACE,sBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,WAAW,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EAC5B,CACE,gBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,OAAO,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACxB,CACE,mBAED,EACD,CAAC6I,EAAG,CAAC0C,EAAG,QAAQ,EAAG,CAACvU,EAAGgJ,CAAC,CAAC,EACzB,CACE,iBAED,EACD,CAACuL,EAAG1C,EAAG,CAAC7R,EAAG6K,CAAC,CAAC,EACb,CACE,oBAED,EACD,CAAC,CAACgH,EAAG,MAAO,GAAG,EAAG,CAAC0C,EAAGgB,EAAE,EAAG,CAACvV,EAAG6K,CAAC,CAAC,EACjC,CACE,uDAED,EACD,CAACgH,EAAG,CAAC0C,EAAGuB,CAAE,EAAG,CAAC9V,EAAGgJ,CAAC,CAAC,EACnB,CACE,uCACD,EACD,CAAC6I,EAAG,CAAC0C,EAAGuB,CAAE,EAAG,CAAC9V,EAAG6K,CAAC,CAAC,EACnB,CAIE,sBAED,EACD,CAAC0J,EAAG,CAACvU,EAAGyU,CAAC,CAAC,EACV,CACE,qBACD,EACD,CAAC,CAAC5C,EAAG,IAAK,SAAS,EAAG,CAAC0C,EAAGmB,EAAC,EAAG,CAAC1V,EAAGyU,CAAC,CAAC,EACpC,CACE,4DAED,EACD,CAAC,CAACF,EAAGe,EAAE,EAAG,CAACtV,EAAGyU,CAAC,CAAC,EAChB,CACE,cAED,EACD,CAACF,EAAG,CAAC1C,EAAGiD,EAAI,KAAK,EAAG,CAAC9U,EAAGyU,CAAC,CAAC,EAC1B,CACE,QAED,EACD,CAAC,CAAC5C,EAAGoD,EAAI,MAAM,EAAG,CAACV,EAAGa,EAAC,EAAG,CAACpV,EAAGyU,CAAC,CAAC,EAChC,CACE,2BAED,EACD,CAAC5C,EAAG,CAAC0C,EAAGM,CAAC,EAAG,CAAC7U,EAAGyU,CAAC,CAAC,EAClB,CACE,uBACA,qBAED,EACD,CAAC5C,EAAG,CAAC0C,EAAGoB,EAAE,EAAG,CAAC3V,EAAGyU,CAAC,CAAC,EACnB,CACE,0BAED,EACD,CAAC5C,EAAG,CAAC0C,EAAGqB,EAAC,EAAG,CAAC5V,EAAGyU,CAAC,CAAC,EAClB,CACE,mBAED,EACD,CAAC5C,EAAG,CAAC0C,EAAGsB,EAAE,EAAG,CAAC7V,EAAGyU,CAAC,CAAC,EACnB,CACE,2BAED,EACD,CAACF,EAAG1C,EAAG,CAAC7R,EAAGyU,CAAC,CAAC,EACb,CACE,0CAEA,2DAED,EACD,CAAC,CAACF,EAAGgC,EAAE,EAAG,CAAC1E,EAAG0E,EAAE,EAAG,CAACvW,EAAGyU,CAAC,CAAC,EACzB,CACE,iDAED,EACD,CAAC,CAACzU,EAAGyU,CAAC,CAAC,EACP,CAIE,UAEA,4BAED,EACD,CAACF,EAAG1C,EAAG,CAAC7R,EAAGwU,CAAC,CAAC,EACb,CACE,wBAED,EACD,CAAC3C,EAAG,CAAC0C,EAAG,QAAQ,EAAG,CAACvU,EAAGwU,CAAC,CAAC,EACzB,CACE,iCAED,EACD,CAAC3C,EAAG,CAAC0C,EAAGqB,EAAC,EAAG,CAAC5V,EAAGwU,CAAC,CAAC,EAClB,CACE,oCAED,EACD,CAAC3C,EAAG,CAAC0C,EAAGgB,EAAE,EAAG,CAACvV,EAAGwU,CAAC,CAAC,EACnB,CAIE,gBAED,EACD,CAACD,EAAG1C,EAAG,CAAC7R,EAAG0U,CAAC,CAAC,EACb,CACE,sCAED,EACD,CAAC7C,EAAG,CAAC0C,EAAGO,CAAC,EAAG,CAAC9U,EAAG0U,CAAC,CAAC,EAClB,CACE,sBAED,EACD,CAAC7C,EAAG,CAAC0C,EAAGa,EAAC,EAAG,CAACpV,EAAG0U,CAAC,CAAC,EAClB,CACE,2BACD,EACD,CAAC7C,EAAG,CAAC0C,EAAGuB,CAAE,EAAG,CAAC9V,EAAG0U,CAAC,CAAC,EACnB,CACE,oBAED,EACD,CAAC7C,EAAG,CAAC0C,EAAGwB,CAAE,EAAG,CAAC/V,EAAG0U,CAAC,CAAC,EACnB,CAIE,sCAED,EACD,CAACH,EAAG,CAACvU,EAAG2U,CAAE,CAAC,EACX,CACE,YAED,EACD,CAAC9C,EAAG,CAAC0C,EAAGM,CAAC,EAAG,CAAC7U,EAAG2U,CAAE,CAAC,EACnB,CAIE,gEAED,EACD,CAAC9C,EAAG,CAAC7R,EAAG6K,CAAC,CAAC,EACV,CACE,6DAED,EACD,CAACgH,EAAG,CAAC7R,EAAGgJ,CAAC,CAAC,EACV,CACE,8CAED,EACD,CAAC,CAAChJ,EAAGgJ,CAAC,CAAC,EACP,CACE,gEAED,EACD,CAAC,CAAChJ,EAAG6K,CAAC,CAAC,EACP,CACE,gCAED,EACD,CAACgH,EAAG,CAAC0C,EAAG,SAAS,CAAC,CACnB,EACD,OAAQ,CACN,CACE,4BAED,EACD,CAAC1L,EAAG,CAACE,EAAGmM,EAAK,MAAM,CAAC,EACpB,CACE,2CAED,EACD,CAACrM,EAAG,CAACE,EAAG,OAAO,CAAC,EAChB,CACE,uBAEA,sEAEA,0BAEA,yCAEA,8BAEA,aACD,EACD,CAACA,EAAGF,CAAC,EACL,CACE,+BAED,EACD,CAACA,EAAGE,CAAC,CACN,EACD,GAAI,CACF,CAEE,iCAED,EACD,CAACA,EAAGF,CAAC,EACL,CACE,uDAED,EACD,CAACE,EAAG,CAACF,EAAGiO,GAAIE,EAAE,CAAC,EACf,CACE,0BAEA,2CACA,sCACD,EACD,CAAC,CAACnO,EAAGiO,GAAIE,EAAE,EAAG,CAACjO,EAAG,SAAS,CAAC,EAC5B,CAEE,sDAEA,4CACA,sBACD,EACD,CAAC,CAACF,EAAG,KAAM,GAAG,EAAG,CAACE,EAAG,KAAK,CAAC,EAC3B,CACE,0BACA,uCAED,EACD,CAAC,CAACA,EAAGkN,EAAE,EAAG,CAACpN,EAAG,KAAM,GAAG,CAAC,EACxB,CAEE,gDAED,EACD,CAACA,EAAGE,CAAC,EACL,CAEE,+EACA,8BAEA,+BAEA,gBAED,EACD,CAACA,EAAGF,CAAC,EACL,CACE,YAED,EACD,CAACA,EAAG,CAACE,EAAGiM,CAAE,CAAC,EACX,CACE,2DAED,EACD,CAACnM,EAAG,CAACE,EAAG,SAAS,CAAC,EAClB,CACE,iFAED,EACD,CAACF,EAAG,CAACE,EAAGoM,EAAI,KAAK,CAAC,EAClB,CACE,kBACA,sCAED,EACD,CAACtM,EAAG,CAACE,EAAG,OAAO,CAAC,EAChB,CACE,sCAED,EACD,CAACF,EAAG,CAACE,EAAG,SAAS,CAAC,EAClB,CAEE,mBAED,EACD,CAACF,EAAG,CAACE,EAAGkM,EAAI,MAAM,CAAC,EACnB,CACE,kCAED,EACD,CAAC,CAAClM,EAAGiN,EAAE,EAAGnN,CAAC,EACX,CAEE,qBAEA,iBAEA,2BAGA,mDAEA,2BAGA,wCAEA,yBAEA,4BAEA,8SAEA,2BAEA,oBAEA,6EAEA,gBAED,EACD,CAACE,EAAGF,CAAC,EACL,CACE,uBAED,EACD,CAAC,CAACE,EAAG,SAAS,EAAGF,CAAC,EAClB,CACE,sCAEA,kCAEA,mEAEA,oBAED,EACD,CAACE,EAAGF,CAAC,CACb,CACA,EAAOqO,EAAI,SAAS/K,EAAG7E,EAAG,CACpB,GAAI,OAAO6E,IAAMkI,IAAO/M,EAAI6E,EAAGA,EAAI4H,GAAI,EAAE,gBAAgBmD,GACvD,OAAO,IAAIA,EAAE/K,EAAG7E,CAAC,EAAE,UAAW,EAChC,IAAIM,EAAI,OAAOkM,IAAMM,GAAKN,EAAE,UAAYA,EAAE,UAAYC,EAAGtN,EAAI0F,IAAMvE,GAAKA,EAAE,UAAYA,EAAE,UAAYqM,GAAI9Q,GAAIyE,GAAKA,EAAE,cAAgBA,EAAE,cAAgBmM,EAAG0C,GAAInP,EAAI4O,GAAGe,GAAI3P,CAAC,EAAI2P,GAAIP,EAAI9O,GAAKA,EAAE,WAAanB,EACxM,OAAO,KAAK,WAAa,UAAW,CAClC,IAAIyF,EAAI,CAAE,EACV,OAAOA,EAAEnD,CAAC,EAAIgL,EAAG7H,EAAErD,CAAC,EAAIkL,EAAGyC,GAAE,KAAKtK,EAAGzF,EAAGgQ,GAAE,OAAO,EAAGvK,EAAEoI,CAAE,EAAIgC,GAAGpK,EAAErD,CAAC,CAAC,EAAG6N,GAAK9O,GAAKA,EAAE,OAAS,OAAOA,EAAE,MAAM,SAAWuM,IAAMjI,EAAEnD,CAAC,EAAI,SAAUmD,CACpJ,EAAS,KAAK,OAAS,UAAW,CAC1B,IAAIA,EAAI,CAAE,EACV,OAAOA,EAAEhE,CAAC,EAAI6L,EAAGyC,GAAE,KAAKtK,EAAGzF,EAAGgQ,GAAE,GAAG,EAAGvK,CAC9C,EAAS,KAAK,UAAY,UAAW,CAC7B,IAAIA,EAAI,CAAE,EACV,OAAOA,EAAEqI,CAAC,EAAIR,EAAG7H,EAAE2F,CAAC,EAAIkC,EAAG7H,EAAElM,CAAC,EAAI+T,EAAGyC,GAAE,KAAKtK,EAAGzF,EAAGgQ,GAAE,MAAM,EAAGC,GAAK,CAACxK,EAAElM,CAAC,GAAKmD,IAAKA,GAAE,SAAW+I,EAAElM,CAAC,EAAI6K,GAAI6L,GAAKxK,EAAE2F,CAAC,GAAK,aAAejK,GAAK,OAAOA,EAAE,aAAewM,GAAKxM,EAAE,gBAAkBA,EAAE,eAAiB,IAAMsE,EAAE2F,CAAC,EAAI,OAAQ3F,EAAElM,CAAC,EAAIgJ,GAAIkD,CACrP,EAAS,KAAK,UAAY,UAAW,CAC7B,IAAIA,EAAI,CAAE,EACV,OAAOA,EAAEnD,CAAC,EAAIgL,EAAG7H,EAAErD,CAAC,EAAIkL,EAAGyC,GAAE,KAAKtK,EAAGzF,EAAGgQ,GAAE,MAAM,EAAGvK,CAC3D,EAAS,KAAK,MAAQ,UAAW,CACzB,IAAIA,EAAI,CAAE,EACV,OAAOA,EAAEnD,CAAC,EAAIgL,EAAG7H,EAAErD,CAAC,EAAIkL,EAAGyC,GAAE,KAAKtK,EAAGzF,EAAGgQ,GAAE,EAAE,EAAGC,GAAK,CAACxK,EAAEnD,CAAC,GAAK5F,IAAKA,GAAE,UAAY,YAAc+I,EAAEnD,CAAC,EAAI5F,GAAE,SAAS,QAAQ,aAAc6S,EAAE,EAAE,QAAQ,SAAUC,EAAE,GAAI/J,CAC1K,EAAS,KAAK,UAAY,UAAW,CAC7B,MAAO,CACL,GAAI,KAAK,MAAO,EAChB,QAAS,KAAK,WAAY,EAC1B,OAAQ,KAAK,UAAW,EACxB,GAAI,KAAK,MAAO,EAChB,OAAQ,KAAK,UAAW,EACxB,IAAK,KAAK,OAAM,CACjB,CACT,EAAS,KAAK,MAAQ,UAAW,CACzB,OAAOzF,CACf,EAAS,KAAK,MAAQ,SAASyF,EAAG,CAC1B,OAAOzF,EAAI,OAAOyF,IAAMjL,GAAKiL,EAAE,OAAS0I,EAAK2B,GAAGrK,EAAG0I,CAAE,EAAI1I,EAAG,IAC7D,EAAE,KAAK,MAAMzF,CAAC,EAAG,IACnB,EACDyQ,EAAE,QAAUlD,EAAGkD,EAAE,QAAUf,GAAE,CAACpN,EAAGF,EAAGyL,CAAE,CAAC,EAAG4C,EAAE,IAAMf,GAAE,CAACjO,CAAC,CAAC,EAAGgP,EAAE,OAASf,GAAE,CAACtE,EAAG0C,EAAGvU,EAAGwU,EAAG3J,EAAG4J,EAAGzL,EAAG0L,EAAGC,CAAE,CAAC,EAAGuC,EAAE,OAASA,EAAE,GAAKf,GAAE,CAACpN,EAAGF,CAAC,CAAC,EAAG8K,EAAE,UAAYE,EAAIF,EAAE,QAAUuD,GAAIrD,EAAE,SAAWqD,EAClL,IAAIC,GAAI,OAAOrD,IAAMM,IAAMN,EAAE,QAAUA,EAAE,OACzC,GAAIqD,IAAK,CAACA,GAAE,GAAI,CACd,IAAIC,GAAI,IAAIF,EACZC,GAAE,GAAKC,GAAE,UAAW,EAAED,GAAE,GAAG,IAAM,UAAW,CAC1C,OAAOC,GAAE,MAAO,CACjB,EAAED,GAAE,GAAG,IAAM,SAAShL,EAAG,CACxBiL,GAAE,MAAMjL,CAAC,EACT,IAAI7E,EAAI8P,GAAE,UAAW,EACrB,QAASxP,KAAKN,EACZ6P,GAAE,GAAGvP,CAAC,EAAIN,EAAEM,CAAC,CAChB,CACP,CACG,GAAE,OAAO,QAAU,SAAW,OAAS6L,EAAE,CAC5C,GAAGG,GAAIA,GAAG,OAAO,EACjB,IAAIyD,GAAKzD,GAAG,QACP,MAAC0D,GAAqB5D,GAAG2D,EAAE,EAAGE,GAAI,CACrC,QAAS,UACT,QAAS,OACT,SAAU,WACV,OAAQ,SACR,SAAU,UACV,OAAQ,SACR,SAAU,UACZ,EAAGxF,GAAI,CACL,QAAS,UACT,IAAK,MACL,MAAO,QACP,OAAQ,SACR,cAAe,gBACf,QAAS,SACX,EAAGvP,EAAI,CACL,OAAQ,SACR,SAAU,WAEV,KAAM,OACN,QAAS,UACT,GAAI,KACJ,kBAAmB,oBACnB,KAAM,eACN,cAAe,gBACf,MAAO,QACP,OAAQ,SACR,gBAAiB,kBACjB,OAAQ,QACV,EAAGgV,GAAI,IAAIF,GAAMnY,EAAIqY,GAAE,UAAW,EAAEvU,GAAIuU,GAAE,MAAK,EAAIvP,EAAIuP,GAAE,WAAY,EAAOA,GAAE,UAAW,QAAEC,GAAID,GAAE,MAAO,EAAEE,GAAI,IAAM,OAAO,KAAKD,EAAC,EAAGE,GAAK,IAAM1U,GAAE,OAAS8O,GAAE,SAAW9O,GAAE,UAAY,MAAQwU,GAAE,QAAQ,MAAM,IAAM,GAASxU,GAAE,KAAS8O,GAAE,QAAc9J,EAAE,KAASzF,EAAE,OAAayF,EAAE,KAASzF,EAAE,SAAerD,EAAE,KAASoY,GAAE,QAAcpY,EAAE,KAASoY,GAAE,QAActP,EAAE,OAASzF,EAAE,MAAQmV,GAAI,EAAOA,GAAE,EAAS1P,EAAE,KAASzF,EAAE,KAAW,WAAW,KAAKiV,GAAE,YAAW,CAAE,EAAQtY,EAAE,KAASoY,GAAE,SAAetP,EAAE,KAASzF,EAAE,QAAcyF,EAAE,OAASzF,EAAE,oBAAqByF,EAAE,KAASzF,EAAE,IAASS,GAAE,OAAS8O,GAAE,KAAO2F,KAAgEzU,GAAE,KAAS8O,GAAE,MAAY9O,GAAE,KAAS8O,GAAE,OAAa9J,EAAE,KAASzF,EAAE,KAAWrD,EAAE,OAASoY,GAAE,QAAUpY,EAAE,OAASoY,GAAE,QAAUG,KAAUvY,EAAE,KAASoY,GAAE,OAAatP,EAAE,OAASzF,EAAE,eAAiBkV,GAAC,EAASzP,EAAE,KAASzF,EAAE,MAAYyF,EAAE,OAASzF,EAAE,SAAUyF,EAAE,KAASzF,EAAE,eAAoByF,EAAE,KAASzF,EAAE,gBAAsBrD,EAAE,KAASoY,GAAE,SAAepY,EAAE,OAASoY,GAAE,QAAUG,GAAC,EAASvY,EAAE,KAASoY,GAAE,SAAetU,GAAE,KAAS8O,GAAE,QAAc9O,GAAE,KAAS8O,GAAE,cAAoB9J,EAAE,KAASzF,EAAE,OAAO,MAA0CoV,GAAK,IAAMzY,EAAE,MAAO0Y,GAAK,IAAM1Y,EAAE,MAAQ,UAAW2Y,GAAK,IAAM3Y,EAAE,8dCrjC7tC,MAAM6S,EAASC,GAAc,EAEvB8F,EAAgB5F,GAAG,EACnB6F,EAAe7F,GAAG,EAElBE,EAASC,GAAS,CACtB,KAAM,GACN,KAAM,OAAO,WAAW,WACxB,OAAQ,GACR,KAAM,GACN,SAAU,GACV,aAAc,GACd,IAAK,EACP,CAAC,EAEDE,GAAU,SAAY,CACpBH,EAAO,KAAO,OAAO,SAAS,IAChC,CAAC,EAEDO,GAAU,IAAM,CACTP,EAAO,QAAQ4F,EAAiB,EAEjC5F,EAAO,SAAW,cAAgBA,EAAO,WAAUA,EAAO,SAAW,GAC3E,CAAC,EAED,eAAe4F,EAAkBC,EAAU,GAAM,CAC/C,MAAMC,EAAS,MAAMnG,EAAO,wBAAuB,EAInD,OAFAK,EAAO,OAAS8F,EAEZA,IAAW,YAAcA,IAAW,gBAClCD,GAASE,EAAa,EACnB,IAGJpG,EAAO,OAKM,MAAMA,EAAO,gBAAgBA,EAAO,IAAK,CAAA,EAE5CK,EAAO,IAAML,EAAO,IAAG,GAEpCA,EAAO,gBAAe,EACtBK,EAAO,OAAS,WACZ6F,GAASE,EAAa,GAGrB,KAbL/F,EAAO,OAAS,eACT,GAaX,CAEA,SAAS+F,GAAgB,CACvB,IAAIC,EAAa,GAAGC,GAAY,EAAKA,GAAc,EAAG,SAAS,IAAIA,GAAc,EAAGC,GAAa,EAAGC,GAAU,CAAE,GAEhHxG,EAAO,0BAA0BqG,EAAYG,GAAY,CAAA,EAAE,KAAMvZ,GAAS,CACpEA,EAAK,OAAOoT,EAAO,OAASpT,EAAK,KAAOwZ,EAAQ,EACrD,CAAA,CACH,CAEA,SAASA,GAAW,CAClBpG,EAAO,KAAO,WAEdL,EAAO,eAAgB0G,GAAiB,CACtCrG,EAAO,KAAO,GACdA,EAAO,aAAeqG,EAEtBX,EAAc,MAAM,aAAa,EAAI,EACrCC,EAAa,MAAM,MAAK,CACzB,CAAA,CACH,CAEA,eAAeW,GAAa,CAC1B,MAAMC,EAAeC,GAAWxG,EAAO,SAAUA,EAAO,YAAY,EAElD,MAAML,EAAO,gBAAgB4G,CAAY,IAGzD5G,EAAO,aAAa4G,CAAY,EAChCvG,EAAO,IAAMuG,EACbb,EAAc,MAAM,aAAa,EAAK,EACtC1F,EAAO,OAAS,aAEpB,CAEA,SAASyG,GAAsB,CAC7BzF,GAAM,KAAKC,GAAQ,EAAG,sBAAuByF,GAAS,CAAE,KAAM/G,EAAO,KAAI,CAAI,CAAA,CAAC,EAAE,KAAM/S,GAAS,CACzFA,EAAK,MAAMgZ,EAAkB,EAAK,CACvC,CAAA,CACH","x_google_ignoreList":[0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,36]} \ No newline at end of file diff --git a/public/assets/DevicesView-DqasecOn.js b/public/assets/DevicesView-DqasecOn.js new file mode 100644 index 0000000..15fe568 --- /dev/null +++ b/public/assets/DevicesView-DqasecOn.js @@ -0,0 +1,1758 @@ +import { a as createVueComponent, _ as _export_sfc, c as createElementBlock, o as openBlock, s as createBlock, p as createCommentVNode, v as renderSlot, u as unref, q as normalizeClass, z as useDeviceStore, m as ref, r as reactive, b as onMounted, h as createVNode, f as createBaseVNode, w as withCtx, t as toDisplayString, i as createTextVNode, B as IconDevices, F as Fragment, g as renderList, d as axios, e as appUrl, n as onUpdated, j as withModifiers, x as withDirectives, y as vModelText, A as AuthCall, C as decryptAES, k as isLocal } from "./index-GNAKlyBz.js"; +import { _ as _sfc_main$4, a as _sfc_main$5 } from "./DialogComp-Ba5-BUTe.js"; +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconAlertTriangle = createVueComponent("outline", "alert-triangle", "IconAlertTriangle", [["path", { "d": "M12 9v4", "key": "svg-0" }], ["path", { "d": "M10.363 3.591l-8.106 13.534a1.914 1.914 0 0 0 1.636 2.871h16.214a1.914 1.914 0 0 0 1.636 -2.87l-8.106 -13.536a1.914 1.914 0 0 0 -3.274 0z", "key": "svg-1" }], ["path", { "d": "M12 16h.01", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconCheck = createVueComponent("outline", "check", "IconCheck", [["path", { "d": "M5 12l5 5l10 -10", "key": "svg-0" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconDeviceDesktop = createVueComponent("outline", "device-desktop", "IconDeviceDesktop", [["path", { "d": "M3 5a1 1 0 0 1 1 -1h16a1 1 0 0 1 1 1v10a1 1 0 0 1 -1 1h-16a1 1 0 0 1 -1 -1v-10z", "key": "svg-0" }], ["path", { "d": "M7 20h10", "key": "svg-1" }], ["path", { "d": "M9 16v4", "key": "svg-2" }], ["path", { "d": "M15 16v4", "key": "svg-3" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconDeviceMobile = createVueComponent("outline", "device-mobile", "IconDeviceMobile", [["path", { "d": "M6 5a2 2 0 0 1 2 -2h8a2 2 0 0 1 2 2v14a2 2 0 0 1 -2 2h-8a2 2 0 0 1 -2 -2v-14z", "key": "svg-0" }], ["path", { "d": "M11 4h2", "key": "svg-1" }], ["path", { "d": "M12 17v.01", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconDeviceTablet = createVueComponent("outline", "device-tablet", "IconDeviceTablet", [["path", { "d": "M5 4a1 1 0 0 1 1 -1h12a1 1 0 0 1 1 1v16a1 1 0 0 1 -1 1h-12a1 1 0 0 1 -1 -1v-16z", "key": "svg-0" }], ["path", { "d": "M11 17a1 1 0 1 0 2 0a1 1 0 0 0 -2 0", "key": "svg-1" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconDeviceUnknown = createVueComponent("outline", "device-unknown", "IconDeviceUnknown", [["path", { "d": "M5 5a2 2 0 0 1 2 -2h10a2 2 0 0 1 2 2v14a2 2 0 0 1 -2 2h-10a2 2 0 0 1 -2 -2z", "key": "svg-0" }], ["path", { "d": "M12 16v.01", "key": "svg-1" }], ["path", { "d": "M12 13a2 2 0 0 0 .914 -3.782a1.98 1.98 0 0 0 -2.414 .483", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconExclamationCircle = createVueComponent("outline", "exclamation-circle", "IconExclamationCircle", [["path", { "d": "M12 12m-9 0a9 9 0 1 0 18 0a9 9 0 1 0 -18 0", "key": "svg-0" }], ["path", { "d": "M12 9v4", "key": "svg-1" }], ["path", { "d": "M12 16v.01", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconInfoCircle = createVueComponent("outline", "info-circle", "IconInfoCircle", [["path", { "d": "M3 12a9 9 0 1 0 18 0a9 9 0 0 0 -18 0", "key": "svg-0" }], ["path", { "d": "M12 9h.01", "key": "svg-1" }], ["path", { "d": "M11 12h1v4h1", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconKey = createVueComponent("outline", "key", "IconKey", [["path", { "d": "M16.555 3.843l3.602 3.602a2.877 2.877 0 0 1 0 4.069l-2.643 2.643a2.877 2.877 0 0 1 -4.069 0l-.301 -.301l-6.558 6.558a2 2 0 0 1 -1.239 .578l-.175 .008h-1.172a1 1 0 0 1 -.993 -.883l-.007 -.117v-1.172a2 2 0 0 1 .467 -1.284l.119 -.13l.414 -.414h2v-2h2v-2l2.144 -2.144l-.301 -.301a2.877 2.877 0 0 1 0 -4.069l2.643 -2.643a2.877 2.877 0 0 1 4.069 0z", "key": "svg-0" }], ["path", { "d": "M15 9h.01", "key": "svg-1" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconLinkOff = createVueComponent("outline", "link-off", "IconLinkOff", [["path", { "d": "M9 15l3 -3m2 -2l1 -1", "key": "svg-0" }], ["path", { "d": "M11 6l.463 -.536a5 5 0 0 1 7.071 7.072l-.534 .464", "key": "svg-1" }], ["path", { "d": "M3 3l18 18", "key": "svg-2" }], ["path", { "d": "M13 18l-.397 .534a5.068 5.068 0 0 1 -7.127 0a4.972 4.972 0 0 1 0 -7.071l.524 -.463", "key": "svg-3" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconLink = createVueComponent("outline", "link", "IconLink", [["path", { "d": "M9 15l6 -6", "key": "svg-0" }], ["path", { "d": "M11 6l.463 -.536a5 5 0 0 1 7.071 7.072l-.534 .464", "key": "svg-1" }], ["path", { "d": "M13 18l-.397 .534a5.068 5.068 0 0 1 -7.127 0a4.972 4.972 0 0 1 0 -7.071l.524 -.463", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconPlugConnectedX = createVueComponent("outline", "plug-connected-x", "IconPlugConnectedX", [["path", { "d": "M20 16l-4 4", "key": "svg-0" }], ["path", { "d": "M7 12l5 5l-1.5 1.5a3.536 3.536 0 1 1 -5 -5l1.5 -1.5z", "key": "svg-1" }], ["path", { "d": "M17 12l-5 -5l1.5 -1.5a3.536 3.536 0 1 1 5 5l-1.5 1.5z", "key": "svg-2" }], ["path", { "d": "M3 21l2.5 -2.5", "key": "svg-3" }], ["path", { "d": "M18.5 5.5l2.5 -2.5", "key": "svg-4" }], ["path", { "d": "M10 11l-2 2", "key": "svg-5" }], ["path", { "d": "M13 14l-2 2", "key": "svg-6" }], ["path", { "d": "M16 16l4 4", "key": "svg-7" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconReload = createVueComponent("outline", "reload", "IconReload", [["path", { "d": "M19.933 13.041a8 8 0 1 1 -9.925 -8.788c3.899 -1 7.935 1.007 9.425 4.747", "key": "svg-0" }], ["path", { "d": "M20 4v5h-5", "key": "svg-1" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconServer = createVueComponent("outline", "server", "IconServer", [["path", { "d": "M3 4m0 3a3 3 0 0 1 3 -3h12a3 3 0 0 1 3 3v2a3 3 0 0 1 -3 3h-12a3 3 0 0 1 -3 -3z", "key": "svg-0" }], ["path", { "d": "M3 12m0 3a3 3 0 0 1 3 -3h12a3 3 0 0 1 3 3v2a3 3 0 0 1 -3 3h-12a3 3 0 0 1 -3 -3z", "key": "svg-1" }], ["path", { "d": "M7 8l0 .01", "key": "svg-2" }], ["path", { "d": "M7 16l0 .01", "key": "svg-3" }]]); +const _sfc_main$3 = { + __name: "AlertComp", + props: { + type: String + // info, success, warning, error + }, + setup(__props) { + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", { + class: normalizeClass(`alert alert__${__props.type}`) + }, [ + __props.type === "info" ? (openBlock(), createBlock(unref(IconInfoCircle), { key: 0 })) : createCommentVNode("", true), + __props.type === "success" ? (openBlock(), createBlock(unref(IconCheck), { key: 1 })) : createCommentVNode("", true), + __props.type === "warning" ? (openBlock(), createBlock(unref(IconExclamationCircle), { key: 2 })) : createCommentVNode("", true), + __props.type === "error" ? (openBlock(), createBlock(unref(IconAlertTriangle), { key: 3 })) : createCommentVNode("", true), + renderSlot(_ctx.$slots, "default", {}, void 0, true) + ], 2); + }; + } +}; +const AlertComp = /* @__PURE__ */ _export_sfc(_sfc_main$3, [["__scopeId", "data-v-87f6de25"]]); +const _hoisted_1$2 = { class: "device-overview" }; +const _hoisted_2$2 = { class: "grid" }; +const _hoisted_3$2 = { class: "mcrm-block block__light flex flex-wrap items-start gap-4" }; +const _hoisted_4$2 = { class: "w-full flex gap-4 items-center justify-between mb-4" }; +const _hoisted_5$1 = { class: "flex gap-4" }; +const _hoisted_6$1 = { class: "grid gap-2" }; +const _hoisted_7$1 = { class: "grid grid-cols-[auto_1fr] gap-2" }; +const _hoisted_8$1 = { class: "w-full truncate" }; +const _hoisted_9 = { + key: 1, + class: "grid w-full gap-4" +}; +const _hoisted_10 = { class: "grid gap-4" }; +const _hoisted_11 = { class: "text-4xl font-mono tracking-wide" }; +const _sfc_main$2 = { + __name: "ServerView", + setup(__props) { + const device = useDeviceStore(); + const pinDialog = ref(); + const remote = reactive({ devices: [], pinlink: false }); + onMounted(() => { + device.serverGetRemotes(); + device.$subscribe((mutation, state) => { + if (Object.keys(state.remote).length) remote.devices = device.remote; + }); + }); + async function startLink(deviceUuid) { + const pin = await device.serverStartLink(deviceUuid); + remote.pinlink = { uuid: deviceUuid, pin }; + pinDialog.value.toggleDialog(true); + pollLink(); + setTimeout(() => { + resetPinLink(); + }, 6e4); + } + function pollLink() { + const pollInterval = setInterval(() => { + axios.post(appUrl() + "/device/link/poll", { uuid: remote.pinlink.uuid }).then((data) => { + if (!data.data) { + clearInterval(pollInterval); + resetPinLink(); + device.serverGetRemotes(); + } + }); + }, 1e3); + } + function resetPinLink() { + remote.pinlink = false; + if (pinDialog.value) pinDialog.value.toggleDialog(false); + } + function unlinkDevice(id) { + axios.post(appUrl() + "/device/link/remove", { uuid: id }).then((data) => { + if (data.data) device.serverGetRemotes(); + }); + } + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$2, [ + createVNode(AlertComp, { type: "info" }, { + default: withCtx(() => [ + createBaseVNode("div", _hoisted_2$2, [ + _cache[1] || (_cache[1] = createBaseVNode("strong", null, "This is a server!", -1)), + createBaseVNode("em", null, "UUID: " + toDisplayString(unref(device).uuid()), 1) + ]) + ]), + _: 1 + }), + createBaseVNode("div", _hoisted_3$2, [ + createBaseVNode("h4", _hoisted_4$2, [ + createBaseVNode("span", _hoisted_5$1, [ + createVNode(unref(IconDevices)), + _cache[2] || (_cache[2] = createTextVNode("Remote devices ")) + ]), + createVNode(_sfc_main$4, { + variant: "primary", + onClick: _cache[0] || (_cache[0] = ($event) => unref(device).serverGetRemotes()) + }, { + default: withCtx(() => [ + createVNode(unref(IconReload)) + ]), + _: 1 + }) + ]), + Object.keys(remote.devices).length > 0 ? (openBlock(true), createElementBlock(Fragment, { key: 0 }, renderList(remote.devices, (remoteDevice, id) => { + return openBlock(), createElementBlock("div", { + class: "mcrm-block block__dark block-size__sm w-64 grid !gap-4 content-start", + key: id + }, [ + createBaseVNode("div", _hoisted_6$1, [ + createBaseVNode("h5", _hoisted_7$1, [ + remoteDevice.settings.type == "unknown" ? (openBlock(), createBlock(unref(IconDeviceUnknown), { key: 0 })) : createCommentVNode("", true), + remoteDevice.settings.type == "mobile" ? (openBlock(), createBlock(unref(IconDeviceMobile), { key: 1 })) : createCommentVNode("", true), + remoteDevice.settings.type == "tablet" ? (openBlock(), createBlock(unref(IconDeviceTablet), { key: 2 })) : createCommentVNode("", true), + remoteDevice.settings.type == "desktop" ? (openBlock(), createBlock(unref(IconDeviceDesktop), { key: 3 })) : createCommentVNode("", true), + createBaseVNode("span", _hoisted_8$1, toDisplayString(remoteDevice.settings.name), 1) + ]), + createBaseVNode("em", null, toDisplayString(id), 1) + ]), + remoteDevice.key ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [ + createVNode(AlertComp, { type: "success" }, { + default: withCtx(() => _cache[3] || (_cache[3] = [ + createTextVNode("Authorized") + ])), + _: 1 + }), + createVNode(_sfc_main$4, { + variant: "danger", + onClick: ($event) => unlinkDevice(id) + }, { + default: withCtx(() => [ + createVNode(unref(IconLinkOff)), + _cache[4] || (_cache[4] = createTextVNode("Unlink device ")) + ]), + _: 2 + }, 1032, ["onClick"]) + ], 64)) : (openBlock(), createElementBlock(Fragment, { key: 1 }, [ + createVNode(AlertComp, { type: "warning" }, { + default: withCtx(() => _cache[5] || (_cache[5] = [ + createTextVNode("Unauthorized") + ])), + _: 1 + }), + createVNode(_sfc_main$4, { + variant: "primary", + onClick: ($event) => startLink(id) + }, { + default: withCtx(() => [ + createVNode(unref(IconLink)), + _cache[6] || (_cache[6] = createTextVNode("Link device ")) + ]), + _: 2 + }, 1032, ["onClick"]) + ], 64)), + remote.pinlink.uuid == id ? (openBlock(), createBlock(AlertComp, { + key: 2, + type: "info" + }, { + default: withCtx(() => [ + createTextVNode("One time pin: " + toDisplayString(remote.pinlink.pin), 1) + ]), + _: 1 + })) : createCommentVNode("", true) + ]); + }), 128)) : (openBlock(), createElementBlock("div", _hoisted_9, _cache[7] || (_cache[7] = [ + createBaseVNode("em", { class: "text-slate-300" }, "No remote devices", -1) + ]))), + createVNode(_sfc_main$5, { + ref_key: "pinDialog", + ref: pinDialog + }, { + content: withCtx(() => [ + createBaseVNode("div", _hoisted_10, [ + _cache[8] || (_cache[8] = createBaseVNode("h3", null, "Pin code", -1)), + createBaseVNode("span", _hoisted_11, toDisplayString(remote.pinlink.pin), 1) + ]) + ]), + _: 1 + }, 512) + ]) + ]); + }; + } +}; +const ServerView = /* @__PURE__ */ _export_sfc(_sfc_main$2, [["__scopeId", "data-v-f4165abd"]]); +var Ni = typeof globalThis < "u" ? globalThis : typeof window < "u" ? window : typeof global < "u" ? global : typeof self < "u" ? self : {}; +function Ci(E) { + return E && E.__esModule && Object.prototype.hasOwnProperty.call(E, "default") ? E.default : E; +} +var wi = { exports: {} }; +(function(E, q) { + (function(A, m) { + var F = "1.0.37", M = "", I = "?", R = "function", V = "undefined", ii = "object", j = "string", li = "major", e = "model", a = "name", i = "type", o = "vendor", t = "version", v = "architecture", B = "console", n = "mobile", b = "tablet", h = "smarttv", N = "wearable", ei = "embedded", oi = 500, G = "Amazon", D = "Apple", di = "ASUS", mi = "BlackBerry", T = "Browser", H = "Chrome", yi = "Edge", X = "Firefox", Y = "Google", ui = "Huawei", ai = "LG", ti = "Microsoft", pi = "Motorola", K = "Opera", Z = "Samsung", hi = "Sharp", J = "Sony", ri = "Xiaomi", si = "Zebra", fi = "Facebook", vi = "Chromium OS", gi = "Mac OS", Ti = function(c, l) { + var s = {}; + for (var d in c) + l[d] && l[d].length % 2 === 0 ? s[d] = l[d].concat(c[d]) : s[d] = c[d]; + return s; + }, Q = function(c) { + for (var l = {}, s = 0; s < c.length; s++) + l[c[s].toUpperCase()] = c[s]; + return l; + }, Ei = function(c, l) { + return typeof c === j ? U(l).indexOf(U(c)) !== -1 : false; + }, U = function(c) { + return c.toLowerCase(); + }, _i = function(c) { + return typeof c === j ? c.replace(/[^\d\.]/g, M).split(".")[0] : m; + }, ni = function(c, l) { + if (typeof c === j) + return c = c.replace(/^\s\s*/, M), typeof l === V ? c : c.substring(0, oi); + }, L = function(c, l) { + for (var s = 0, d, y, O, w, r, k; s < l.length && !r; ) { + var ci = l[s], xi = l[s + 1]; + for (d = y = 0; d < ci.length && !r && ci[d]; ) + if (r = ci[d++].exec(c), r) + for (O = 0; O < xi.length; O++) + k = r[++y], w = xi[O], typeof w === ii && w.length > 0 ? w.length === 2 ? typeof w[1] == R ? this[w[0]] = w[1].call(this, k) : this[w[0]] = w[1] : w.length === 3 ? typeof w[1] === R && !(w[1].exec && w[1].test) ? this[w[0]] = k ? w[1].call(this, k, w[2]) : m : this[w[0]] = k ? k.replace(w[1], w[2]) : m : w.length === 4 && (this[w[0]] = k ? w[3].call(this, k.replace(w[1], w[2])) : m) : this[w] = k || m; + s += 2; + } + }, bi = function(c, l) { + for (var s in l) + if (typeof l[s] === ii && l[s].length > 0) { + for (var d = 0; d < l[s].length; d++) + if (Ei(l[s][d], c)) + return s === I ? m : s; + } else if (Ei(l[s], c)) + return s === I ? m : s; + return c; + }, Mi = { + "1.0": "/8", + "1.2": "/1", + "1.3": "/3", + "2.0": "/412", + "2.0.2": "/416", + "2.0.3": "/417", + "2.0.4": "/419", + "?": "/" + }, Oi = { + ME: "4.90", + "NT 3.11": "NT3.51", + "NT 4.0": "NT4.0", + 2e3: "NT 5.0", + XP: ["NT 5.1", "NT 5.2"], + Vista: "NT 6.0", + 7: "NT 6.1", + 8: "NT 6.2", + "8.1": "NT 6.3", + 10: ["NT 6.4", "NT 10.0"], + RT: "ARM" + }, ki = { + browser: [ + [ + /\b(?:crmo|crios)\/([\w\.]+)/i + // Chrome for Android/iOS + ], + [t, [a, "Chrome"]], + [ + /edg(?:e|ios|a)?\/([\w\.]+)/i + // Microsoft Edge + ], + [t, [a, "Edge"]], + [ + // Presto based + /(opera mini)\/([-\w\.]+)/i, + // Opera Mini + /(opera [mobiletab]{3,6})\b.+version\/([-\w\.]+)/i, + // Opera Mobi/Tablet + /(opera)(?:.+version\/|[\/ ]+)([\w\.]+)/i + // Opera + ], + [a, t], + [ + /opios[\/ ]+([\w\.]+)/i + // Opera mini on iphone >= 8.0 + ], + [t, [a, K + " Mini"]], + [ + /\bopr\/([\w\.]+)/i + // Opera Webkit + ], + [t, [a, K]], + [ + // Mixed + /\bb[ai]*d(?:uhd|[ub]*[aekoprswx]{5,6})[\/ ]?([\w\.]+)/i + // Baidu + ], + [t, [a, "Baidu"]], + [ + /(kindle)\/([\w\.]+)/i, + // Kindle + /(lunascape|maxthon|netfront|jasmine|blazer)[\/ ]?([\w\.]*)/i, + // Lunascape/Maxthon/Netfront/Jasmine/Blazer + // Trident based + /(avant|iemobile|slim)\s?(?:browser)?[\/ ]?([\w\.]*)/i, + // Avant/IEMobile/SlimBrowser + /(?:ms|\()(ie) ([\w\.]+)/i, + // Internet Explorer + // Webkit/KHTML based // Flock/RockMelt/Midori/Epiphany/Silk/Skyfire/Bolt/Iron/Iridium/PhantomJS/Bowser/QupZilla/Falkon + /(flock|rockmelt|midori|epiphany|silk|skyfire|bolt|iron|vivaldi|iridium|phantomjs|bowser|quark|qupzilla|falkon|rekonq|puffin|brave|whale(?!.+naver)|qqbrowserlite|qq|duckduckgo)\/([-\w\.]+)/i, + // Rekonq/Puffin/Brave/Whale/QQBrowserLite/QQ, aka ShouQ + /(heytap|ovi)browser\/([\d\.]+)/i, + // Heytap/Ovi + /(weibo)__([\d\.]+)/i + // Weibo + ], + [a, t], + [ + /(?:\buc? ?browser|(?:juc.+)ucweb)[\/ ]?([\w\.]+)/i + // UCBrowser + ], + [t, [a, "UC" + T]], + [ + /microm.+\bqbcore\/([\w\.]+)/i, + // WeChat Desktop for Windows Built-in Browser + /\bqbcore\/([\w\.]+).+microm/i, + /micromessenger\/([\w\.]+)/i + // WeChat + ], + [t, [a, "WeChat"]], + [ + /konqueror\/([\w\.]+)/i + // Konqueror + ], + [t, [a, "Konqueror"]], + [ + /trident.+rv[: ]([\w\.]{1,9})\b.+like gecko/i + // IE11 + ], + [t, [a, "IE"]], + [ + /ya(?:search)?browser\/([\w\.]+)/i + // Yandex + ], + [t, [a, "Yandex"]], + [ + /slbrowser\/([\w\.]+)/i + // Smart Lenovo Browser + ], + [t, [a, "Smart Lenovo " + T]], + [ + /(avast|avg)\/([\w\.]+)/i + // Avast/AVG Secure Browser + ], + [[a, /(.+)/, "$1 Secure " + T], t], + [ + /\bfocus\/([\w\.]+)/i + // Firefox Focus + ], + [t, [a, X + " Focus"]], + [ + /\bopt\/([\w\.]+)/i + // Opera Touch + ], + [t, [a, K + " Touch"]], + [ + /coc_coc\w+\/([\w\.]+)/i + // Coc Coc Browser + ], + [t, [a, "Coc Coc"]], + [ + /dolfin\/([\w\.]+)/i + // Dolphin + ], + [t, [a, "Dolphin"]], + [ + /coast\/([\w\.]+)/i + // Opera Coast + ], + [t, [a, K + " Coast"]], + [ + /miuibrowser\/([\w\.]+)/i + // MIUI Browser + ], + [t, [a, "MIUI " + T]], + [ + /fxios\/([-\w\.]+)/i + // Firefox for iOS + ], + [t, [a, X]], + [ + /\bqihu|(qi?ho?o?|360)browser/i + // 360 + ], + [[a, "360 " + T]], + [ + /(oculus|sailfish|huawei|vivo)browser\/([\w\.]+)/i + ], + [[a, /(.+)/, "$1 " + T], t], + [ + // Oculus/Sailfish/HuaweiBrowser/VivoBrowser + /samsungbrowser\/([\w\.]+)/i + // Samsung Internet + ], + [t, [a, Z + " Internet"]], + [ + /(comodo_dragon)\/([\w\.]+)/i + // Comodo Dragon + ], + [[a, /_/g, " "], t], + [ + /metasr[\/ ]?([\d\.]+)/i + // Sogou Explorer + ], + [t, [a, "Sogou Explorer"]], + [ + /(sogou)mo\w+\/([\d\.]+)/i + // Sogou Mobile + ], + [[a, "Sogou Mobile"], t], + [ + /(electron)\/([\w\.]+) safari/i, + // Electron-based App + /(tesla)(?: qtcarbrowser|\/(20\d\d\.[-\w\.]+))/i, + // Tesla + /m?(qqbrowser|2345Explorer)[\/ ]?([\w\.]+)/i + // QQBrowser/2345 Browser + ], + [a, t], + [ + /(lbbrowser)/i, + // LieBao Browser + /\[(linkedin)app\]/i + // LinkedIn App for iOS & Android + ], + [a], + [ + // WebView + /((?:fban\/fbios|fb_iab\/fb4a)(?!.+fbav)|;fbav\/([\w\.]+);)/i + // Facebook App for iOS & Android + ], + [[a, fi], t], + [ + /(Klarna)\/([\w\.]+)/i, + // Klarna Shopping Browser for iOS & Android + /(kakao(?:talk|story))[\/ ]([\w\.]+)/i, + // Kakao App + /(naver)\(.*?(\d+\.[\w\.]+).*\)/i, + // Naver InApp + /safari (line)\/([\w\.]+)/i, + // Line App for iOS + /\b(line)\/([\w\.]+)\/iab/i, + // Line App for Android + /(alipay)client\/([\w\.]+)/i, + // Alipay + /(chromium|instagram|snapchat)[\/ ]([-\w\.]+)/i + // Chromium/Instagram/Snapchat + ], + [a, t], + [ + /\bgsa\/([\w\.]+) .*safari\//i + // Google Search Appliance on iOS + ], + [t, [a, "GSA"]], + [ + /musical_ly(?:.+app_?version\/|_)([\w\.]+)/i + // TikTok + ], + [t, [a, "TikTok"]], + [ + /headlesschrome(?:\/([\w\.]+)| )/i + // Chrome Headless + ], + [t, [a, H + " Headless"]], + [ + / wv\).+(chrome)\/([\w\.]+)/i + // Chrome WebView + ], + [[a, H + " WebView"], t], + [ + /droid.+ version\/([\w\.]+)\b.+(?:mobile safari|safari)/i + // Android Browser + ], + [t, [a, "Android " + T]], + [ + /(chrome|omniweb|arora|[tizenoka]{5} ?browser)\/v?([\w\.]+)/i + // Chrome/OmniWeb/Arora/Tizen/Nokia + ], + [a, t], + [ + /version\/([\w\.\,]+) .*mobile\/\w+ (safari)/i + // Mobile Safari + ], + [t, [a, "Mobile Safari"]], + [ + /version\/([\w(\.|\,)]+) .*(mobile ?safari|safari)/i + // Safari & Safari Mobile + ], + [t, a], + [ + /webkit.+?(mobile ?safari|safari)(\/[\w\.]+)/i + // Safari < 3.0 + ], + [a, [t, bi, Mi]], + [ + /(webkit|khtml)\/([\w\.]+)/i + ], + [a, t], + [ + // Gecko based + /(navigator|netscape\d?)\/([-\w\.]+)/i + // Netscape + ], + [[a, "Netscape"], t], + [ + /mobile vr; rv:([\w\.]+)\).+firefox/i + // Firefox Reality + ], + [t, [a, X + " Reality"]], + [ + /ekiohf.+(flow)\/([\w\.]+)/i, + // Flow + /(swiftfox)/i, + // Swiftfox + /(icedragon|iceweasel|camino|chimera|fennec|maemo browser|minimo|conkeror|klar)[\/ ]?([\w\.\+]+)/i, + // IceDragon/Iceweasel/Camino/Chimera/Fennec/Maemo/Minimo/Conkeror/Klar + /(seamonkey|k-meleon|icecat|iceape|firebird|phoenix|palemoon|basilisk|waterfox)\/([-\w\.]+)$/i, + // Firefox/SeaMonkey/K-Meleon/IceCat/IceApe/Firebird/Phoenix + /(firefox)\/([\w\.]+)/i, + // Other Firefox-based + /(mozilla)\/([\w\.]+) .+rv\:.+gecko\/\d+/i, + // Mozilla + // Other + /(polaris|lynx|dillo|icab|doris|amaya|w3m|netsurf|sleipnir|obigo|mosaic|(?:go|ice|up)[\. ]?browser)[-\/ ]?v?([\w\.]+)/i, + // Polaris/Lynx/Dillo/iCab/Doris/Amaya/w3m/NetSurf/Sleipnir/Obigo/Mosaic/Go/ICE/UP.Browser + /(links) \(([\w\.]+)/i, + // Links + /panasonic;(viera)/i + // Panasonic Viera + ], + [a, t], + [ + /(cobalt)\/([\w\.]+)/i + // Cobalt + ], + [a, [t, /master.|lts./, ""]] + ], + cpu: [ + [ + /(?:(amd|x(?:(?:86|64)[-_])?|wow|win)64)[;\)]/i + // AMD64 (x64) + ], + [[v, "amd64"]], + [ + /(ia32(?=;))/i + // IA32 (quicktime) + ], + [[v, U]], + [ + /((?:i[346]|x)86)[;\)]/i + // IA32 (x86) + ], + [[v, "ia32"]], + [ + /\b(aarch64|arm(v?8e?l?|_?64))\b/i + // ARM64 + ], + [[v, "arm64"]], + [ + /\b(arm(?:v[67])?ht?n?[fl]p?)\b/i + // ARMHF + ], + [[v, "armhf"]], + [ + // PocketPC mistakenly identified as PowerPC + /windows (ce|mobile); ppc;/i + ], + [[v, "arm"]], + [ + /((?:ppc|powerpc)(?:64)?)(?: mac|;|\))/i + // PowerPC + ], + [[v, /ower/, M, U]], + [ + /(sun4\w)[;\)]/i + // SPARC + ], + [[v, "sparc"]], + [ + /((?:avr32|ia64(?=;))|68k(?=\))|\barm(?=v(?:[1-7]|[5-7]1)l?|;|eabi)|(?=atmel )avr|(?:irix|mips|sparc)(?:64)?\b|pa-risc)/i + // IA64, 68K, ARM/64, AVR/32, IRIX/64, MIPS/64, SPARC/64, PA-RISC + ], + [[v, U]] + ], + device: [ + [ + ////////////////////////// + // MOBILES & TABLETS + ///////////////////////// + // Samsung + /\b(sch-i[89]0\d|shw-m380s|sm-[ptx]\w{2,4}|gt-[pn]\d{2,4}|sgh-t8[56]9|nexus 10)/i + ], + [e, [o, Z], [i, b]], + [ + /\b((?:s[cgp]h|gt|sm)-\w+|sc[g-]?[\d]+a?|galaxy nexus)/i, + /samsung[- ]([-\w]+)/i, + /sec-(sgh\w+)/i + ], + [e, [o, Z], [i, n]], + [ + // Apple + /(?:\/|\()(ip(?:hone|od)[\w, ]*)(?:\/|;)/i + // iPod/iPhone + ], + [e, [o, D], [i, n]], + [ + /\((ipad);[-\w\),; ]+apple/i, + // iPad + /applecoremedia\/[\w\.]+ \((ipad)/i, + /\b(ipad)\d\d?,\d\d?[;\]].+ios/i + ], + [e, [o, D], [i, b]], + [ + /(macintosh);/i + ], + [e, [o, D]], + [ + // Sharp + /\b(sh-?[altvz]?\d\d[a-ekm]?)/i + ], + [e, [o, hi], [i, n]], + [ + // Huawei + /\b((?:ag[rs][23]?|bah2?|sht?|btv)-a?[lw]\d{2})\b(?!.+d\/s)/i + ], + [e, [o, ui], [i, b]], + [ + /(?:huawei|honor)([-\w ]+)[;\)]/i, + /\b(nexus 6p|\w{2,4}e?-[atu]?[ln][\dx][012359c][adn]?)\b(?!.+d\/s)/i + ], + [e, [o, ui], [i, n]], + [ + // Xiaomi + /\b(poco[\w ]+|m2\d{3}j\d\d[a-z]{2})(?: bui|\))/i, + // Xiaomi POCO + /\b; (\w+) build\/hm\1/i, + // Xiaomi Hongmi 'numeric' models + /\b(hm[-_ ]?note?[_ ]?(?:\d\w)?) bui/i, + // Xiaomi Hongmi + /\b(redmi[\-_ ]?(?:note|k)?[\w_ ]+)(?: bui|\))/i, + // Xiaomi Redmi + /oid[^\)]+; (m?[12][0-389][01]\w{3,6}[c-y])( bui|; wv|\))/i, + // Xiaomi Redmi 'numeric' models + /\b(mi[-_ ]?(?:a\d|one|one[_ ]plus|note lte|max|cc)?[_ ]?(?:\d?\w?)[_ ]?(?:plus|se|lite)?)(?: bui|\))/i + // Xiaomi Mi + ], + [[e, /_/g, " "], [o, ri], [i, n]], + [ + /oid[^\)]+; (2\d{4}(283|rpbf)[cgl])( bui|\))/i, + // Redmi Pad + /\b(mi[-_ ]?(?:pad)(?:[\w_ ]+))(?: bui|\))/i + // Mi Pad tablets + ], + [[e, /_/g, " "], [o, ri], [i, b]], + [ + // OPPO + /; (\w+) bui.+ oppo/i, + /\b(cph[12]\d{3}|p(?:af|c[al]|d\w|e[ar])[mt]\d0|x9007|a101op)\b/i + ], + [e, [o, "OPPO"], [i, n]], + [ + // Vivo + /vivo (\w+)(?: bui|\))/i, + /\b(v[12]\d{3}\w?[at])(?: bui|;)/i + ], + [e, [o, "Vivo"], [i, n]], + [ + // Realme + /\b(rmx[1-3]\d{3})(?: bui|;|\))/i + ], + [e, [o, "Realme"], [i, n]], + [ + // Motorola + /\b(milestone|droid(?:[2-4x]| (?:bionic|x2|pro|razr))?:?( 4g)?)\b[\w ]+build\//i, + /\bmot(?:orola)?[- ](\w*)/i, + /((?:moto[\w\(\) ]+|xt\d{3,4}|nexus 6)(?= bui|\)))/i + ], + [e, [o, pi], [i, n]], + [ + /\b(mz60\d|xoom[2 ]{0,2}) build\//i + ], + [e, [o, pi], [i, b]], + [ + // LG + /((?=lg)?[vl]k\-?\d{3}) bui| 3\.[-\w; ]{10}lg?-([06cv9]{3,4})/i + ], + [e, [o, ai], [i, b]], + [ + /(lm(?:-?f100[nv]?|-[\w\.]+)(?= bui|\))|nexus [45])/i, + /\blg[-e;\/ ]+((?!browser|netcast|android tv)\w+)/i, + /\blg-?([\d\w]+) bui/i + ], + [e, [o, ai], [i, n]], + [ + // Lenovo + /(ideatab[-\w ]+)/i, + /lenovo ?(s[56]000[-\w]+|tab(?:[\w ]+)|yt[-\d\w]{6}|tb[-\d\w]{6})/i + ], + [e, [o, "Lenovo"], [i, b]], + [ + // Nokia + /(?:maemo|nokia).*(n900|lumia \d+)/i, + /nokia[-_ ]?([-\w\.]*)/i + ], + [[e, /_/g, " "], [o, "Nokia"], [i, n]], + [ + // Google + /(pixel c)\b/i + // Google Pixel C + ], + [e, [o, Y], [i, b]], + [ + /droid.+; (pixel[\daxl ]{0,6})(?: bui|\))/i + // Google Pixel + ], + [e, [o, Y], [i, n]], + [ + // Sony + /droid.+ (a?\d[0-2]{2}so|[c-g]\d{4}|so[-gl]\w+|xq-a\w[4-7][12])(?= bui|\).+chrome\/(?![1-6]{0,1}\d\.))/i + ], + [e, [o, J], [i, n]], + [ + /sony tablet [ps]/i, + /\b(?:sony)?sgp\w+(?: bui|\))/i + ], + [[e, "Xperia Tablet"], [o, J], [i, b]], + [ + // OnePlus + / (kb2005|in20[12]5|be20[12][59])\b/i, + /(?:one)?(?:plus)? (a\d0\d\d)(?: b|\))/i + ], + [e, [o, "OnePlus"], [i, n]], + [ + // Amazon + /(alexa)webm/i, + /(kf[a-z]{2}wi|aeo[c-r]{2})( bui|\))/i, + // Kindle Fire without Silk / Echo Show + /(kf[a-z]+)( bui|\)).+silk\//i + // Kindle Fire HD + ], + [e, [o, G], [i, b]], + [ + /((?:sd|kf)[0349hijorstuw]+)( bui|\)).+silk\//i + // Fire Phone + ], + [[e, /(.+)/g, "Fire Phone $1"], [o, G], [i, n]], + [ + // BlackBerry + /(playbook);[-\w\),; ]+(rim)/i + // BlackBerry PlayBook + ], + [e, o, [i, b]], + [ + /\b((?:bb[a-f]|st[hv])100-\d)/i, + /\(bb10; (\w+)/i + // BlackBerry 10 + ], + [e, [o, mi], [i, n]], + [ + // Asus + /(?:\b|asus_)(transfo[prime ]{4,10} \w+|eeepc|slider \w+|nexus 7|padfone|p00[cj])/i + ], + [e, [o, di], [i, b]], + [ + / (z[bes]6[027][012][km][ls]|zenfone \d\w?)\b/i + ], + [e, [o, di], [i, n]], + [ + // HTC + /(nexus 9)/i + // HTC Nexus 9 + ], + [e, [o, "HTC"], [i, b]], + [ + /(htc)[-;_ ]{1,2}([\w ]+(?=\)| bui)|\w+)/i, + // HTC + // ZTE + /(zte)[- ]([\w ]+?)(?: bui|\/|\))/i, + /(alcatel|geeksphone|nexian|panasonic(?!(?:;|\.))|sony(?!-bra))[-_ ]?([-\w]*)/i + // Alcatel/GeeksPhone/Nexian/Panasonic/Sony + ], + [o, [e, /_/g, " "], [i, n]], + [ + // Acer + /droid.+; ([ab][1-7]-?[0178a]\d\d?)/i + ], + [e, [o, "Acer"], [i, b]], + [ + // Meizu + /droid.+; (m[1-5] note) bui/i, + /\bmz-([-\w]{2,})/i + ], + [e, [o, "Meizu"], [i, n]], + [ + // Ulefone + /; ((?:power )?armor(?:[\w ]{0,8}))(?: bui|\))/i + ], + [e, [o, "Ulefone"], [i, n]], + [ + // MIXED + /(blackberry|benq|palm(?=\-)|sonyericsson|acer|asus|dell|meizu|motorola|polytron|infinix|tecno)[-_ ]?([-\w]*)/i, + // BlackBerry/BenQ/Palm/Sony-Ericsson/Acer/Asus/Dell/Meizu/Motorola/Polytron + /(hp) ([\w ]+\w)/i, + // HP iPAQ + /(asus)-?(\w+)/i, + // Asus + /(microsoft); (lumia[\w ]+)/i, + // Microsoft Lumia + /(lenovo)[-_ ]?([-\w]+)/i, + // Lenovo + /(jolla)/i, + // Jolla + /(oppo) ?([\w ]+) bui/i + // OPPO + ], + [o, e, [i, n]], + [ + /(kobo)\s(ereader|touch)/i, + // Kobo + /(archos) (gamepad2?)/i, + // Archos + /(hp).+(touchpad(?!.+tablet)|tablet)/i, + // HP TouchPad + /(kindle)\/([\w\.]+)/i, + // Kindle + /(nook)[\w ]+build\/(\w+)/i, + // Nook + /(dell) (strea[kpr\d ]*[\dko])/i, + // Dell Streak + /(le[- ]+pan)[- ]+(\w{1,9}) bui/i, + // Le Pan Tablets + /(trinity)[- ]*(t\d{3}) bui/i, + // Trinity Tablets + /(gigaset)[- ]+(q\w{1,9}) bui/i, + // Gigaset Tablets + /(vodafone) ([\w ]+)(?:\)| bui)/i + // Vodafone + ], + [o, e, [i, b]], + [ + /(surface duo)/i + // Surface Duo + ], + [e, [o, ti], [i, b]], + [ + /droid [\d\.]+; (fp\du?)(?: b|\))/i + // Fairphone + ], + [e, [o, "Fairphone"], [i, n]], + [ + /(u304aa)/i + // AT&T + ], + [e, [o, "AT&T"], [i, n]], + [ + /\bsie-(\w*)/i + // Siemens + ], + [e, [o, "Siemens"], [i, n]], + [ + /\b(rct\w+) b/i + // RCA Tablets + ], + [e, [o, "RCA"], [i, b]], + [ + /\b(venue[\d ]{2,7}) b/i + // Dell Venue Tablets + ], + [e, [o, "Dell"], [i, b]], + [ + /\b(q(?:mv|ta)\w+) b/i + // Verizon Tablet + ], + [e, [o, "Verizon"], [i, b]], + [ + /\b(?:barnes[& ]+noble |bn[rt])([\w\+ ]*) b/i + // Barnes & Noble Tablet + ], + [e, [o, "Barnes & Noble"], [i, b]], + [ + /\b(tm\d{3}\w+) b/i + ], + [e, [o, "NuVision"], [i, b]], + [ + /\b(k88) b/i + // ZTE K Series Tablet + ], + [e, [o, "ZTE"], [i, b]], + [ + /\b(nx\d{3}j) b/i + // ZTE Nubia + ], + [e, [o, "ZTE"], [i, n]], + [ + /\b(gen\d{3}) b.+49h/i + // Swiss GEN Mobile + ], + [e, [o, "Swiss"], [i, n]], + [ + /\b(zur\d{3}) b/i + // Swiss ZUR Tablet + ], + [e, [o, "Swiss"], [i, b]], + [ + /\b((zeki)?tb.*\b) b/i + // Zeki Tablets + ], + [e, [o, "Zeki"], [i, b]], + [ + /\b([yr]\d{2}) b/i, + /\b(dragon[- ]+touch |dt)(\w{5}) b/i + // Dragon Touch Tablet + ], + [[o, "Dragon Touch"], e, [i, b]], + [ + /\b(ns-?\w{0,9}) b/i + // Insignia Tablets + ], + [e, [o, "Insignia"], [i, b]], + [ + /\b((nxa|next)-?\w{0,9}) b/i + // NextBook Tablets + ], + [e, [o, "NextBook"], [i, b]], + [ + /\b(xtreme\_)?(v(1[045]|2[015]|[3469]0|7[05])) b/i + // Voice Xtreme Phones + ], + [[o, "Voice"], e, [i, n]], + [ + /\b(lvtel\-)?(v1[12]) b/i + // LvTel Phones + ], + [[o, "LvTel"], e, [i, n]], + [ + /\b(ph-1) /i + // Essential PH-1 + ], + [e, [o, "Essential"], [i, n]], + [ + /\b(v(100md|700na|7011|917g).*\b) b/i + // Envizen Tablets + ], + [e, [o, "Envizen"], [i, b]], + [ + /\b(trio[-\w\. ]+) b/i + // MachSpeed Tablets + ], + [e, [o, "MachSpeed"], [i, b]], + [ + /\btu_(1491) b/i + // Rotor Tablets + ], + [e, [o, "Rotor"], [i, b]], + [ + /(shield[\w ]+) b/i + // Nvidia Shield Tablets + ], + [e, [o, "Nvidia"], [i, b]], + [ + /(sprint) (\w+)/i + // Sprint Phones + ], + [o, e, [i, n]], + [ + /(kin\.[onetw]{3})/i + // Microsoft Kin + ], + [[e, /\./g, " "], [o, ti], [i, n]], + [ + /droid.+; (cc6666?|et5[16]|mc[239][23]x?|vc8[03]x?)\)/i + // Zebra + ], + [e, [o, si], [i, b]], + [ + /droid.+; (ec30|ps20|tc[2-8]\d[kx])\)/i + ], + [e, [o, si], [i, n]], + [ + /////////////////// + // SMARTTVS + /////////////////// + /smart-tv.+(samsung)/i + // Samsung + ], + [o, [i, h]], + [ + /hbbtv.+maple;(\d+)/i + ], + [[e, /^/, "SmartTV"], [o, Z], [i, h]], + [ + /(nux; netcast.+smarttv|lg (netcast\.tv-201\d|android tv))/i + // LG SmartTV + ], + [[o, ai], [i, h]], + [ + /(apple) ?tv/i + // Apple TV + ], + [o, [e, D + " TV"], [i, h]], + [ + /crkey/i + // Google Chromecast + ], + [[e, H + "cast"], [o, Y], [i, h]], + [ + /droid.+aft(\w+)( bui|\))/i + // Fire TV + ], + [e, [o, G], [i, h]], + [ + /\(dtv[\);].+(aquos)/i, + /(aquos-tv[\w ]+)\)/i + // Sharp + ], + [e, [o, hi], [i, h]], + [ + /(bravia[\w ]+)( bui|\))/i + // Sony + ], + [e, [o, J], [i, h]], + [ + /(mitv-\w{5}) bui/i + // Xiaomi + ], + [e, [o, ri], [i, h]], + [ + /Hbbtv.*(technisat) (.*);/i + // TechniSAT + ], + [o, e, [i, h]], + [ + /\b(roku)[\dx]*[\)\/]((?:dvp-)?[\d\.]*)/i, + // Roku + /hbbtv\/\d+\.\d+\.\d+ +\([\w\+ ]*; *([\w\d][^;]*);([^;]*)/i + // HbbTV devices + ], + [[o, ni], [e, ni], [i, h]], + [ + /\b(android tv|smart[- ]?tv|opera tv|tv; rv:)\b/i + // SmartTV from Unidentified Vendors + ], + [[i, h]], + [ + /////////////////// + // CONSOLES + /////////////////// + /(ouya)/i, + // Ouya + /(nintendo) ([wids3utch]+)/i + // Nintendo + ], + [o, e, [i, B]], + [ + /droid.+; (shield) bui/i + // Nvidia + ], + [e, [o, "Nvidia"], [i, B]], + [ + /(playstation [345portablevi]+)/i + // Playstation + ], + [e, [o, J], [i, B]], + [ + /\b(xbox(?: one)?(?!; xbox))[\); ]/i + // Microsoft Xbox + ], + [e, [o, ti], [i, B]], + [ + /////////////////// + // WEARABLES + /////////////////// + /((pebble))app/i + // Pebble + ], + [o, e, [i, N]], + [ + /(watch)(?: ?os[,\/]|\d,\d\/)[\d\.]+/i + // Apple Watch + ], + [e, [o, D], [i, N]], + [ + /droid.+; (glass) \d/i + // Google Glass + ], + [e, [o, Y], [i, N]], + [ + /droid.+; (wt63?0{2,3})\)/i + ], + [e, [o, si], [i, N]], + [ + /(quest( 2| pro)?)/i + // Oculus Quest + ], + [e, [o, fi], [i, N]], + [ + /////////////////// + // EMBEDDED + /////////////////// + /(tesla)(?: qtcarbrowser|\/[-\w\.]+)/i + // Tesla + ], + [o, [i, ei]], + [ + /(aeobc)\b/i + // Echo Dot + ], + [e, [o, G], [i, ei]], + [ + //////////////////// + // MIXED (GENERIC) + /////////////////// + /droid .+?; ([^;]+?)(?: bui|; wv\)|\) applew).+? mobile safari/i + // Android Phones from Unidentified Vendors + ], + [e, [i, n]], + [ + /droid .+?; ([^;]+?)(?: bui|\) applew).+?(?! mobile) safari/i + // Android Tablets from Unidentified Vendors + ], + [e, [i, b]], + [ + /\b((tablet|tab)[;\/]|focus\/\d(?!.+mobile))/i + // Unidentifiable Tablet + ], + [[i, b]], + [ + /(phone|mobile(?:[;\/]| [ \w\/\.]*safari)|pda(?=.+windows ce))/i + // Unidentifiable Mobile + ], + [[i, n]], + [ + /(android[-\w\. ]{0,9});.+buil/i + // Generic Android Device + ], + [e, [o, "Generic"]] + ], + engine: [ + [ + /windows.+ edge\/([\w\.]+)/i + // EdgeHTML + ], + [t, [a, yi + "HTML"]], + [ + /webkit\/537\.36.+chrome\/(?!27)([\w\.]+)/i + // Blink + ], + [t, [a, "Blink"]], + [ + /(presto)\/([\w\.]+)/i, + // Presto + /(webkit|trident|netfront|netsurf|amaya|lynx|w3m|goanna)\/([\w\.]+)/i, + // WebKit/Trident/NetFront/NetSurf/Amaya/Lynx/w3m/Goanna + /ekioh(flow)\/([\w\.]+)/i, + // Flow + /(khtml|tasman|links)[\/ ]\(?([\w\.]+)/i, + // KHTML/Tasman/Links + /(icab)[\/ ]([23]\.[\d\.]+)/i, + // iCab + /\b(libweb)/i + ], + [a, t], + [ + /rv\:([\w\.]{1,9})\b.+(gecko)/i + // Gecko + ], + [t, a] + ], + os: [ + [ + // Windows + /microsoft (windows) (vista|xp)/i + // Windows (iTunes) + ], + [a, t], + [ + /(windows (?:phone(?: os)?|mobile))[\/ ]?([\d\.\w ]*)/i + // Windows Phone + ], + [a, [t, bi, Oi]], + [ + /windows nt 6\.2; (arm)/i, + // Windows RT + /windows[\/ ]?([ntce\d\. ]+\w)(?!.+xbox)/i, + /(?:win(?=3|9|n)|win 9x )([nt\d\.]+)/i + ], + [[t, bi, Oi], [a, "Windows"]], + [ + // iOS/macOS + /ip[honead]{2,4}\b(?:.*os ([\w]+) like mac|; opera)/i, + // iOS + /(?:ios;fbsv\/|iphone.+ios[\/ ])([\d\.]+)/i, + /cfnetwork\/.+darwin/i + ], + [[t, /_/g, "."], [a, "iOS"]], + [ + /(mac os x) ?([\w\. ]*)/i, + /(macintosh|mac_powerpc\b)(?!.+haiku)/i + // Mac OS + ], + [[a, gi], [t, /_/g, "."]], + [ + // Mobile OSes + /droid ([\w\.]+)\b.+(android[- ]x86|harmonyos)/i + // Android-x86/HarmonyOS + ], + [t, a], + [ + // Android/WebOS/QNX/Bada/RIM/Maemo/MeeGo/Sailfish OS + /(android|webos|qnx|bada|rim tablet os|maemo|meego|sailfish)[-\/ ]?([\w\.]*)/i, + /(blackberry)\w*\/([\w\.]*)/i, + // Blackberry + /(tizen|kaios)[\/ ]([\w\.]+)/i, + // Tizen/KaiOS + /\((series40);/i + // Series 40 + ], + [a, t], + [ + /\(bb(10);/i + // BlackBerry 10 + ], + [t, [a, mi]], + [ + /(?:symbian ?os|symbos|s60(?=;)|series60)[-\/ ]?([\w\.]*)/i + // Symbian + ], + [t, [a, "Symbian"]], + [ + /mozilla\/[\d\.]+ \((?:mobile|tablet|tv|mobile; [\w ]+); rv:.+ gecko\/([\w\.]+)/i + // Firefox OS + ], + [t, [a, X + " OS"]], + [ + /web0s;.+rt(tv)/i, + /\b(?:hp)?wos(?:browser)?\/([\w\.]+)/i + // WebOS + ], + [t, [a, "webOS"]], + [ + /watch(?: ?os[,\/]|\d,\d\/)([\d\.]+)/i + // watchOS + ], + [t, [a, "watchOS"]], + [ + // Google Chromecast + /crkey\/([\d\.]+)/i + // Google Chromecast + ], + [t, [a, H + "cast"]], + [ + /(cros) [\w]+(?:\)| ([\w\.]+)\b)/i + // Chromium OS + ], + [[a, vi], t], + [ + // Smart TVs + /panasonic;(viera)/i, + // Panasonic Viera + /(netrange)mmh/i, + // Netrange + /(nettv)\/(\d+\.[\w\.]+)/i, + // NetTV + // Console + /(nintendo|playstation) ([wids345portablevuch]+)/i, + // Nintendo/Playstation + /(xbox); +xbox ([^\);]+)/i, + // Microsoft Xbox (360, One, X, S, Series X, Series S) + // Other + /\b(joli|palm)\b ?(?:os)?\/?([\w\.]*)/i, + // Joli/Palm + /(mint)[\/\(\) ]?(\w*)/i, + // Mint + /(mageia|vectorlinux)[; ]/i, + // Mageia/VectorLinux + /([kxln]?ubuntu|debian|suse|opensuse|gentoo|arch(?= linux)|slackware|fedora|mandriva|centos|pclinuxos|red ?hat|zenwalk|linpus|raspbian|plan 9|minix|risc os|contiki|deepin|manjaro|elementary os|sabayon|linspire)(?: gnu\/linux)?(?: enterprise)?(?:[- ]linux)?(?:-gnu)?[-\/ ]?(?!chrom|package)([-\w\.]*)/i, + // Ubuntu/Debian/SUSE/Gentoo/Arch/Slackware/Fedora/Mandriva/CentOS/PCLinuxOS/RedHat/Zenwalk/Linpus/Raspbian/Plan9/Minix/RISCOS/Contiki/Deepin/Manjaro/elementary/Sabayon/Linspire + /(hurd|linux) ?([\w\.]*)/i, + // Hurd/Linux + /(gnu) ?([\w\.]*)/i, + // GNU + /\b([-frentopcghs]{0,5}bsd|dragonfly)[\/ ]?(?!amd|[ix346]{1,2}86)([\w\.]*)/i, + // FreeBSD/NetBSD/OpenBSD/PC-BSD/GhostBSD/DragonFly + /(haiku) (\w+)/i + // Haiku + ], + [a, t], + [ + /(sunos) ?([\w\.\d]*)/i + // Solaris + ], + [[a, "Solaris"], t], + [ + /((?:open)?solaris)[-\/ ]?([\w\.]*)/i, + // Solaris + /(aix) ((\d)(?=\.|\)| )[\w\.])*/i, + // AIX + /\b(beos|os\/2|amigaos|morphos|openvms|fuchsia|hp-ux|serenityos)/i, + // BeOS/OS2/AmigaOS/MorphOS/OpenVMS/Fuchsia/HP-UX/SerenityOS + /(unix) ?([\w\.]*)/i + // UNIX + ], + [a, t] + ] + }, g = function(c, l) { + if (typeof c === ii && (l = c, c = m), !(this instanceof g)) + return new g(c, l).getResult(); + var s = typeof A !== V && A.navigator ? A.navigator : m, d = c || (s && s.userAgent ? s.userAgent : M), y = s && s.userAgentData ? s.userAgentData : m, O = l ? Ti(ki, l) : ki, w = s && s.userAgent == d; + return this.getBrowser = function() { + var r = {}; + return r[a] = m, r[t] = m, L.call(r, d, O.browser), r[li] = _i(r[t]), w && s && s.brave && typeof s.brave.isBrave == R && (r[a] = "Brave"), r; + }, this.getCPU = function() { + var r = {}; + return r[v] = m, L.call(r, d, O.cpu), r; + }, this.getDevice = function() { + var r = {}; + return r[o] = m, r[e] = m, r[i] = m, L.call(r, d, O.device), w && !r[i] && y && y.mobile && (r[i] = n), w && r[e] == "Macintosh" && s && typeof s.standalone !== V && s.maxTouchPoints && s.maxTouchPoints > 2 && (r[e] = "iPad", r[i] = b), r; + }, this.getEngine = function() { + var r = {}; + return r[a] = m, r[t] = m, L.call(r, d, O.engine), r; + }, this.getOS = function() { + var r = {}; + return r[a] = m, r[t] = m, L.call(r, d, O.os), w && !r[a] && y && y.platform != "Unknown" && (r[a] = y.platform.replace(/chrome os/i, vi).replace(/macos/i, gi)), r; + }, this.getResult = function() { + return { + ua: this.getUA(), + browser: this.getBrowser(), + engine: this.getEngine(), + os: this.getOS(), + device: this.getDevice(), + cpu: this.getCPU() + }; + }, this.getUA = function() { + return d; + }, this.setUA = function(r) { + return d = typeof r === j && r.length > oi ? ni(r, oi) : r, this; + }, this.setUA(d), this; + }; + g.VERSION = F, g.BROWSER = Q([a, t, li]), g.CPU = Q([v]), g.DEVICE = Q([e, o, i, B, n, h, b, N, ei]), g.ENGINE = g.OS = Q([a, t]), E.exports && (q = E.exports = g), q.UAParser = g; + var C = typeof A !== V && (A.jQuery || A.Zepto); + if (C && !C.ua) { + var $ = new g(); + C.ua = $.getResult(), C.ua.get = function() { + return $.getUA(); + }, C.ua.set = function(c) { + $.setUA(c); + var l = $.getResult(); + for (var s in l) + C.ua[s] = l[s]; + }; + } + })(typeof window == "object" ? window : Ni); +})(wi, wi.exports); +var Pi = wi.exports; +const Bi = /* @__PURE__ */ Ci(Pi), S = { + CONSOLE: "console", + DESKTOP: void 0, + EMBEDDED: "embedded", + MOBILE: "mobile", + SMART_TV: "smarttv", + TABLET: "tablet", + WEARABLE: "wearable" +}, _ = { + ANDROID: "Android", + IOS: "iOS", + LINUX: "Linux", + MAC_OS: "Mac OS", + WINDOWS_PHONE: "Windows Phone", + WINDOWS: "Windows" +}, p = { + CHROME: "Chrome", + CHROMIUM: "Chromium", + EDGE: "Edge", + FIREFOX: "Firefox", + IE: "IE", + INTERNET_EXPLORER: "Internet Explorer", + MIUI: "MIUI Browser", + MOBILE_SAFARI: "Mobile Safari", + OPERA: "Opera", + SAFARI: "Safari", + SAMSUNG_BROWSER: "Samsung Browser", + YANDEX: "Yandex" +}, z = new Bi(), f = z.getDevice(), x = z.getOS(), u = z.getBrowser(); +z.getEngine(); +const P = z.getUA(), W = () => /iPad/.test(P), Ai = () => x.name === _.WINDOWS && x.version === "10" && P.indexOf("Edg/") !== -1; +x.name === _.ANDROID; +u.name === p.CHROME; +u.name === p.CHROMIUM; +f.type === S.CONSOLE; +f.type === S.DESKTOP; +u.name === p.EDGE || Ai(); +Ai(); +u.name === p.EDGE; +/electron/.test(P.toLowerCase()); +f.type === S.EMBEDDED; +u.name === p.FIREFOX; +u.name === p.INTERNET_EXPLORER || u.name === p.IE; +x.name === _.IOS || W(); +x.name === _.LINUX; +x.name === _.MAC_OS; +u.name === p.MIUI; +f.type === S.MOBILE || f.type === S.TABLET || W(); +f.type === S.MOBILE; +u.name === p.MOBILE_SAFARI || W(); +u.name === p.OPERA; +u.name === p.SAFARI || u.name === p.MOBILE_SAFARI; +u.name === p.SAMSUNG_BROWSER; +f.type === S.SMART_TV; +f.type === S.TABLET || W(); +f.type === S.WEARABLE; +x.name === _.WINDOWS; +x.name === _.WINDOWS_PHONE; +u.name === p.YANDEX; +const fe = () => f.model, ve = () => f.type || "desktop", ge = () => f.vendor; +const _hoisted_1$1 = { class: "server-overview" }; +const _hoisted_2$1 = { class: "grid" }; +const _hoisted_3$1 = { class: "mcrm-block block__light grid gap-4" }; +const _hoisted_4$1 = { class: "text-lg flex gap-4 items-center justify-between" }; +const _hoisted_5 = { class: "flex gap-4" }; +const _hoisted_6 = { class: "grid gap-2" }; +const _hoisted_7 = { + key: 0, + class: "grid grid-cols-[2rem_1fr] gap-2" +}; +const _hoisted_8 = { class: "grid gap-4 w-64" }; +const _sfc_main$1 = { + __name: "RemoteView", + setup(__props) { + const device = useDeviceStore(); + const linkPinDialog = ref(); + const server = reactive({ + host: "", + status: false, + link: false, + inputPin: "", + encryptedKey: "", + key: "" + }); + onMounted(async () => { + server.host = window.location.host; + }); + onUpdated(() => { + if (!server.status) checkServerStatus(); + }); + async function checkServerStatus(request = true) { + const status = await device.remoteCheckServerAccess(); + server.status = status; + if (status === "unlinked" || status === "unauthorized") { + if (request) requestAccess(); + return true; + } + if (!device.key()) { + server.status = "unauthorized"; + return true; + } + const handshake = await device.remoteHandshake(device.key()); + if (handshake) server.key = device.key(); + else { + device.removeDeviceKey(); + server.status = "unlinked"; + if (request) requestAccess(); + } + return true; + } + function requestAccess() { + let deviceName = `${ge() ? ge() : "Unknown"} ${ge() ? fe() : ve()}`; + device.remoteRequestServerAccess(deviceName, ve()).then((data) => { + if (data.data) server.status = data.data, pingLink(); + }); + } + function pingLink() { + server.link = "checking"; + device.remotePingLink((encryptedKey) => { + server.link = true; + server.encryptedKey = encryptedKey; + linkPinDialog.value.toggleDialog(true); + }); + } + async function decryptKey() { + const decryptedKey = decryptAES(server.inputPin, server.encryptedKey); + const handshake = await device.remoteHandshake(decryptedKey); + if (handshake) { + device.setDeviceKey(decryptedKey); + server.key = decryptedKey; + linkPinDialog.value.toggleDialog(false); + server.status = "authorized"; + } + } + function disonnectFromServer() { + axios.post(appUrl() + "/device/link/remove", AuthCall({ uuid: device.uuid() })).then((data) => { + if (data.data) checkServerStatus(false); + }); + } + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$1, [ + createVNode(AlertComp, { type: "info" }, { + default: withCtx(() => [ + createBaseVNode("div", _hoisted_2$1, [ + _cache[6] || (_cache[6] = createBaseVNode("strong", null, "This is a remote device.", -1)), + createBaseVNode("em", null, "UUID: " + toDisplayString(unref(device).uuid()), 1) + ]) + ]), + _: 1 + }), + createBaseVNode("div", _hoisted_3$1, [ + createBaseVNode("h4", _hoisted_4$1, [ + createBaseVNode("span", _hoisted_5, [ + createVNode(unref(IconServer)), + _cache[7] || (_cache[7] = createTextVNode("Server")) + ]), + createVNode(_sfc_main$4, { + variant: "primary", + onClick: _cache[0] || (_cache[0] = ($event) => checkServerStatus()) + }, { + default: withCtx(() => [ + createVNode(unref(IconReload)) + ]), + _: 1 + }) + ]), + createBaseVNode("p", null, [ + _cache[8] || (_cache[8] = createTextVNode(" Connected to: ")), + createBaseVNode("strong", null, toDisplayString(server.host), 1) + ]), + server.status === "authorized" ? (openBlock(), createBlock(AlertComp, { + key: 0, + type: "success" + }, { + default: withCtx(() => _cache[9] || (_cache[9] = [ + createTextVNode("Authorized") + ])), + _: 1 + })) : createCommentVNode("", true), + server.status === "unlinked" ? (openBlock(), createBlock(AlertComp, { + key: 1, + type: "warning" + }, { + default: withCtx(() => _cache[10] || (_cache[10] = [ + createTextVNode("Not linked") + ])), + _: 1 + })) : createCommentVNode("", true), + server.status === "unauthorized" ? (openBlock(), createBlock(AlertComp, { + key: 2, + type: "info" + }, { + default: withCtx(() => [ + createBaseVNode("div", _hoisted_6, [ + _cache[13] || (_cache[13] = createBaseVNode("strong", null, "Access requested", -1)), + _cache[14] || (_cache[14] = createBaseVNode("p", null, [ + createTextVNode(" Navigate to "), + createBaseVNode("em", { class: "font-semibold" }, "http://localhost:6970/devices"), + createTextVNode(" on your pc to authorize. ") + ], -1)), + server.link == "checking" ? (openBlock(), createElementBlock("div", _hoisted_7, [ + createVNode(unref(IconReload), { class: "animate-spin" }), + _cache[11] || (_cache[11] = createTextVNode(" Checking server for link... ")) + ])) : createCommentVNode("", true), + server.link === false ? (openBlock(), createBlock(_sfc_main$4, { + key: 1, + variant: "subtle", + onClick: _cache[1] || (_cache[1] = ($event) => pingLink()), + class: "w-fit" + }, { + default: withCtx(() => [ + createVNode(unref(IconReload)), + _cache[12] || (_cache[12] = createTextVNode("Check for server link ")) + ]), + _: 1 + })) : createCommentVNode("", true) + ]) + ]), + _: 1 + })) : createCommentVNode("", true), + server.status === "unauthorized" ? (openBlock(), createBlock(_sfc_main$4, { + key: 3, + variant: "primary", + onClick: _cache[2] || (_cache[2] = ($event) => requestAccess()) + }, { + default: withCtx(() => [ + createVNode(unref(IconKey)), + _cache[15] || (_cache[15] = createTextVNode(" Request access ")) + ]), + _: 1 + })) : createCommentVNode("", true), + server.status === "authorized" ? (openBlock(), createBlock(_sfc_main$4, { + key: 4, + variant: "danger", + onClick: _cache[3] || (_cache[3] = ($event) => disonnectFromServer()) + }, { + default: withCtx(() => [ + createVNode(unref(IconPlugConnectedX)), + _cache[16] || (_cache[16] = createTextVNode(" Disconnect ")) + ]), + _: 1 + })) : createCommentVNode("", true) + ]), + createVNode(_sfc_main$5, { + ref_key: "linkPinDialog", + ref: linkPinDialog + }, { + content: withCtx(() => [ + createBaseVNode("div", _hoisted_8, [ + _cache[18] || (_cache[18] = createBaseVNode("h3", null, "Server link pin:", -1)), + createBaseVNode("form", { + class: "grid gap-4", + onSubmit: _cache[5] || (_cache[5] = withModifiers(($event) => decryptKey(), ["prevent"])) + }, [ + withDirectives(createBaseVNode("input", { + class: "input", + id: "input-pin", + type: "text", + pattern: "[0-9]{4}", + "onUpdate:modelValue": _cache[4] || (_cache[4] = ($event) => server.inputPin = $event) + }, null, 512), [ + [vModelText, server.inputPin] + ]), + createVNode(_sfc_main$4, { variant: "primary" }, { + default: withCtx(() => _cache[17] || (_cache[17] = [ + createTextVNode("Enter") + ])), + _: 1 + }) + ], 32) + ]) + ]), + _: 1 + }, 512) + ]); + }; + } +}; +const RemoteView = /* @__PURE__ */ _export_sfc(_sfc_main$1, [["__scopeId", "data-v-3109048f"]]); +const _hoisted_1 = { + id: "devices-view", + class: "panel" +}; +const _hoisted_2 = { class: "panel__title" }; +const _hoisted_3 = { class: "text-sm" }; +const _hoisted_4 = { class: "panel__content grid gap-8" }; +const _sfc_main = { + __name: "DevicesView", + setup(__props) { + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1, [ + createBaseVNode("h1", _hoisted_2, [ + _cache[0] || (_cache[0] = createTextVNode(" Devices ")), + createBaseVNode("span", _hoisted_3, toDisplayString(unref(isLocal)() ? "remote" : "servers"), 1) + ]), + createBaseVNode("div", _hoisted_4, [ + unref(isLocal)() ? (openBlock(), createBlock(ServerView, { key: 0 })) : (openBlock(), createBlock(RemoteView, { key: 1 })) + ]) + ]); + }; + } +}; +const DevicesView = /* @__PURE__ */ _export_sfc(_sfc_main, [["__scopeId", "data-v-97929e31"]]); +export { + DevicesView as default +}; diff --git a/public/assets/DevicesView-Dw_Mls3X.css b/public/assets/DevicesView-Dw_Mls3X.css new file mode 100644 index 0000000..4735417 --- /dev/null +++ b/public/assets/DevicesView-Dw_Mls3X.css @@ -0,0 +1,87 @@ +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.alert[data-v-87f6de25] { + align-items: flex-start; + gap: calc(var(--spacing, .25rem) * 4); + border-radius: var(--radius-md, .375rem); + border-style: var(--tw-border-style); + border-width: 1px; + border-color: color-mix(in oklab, var(--color-white, #fff) 10%, transparent); + background-color: color-mix(in oklab, var(--color-white, #fff) 10%, transparent); + padding: calc(var(--spacing, .25rem) * 4); + --tw-backdrop-blur: blur(var(--blur-md, 12px)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + grid-template-columns: 1rem 1fr; + display: grid; +} +.alert.alert__info[data-v-87f6de25] { + background-color: color-mix(in oklab, var(--color-sky-400, oklch(.746 .16 232.661)) 40%, transparent); + color: var(--color-sky-100, oklch(.951 .026 236.824)); +} +.alert.alert__success[data-v-87f6de25] { + background-color: color-mix(in oklab, var(--color-lime-400, oklch(.841 .238 128.85)) 10%, transparent); + color: var(--color-lime-400, oklch(.841 .238 128.85)); +} +.alert.alert__warning[data-v-87f6de25] { + background-color: color-mix(in oklab, var(--color-amber-400, oklch(.828 .189 84.429)) 10%, transparent); + color: var(--color-amber-400, oklch(.828 .189 84.429)); +} +.alert.alert__error[data-v-87f6de25] { + background-color: color-mix(in oklab, var(--color-rose-400, oklch(.712 .194 13.428)) 10%, transparent); + color: var(--color-rose-400, oklch(.712 .194 13.428)); +} +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@property --tw-backdrop-blur { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-brightness { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-contrast { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-grayscale { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-hue-rotate { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-invert { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-opacity { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-saturate { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-sepia { + syntax: "*"; + inherits: false +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.device-overview[data-v-f4165abd] { + align-content: flex-start; + gap: calc(var(--spacing, .25rem) * 4); + display: grid; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.server-overview[data-v-3109048f] { + align-content: flex-start; + gap: calc(var(--spacing, .25rem) * 4); + display: grid; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ + diff --git a/public/assets/DialogComp-Ba5-BUTe.js b/public/assets/DialogComp-Ba5-BUTe.js new file mode 100644 index 0000000..70496d5 --- /dev/null +++ b/public/assets/DialogComp-Ba5-BUTe.js @@ -0,0 +1,106 @@ +import { D as computed, c as createElementBlock, o as openBlock, v as renderSlot, q as normalizeClass, m as ref, b as onMounted, n as onUpdated, f as createBaseVNode, h as createVNode, w as withCtx, u as unref, E as IconX } from "./index-GNAKlyBz.js"; +const _hoisted_1$1 = ["href"]; +const _sfc_main$1 = { + __name: "ButtonComp", + props: { + href: String, + variant: String, + size: String + }, + setup(__props) { + const props = __props; + const classString = computed(() => { + let classes = "btn"; + if (props.variant) classes += ` btn__${props.variant}`; + if (props.size) classes += ` btn__${props.size}`; + return classes; + }); + return (_ctx, _cache) => { + return __props.href ? (openBlock(), createElementBlock("a", { + key: 0, + href: __props.href, + class: normalizeClass(classString.value) + }, [ + renderSlot(_ctx.$slots, "default") + ], 10, _hoisted_1$1)) : (openBlock(), createElementBlock("button", { + key: 1, + class: normalizeClass(classString.value) + }, [ + renderSlot(_ctx.$slots, "default") + ], 2)); + }; + } +}; +const _hoisted_1 = { class: "dialog-container" }; +const _sfc_main = { + __name: "DialogComp", + props: { + open: Boolean + }, + emits: ["onOpen", "onClose", "onToggle"], + setup(__props, { expose: __expose, emit: __emit }) { + const dialog = ref(null); + const openDialog = ref(); + const emit = __emit; + __expose({ toggleDialog }); + const props = __props; + onMounted(() => { + if (props.open === true) toggleDialog(props.open); + }); + onUpdated(() => { + if (props.open === true) toggleDialog(props.open); + }); + function toggleDialog(openToggle) { + if (openToggle) { + dialog.value.showModal(); + emit("onOpen"); + } else { + dialog.value.close(); + emit("onClose"); + } + openDialog.value = openToggle; + emit("onToggle"); + } + onMounted(() => { + openDialog.value = props.open; + if (dialog.value.innerHTML.includes("form")) { + dialog.value.querySelector("form").addEventListener("submit", () => { + toggleDialog(); + }); + } + }); + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1, [ + createBaseVNode("div", { + class: "trigger", + onClick: _cache[0] || (_cache[0] = ($event) => toggleDialog(true)) + }, [ + renderSlot(_ctx.$slots, "trigger") + ]), + createBaseVNode("dialog", { + ref_key: "dialog", + ref: dialog, + class: "mcrm-block block__dark" + }, [ + createVNode(_sfc_main$1, { + class: "dialog__close p-0", + variant: "ghost", + size: "sm", + tabindex: "-1", + onClick: _cache[1] || (_cache[1] = ($event) => toggleDialog(false)) + }, { + default: withCtx(() => [ + createVNode(unref(IconX)) + ]), + _: 1 + }), + renderSlot(_ctx.$slots, "content") + ], 512) + ]); + }; + } +}; +export { + _sfc_main$1 as _, + _sfc_main as a +}; diff --git a/public/assets/DialogComp-ByJn29_w.css b/public/assets/DialogComp-ByJn29_w.css new file mode 100644 index 0000000..a8db749 --- /dev/null +++ b/public/assets/DialogComp-ByJn29_w.css @@ -0,0 +1,357 @@ +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +button, .btn { + cursor: pointer; + align-items: center; + gap: calc(var(--spacing, .25rem) * 3); + border-radius: var(--radius-lg, .5rem); + border-style: var(--tw-border-style); + --tw-border-style: solid; + height: fit-content; + padding-inline: calc(var(--spacing, .25rem) * 4); + padding-block: calc(var(--spacing, .25rem) * 2); + --tw-font-weight: var(--font-weight-normal, 400); + font-weight: var(--font-weight-normal, 400); + --tw-tracking: var(--tracking-wide, .025em); + letter-spacing: var(--tracking-wide, .025em); + transition-property: all; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + border-style: solid; + border-width: 1px; + transition: border-color .1s ease-in-out, background-color .2s; + display: flex; +} +:is(button, .btn):not(.button__subtle, .button__ghost):hover { + --tw-shadow-color: var(--color-black, #000); +} +:is(button, .btn)[disabled], :is(button, .btn).disabled { + pointer-events: none; + cursor: not-allowed; + opacity: .5; +} +:is(button, .btn) svg { + width: calc(var(--spacing, .25rem) * 5); + height: calc(var(--spacing, .25rem) * 5); + transition-property: stroke; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + --tw-duration: .4s; + --tw-ease: var(--ease-in-out, cubic-bezier(.4, 0, .2, 1)); + transition-duration: .4s; + transition-timing-function: var(--ease-in-out, cubic-bezier(.4, 0, .2, 1)); +} +:is(button, .btn).btn__sm svg { + width: calc(var(--spacing, .25rem) * 4); + height: calc(var(--spacing, .25rem) * 4); +} +:is(button, .btn).btn__lg svg { + width: calc(var(--spacing, .25rem) * 6); + height: calc(var(--spacing, .25rem) * 6); +} +:is(button, .btn):hover { + color: var(--color-white, #fff) !important; +} +:is(button, .btn):hover svg { + stroke: var(--color-white, #fff) !important; +} +:is(button, .btn).btn__primary { + border-color: var(--color-sky-100, oklch(.951 .026 236.824)); + background-color: color-mix(in oklab, var(--color-sky-100, oklch(.951 .026 236.824)) 10%, transparent); + color: var(--color-sky-100, oklch(.951 .026 236.824)); +} +:is(button, .btn).btn__primary svg { + stroke: var(--color-sky-200, oklch(.901 .058 230.902)); +} +:is(button, .btn).btn__primary:hover { + border-color: var(--color-sky-300, oklch(.828 .111 230.318)); + background-color: color-mix(in oklab, var(--color-sky-400, oklch(.746 .16 232.661)) 40%, transparent); +} +:is(button, .btn).btn__secondary { + border-color: var(--color-amber-100, oklch(.962 .059 95.617)); + background-color: color-mix(in oklab, var(--color-amber-100, oklch(.962 .059 95.617)) 10%, transparent); + color: var(--color-amber-100, oklch(.962 .059 95.617)); +} +:is(button, .btn).btn__secondary svg { + stroke: var(--color-amber-300, oklch(.879 .169 91.605)); +} +:is(button, .btn).btn__secondary:hover { + border-color: var(--color-amber-400, oklch(.828 .189 84.429)); + background-color: color-mix(in oklab, var(--color-amber-400, oklch(.828 .189 84.429)) 40%, transparent); +} +:is(button, .btn).btn__danger { + border-color: var(--color-rose-100, oklch(.941 .03 12.58)); + background-color: color-mix(in oklab, var(--color-rose-200, oklch(.892 .058 10.001)) 20%, transparent); + color: var(--color-rose-200, oklch(.892 .058 10.001)); +} +:is(button, .btn).btn__danger svg { + stroke: var(--color-rose-400, oklch(.712 .194 13.428)); +} +:is(button, .btn).btn__danger:hover { + border-color: var(--color-rose-500, oklch(.645 .246 16.439)); + background-color: color-mix(in oklab, var(--color-rose-400, oklch(.712 .194 13.428)) 40%, transparent); + color: var(--color-white, #fff); +} +:is(button, .btn).btn__dark { + border-color: var(--color-slate-400, oklch(.704 .04 256.788)); + background-color: color-mix(in oklab, var(--color-slate-200, oklch(.929 .013 255.508)) 10%, transparent); + color: var(--color-slate-100, oklch(.968 .007 247.896)); +} +:is(button, .btn).btn__dark svg { + stroke: var(--color-slate-300, oklch(.869 .022 252.894)); +} +:is(button, .btn).btn__dark:hover { + border-color: var(--color-slate-200, oklch(.929 .013 255.508)); + background-color: color-mix(in oklab, var(--color-slate-400, oklch(.704 .04 256.788)) 40%, transparent); + color: var(--color-white, #fff); +} +:is(button, .btn).btn__success { + border-color: var(--color-lime-100, oklch(.967 .067 122.328)); + background-color: color-mix(in oklab, var(--color-lime-200, oklch(.938 .127 124.321)) 10%, transparent); + color: var(--color-lime-100, oklch(.967 .067 122.328)); +} +:is(button, .btn).btn__success svg { + stroke: var(--color-lime-400, oklch(.841 .238 128.85)); +} +:is(button, .btn).btn__success:hover { + border-color: var(--color-lime-500, oklch(.768 .233 130.85)); + background-color: color-mix(in oklab, var(--color-lime-400, oklch(.841 .238 128.85)) 40%, transparent); + color: var(--color-white, #fff); +} +:is(button, .btn).btn__subtle { + color: var(--color-white, #fff); + background-color: #0000; + border-color: #0000; +} +@media (hover: hover) { +:is(button, .btn).btn__subtle:hover { + background-color: color-mix(in oklab, var(--color-white, #fff) 10%, transparent); +} +} +:is(button, .btn).btn__subtle:hover { + border-color: color-mix(in oklab, var(--color-white, #fff) 40%, transparent); + background-color: color-mix(in oklab, var(--color-white, #fff) 20%, transparent); + --tw-gradient-to: color-mix(in oklab, var(--color-white, #fff) 30%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); +} +:is(button, .btn).btn__ghost { + color: color-mix(in oklab, var(--color-white, #fff) 80%, transparent); + background-color: #0000; + border-color: #0000; +} +@media (hover: hover) { +:is(button, .btn).btn__ghost:hover { + color: var(--color-white, #fff); +} +} +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@property --tw-font-weight { + syntax: "*"; + inherits: false +} +@property --tw-tracking { + syntax: "*"; + inherits: false +} +@property --tw-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-shadow-color { + syntax: "*"; + inherits: false +} +@property --tw-inset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-inset-shadow-color { + syntax: "*"; + inherits: false +} +@property --tw-ring-color { + syntax: "*"; + inherits: false +} +@property --tw-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-inset-ring-color { + syntax: "*"; + inherits: false +} +@property --tw-inset-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-ring-inset { + syntax: "*"; + inherits: false +} +@property --tw-ring-offset-width { + syntax: ""; + inherits: false; + initial-value: 0; +} +@property --tw-ring-offset-color { + syntax: "*"; + inherits: false; + initial-value: #fff; +} +@property --tw-ring-offset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-duration { + syntax: "*"; + inherits: false +} +@property --tw-ease { + syntax: "*"; + inherits: false +} +@property --tw-gradient-position { + syntax: "*"; + inherits: false +} +@property --tw-gradient-from { + syntax: ""; + inherits: false; + initial-value: #0000; +} +@property --tw-gradient-via { + syntax: ""; + inherits: false; + initial-value: #0000; +} +@property --tw-gradient-to { + syntax: ""; + inherits: false; + initial-value: #0000; +} +@property --tw-gradient-stops { + syntax: "*"; + inherits: false +} +@property --tw-gradient-via-stops { + syntax: "*"; + inherits: false +} +@property --tw-gradient-from-position { + syntax: ""; + inherits: false; + initial-value: 0%; +} +@property --tw-gradient-via-position { + syntax: ""; + inherits: false; + initial-value: 50%; +} +@property --tw-gradient-to-position { + syntax: ""; + inherits: false; + initial-value: 100%; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.dialog-container { + position: relative; +} +.dialog-container dialog { + pointer-events: none; + z-index: 50; + --tw-translate-x: calc(calc(1 / 2 * 100%) * -1); + max-width: calc(100vw - 2rem); + translate: var(--tw-translate-x) var(--tw-translate-y); + --tw-translate-y: calc(calc(1 / 2 * 100%) * -1); + translate: var(--tw-translate-x) var(--tw-translate-y); + color: var(--color-slate-200, oklch(.929 .013 255.508)); + position: fixed; + top: 50%; + left: 50%; +} +.dialog-container dialog[open] { + pointer-events: auto; +} +.dialog-container dialog::backdrop { + background-color: color-mix(in oklab, var(--color-black, #000) 50%, transparent); + --tw-backdrop-blur: blur(var(--blur-xs, 4px)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to, opacity, box-shadow, transform, translate, scale, rotate, filter, -webkit-backdrop-filter, backdrop-filter; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); +} +.dialog-container dialog .dialog__close { + top: calc(var(--spacing, .25rem) * 4); + right: calc(var(--spacing, .25rem) * 4); + padding: calc(var(--spacing, .25rem) * 0); + color: var(--color-white, #fff); + position: absolute; +} +.dialog-container dialog .dialog__close svg { + width: calc(var(--spacing, .25rem) * 5); + height: calc(var(--spacing, .25rem) * 5); +} +.dialog__content > :first-child { + padding-right: calc(var(--spacing, .25rem) * 8); +} +@property --tw-translate-x { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-y { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-z { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-backdrop-blur { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-brightness { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-contrast { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-grayscale { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-hue-rotate { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-invert { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-opacity { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-saturate { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-sepia { + syntax: "*"; + inherits: false +} diff --git a/public/assets/DialogComp-CyRyORDj.js b/public/assets/DialogComp-CyRyORDj.js deleted file mode 100644 index 4e73f8d..0000000 --- a/public/assets/DialogComp-CyRyORDj.js +++ /dev/null @@ -1,2 +0,0 @@ -import{a as i,o as r,b as v,d as _,e as k,g as c,L as d,k as u,j as C,u as b,U as $,l as B}from"./index-oAtpp-VZ.js";const x={class:"dialog-container"},L={__name:"DialogComp",props:{open:Boolean},emits:["onOpen","onClose","onToggle"],setup(p,{expose:g,emit:f}){const o=i(null),l=i(),t=f;g({toggleDialog:e});const s=p;r(()=>{s.open===!0&&e(s.open)}),v(()=>{s.open===!0&&e(s.open)});function e(n){n?(o.value.showModal(),t("onOpen")):(o.value.close(),t("onClose")),l.value=n,t("onToggle")}return r(()=>{l.value=s.open,o.value.innerHTML.includes("form")&&o.value.querySelector("form").addEventListener("submit",()=>{e()})}),(n,a)=>(k(),_("div",x,[c("div",{class:"trigger",onClick:a[0]||(a[0]=m=>e(!0))},[d(n.$slots,"trigger")]),c("dialog",{ref_key:"dialog",ref:o,class:"mcrm-block block__dark"},[u(B,{class:"dialog__close p-0",variant:"ghost",size:"sm",tabindex:"-1",onClick:a[1]||(a[1]=m=>e(!1))},{default:C(()=>[u(b($))]),_:1}),d(n.$slots,"content")],512)]))}};export{L as _}; -//# sourceMappingURL=DialogComp-CyRyORDj.js.map diff --git a/public/assets/DialogComp-CyRyORDj.js.map b/public/assets/DialogComp-CyRyORDj.js.map deleted file mode 100644 index 17d1fea..0000000 --- a/public/assets/DialogComp-CyRyORDj.js.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"file":"DialogComp-CyRyORDj.js","sources":["../../ui/src/components/base/DialogComp.vue"],"sourcesContent":["\n\n\n\n\n\n\n"],"names":["dialog","ref","openDialog","emit","__emit","__expose","toggleDialog","props","__props","onMounted","onUpdated","openToggle"],"mappings":"qQA8CA,MAAMA,EAASC,EAAI,IAAI,EACjBC,EAAaD,EAAG,EAEhBE,EAAOC,EAEbC,EAAa,CAAE,aAAAC,CAAc,CAAA,EAE7B,MAAMC,EAAQC,EAIdC,EAAU,IAAM,CACVF,EAAM,OAAS,IAAMD,EAAaC,EAAM,IAAI,CAClD,CAAC,EAEDG,EAAU,IAAM,CACVH,EAAM,OAAS,IAAMD,EAAaC,EAAM,IAAI,CAClD,CAAC,EAED,SAASD,EAAaK,EAAY,CAC5BA,GACFX,EAAO,MAAM,UAAS,EACtBG,EAAK,QAAQ,IAEbH,EAAO,MAAM,MAAK,EAClBG,EAAK,SAAS,GAGhBD,EAAW,MAAQS,EACnBR,EAAK,UAAU,CACjB,CAEA,OAAAM,EAAU,IAAM,CACdP,EAAW,MAAQK,EAAM,KAErBP,EAAO,MAAM,UAAU,SAAS,MAAM,GACxCA,EAAO,MAAM,cAAc,MAAM,EAAE,iBAAiB,SAAU,IAAM,CAClEM,EAAY,CACb,CAAA,CAEL,CAAC"} \ No newline at end of file diff --git a/public/assets/DialogComp-Dr-kHiJQ.css b/public/assets/DialogComp-Dr-kHiJQ.css deleted file mode 100644 index d31fe84..0000000 --- a/public/assets/DialogComp-Dr-kHiJQ.css +++ /dev/null @@ -1 +0,0 @@ -/*! tailwindcss v4.1.2 | MIT License | https://tailwindcss.com */@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-backdrop-blur:initial;--tw-backdrop-brightness:initial;--tw-backdrop-contrast:initial;--tw-backdrop-grayscale:initial;--tw-backdrop-hue-rotate:initial;--tw-backdrop-invert:initial;--tw-backdrop-opacity:initial;--tw-backdrop-saturate:initial;--tw-backdrop-sepia:initial}}}.dialog-container{position:relative}.dialog-container dialog{pointer-events:none;z-index:50;--tw-translate-x: -50% ;max-width:calc(100vw - 2rem);--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y);color:var(--color-slate-200,oklch(92.9% .013 255.508));position:fixed;top:50%;left:50%}.dialog-container dialog[open]{pointer-events:auto}.dialog-container dialog::backdrop{--tw-backdrop-blur:blur(var(--blur-xs,4px));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to,opacity,box-shadow,transform,translate,scale,rotate,filter,-webkit-backdrop-filter,backdrop-filter;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));background-color:#00000080}@supports (color:color-mix(in lab,red,red)){.dialog-container dialog::backdrop{background-color:color-mix(in oklab,var(--color-black,#000)50%,transparent)}}.dialog-container dialog .dialog__close{top:calc(var(--spacing,.25rem)*4);right:calc(var(--spacing,.25rem)*4);padding:calc(var(--spacing,.25rem)*0);color:var(--color-white,#fff);position:absolute}.dialog-container dialog .dialog__close svg{width:calc(var(--spacing,.25rem)*5);height:calc(var(--spacing,.25rem)*5)}.dialog__content>:first-child{padding-right:calc(var(--spacing,.25rem)*8)}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-backdrop-blur{syntax:"*";inherits:false}@property --tw-backdrop-brightness{syntax:"*";inherits:false}@property --tw-backdrop-contrast{syntax:"*";inherits:false}@property --tw-backdrop-grayscale{syntax:"*";inherits:false}@property --tw-backdrop-hue-rotate{syntax:"*";inherits:false}@property --tw-backdrop-invert{syntax:"*";inherits:false}@property --tw-backdrop-opacity{syntax:"*";inherits:false}@property --tw-backdrop-saturate{syntax:"*";inherits:false}@property --tw-backdrop-sepia{syntax:"*";inherits:false} diff --git a/public/assets/IconTrash-DtIpQ-M_.js b/public/assets/IconTrash-DtIpQ-M_.js deleted file mode 100644 index 6e8c1cc..0000000 --- a/public/assets/IconTrash-DtIpQ-M_.js +++ /dev/null @@ -1,17 +0,0 @@ -import{c as a}from"./index-oAtpp-VZ.js";/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var l=a("outline","device-floppy","IconDeviceFloppy",[["path",{d:"M6 4h10l4 4v10a2 2 0 0 1 -2 2h-12a2 2 0 0 1 -2 -2v-12a2 2 0 0 1 2 -2",key:"svg-0"}],["path",{d:"M12 14m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0",key:"svg-1"}],["path",{d:"M14 4l0 4l-6 0l0 -4",key:"svg-2"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var v=a("outline","pencil","IconPencil",[["path",{d:"M4 20h4l10.5 -10.5a2.828 2.828 0 1 0 -4 -4l-10.5 10.5v4",key:"svg-0"}],["path",{d:"M13.5 6.5l4 4",key:"svg-1"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var p=a("outline","trash","IconTrash",[["path",{d:"M4 7l16 0",key:"svg-0"}],["path",{d:"M10 11l0 6",key:"svg-1"}],["path",{d:"M14 11l0 6",key:"svg-2"}],["path",{d:"M5 7l1 12a2 2 0 0 0 2 2h8a2 2 0 0 0 2 -2l1 -12",key:"svg-3"}],["path",{d:"M9 7v-3a1 1 0 0 1 1 -1h4a1 1 0 0 1 1 1v3",key:"svg-4"}]]);export{p as I,l as a,v as b}; -//# sourceMappingURL=IconTrash-DtIpQ-M_.js.map diff --git a/public/assets/IconTrash-DtIpQ-M_.js.map b/public/assets/IconTrash-DtIpQ-M_.js.map deleted file mode 100644 index f65e4f6..0000000 --- a/public/assets/IconTrash-DtIpQ-M_.js.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"file":"IconTrash-DtIpQ-M_.js","sources":["../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconDeviceFloppy.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconPencil.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconTrash.mjs"],"sourcesContent":["/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconDeviceFloppy = createVueComponent(\"outline\", \"device-floppy\", \"IconDeviceFloppy\", [[\"path\", { \"d\": \"M6 4h10l4 4v10a2 2 0 0 1 -2 2h-12a2 2 0 0 1 -2 -2v-12a2 2 0 0 1 2 -2\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M12 14m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M14 4l0 4l-6 0l0 -4\", \"key\": \"svg-2\" }]]);\n\nexport { IconDeviceFloppy as default };\n//# sourceMappingURL=IconDeviceFloppy.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconPencil = createVueComponent(\"outline\", \"pencil\", \"IconPencil\", [[\"path\", { \"d\": \"M4 20h4l10.5 -10.5a2.828 2.828 0 1 0 -4 -4l-10.5 10.5v4\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M13.5 6.5l4 4\", \"key\": \"svg-1\" }]]);\n\nexport { IconPencil as default };\n//# sourceMappingURL=IconPencil.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconTrash = createVueComponent(\"outline\", \"trash\", \"IconTrash\", [[\"path\", { \"d\": \"M4 7l16 0\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M10 11l0 6\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M14 11l0 6\", \"key\": \"svg-2\" }], [\"path\", { \"d\": \"M5 7l1 12a2 2 0 0 0 2 2h8a2 2 0 0 0 2 -2l1 -12\", \"key\": \"svg-3\" }], [\"path\", { \"d\": \"M9 7v-3a1 1 0 0 1 1 -1h4a1 1 0 0 1 1 1v3\", \"key\": \"svg-4\" }]]);\n\nexport { IconTrash as default };\n//# sourceMappingURL=IconTrash.mjs.map\n"],"names":["IconDeviceFloppy","createVueComponent","IconPencil","IconTrash"],"mappings":"wCAAA;AAAA;AAAA;AAAA;AAAA;AAAA,GASG,IAACA,EAAmBC,EAAmB,UAAW,gBAAiB,mBAAoB,CAAC,CAAC,OAAQ,CAAE,EAAK,uEAAwE,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,2CAA4C,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,sBAAuB,IAAO,OAAS,CAAA,CAAC,CAAC,ECT9U;AAAA;AAAA;AAAA;AAAA;AAAA,GASG,IAACC,EAAaD,EAAmB,UAAW,SAAU,aAAc,CAAC,CAAC,OAAQ,CAAE,EAAK,0DAA2D,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,gBAAiB,IAAO,OAAO,CAAE,CAAC,CAAC,ECTzN;AAAA;AAAA;AAAA;AAAA;AAAA,GASG,IAACE,EAAYF,EAAmB,UAAW,QAAS,YAAa,CAAC,CAAC,OAAQ,CAAE,EAAK,YAAa,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,iDAAkD,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,2CAA4C,IAAO,OAAO,CAAE,CAAC,CAAC","x_google_ignoreList":[0,1,2]} \ No newline at end of file diff --git a/public/assets/MacrosView-B-ccNLSC.css b/public/assets/MacrosView-B-ccNLSC.css new file mode 100644 index 0000000..fb3f526 --- /dev/null +++ b/public/assets/MacrosView-B-ccNLSC.css @@ -0,0 +1,624 @@ +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.macro-overview[data-v-f9a187e3] { + grid-template-rows: auto 1fr; + display: grid; + position: relative; +} +.macro-overview[data-v-f9a187e3]:after { + top: calc(var(--spacing, .25rem) * 0); + background-color: var(--color-slate-600, oklch(.446 .043 257.281)); + --tw-content: ""; + content: var(--tw-content); + width: 1px; + height: 100%; + position: absolute; + left: 100%; +} +.macro-overview .macro-overview__list[data-v-f9a187e3] { + align-content: flex-start; + gap: calc(var(--spacing, .25rem) * 1); + display: grid; +} +.macro-overview .macro-item[data-v-f9a187e3] { + align-items: center; + display: flex; +} +.macro-overview .macro-item button[data-v-f9a187e3] { + width: 100%; +} +@property --tw-content { + syntax: "*"; + inherits: false; + initial-value: ""; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +kbd { + height: calc(var(--spacing, .25rem) * 9); + align-items: center; + gap: calc(var(--spacing, .25rem) * 2); + border-radius: var(--radius-md, .375rem); + border-style: var(--tw-border-style); + border-width: 1px; + border-color: var(--color-slate-500, oklch(.554 .046 257.417)); + background-color: var(--color-slate-700, oklch(.372 .044 257.287)); + padding-block: calc(var(--spacing, .25rem) * 1); + padding-right: calc(var(--spacing, .25rem) * 2); + padding-left: calc(var(--spacing, .25rem) * 4); + font-family: var(--font-mono, "Fira Code", monospace); + font-size: var(--text-lg, 1.125rem); + line-height: var(--tw-leading, var(--text-lg--line-height, calc(1.75 / 1.125))); + --tw-font-weight: var(--font-weight-bold, 700); + font-weight: var(--font-weight-bold, 700); + white-space: nowrap; + color: var(--color-white, #fff); + text-transform: uppercase; + --tw-shadow-color: var(--color-slate-500, oklch(.554 .046 257.417)); + transition-property: all; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + box-shadow: 0 .2rem 0 .2rem var(--tw-shadow-color); + display: flex; +} +kbd:has(sup) { + padding-left: calc(var(--spacing, .25rem) * 2); +} +kbd sup { + margin-top: calc(var(--spacing, .25rem) * 1); + font-size: var(--text-xs, .75rem); + line-height: var(--tw-leading, var(--text-xs--line-height, calc(1 / .75))); + --tw-font-weight: var(--font-weight-light, 300); + font-weight: var(--font-weight-light, 300); + color: var(--color-slate-200, oklch(.929 .013 255.508)); +} +kbd span.dir { + padding-left: calc(var(--spacing, .25rem) * 1); + color: var(--color-slate-200, oklch(.929 .013 255.508)); +} +kbd.empty { + cursor: pointer; + border-color: var(--color-sky-300, oklch(.828 .111 230.318)); + background-color: color-mix(in oklab, var(--color-sky-400, oklch(.746 .16 232.661)) 50%, transparent); + padding-right: calc(var(--spacing, .25rem) * 3); + padding-left: calc(var(--spacing, .25rem) * 3); + --tw-tracking: var(--tracking-widest, .1em); + letter-spacing: var(--tracking-widest, .1em); + --tw-shadow-color: var(--color-sky-600, oklch(.588 .158 241.966)); +} +kbd.insert { + cursor: pointer; + border-color: var(--color-yellow-300, oklch(.905 .182 98.111)); + background-color: color-mix(in oklab, var(--color-yellow-500, oklch(.795 .184 86.047)) 50%, transparent); + --tw-shadow-color: var(--color-yellow-600, oklch(.681 .162 75.834)); +} +:has(kdb):not(.edit) kbd { + pointer-events: none; + cursor: default; +} +.edit kbd { + pointer-events: auto; + cursor: pointer; +} +.edit kbd:hover, .edit kbd.active { + border-color: var(--color-sky-400, oklch(.746 .16 232.661)); + background-color: var(--color-sky-900, oklch(.391 .09 240.876)); + --tw-shadow-color: var(--color-sky-700, oklch(.5 .134 242.749)); +} +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@property --tw-font-weight { + syntax: "*"; + inherits: false +} +@property --tw-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-shadow-color { + syntax: "*"; + inherits: false +} +@property --tw-inset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-inset-shadow-color { + syntax: "*"; + inherits: false +} +@property --tw-ring-color { + syntax: "*"; + inherits: false +} +@property --tw-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-inset-ring-color { + syntax: "*"; + inherits: false +} +@property --tw-inset-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-ring-inset { + syntax: "*"; + inherits: false +} +@property --tw-ring-offset-width { + syntax: ""; + inherits: false; + initial-value: 0; +} +@property --tw-ring-offset-color { + syntax: "*"; + inherits: false; + initial-value: #fff; +} +@property --tw-ring-offset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-tracking { + syntax: "*"; + inherits: false +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +span.delay[data-v-05e04cbb] { + cursor: default; + border-radius: var(--radius-sm, .25rem); + border-style: var(--tw-border-style); + border-width: 1px; + border-color: var(--color-slate-400, oklch(.704 .04 256.788)); + background-color: var(--color-slate-500, oklch(.554 .046 257.417)); + padding-inline: calc(var(--spacing, .25rem) * 2); + padding-block: calc(var(--spacing, .25rem) * 1); + font-family: var(--font-sans, "Roboto", sans-serif); + font-size: var(--text-sm, .875rem); + line-height: var(--tw-leading, var(--text-sm--line-height, calc(1.25 / .875))); + --tw-font-weight: var(--font-weight-semibold, 600); + font-weight: var(--font-weight-semibold, 600); + color: var(--color-slate-950, oklch(.129 .042 264.695)); + align-items: center; + display: flex; +} +span.delay.preset[data-v-05e04cbb] { + border-color: color-mix(in oklab, var(--color-amber-300, oklch(.879 .169 91.605)) 80%, transparent); + background-color: color-mix(in oklab, var(--color-amber-100, oklch(.962 .059 95.617)) 60%, transparent); + color: var(--color-amber-400, oklch(.828 .189 84.429)); +} +span.delay i[data-v-05e04cbb] { + padding-left: calc(var(--spacing, .25rem) * 1); + --tw-font-weight: var(--font-weight-normal, 400); + font-weight: var(--font-weight-normal, 400); + opacity: .8; + font-style: normal; +} +.edit span.delay[data-v-05e04cbb] { + cursor: pointer; +} +.edit span.delay[data-v-05e04cbb]:hover, .edit span.delay.active[data-v-05e04cbb] { + border-color: var(--color-lime-500, oklch(.768 .233 130.85)); + background-color: var(--color-lime-700, oklch(.532 .157 131.589)); + color: var(--color-lime-200, oklch(.938 .127 124.321)); +} +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@property --tw-font-weight { + syntax: "*"; + inherits: false +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.macro-recorder__output[data-v-33cbf1af] { + top: calc(var(--spacing, .25rem) * 0); + left: calc(var(--spacing, .25rem) * 0); + align-items: center; + row-gap: calc(var(--spacing, .25rem) * 4); + height: fit-content; + padding: calc(var(--spacing, .25rem) * 4); + flex-wrap: wrap; + display: flex; + position: absolute; +} +hr.spacer[data-v-33cbf1af]:last-of-type { + display: none; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.recorder-input__container[data-v-9a99c4ac], .macro-recorder__input[data-v-9a99c4ac] { + inset: calc(var(--spacing, .25rem) * 0); + opacity: 0; + width: 100%; + height: 100%; + display: none; + position: absolute; +} +:is(.recorder-input__container, .macro-recorder__input).record[data-v-9a99c4ac] { + display: block; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.context-menu { + position: relative; +} +.context-menu .context-menu__content { + pointer-events: none; + z-index: 50; + margin-top: calc(var(--spacing, .25rem) * 2); + --tw-translate-y: -100%; + min-width: 100%; + translate: var(--tw-translate-x) var(--tw-translate-y); + border-radius: var(--radius-md, .375rem); + border-style: var(--tw-border-style); + border-width: 1px; + border-color: color-mix(in oklab, var(--color-white, #fff) 50%, transparent); + background-color: color-mix(in oklab, var(--color-slate-100, oklch(.968 .007 247.896)) 60%, transparent); + color: var(--color-slate-800, oklch(.279 .041 260.031)); + opacity: 0; + --tw-backdrop-blur: blur(var(--blur-3xl, 64px)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + transition-property: all; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + display: grid; + position: absolute; + top: 100%; +} +.context-menu .context-menu__content.open { + pointer-events: auto; + --tw-translate-y: calc(var(--spacing, .25rem) * 0); + translate: var(--tw-translate-x) var(--tw-translate-y); + opacity: 1; +} +.context-menu ul { + color: var(--color-slate-800, oklch(.279 .041 260.031)); +} +:where(.context-menu ul > :not(:last-child)) { + --tw-divide-y-reverse: 0; + border-bottom-style: var(--tw-border-style); + border-top-style: var(--tw-border-style); + border-top-width: calc(1px * var(--tw-divide-y-reverse)); + border-bottom-width: calc(1px * calc(1 - var(--tw-divide-y-reverse))); + border-color: var(--color-slate-300, oklch(.869 .022 252.894)); +} +.context-menu ul li { + cursor: pointer; + align-items: center; + gap: calc(var(--spacing, .25rem) * 2); + padding: calc(var(--spacing, .25rem) * 2); + display: flex; +} +@media (hover: hover) { +.context-menu ul li:hover { + background-color: color-mix(in oklab, var(--color-black, #000) 10%, transparent); +} +} +.context-menu ul li svg { + width: calc(var(--spacing, .25rem) * 5); + height: calc(var(--spacing, .25rem) * 5); +} +@property --tw-translate-x { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-y { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-z { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@property --tw-backdrop-blur { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-brightness { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-contrast { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-grayscale { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-hue-rotate { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-invert { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-opacity { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-saturate { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-sepia { + syntax: "*"; + inherits: false +} +@property --tw-divide-y-reverse { + syntax: "*"; + inherits: false; + initial-value: 0; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ + +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +button.selected[data-v-601167b6] { + background-color: var(--color-sky-500, oklch(.685 .169 237.323)); + --tw-ring-shadow: var(--tw-ring-inset, ) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color, currentColor); + box-shadow: var(--tw-inset-shadow), var(--tw-inset-ring-shadow), var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow); + --tw-ring-color: var(--color-sky-500, oklch(.685 .169 237.323)); + --tw-ring-offset-width: 1px; + --tw-ring-offset-shadow: var(--tw-ring-inset, ) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color); +} +@property --tw-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-shadow-color { + syntax: "*"; + inherits: false +} +@property --tw-inset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-inset-shadow-color { + syntax: "*"; + inherits: false +} +@property --tw-ring-color { + syntax: "*"; + inherits: false +} +@property --tw-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-inset-ring-color { + syntax: "*"; + inherits: false +} +@property --tw-inset-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-ring-inset { + syntax: "*"; + inherits: false +} +@property --tw-ring-offset-width { + syntax: ""; + inherits: false; + initial-value: 0; +} +@property --tw-ring-offset-color { + syntax: "*"; + inherits: false; + initial-value: #fff; +} +@property --tw-ring-offset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ + +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ + +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.insert-output[data-v-d2aab140] { + margin-bottom: calc(var(--spacing, .25rem) * 4); + justify-content: center; + align-items: center; + width: 100%; + display: flex; +} +.insert-key__direction[data-v-d2aab140] { + margin-top: calc(var(--spacing, .25rem) * 6); + justify-content: center; + gap: calc(var(--spacing, .25rem) * 2); + display: flex; +} +button.selected[data-v-d2aab140] { + background-color: var(--color-sky-500, oklch(.685 .169 237.323)); + --tw-ring-shadow: var(--tw-ring-inset, ) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color, currentColor); + box-shadow: var(--tw-inset-shadow), var(--tw-inset-ring-shadow), var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow); + --tw-ring-color: var(--color-sky-500, oklch(.685 .169 237.323)); + --tw-ring-offset-width: 1px; + --tw-ring-offset-shadow: var(--tw-ring-inset, ) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color); +} +@property --tw-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-shadow-color { + syntax: "*"; + inherits: false +} +@property --tw-inset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-inset-shadow-color { + syntax: "*"; + inherits: false +} +@property --tw-ring-color { + syntax: "*"; + inherits: false +} +@property --tw-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-inset-ring-color { + syntax: "*"; + inherits: false +} +@property --tw-inset-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +@property --tw-ring-inset { + syntax: "*"; + inherits: false +} +@property --tw-ring-offset-width { + syntax: ""; + inherits: false; + initial-value: 0; +} +@property --tw-ring-offset-color { + syntax: "*"; + inherits: false; + initial-value: #fff; +} +@property --tw-ring-offset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.macro-edit__dialogs[data-v-bf9e32be] { + flex-grow: 1; + justify-content: flex-end; + display: flex; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.macro-recorder__header[data-v-19251359] { + gap: calc(var(--spacing, .25rem) * 4); + width: 100%; + display: grid; +} +.macro-recorder__header .edit__buttons[data-v-19251359] { + justify-content: space-between; + gap: calc(var(--spacing, .25rem) * 2); + width: 100%; + display: flex; +} +.macro-recorder__header > div[data-v-19251359] { + align-items: flex-end; + gap: calc(var(--spacing, .25rem) * 2); + display: flex; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ + +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.macro-recorder__footer[data-v-fec5e8b6] { + justify-content: space-between; + gap: calc(var(--spacing, .25rem) * 2); + display: flex; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.macro-recorder { + height: 100%; +} +.recorder-interface { + gap: calc(var(--spacing, .25rem) * 4); + height: 100%; + transition-property: grid-template-rows; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + grid-template-rows: auto 1fr auto; + display: grid; +} +.recorder-interface__container { + border-radius: var(--radius-lg, .5rem); + border-style: var(--tw-border-style); + border-width: 1px; + border-color: var(--color-slate-600, oklch(.446 .043 257.281)); + background-color: color-mix(in oklab, var(--color-slate-950, oklch(.129 .042 264.695)) 50%, transparent); + width: 100%; + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + position: relative; + overflow: auto; +} +.recorder-interface__container.record { + border-color: var(--color-rose-300, oklch(.81 .117 11.638)); + background-color: color-mix(in oklab, var(--color-rose-400, oklch(.712 .194 13.428)) 10%, transparent); +} +.recorder-interface__container.edit { + border-color: var(--color-sky-300, oklch(.828 .111 230.318)); + background-color: color-mix(in oklab, var(--color-sky-900, oklch(.391 .09 240.876)) 10%, transparent); +} +#macro-name { + border-color: #0000; + border-bottom-color: var(--color-slate-300, oklch(.869 .022 252.894)); + width: 100%; + padding-block: calc(var(--spacing, .25rem) * 0); + font-size: var(--text-lg, 1.125rem); + line-height: var(--tw-leading, var(--text-lg--line-height, calc(1.75 / 1.125))); + outline-style: var(--tw-outline-style); + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + background-color: #0000; + border-radius: 0; + outline-width: 0; +} +#macro-name:focus { + border-color: #0000; + border-bottom-color: var(--color-sky-400, oklch(.746 .16 232.661)); + background-color: color-mix(in oklab, var(--color-sky-400, oklch(.746 .16 232.661)) 10%, transparent); +} +.disabled { + pointer-events: none; + cursor: not-allowed; + opacity: .5; +} +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@property --tw-outline-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.macro-panel__content[data-v-c7be9772] { + gap: calc(var(--spacing, .25rem) * 6); + padding-top: calc(var(--spacing, .25rem) * 2); + grid-template-columns: 25ch 1fr; + display: grid; +} diff --git a/public/assets/MacrosView-B-lS0uCi.css b/public/assets/MacrosView-B-lS0uCi.css deleted file mode 100644 index c5a05ec..0000000 --- a/public/assets/MacrosView-B-lS0uCi.css +++ /dev/null @@ -1 +0,0 @@ -@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-backdrop-blur:initial;--tw-backdrop-brightness:initial;--tw-backdrop-contrast:initial;--tw-backdrop-grayscale:initial;--tw-backdrop-hue-rotate:initial;--tw-backdrop-invert:initial;--tw-backdrop-opacity:initial;--tw-backdrop-saturate:initial;--tw-backdrop-sepia:initial}}}:scope:has(.loading-component){position:relative}.loading-component{inset:calc(var(--spacing,.25rem)*0);justify-content:center;align-items:center;gap:calc(var(--spacing,.25rem)*2);width:100%;height:100%;font-size:var(--text-sm,.875rem);line-height:var(--tw-leading,var(--text-sm--line-height,calc(1.25/.875)));--tw-backdrop-blur:blur(var(--blur-md,12px));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);background-color:#00000080;flex-direction:column;display:flex;position:absolute}@supports (color:color-mix(in lab,red,red)){.loading-component{background-color:color-mix(in oklab,var(--color-black,#000)50%,transparent)}}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){[data-v-07eda649],[data-v-07eda649]:before,[data-v-07eda649]:after,[data-v-07eda649]::backdrop{--tw-content:"";--tw-duration:initial}}}.macro-overview[data-v-07eda649]{grid-template-rows:auto 1fr;display:grid;position:relative}.macro-overview[data-v-07eda649]:after{top:calc(var(--spacing,.25rem)*0);background-color:var(--color-slate-600,oklch(44.6% .043 257.281));--tw-content:"";content:var(--tw-content);width:1px;height:100%;position:absolute;left:100%}.macro-overview .macro-overview__list[data-v-07eda649]{margin-right:calc(var(--spacing,.25rem)*-1);gap:calc(var(--spacing,.25rem)*1);height:calc(100vh - 11.7rem);padding-right:calc(var(--spacing,.25rem)*1);flex-direction:column;display:flex;overflow:auto}.macro-overview .macro-item[data-v-07eda649]{transition-property:grid-template-columns;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));--tw-duration:.3s;grid-template-columns:1fr 0fr;align-items:center;transition-duration:.3s;transition-delay:0s;display:grid}.macro-overview .macro-item[data-v-07eda649]:hover{grid-template-columns:1fr auto;transition-delay:.5s}.macro-overview .macro-item button.overview__macro-open[data-v-07eda649]{grid-template-columns:1rem 1fr;justify-items:start;width:100%;display:grid}.macro-overview .macro-item button.overview__macro-open span[data-v-07eda649]{text-overflow:ellipsis;white-space:nowrap;text-align:left;width:100%;overflow:hidden}.macro-overview .macro-item div.overview__macro-delete[data-v-07eda649]{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to,opacity,box-shadow,transform,translate,scale,rotate,filter,-webkit-backdrop-filter,backdrop-filter;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));display:grid;overflow:hidden}@property --tw-content{syntax:"*";inherits:false;initial-value:""}@property --tw-duration{syntax:"*";inherits:false}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-border-style:solid;--tw-font-weight:initial;--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000;--tw-tracking:initial}}}kbd{height:calc(var(--spacing,.25rem)*9);align-items:center;gap:calc(var(--spacing,.25rem)*2);border-radius:var(--radius-md,.375rem);border-style:var(--tw-border-style);border-width:1px;border-color:var(--color-slate-500,oklch(55.4% .046 257.417));background-color:var(--color-slate-700,oklch(37.2% .044 257.287));padding-block:calc(var(--spacing,.25rem)*1);padding-right:calc(var(--spacing,.25rem)*2);padding-left:calc(var(--spacing,.25rem)*4);font-family:var(--font-mono,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-size:var(--text-lg,1.125rem);line-height:var(--tw-leading,var(--text-lg--line-height,calc(1.75/1.125)));--tw-font-weight:var(--font-weight-bold,700);font-weight:var(--font-weight-bold,700);white-space:nowrap;color:var(--color-white,#fff);text-transform:uppercase;--tw-shadow-color:oklch(55.4% .046 257.417);transition-property:all;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));box-shadow:0 .2rem 0 .2rem var(--tw-shadow-color);display:flex}@supports (color:color-mix(in lab,red,red)){kbd{--tw-shadow-color:color-mix(in oklab,var(--color-slate-500,oklch(55.4% .046 257.417))var(--tw-shadow-alpha),transparent)}}kbd:has(sup){padding-left:calc(var(--spacing,.25rem)*2)}kbd sup{margin-top:calc(var(--spacing,.25rem)*1);font-size:var(--text-xs,.75rem);line-height:var(--tw-leading,var(--text-xs--line-height,calc(1/.75)));--tw-font-weight:var(--font-weight-light,300);font-weight:var(--font-weight-light,300);color:var(--color-slate-200,oklch(92.9% .013 255.508))}kbd span.dir{padding-left:calc(var(--spacing,.25rem)*1);color:var(--color-slate-200,oklch(92.9% .013 255.508))}kbd.empty{cursor:pointer;border-color:var(--color-sky-300,oklch(82.8% .111 230.318));padding-right:calc(var(--spacing,.25rem)*3);padding-left:calc(var(--spacing,.25rem)*3);--tw-tracking:var(--tracking-widest,.1em);letter-spacing:var(--tracking-widest,.1em);--tw-shadow-color:oklch(58.8% .158 241.966);background-color:#00bcfe80}@supports (color:color-mix(in lab,red,red)){kbd.empty{background-color:color-mix(in oklab,var(--color-sky-400,oklch(74.6% .16 232.661))50%,transparent);--tw-shadow-color:color-mix(in oklab,var(--color-sky-600,oklch(58.8% .158 241.966))var(--tw-shadow-alpha),transparent)}}kbd.insert{cursor:pointer;border-color:var(--color-yellow-300,oklch(90.5% .182 98.111));--tw-shadow-color:oklch(68.1% .162 75.834);background-color:#edb20080}@supports (color:color-mix(in lab,red,red)){kbd.insert{background-color:color-mix(in oklab,var(--color-yellow-500,oklch(79.5% .184 86.047))50%,transparent);--tw-shadow-color:color-mix(in oklab,var(--color-yellow-600,oklch(68.1% .162 75.834))var(--tw-shadow-alpha),transparent)}}:has(kdb):not(.edit) kbd{pointer-events:none;cursor:default}.edit kbd{pointer-events:auto;cursor:pointer}.edit kbd:hover,.edit kbd.active{border-color:var(--color-sky-400,oklch(74.6% .16 232.661));background-color:var(--color-sky-900,oklch(39.1% .09 240.876));--tw-shadow-color:oklch(50% .134 242.749)}@supports (color:color-mix(in lab,red,red)){:is(.edit kbd:hover,.edit kbd.active){--tw-shadow-color:color-mix(in oklab,var(--color-sky-700,oklch(50% .134 242.749))var(--tw-shadow-alpha),transparent)}}@property --tw-tracking{syntax:"*";inherits:false}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){[data-v-eb548d44],[data-v-eb548d44]:before,[data-v-eb548d44]:after,[data-v-eb548d44]::backdrop{--tw-border-style:solid;--tw-font-weight:initial}}}span.delay[data-v-eb548d44]{cursor:default;border-radius:var(--radius-sm,.25rem);border-style:var(--tw-border-style);border-width:1px;border-color:var(--color-slate-400,oklch(70.4% .04 256.788));background-color:var(--color-slate-500,oklch(55.4% .046 257.417));padding-inline:calc(var(--spacing,.25rem)*2);padding-block:calc(var(--spacing,.25rem)*1);font-family:var(--font-sans,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-size:var(--text-sm,.875rem);line-height:var(--tw-leading,var(--text-sm--line-height,calc(1.25/.875)));--tw-font-weight:var(--font-weight-semibold,600);font-weight:var(--font-weight-semibold,600);color:var(--color-slate-950,oklch(12.9% .042 264.695));align-items:center;display:flex}span.delay.preset[data-v-eb548d44]{color:var(--color-amber-400,oklch(82.8% .189 84.429));background-color:#fef3c699;border-color:#ffd236cc}@supports (color:color-mix(in lab,red,red)){span.delay.preset[data-v-eb548d44]{border-color:color-mix(in oklab,var(--color-amber-300,oklch(87.9% .169 91.605))80%,transparent);background-color:color-mix(in oklab,var(--color-amber-100,oklch(96.2% .059 95.617))60%,transparent)}}span.delay i[data-v-eb548d44]{padding-left:calc(var(--spacing,.25rem)*1);--tw-font-weight:var(--font-weight-normal,400);font-weight:var(--font-weight-normal,400);opacity:.8;font-style:normal}.edit span.delay[data-v-eb548d44]{cursor:pointer}.edit span.delay[data-v-eb548d44]:hover,.edit span.delay.active[data-v-eb548d44]{border-color:var(--color-lime-500,oklch(76.8% .233 130.85));background-color:var(--color-lime-700,oklch(53.2% .157 131.589));color:var(--color-lime-200,oklch(93.8% .127 124.321))}@property --tw-font-weight{syntax:"*";inherits:false}.macro-recorder__output[data-v-bfb55e2e]{top:calc(var(--spacing,.25rem)*0);left:calc(var(--spacing,.25rem)*0);align-items:center;row-gap:calc(var(--spacing,.25rem)*4);height:fit-content;padding:calc(var(--spacing,.25rem)*4);flex-wrap:wrap;display:flex;position:absolute}hr.spacer[data-v-bfb55e2e]:last-of-type{display:none}.recorder-input__container[data-v-f1475559],.macro-recorder__input[data-v-f1475559]{inset:calc(var(--spacing,.25rem)*0);opacity:0;width:100%;height:100%;display:none;position:absolute}:is(.recorder-input__container,.macro-recorder__input).record[data-v-f1475559]{display:block}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-border-style:solid;--tw-backdrop-blur:initial;--tw-backdrop-brightness:initial;--tw-backdrop-contrast:initial;--tw-backdrop-grayscale:initial;--tw-backdrop-hue-rotate:initial;--tw-backdrop-invert:initial;--tw-backdrop-opacity:initial;--tw-backdrop-saturate:initial;--tw-backdrop-sepia:initial;--tw-divide-y-reverse:0}}}.context-menu{position:relative}.context-menu .context-menu__content{pointer-events:none;z-index:50;margin-top:calc(var(--spacing,.25rem)*2);--tw-translate-y:-100%;min-width:100%;translate:var(--tw-translate-x)var(--tw-translate-y);border-radius:var(--radius-md,.375rem);border-style:var(--tw-border-style);color:var(--color-slate-800,oklch(27.9% .041 260.031));opacity:0;--tw-backdrop-blur:blur(var(--blur-3xl,64px));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);transition-property:all;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));background-color:#f1f5f999;border-width:1px;border-color:#ffffff80;display:grid;position:absolute;top:100%}@supports (color:color-mix(in lab,red,red)){.context-menu .context-menu__content{border-color:color-mix(in oklab,var(--color-white,#fff)50%,transparent);background-color:color-mix(in oklab,var(--color-slate-100,oklch(96.8% .007 247.896))60%,transparent)}}.context-menu .context-menu__content.open{pointer-events:auto;--tw-translate-y:calc(var(--spacing,.25rem)*0);translate:var(--tw-translate-x)var(--tw-translate-y);opacity:1}.context-menu ul{color:var(--color-slate-800,oklch(27.9% .041 260.031))}:where(.context-menu ul>:not(:last-child)){--tw-divide-y-reverse:0;border-bottom-style:var(--tw-border-style);border-top-style:var(--tw-border-style);border-top-width:calc(1px*var(--tw-divide-y-reverse));border-bottom-width:calc(1px*calc(1 - var(--tw-divide-y-reverse)));border-color:var(--color-slate-300,oklch(86.9% .022 252.894))}.context-menu ul li{cursor:pointer;align-items:center;gap:calc(var(--spacing,.25rem)*2);padding:calc(var(--spacing,.25rem)*2);display:flex}@media (hover:hover){.context-menu ul li:hover{background-color:#0000001a}@supports (color:color-mix(in lab,red,red)){.context-menu ul li:hover{background-color:color-mix(in oklab,var(--color-black,#000)10%,transparent)}}}.context-menu ul li svg{width:calc(var(--spacing,.25rem)*5);height:calc(var(--spacing,.25rem)*5)}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-backdrop-blur{syntax:"*";inherits:false}@property --tw-backdrop-brightness{syntax:"*";inherits:false}@property --tw-backdrop-contrast{syntax:"*";inherits:false}@property --tw-backdrop-grayscale{syntax:"*";inherits:false}@property --tw-backdrop-hue-rotate{syntax:"*";inherits:false}@property --tw-backdrop-invert{syntax:"*";inherits:false}@property --tw-backdrop-opacity{syntax:"*";inherits:false}@property --tw-backdrop-saturate{syntax:"*";inherits:false}@property --tw-backdrop-sepia{syntax:"*";inherits:false}@property --tw-divide-y-reverse{syntax:"*";inherits:false;initial-value:0}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){[data-v-ba580ef2],[data-v-ba580ef2]:before,[data-v-ba580ef2]:after,[data-v-ba580ef2]::backdrop{--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000}}}button.selected[data-v-ba580ef2]{background-color:var(--color-sky-500,oklch(68.5% .169 237.323));--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(2px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow);--tw-ring-color:var(--color-sky-500,oklch(68.5% .169 237.323));--tw-ring-offset-width:1px;--tw-ring-offset-shadow:var(--tw-ring-inset,)0 0 0 var(--tw-ring-offset-width)var(--tw-ring-offset-color)}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){[data-v-046a1063],[data-v-046a1063]:before,[data-v-046a1063]:after,[data-v-046a1063]::backdrop{--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000}}}.insert-output[data-v-046a1063]{margin-bottom:calc(var(--spacing,.25rem)*4);justify-content:center;align-items:center;width:100%;display:flex}.insert-key__direction[data-v-046a1063]{margin-top:calc(var(--spacing,.25rem)*6);justify-content:center;gap:calc(var(--spacing,.25rem)*2);display:flex}button.selected[data-v-046a1063]{background-color:var(--color-sky-500,oklch(68.5% .169 237.323));--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(2px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow);--tw-ring-color:var(--color-sky-500,oklch(68.5% .169 237.323));--tw-ring-offset-width:1px;--tw-ring-offset-shadow:var(--tw-ring-inset,)0 0 0 var(--tw-ring-offset-width)var(--tw-ring-offset-color)}@property --tw-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-shadow-color{syntax:"*";inherits:false}@property --tw-shadow-alpha{syntax:"";inherits:false;initial-value:100%}@property --tw-inset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-shadow-color{syntax:"*";inherits:false}@property --tw-inset-shadow-alpha{syntax:"";inherits:false;initial-value:100%}@property --tw-ring-color{syntax:"*";inherits:false}@property --tw-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-ring-color{syntax:"*";inherits:false}@property --tw-inset-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-ring-inset{syntax:"*";inherits:false}@property --tw-ring-offset-width{syntax:"";inherits:false;initial-value:0}@property --tw-ring-offset-color{syntax:"*";inherits:false;initial-value:#fff}@property --tw-ring-offset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}.macro-edit__dialogs[data-v-2ff36c22]{flex-grow:1;justify-content:flex-end;display:flex}.macro-recorder__header[data-v-f2d09e68]{gap:calc(var(--spacing,.25rem)*4);width:100%;display:grid}.macro-recorder__header .edit__buttons[data-v-f2d09e68]{justify-content:space-between;gap:calc(var(--spacing,.25rem)*2);width:100%;display:flex}.macro-recorder__header>div[data-v-f2d09e68]{align-items:flex-end;gap:calc(var(--spacing,.25rem)*2);display:flex}.macro-recorder__footer[data-v-0a809300]{justify-content:space-between;gap:calc(var(--spacing,.25rem)*2);display:flex}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-border-style:solid;--tw-outline-style:solid}}}.macro-recorder{height:100%}.recorder-interface{gap:calc(var(--spacing,.25rem)*4);height:100%;transition-property:grid-template-rows;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));grid-template-rows:auto 1fr auto;display:grid}.recorder-interface__container{border-radius:var(--radius-lg,.5rem);border-style:var(--tw-border-style);border-width:1px;border-color:var(--color-slate-600,oklch(44.6% .043 257.281));width:100%;transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));background-color:#02061880;position:relative;overflow:auto}@supports (color:color-mix(in lab,red,red)){.recorder-interface__container{background-color:color-mix(in oklab,var(--color-slate-950,oklch(12.9% .042 264.695))50%,transparent)}}.recorder-interface__container.record{border-color:var(--color-rose-300,oklch(81% .117 11.638));background-color:#ff667f1a}@supports (color:color-mix(in lab,red,red)){.recorder-interface__container.record{background-color:color-mix(in oklab,var(--color-rose-400,oklch(71.2% .194 13.428))10%,transparent)}}.recorder-interface__container.edit{border-color:var(--color-sky-300,oklch(82.8% .111 230.318));background-color:#024a701a}@supports (color:color-mix(in lab,red,red)){.recorder-interface__container.edit{background-color:color-mix(in oklab,var(--color-sky-900,oklch(39.1% .09 240.876))10%,transparent)}}#macro-name{border-color:#0000;border-bottom-color:var(--color-slate-300,oklch(86.9% .022 252.894));width:100%;padding-block:calc(var(--spacing,.25rem)*0);font-size:var(--text-lg,1.125rem);line-height:var(--tw-leading,var(--text-lg--line-height,calc(1.75/1.125)));outline-style:var(--tw-outline-style);transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));background-color:#0000;border-radius:0;outline-width:0}#macro-name:focus{border-color:#0000;border-bottom-color:var(--color-sky-400,oklch(74.6% .16 232.661));background-color:#00bcfe1a}@supports (color:color-mix(in lab,red,red)){#macro-name:focus{background-color:color-mix(in oklab,var(--color-sky-400,oklch(74.6% .16 232.661))10%,transparent)}}.disabled{pointer-events:none;cursor:not-allowed;opacity:.5}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-outline-style{syntax:"*";inherits:false;initial-value:solid}/*! tailwindcss v4.1.2 | MIT License | https://tailwindcss.com */.macro-panel__content[data-v-fc7e8117]{gap:calc(var(--spacing,.25rem)*6);padding-top:calc(var(--spacing,.25rem)*2);grid-template-columns:25ch 1fr;display:grid} diff --git a/public/assets/MacrosView-Bf1eb3go.js b/public/assets/MacrosView-Bf1eb3go.js new file mode 100644 index 0000000..5028ea7 --- /dev/null +++ b/public/assets/MacrosView-Bf1eb3go.js @@ -0,0 +1,1419 @@ +import { a as createVueComponent, _ as _export_sfc, r as reactive, b as onMounted, d as axios, e as appUrl, c as createElementBlock, f as createBaseVNode, F as Fragment, g as renderList, o as openBlock, h as createVNode, w as withCtx, i as createTextVNode, u as unref, I as IconKeyboard, t as toDisplayString, j as withModifiers, k as isLocal, A as AuthCall, l as defineStore, m as ref, n as onUpdated, p as createCommentVNode, q as normalizeClass, s as createBlock, v as renderSlot, x as withDirectives, y as vModelText } from "./index-GNAKlyBz.js"; +import { _ as _sfc_main$h, a as _sfc_main$i } from "./DialogComp-Ba5-BUTe.js"; +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconAlarm = createVueComponent("outline", "alarm", "IconAlarm", [["path", { "d": "M12 13m-7 0a7 7 0 1 0 14 0a7 7 0 1 0 -14 0", "key": "svg-0" }], ["path", { "d": "M12 10l0 3l2 0", "key": "svg-1" }], ["path", { "d": "M7 4l-2.75 2", "key": "svg-2" }], ["path", { "d": "M17 4l2.75 2", "key": "svg-3" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconArrowLeftCircle = createVueComponent("outline", "arrow-left-circle", "IconArrowLeftCircle", [["path", { "d": "M17 12h-14", "key": "svg-0" }], ["path", { "d": "M6 9l-3 3l3 3", "key": "svg-1" }], ["path", { "d": "M19 12m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconArrowRightCircle = createVueComponent("outline", "arrow-right-circle", "IconArrowRightCircle", [["path", { "d": "M18 15l3 -3l-3 -3", "key": "svg-0" }], ["path", { "d": "M5 12m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0", "key": "svg-1" }], ["path", { "d": "M7 12h14", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconDeviceFloppy = createVueComponent("outline", "device-floppy", "IconDeviceFloppy", [["path", { "d": "M6 4h10l4 4v10a2 2 0 0 1 -2 2h-12a2 2 0 0 1 -2 -2v-12a2 2 0 0 1 2 -2", "key": "svg-0" }], ["path", { "d": "M12 14m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0", "key": "svg-1" }], ["path", { "d": "M14 4l0 4l-6 0l0 -4", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconPencil = createVueComponent("outline", "pencil", "IconPencil", [["path", { "d": "M4 20h4l10.5 -10.5a2.828 2.828 0 1 0 -4 -4l-10.5 10.5v4", "key": "svg-0" }], ["path", { "d": "M13.5 6.5l4 4", "key": "svg-1" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconPlus = createVueComponent("outline", "plus", "IconPlus", [["path", { "d": "M12 5l0 14", "key": "svg-0" }], ["path", { "d": "M5 12l14 0", "key": "svg-1" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconRestore = createVueComponent("outline", "restore", "IconRestore", [["path", { "d": "M3.06 13a9 9 0 1 0 .49 -4.087", "key": "svg-0" }], ["path", { "d": "M3 4.001v5h5", "key": "svg-1" }], ["path", { "d": "M12 12m-1 0a1 1 0 1 0 2 0a1 1 0 1 0 -2 0", "key": "svg-2" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconTimeDuration15 = createVueComponent("outline", "time-duration-15", "IconTimeDuration15", [["path", { "d": "M12 15h2a1 1 0 0 0 1 -1v-1a1 1 0 0 0 -1 -1h-2v-3h3", "key": "svg-0" }], ["path", { "d": "M9 9v6", "key": "svg-1" }], ["path", { "d": "M3 12v.01", "key": "svg-2" }], ["path", { "d": "M12 21v.01", "key": "svg-3" }], ["path", { "d": "M7.5 4.2v.01", "key": "svg-4" }], ["path", { "d": "M16.5 19.8v.01", "key": "svg-5" }], ["path", { "d": "M7.5 19.8v.01", "key": "svg-6" }], ["path", { "d": "M4.2 16.5v.01", "key": "svg-7" }], ["path", { "d": "M19.8 16.5v.01", "key": "svg-8" }], ["path", { "d": "M4.2 7.5v.01", "key": "svg-9" }], ["path", { "d": "M21 12a9 9 0 0 0 -9 -9", "key": "svg-10" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconTrash = createVueComponent("outline", "trash", "IconTrash", [["path", { "d": "M4 7l16 0", "key": "svg-0" }], ["path", { "d": "M10 11l0 6", "key": "svg-1" }], ["path", { "d": "M14 11l0 6", "key": "svg-2" }], ["path", { "d": "M5 7l1 12a2 2 0 0 0 2 2h8a2 2 0 0 0 2 -2l1 -12", "key": "svg-3" }], ["path", { "d": "M9 7v-3a1 1 0 0 1 1 -1h4a1 1 0 0 1 1 1v3", "key": "svg-4" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconPlayerRecordFilled = createVueComponent("filled", "player-record-filled", "IconPlayerRecordFilled", [["path", { "d": "M8 5.072a8 8 0 1 1 -3.995 7.213l-.005 -.285l.005 -.285a8 8 0 0 1 3.995 -6.643z", "key": "svg-0" }]]); +/** + * @license @tabler/icons-vue v3.30.0 - MIT + * + * This source code is licensed under the MIT license. + * See the LICENSE file in the root directory of this source tree. + */ +var IconPlayerStopFilled = createVueComponent("filled", "player-stop-filled", "IconPlayerStopFilled", [["path", { "d": "M17 4h-10a3 3 0 0 0 -3 3v10a3 3 0 0 0 3 3h10a3 3 0 0 0 3 -3v-10a3 3 0 0 0 -3 -3z", "key": "svg-0" }]]); +const _hoisted_1$d = { class: "macro-overview mcrm-block block__dark" }; +const _hoisted_2$b = { class: "macro-overview__list" }; +const _sfc_main$g = { + __name: "MacroOverview", + setup(__props) { + const macros = reactive({ + list: [] + }); + onMounted(() => { + axios.post(appUrl() + "/macro/list").then((data) => { + if (data.data.length > 0) macros.list = data.data; + }); + }); + function runMacro(macro) { + const data = isLocal() ? { macro } : AuthCall({ macro }); + axios.post(appUrl() + "/macro/play", data).then((data2) => { + console.log(data2); + }); + } + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$d, [ + _cache[0] || (_cache[0] = createBaseVNode("h4", { class: "border-b-2 border-transparent" }, "Saved Macros", -1)), + createBaseVNode("div", _hoisted_2$b, [ + (openBlock(true), createElementBlock(Fragment, null, renderList(macros.list, (macro, i) => { + return openBlock(), createElementBlock("div", { + class: "macro-item", + key: i + }, [ + createVNode(_sfc_main$h, { + variant: "dark", + class: "w-full", + size: "sm", + onClick: withModifiers(($event) => runMacro(macro), ["prevent"]) + }, { + default: withCtx(() => [ + createVNode(unref(IconKeyboard)), + createTextVNode(" " + toDisplayString(macro), 1) + ]), + _: 2 + }, 1032, ["onClick"]) + ]); + }), 128)) + ]) + ]); + }; + } +}; +const MacroOverview = /* @__PURE__ */ _export_sfc(_sfc_main$g, [["__scopeId", "data-v-f9a187e3"]]); +const keyMap = { + // Modifier keys + Control: "Ctrl", + Shift: "Shift", + Alt: "Alt", + Meta: "Win", + CapsLock: "Caps", + // Special keys + PageUp: "PgUp", + PageDown: "PgDn", + ScrollLock: "Scr Lk", + Insert: "Ins", + Delete: "Del", + Escape: "Esc", + Space: "Space", + // Symbol keys + Backquote: "`", + Backslash: "\\", + BracketLeft: "[", + BracketRight: "]", + Comma: ",", + Equal: "=", + Minus: "-", + Period: ".", + Quote: "'", + Semicolon: ";", + Slash: "/", + // Arrow keys + ArrowUp: "▲", + ArrowRight: "▶", + ArrowDown: "▼", + ArrowLeft: "◀", + // Media keys + MediaPlayPause: "Play", + MediaStop: "Stop", + MediaTrackNext: "Next", + MediaTrackPrevious: "Prev", + MediaVolumeDown: "Down", + MediaVolumeUp: "Up", + AudioVolumeMute: "Mute", + AudioVolumeDown: "Down", + AudioVolumeUp: "Up" +}; +const filterKey = (e) => { + const k = {}; + if (e.location === 1) k.loc = "left"; + if (e.location === 2) k.loc = "right"; + if (e.location === 3) k.loc = "num"; + if (e.key.includes("Media") || e.key.includes("Audio")) k.loc = mediaPrefix(e); + if (keyMap[e.code] || keyMap[e.key]) { + k.str = keyMap[e.code] || keyMap[e.key]; + } else { + k.str = e.key.toLowerCase(); + } + return k; +}; +const mediaPrefix = (e) => { + switch (e.key) { + case "MediaPlayPause": + case "MediaStop": + case "MediaTrackNext": + case "MediaTrackPrevious": + return "Media"; + case "MediaVolumeDown": + case "MediaVolumeUp": + case "AudioVolumeDown": + case "AudioVolumeUp": + case "AudioVolumeMute": + return "Volume"; + } +}; +const isRepeat = (lastStep, e, direction) => { + return lastStep && lastStep.type === "key" && lastStep.code === e.code && lastStep.direction === direction; +}; +const invalidMacro = (steps) => { + const downKeys = []; + const upKeys = []; + Object.keys(steps).forEach((stepKey) => { + const step = steps[stepKey]; + if (step.type !== "key") return; + if (step.direction == "down") downKeys.push(step.key); + if (step.direction == "up") { + if (!downKeys.includes(step.key)) upKeys.push(step.key); + else downKeys.splice(downKeys.indexOf(step.key), 1); + } + }); + if (upKeys.length === 0 && downKeys.length === 0) return false; + return { down: downKeys, up: upKeys }; +}; +const useMacroRecorderStore = defineStore("macrorecorder", () => { + const state = ref({ + record: false, + edit: false, + editKey: false, + editDelay: false, + validationErrors: false + }); + const macroName = ref(""); + const steps = ref([]); + const delay = ref({ + start: 0, + fixed: false + }); + const getEditKey = () => steps.value[state.value.editKey]; + const getAdjacentKey = (pos, includeDelay = false) => { + let returnVal = false; + const mod = pos == "before" ? -1 : 1; + const keyIndex = state.value.editKey + 2 * mod; + const delayIndex = includeDelay ? state.value.editKey + 1 * mod : false; + if (steps.value[keyIndex]) returnVal = steps.value[keyIndex]; + if (delayIndex && steps.value[delayIndex]) + returnVal = { + delay: steps.value[delayIndex], + key: steps.value[keyIndex], + delayIndex + }; + return returnVal; + }; + const getEditDelay = () => steps.value[state.value.editDelay]; + const recordStep = (e, direction = false, key = false) => { + const lastStep = steps.value[steps.value.length - 1]; + let stepVal = {}; + if (typeof e === "object" && !isRepeat(lastStep, e, direction)) { + if (key === false) recordDelay(); + stepVal = { + type: "key", + key: e.key, + code: e.code, + location: e.location, + direction, + keyObj: filterKey(e) + }; + } else if (direction && key !== false) { + stepVal = steps.value[key]; + stepVal.direction = direction; + } else if (typeof e === "number") { + stepVal = { type: "delay", value: parseFloat(e.toFixed()) }; + } + if (key !== false) steps.value[key] = stepVal; + else steps.value.push(stepVal); + }; + const recordDelay = () => { + if (delay.value.fixed !== false) + recordStep(delay.value.fixed); + else if (delay.value.start == 0) + delay.value.start = performance.now(); + else { + recordStep(performance.now() - delay.value.start); + delay.value.start = performance.now(); + } + }; + const insertKey = (e, direction, adjacentDelayIndex) => { + let min, max, newKeyIndex, newDelayIndex; + if (adjacentDelayIndex === null) { + min = state.value.editKey == 0 ? 0 : state.value.editKey; + max = state.value.editKey == 0 ? 1 : false; + newKeyIndex = max === false ? min + 2 : min; + newDelayIndex = min + 1; + } else if (state.value.editKey < adjacentDelayIndex) { + min = state.value.editKey; + max = adjacentDelayIndex; + newKeyIndex = min + 2; + newDelayIndex = min + 1; + } else { + min = adjacentDelayIndex; + max = state.value.editKey; + newKeyIndex = min + 1; + newDelayIndex = min + 2; + } + if (max !== false) { + for (let i = Object.keys(steps.value).length - 1; i >= max; i--) { + steps.value[i + 2] = steps.value[i]; + } + } + recordStep(e, direction, newKeyIndex); + recordStep(10, false, newDelayIndex); + state.value.editKey = false; + }; + const deleteEditKey = () => { + if (state.value.editKey === 0) steps.value.splice(state.value.editKey, 2); + else steps.value.splice(state.value.editKey - 1, 2); + state.value.editKey = false; + }; + const restartDelay = () => { + delay.value.start = performance.now(); + }; + const changeName = (name) => { + macroName.value = name; + console.log(macroName.value); + }; + const changeDelay = (fixed) => { + delay.value.fixed = fixed; + formatDelays(); + }; + const formatDelays = () => { + steps.value = steps.value.map((step) => { + if (step.type === "delay" && delay.value.fixed !== false) step.value = delay.value.fixed; + return step; + }); + }; + const toggleEdit = (type, key) => { + if (type === "key") { + state.value.editKey = key; + state.value.editDelay = false; + } + if (type === "delay") { + state.value.editKey = false; + state.value.editDelay = key; + } + }; + const resetEdit = () => { + state.value.edit = false; + state.value.editKey = false; + state.value.editDelay = false; + }; + const reset = () => { + state.value.record = false; + delay.value.start = 0; + steps.value = []; + if (state.value.edit) resetEdit(); + }; + const save = () => { + state.value.validationErrors = invalidMacro(steps.value); + if (state.value.validationErrors) return false; + axios.post(appUrl() + "/macro/record", { name: macroName.value, steps: steps.value }).then((data) => { + console.log(data); + }); + return true; + }; + return { + state, + steps, + delay, + getEditKey, + getAdjacentKey, + getEditDelay, + recordStep, + insertKey, + deleteEditKey, + restartDelay, + changeName, + changeDelay, + toggleEdit, + resetEdit, + reset, + save + }; +}); +const _hoisted_1$c = { key: 0 }; +const _hoisted_2$a = ["innerHTML"]; +const _hoisted_3$6 = { class: "dir" }; +const _hoisted_4$4 = { key: 1 }; +const _sfc_main$f = { + __name: "MacroKey", + props: { + keyObj: Object, + direction: String, + active: Boolean, + empty: Boolean + }, + setup(__props) { + const props = __props; + const dir = reactive({ + value: false + }); + onMounted(() => { + if (props.empty) return; + setDirection(); + }); + onUpdated(() => { + setDirection(); + }); + const setDirection = () => { + if (props.direction) dir.value = props.direction; + else dir.value = props.keyObj.direction; + }; + return (_ctx, _cache) => { + return openBlock(), createElementBlock("kbd", { + class: normalizeClass(`${__props.active ? "active" : ""} ${__props.empty ? "empty" : ""}`) + }, [ + __props.keyObj ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [ + __props.keyObj.loc ? (openBlock(), createElementBlock("sup", _hoisted_1$c, toDisplayString(__props.keyObj.loc), 1)) : createCommentVNode("", true), + createBaseVNode("span", { + innerHTML: __props.keyObj.str + }, null, 8, _hoisted_2$a), + createBaseVNode("span", _hoisted_3$6, toDisplayString(dir.value === "down" ? "↓" : "↑"), 1) + ], 64)) : __props.empty ? (openBlock(), createElementBlock("span", _hoisted_4$4, "[ ]")) : createCommentVNode("", true) + ], 2); + }; + } +}; +const _sfc_main$e = { + __name: "DelaySpan", + props: { + value: Number, + active: Boolean, + preset: Boolean + }, + setup(__props) { + return (_ctx, _cache) => { + return openBlock(), createElementBlock("span", { + class: normalizeClass(`delay ${__props.active ? "active" : ""} ${__props.preset ? "preset" : ""}`) + }, [ + __props.value < 1e4 ? (openBlock(), createElementBlock(Fragment, { key: 0 }, [ + createTextVNode(toDisplayString(__props.value) + " ", 1), + _cache[0] || (_cache[0] = createBaseVNode("i", null, "ms", -1)) + ], 64)) : (openBlock(), createElementBlock(Fragment, { key: 1 }, [ + _cache[1] || (_cache[1] = createTextVNode(" >10 ")), + _cache[2] || (_cache[2] = createBaseVNode("i", null, "s", -1)) + ], 64)) + ], 2); + }; + } +}; +const DelaySpan = /* @__PURE__ */ _export_sfc(_sfc_main$e, [["__scopeId", "data-v-05e04cbb"]]); +const _sfc_main$d = { + __name: "RecorderOutput", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", { + class: normalizeClass(`macro-recorder__output ${unref(macroRecorder).state.record && "record"} ${unref(macroRecorder).state.edit && "edit"}`) + }, [ + (openBlock(true), createElementBlock(Fragment, null, renderList(unref(macroRecorder).steps, (step, key) => { + return openBlock(), createElementBlock(Fragment, null, [ + step.type === "key" ? (openBlock(), createBlock(_sfc_main$f, { + key, + "key-obj": step.keyObj, + direction: step.direction, + active: unref(macroRecorder).state.editKey === key, + onClick: ($event) => unref(macroRecorder).state.edit ? unref(macroRecorder).toggleEdit("key", key) : false + }, null, 8, ["key-obj", "direction", "active", "onClick"])) : step.type === "delay" ? (openBlock(), createBlock(DelaySpan, { + key, + value: step.value, + active: unref(macroRecorder).state.editDelay === key, + onClick: ($event) => unref(macroRecorder).toggleEdit("delay", key) + }, null, 8, ["value", "active", "onClick"])) : createCommentVNode("", true), + _cache[0] || (_cache[0] = createBaseVNode("hr", { class: "spacer" }, null, -1)) + ], 64); + }), 256)) + ], 2); + }; + } +}; +const RecorderOutput = /* @__PURE__ */ _export_sfc(_sfc_main$d, [["__scopeId", "data-v-33cbf1af"]]); +const _sfc_main$c = { + __name: "RecorderInput", + setup(__props) { + const macroInput = ref(null); + const macroRecorder = useMacroRecorderStore(); + onUpdated(() => { + if (macroRecorder.state.record) { + macroInput.value.focus(); + if (macroRecorder.delay.start !== 0) macroRecorder.restartDelay(); + } + }); + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", { + class: normalizeClass(`recorder-input__container ${unref(macroRecorder).state.record && "record"}`) + }, [ + unref(macroRecorder).state.record ? (openBlock(), createElementBlock("input", { + key: 0, + class: normalizeClass(`macro-recorder__input ${unref(macroRecorder).state.record && "record"}`), + type: "text", + ref_key: "macroInput", + ref: macroInput, + onFocus: _cache[0] || (_cache[0] = ($event) => console.log("focus")), + onKeydown: _cache[1] || (_cache[1] = withModifiers(($event) => unref(macroRecorder).recordStep($event, "down"), ["prevent"])), + onKeyup: _cache[2] || (_cache[2] = withModifiers(($event) => unref(macroRecorder).recordStep($event, "up"), ["prevent"])) + }, null, 34)) : createCommentVNode("", true) + ], 2); + }; + } +}; +const RecorderInput = /* @__PURE__ */ _export_sfc(_sfc_main$c, [["__scopeId", "data-v-9a99c4ac"]]); +const _hoisted_1$b = { class: "context-menu" }; +const _sfc_main$b = { + __name: "ContextMenu", + props: { + open: Boolean + }, + setup(__props, { expose: __expose }) { + __expose({ toggle }); + const props = __props; + const menuOpen = ref(false); + onMounted(() => { + menuOpen.value = props.open; + }); + function toggle() { + console.log("toggle"); + menuOpen.value = !menuOpen.value; + } + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$b, [ + createBaseVNode("div", { + class: "context-menu__trigger", + onClick: toggle + }, [ + renderSlot(_ctx.$slots, "trigger") + ]), + createBaseVNode("div", { + class: normalizeClass(`context-menu__content ${menuOpen.value ? "open" : ""}`) + }, [ + renderSlot(_ctx.$slots, "content") + ], 2) + ]); + }; + } +}; +const _hoisted_1$a = { + type: "number", + step: "10", + min: "0", + max: "3600000", + ref: "customDelayInput", + placeholder: "100" +}; +const _hoisted_2$9 = { class: "flex justify-end" }; +const _sfc_main$a = { + __name: "FixedDelayMenu", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + const ctxtMenu = ref(); + function changeDelay(num) { + macroRecorder.changeDelay(num); + ctxtMenu.value.toggle(); + } + return (_ctx, _cache) => { + return openBlock(), createBlock(_sfc_main$b, { + ref_key: "ctxtMenu", + ref: ctxtMenu + }, { + trigger: withCtx(() => [ + createVNode(_sfc_main$h, { + variant: "secondary", + size: "sm" + }, { + default: withCtx(() => [ + createVNode(unref(IconTimeDuration15)), + _cache[5] || (_cache[5] = createTextVNode("Fixed delay ")) + ]), + _: 1 + }) + ]), + content: withCtx(() => [ + createBaseVNode("ul", null, [ + createBaseVNode("li", { + onClick: _cache[0] || (_cache[0] = ($event) => changeDelay(0)) + }, "0ms"), + createBaseVNode("li", { + onClick: _cache[1] || (_cache[1] = ($event) => changeDelay(15)) + }, "15ms"), + createBaseVNode("li", { + onClick: _cache[2] || (_cache[2] = ($event) => changeDelay(50)) + }, "50ms"), + createBaseVNode("li", { + onClick: _cache[3] || (_cache[3] = ($event) => changeDelay(100)) + }, "100ms"), + createBaseVNode("li", null, [ + createVNode(_sfc_main$i, null, { + trigger: withCtx(() => _cache[6] || (_cache[6] = [ + createBaseVNode("span", null, "Custom delay", -1) + ])), + content: withCtx(() => [ + _cache[9] || (_cache[9] = createBaseVNode("h4", { class: "text-slate-50 mb-4" }, "Custom delay", -1)), + createBaseVNode("form", { + class: "grid gap-4 w-44", + onSubmit: _cache[4] || (_cache[4] = withModifiers(($event) => changeDelay(parseInt(_ctx.$refs.customDelayInput.value)), ["prevent"])) + }, [ + createBaseVNode("div", null, [ + createBaseVNode("input", _hoisted_1$a, null, 512), + _cache[7] || (_cache[7] = createBaseVNode("span", null, "ms", -1)) + ]), + createBaseVNode("div", _hoisted_2$9, [ + createVNode(_sfc_main$h, { + variant: "primary", + size: "sm" + }, { + default: withCtx(() => _cache[8] || (_cache[8] = [ + createTextVNode("Set custom delay") + ])), + _: 1 + }) + ]) + ], 32) + ]), + _: 1 + }) + ]) + ]) + ]), + _: 1 + }, 512); + }; + } +}; +const FixedDelayMenu = /* @__PURE__ */ _export_sfc(_sfc_main$a, [["__scopeId", "data-v-597b5d4a"]]); +const _hoisted_1$9 = { + id: "edit-key-dialog", + class: "dialog__content" +}; +const _hoisted_2$8 = { + class: "grid gap-4", + "submit.prevent": "" +}; +const _hoisted_3$5 = { class: "flex gap-2 justify-center" }; +const _hoisted_4$3 = { class: "flex justify-end" }; +const _sfc_main$9 = { + __name: "EditKeyDialog", + setup(__props) { + const editable = reactive({ + key: {}, + newKey: {} + }); + const macroRecorder = useMacroRecorderStore(); + const newKeyInput = ref(null); + onMounted(() => { + editable.key = macroRecorder.getEditKey(); + editable.newKey.direction = editable.key.direction; + }); + const handleNewKey = (e) => { + editable.newKey.e = e; + editable.newKey.keyObj = filterKey(e); + }; + const handleNewDirection = (direction) => { + editable.newKey.direction = direction; + editable.newKey.keyObj = filterKey(editable.key); + }; + const changeKey = () => { + macroRecorder.recordStep( + editable.newKey.e, + editable.newKey.direction, + macroRecorder.state.editKey + ); + macroRecorder.state.editKey = false; + }; + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$9, [ + _cache[9] || (_cache[9] = createBaseVNode("h4", { class: "text-slate-50 mb-4" }, "Press a key", -1)), + createBaseVNode("div", { + class: "flex justify-center", + onClick: _cache[0] || (_cache[0] = ($event) => _ctx.$refs.newKeyInput.focus()) + }, [ + editable.key.keyObj ? (openBlock(), createBlock(_sfc_main$f, { + key: 0, + "key-obj": editable.key.keyObj, + direction: editable.key.direction + }, null, 8, ["key-obj", "direction"])) : createCommentVNode("", true), + typeof editable.newKey.keyObj === "object" ? (openBlock(), createElementBlock(Fragment, { key: 1 }, [ + _cache[5] || (_cache[5] = createBaseVNode("span", { class: "px-4 flex items-center text-white" }, " >>> ", -1)), + createVNode(_sfc_main$f, { + "key-obj": editable.newKey.keyObj, + direction: editable.newKey.direction + }, null, 8, ["key-obj", "direction"]) + ], 64)) : createCommentVNode("", true) + ]), + createBaseVNode("form", _hoisted_2$8, [ + createBaseVNode("input", { + class: "size-0 opacity-0", + type: "text", + min: "0", + max: "1", + ref_key: "newKeyInput", + ref: newKeyInput, + placeholder: "New key", + autofocus: "", + onKeydown: _cache[1] || (_cache[1] = withModifiers(($event) => handleNewKey($event), ["prevent"])) + }, null, 544), + createBaseVNode("div", _hoisted_3$5, [ + createVNode(_sfc_main$h, { + variant: "secondary", + class: normalizeClass(editable.newKey.direction === "down" ? "selected" : ""), + size: "sm", + onClick: _cache[2] || (_cache[2] = withModifiers(($event) => handleNewDirection("down"), ["prevent"])) + }, { + default: withCtx(() => _cache[6] || (_cache[6] = [ + createTextVNode(" ↓ Down ") + ])), + _: 1 + }, 8, ["class"]), + createVNode(_sfc_main$h, { + variant: "secondary", + class: normalizeClass(editable.newKey.direction === "up" ? "selected" : ""), + size: "sm", + onClick: _cache[3] || (_cache[3] = withModifiers(($event) => handleNewDirection("up"), ["prevent"])) + }, { + default: withCtx(() => _cache[7] || (_cache[7] = [ + createTextVNode(" ↑ Up ") + ])), + _: 1 + }, 8, ["class"]) + ]), + createBaseVNode("div", _hoisted_4$3, [ + createVNode(_sfc_main$h, { + variant: "primary", + size: "sm", + onClick: _cache[4] || (_cache[4] = withModifiers(($event) => changeKey(), ["prevent"])) + }, { + default: withCtx(() => _cache[8] || (_cache[8] = [ + createTextVNode(" Change key ") + ])), + _: 1 + }) + ]) + ]) + ]); + }; + } +}; +const EditKeyDialog = /* @__PURE__ */ _export_sfc(_sfc_main$9, [["__scopeId", "data-v-601167b6"]]); +const _hoisted_1$8 = { + id: "edit-delay-dialog", + class: "dialog__content" +}; +const _hoisted_2$7 = { + key: 0, + class: "flex justify-center" +}; +const _hoisted_3$4 = { + class: "grid gap-4 mt-6", + "submit.prevent": "" +}; +const _hoisted_4$2 = { key: 0 }; +const _hoisted_5$2 = { class: "flex justify-end" }; +const _sfc_main$8 = { + __name: "EditDelayDialog", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + const editable = reactive({ + delay: {}, + newDelay: { value: 0 } + }); + onMounted(() => { + editable.delay = macroRecorder.getEditDelay(); + editable.newDelay.value = editable.delay.value; + console.log(editable); + }); + const changeDelay = () => { + if (!editable.newDelay.value) return; + macroRecorder.recordStep(editable.newDelay.value, false, macroRecorder.state.editDelay); + macroRecorder.state.editDelay = false; + }; + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$8, [ + _cache[4] || (_cache[4] = createBaseVNode("h4", { class: "text-slate-50 mb-4" }, "Edit delay", -1)), + editable.delay.value ? (openBlock(), createElementBlock("div", _hoisted_2$7, [ + createVNode(DelaySpan, { + class: "!text-lg", + value: editable.delay.value + }, null, 8, ["value"]) + ])) : createCommentVNode("", true), + createBaseVNode("form", _hoisted_3$4, [ + editable.newDelay.value ? (openBlock(), createElementBlock("div", _hoisted_4$2, [ + withDirectives(createBaseVNode("input", { + type: "number", + min: "0", + max: "3600000", + step: "10", + "onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => editable.newDelay.value = $event), + autofocus: "" + }, null, 512), [ + [vModelText, editable.newDelay.value] + ]), + _cache[2] || (_cache[2] = createBaseVNode("span", null, "ms", -1)) + ])) : createCommentVNode("", true), + createBaseVNode("div", _hoisted_5$2, [ + createVNode(_sfc_main$h, { + variant: "primary", + size: "sm", + onClick: _cache[1] || (_cache[1] = withModifiers(($event) => changeDelay(), ["prevent"])) + }, { + default: withCtx(() => _cache[3] || (_cache[3] = [ + createTextVNode(" Change delay ") + ])), + _: 1 + }) + ]) + ]) + ]); + }; + } +}; +const EditDelayDialog = /* @__PURE__ */ _export_sfc(_sfc_main$8, [["__scopeId", "data-v-d4c82ec9"]]); +const _hoisted_1$7 = { + id: "delete-key-dialog", + class: "dialog__content" +}; +const _hoisted_2$6 = { class: "flex justify-center w-full mb-4" }; +const _hoisted_3$3 = { class: "flex justify-end gap-2 mt-6" }; +const _sfc_main$7 = { + __name: "DeleteKeyDialog", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + const keyObj = ref(null); + onMounted(() => { + keyObj.value = filterKey(macroRecorder.getEditKey()); + }); + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$7, [ + _cache[2] || (_cache[2] = createBaseVNode("h4", { class: "text-slate-50 mb-4" }, "Delete key", -1)), + createBaseVNode("div", _hoisted_2$6, [ + keyObj.value ? (openBlock(), createBlock(_sfc_main$f, { + key: 0, + "key-obj": keyObj.value + }, null, 8, ["key-obj"])) : createCommentVNode("", true) + ]), + _cache[3] || (_cache[3] = createBaseVNode("p", { class: "text-sm text-slate-300" }, "Are you sure you want to delete this key?", -1)), + createBaseVNode("div", _hoisted_3$3, [ + createVNode(_sfc_main$h, { + variant: "danger", + size: "sm", + onClick: _cache[0] || (_cache[0] = ($event) => unref(macroRecorder).deleteEditKey()) + }, { + default: withCtx(() => _cache[1] || (_cache[1] = [ + createTextVNode(" Delete key ") + ])), + _: 1 + }) + ]) + ]); + }; + } +}; +const DeleteKeyDialog = /* @__PURE__ */ _export_sfc(_sfc_main$7, [["__scopeId", "data-v-7dc19ba4"]]); +const _hoisted_1$6 = { + id: "insert-key-dialog", + class: "dialog__content w-96" +}; +const _hoisted_2$5 = { class: "text-slate-50 mb-4" }; +const _hoisted_3$2 = { + key: 0, + class: "text-center" +}; +const _hoisted_4$1 = { class: "insert-key__direction" }; +const _hoisted_5$1 = { class: "flex justify-end" }; +const _sfc_main$6 = { + __name: "InsertKeyDialog", + props: { + position: String + }, + setup(__props) { + const props = __props; + const macroRecorder = useMacroRecorderStore(); + const keyObjs = reactive({ + selected: null, + insert: null, + insertEvent: null, + insertDirection: "down", + adjacent: null, + adjacentDelay: null, + adjacentDelayIndex: null + }); + const insertKeyInput = ref(null); + const inputFocus = ref(false); + onMounted(() => { + keyObjs.selected = filterKey(macroRecorder.getEditKey()); + const adjacentKey = macroRecorder.getAdjacentKey(props.position, true); + if (adjacentKey) keyObjs.adjacent = filterKey(adjacentKey.key); + if (adjacentKey.delay) { + keyObjs.adjacentDelay = adjacentKey.delay; + keyObjs.adjacentDelayIndex = adjacentKey.delayIndex; + } + }); + const handleInsertKey = (e) => { + keyObjs.insert = filterKey(e); + keyObjs.insertEvent = e; + }; + const insertKey = () => { + macroRecorder.insertKey(keyObjs.insertEvent, keyObjs.insertDirection, keyObjs.adjacentDelayIndex); + }; + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$6, [ + createBaseVNode("h4", _hoisted_2$5, "Insert key " + toDisplayString(__props.position), 1), + inputFocus.value ? (openBlock(), createElementBlock("p", _hoisted_3$2, "[Press a key]")) : createCommentVNode("", true), + createBaseVNode("input", { + class: "size-0 opacity-0", + type: "text", + min: "0", + max: "1", + ref_key: "insertKeyInput", + ref: insertKeyInput, + placeholder: "New key", + onFocusin: _cache[0] || (_cache[0] = ($event) => inputFocus.value = true), + onFocusout: _cache[1] || (_cache[1] = ($event) => inputFocus.value = false), + onKeydown: _cache[2] || (_cache[2] = withModifiers(($event) => handleInsertKey($event), ["prevent"])), + autofocus: "" + }, null, 544), + createBaseVNode("div", { + class: normalizeClass(["insert-output", __props.position == "before" ? "flex-row-reverse" : ""]) + }, [ + keyObjs.selected ? (openBlock(), createBlock(_sfc_main$f, { + key: 0, + "key-obj": keyObjs.selected + }, null, 8, ["key-obj"])) : createCommentVNode("", true), + _cache[10] || (_cache[10] = createBaseVNode("hr", { class: "spacer" }, null, -1)), + createVNode(DelaySpan, { + preset: true, + value: 10 + }), + _cache[11] || (_cache[11] = createBaseVNode("hr", { class: "spacer" }, null, -1)), + keyObjs.insert ? (openBlock(), createBlock(_sfc_main$f, { + key: 1, + class: "insert", + "key-obj": keyObjs.insert, + direction: keyObjs.insertDirection, + onClick: _cache[3] || (_cache[3] = ($event) => insertKeyInput.value.focus()) + }, null, 8, ["key-obj", "direction"])) : createCommentVNode("", true), + !keyObjs.insert ? (openBlock(), createBlock(_sfc_main$f, { + key: 2, + empty: true, + onClick: _cache[4] || (_cache[4] = ($event) => insertKeyInput.value.focus()) + })) : createCommentVNode("", true), + keyObjs.adjacentDelay ? (openBlock(), createElementBlock(Fragment, { key: 3 }, [ + _cache[8] || (_cache[8] = createBaseVNode("hr", { class: "spacer" }, null, -1)), + createVNode(DelaySpan, { + value: keyObjs.adjacentDelay.value + }, null, 8, ["value"]) + ], 64)) : createCommentVNode("", true), + keyObjs.adjacent ? (openBlock(), createElementBlock(Fragment, { key: 4 }, [ + _cache[9] || (_cache[9] = createBaseVNode("hr", { class: "spacer" }, null, -1)), + createVNode(_sfc_main$f, { + "key-obj": keyObjs.adjacent + }, null, 8, ["key-obj"]) + ], 64)) : createCommentVNode("", true) + ], 2), + createBaseVNode("div", _hoisted_4$1, [ + createVNode(_sfc_main$h, { + variant: "secondary", + class: normalizeClass(keyObjs.insertDirection === "down" ? "selected" : ""), + size: "sm", + onClick: _cache[5] || (_cache[5] = withModifiers(($event) => keyObjs.insertDirection = "down", ["prevent"])) + }, { + default: withCtx(() => _cache[12] || (_cache[12] = [ + createTextVNode(" ↓ Down ") + ])), + _: 1 + }, 8, ["class"]), + createVNode(_sfc_main$h, { + variant: "secondary", + class: normalizeClass(keyObjs.insertDirection === "up" ? "selected" : ""), + size: "sm", + onClick: _cache[6] || (_cache[6] = withModifiers(($event) => keyObjs.insertDirection = "up", ["prevent"])) + }, { + default: withCtx(() => _cache[13] || (_cache[13] = [ + createTextVNode(" ↑ Up ") + ])), + _: 1 + }, 8, ["class"]) + ]), + createBaseVNode("div", _hoisted_5$1, [ + createVNode(_sfc_main$h, { + variant: "primary", + size: "sm", + onClick: _cache[7] || (_cache[7] = ($event) => insertKey()) + }, { + default: withCtx(() => _cache[14] || (_cache[14] = [ + createTextVNode("Insert key") + ])), + _: 1 + }) + ]) + ]); + }; + } +}; +const InsertKeyDialog = /* @__PURE__ */ _export_sfc(_sfc_main$6, [["__scopeId", "data-v-d2aab140"]]); +const _hoisted_1$5 = { + key: 0, + class: "macro-edit__dialogs" +}; +const _hoisted_2$4 = { + key: 0, + class: "flex gap-2" +}; +const _sfc_main$5 = { + __name: "EditDialogs", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + const insert = reactive({ position: null }); + const ctxtMenu = ref(); + onMounted(() => { + macroRecorder.$subscribe((mutation) => { + if (mutation.events && mutation.events.key == "editKey" && mutation.events.newValue === false) { + insert.position = null; + } + }); + }); + function onOpenDialog() { + if (insert.position !== null) ctxtMenu.value.toggle(); + } + function onCloseDialog() { + macroRecorder.state.editKey = false; + macroRecorder.state.editDelay = false; + insert.position = null; + } + return (_ctx, _cache) => { + return unref(macroRecorder).state.edit !== false ? (openBlock(), createElementBlock("div", _hoisted_1$5, [ + unref(macroRecorder).state.editKey !== false && typeof unref(macroRecorder).getEditKey() === "object" ? (openBlock(), createElementBlock("div", _hoisted_2$4, [ + createVNode(_sfc_main$b, { + ref_key: "ctxtMenu", + ref: ctxtMenu + }, { + trigger: withCtx(() => [ + createVNode(_sfc_main$h, { + variant: "dark", + size: "sm" + }, { + default: withCtx(() => [ + createVNode(unref(IconPlus)), + _cache[2] || (_cache[2] = createTextVNode(" Insert ")) + ]), + _: 1 + }) + ]), + content: withCtx(() => [ + createBaseVNode("ul", null, [ + createBaseVNode("li", { + onClick: _cache[0] || (_cache[0] = ($event) => insert.position = "before") + }, [ + createVNode(unref(IconArrowLeftCircle)), + _cache[3] || (_cache[3] = createTextVNode(" Before")) + ]), + createBaseVNode("li", { + onClick: _cache[1] || (_cache[1] = ($event) => insert.position = "after") + }, [ + createVNode(unref(IconArrowRightCircle)), + _cache[4] || (_cache[4] = createTextVNode(" After")) + ]) + ]) + ]), + _: 1 + }, 512), + insert.position !== null ? (openBlock(), createBlock(_sfc_main$i, { + key: 0, + open: insert.position !== null, + onOnOpen: onOpenDialog, + onOnClose: onCloseDialog + }, { + content: withCtx(() => [ + createVNode(InsertKeyDialog, { + position: insert.position + }, null, 8, ["position"]) + ]), + _: 1 + }, 8, ["open"])) : createCommentVNode("", true), + createVNode(_sfc_main$i, { + id: `edit-key-${unref(macroRecorder).state.editKey}`, + onOnOpen: onOpenDialog, + onOnClose: onCloseDialog + }, { + trigger: withCtx(() => [ + createVNode(_sfc_main$h, { + variant: "secondary", + size: "sm" + }, { + default: withCtx(() => [ + createVNode(unref(IconPencil)), + _cache[5] || (_cache[5] = createTextVNode("Edit ")) + ]), + _: 1 + }) + ]), + content: withCtx(() => [ + createVNode(EditKeyDialog) + ]), + _: 1 + }, 8, ["id"]), + createVNode(_sfc_main$i, { + onOnOpen: onOpenDialog, + onOnClose: onCloseDialog + }, { + trigger: withCtx(() => [ + createVNode(_sfc_main$h, { + size: "sm", + variant: "danger" + }, { + default: withCtx(() => [ + createVNode(unref(IconTrash)), + _cache[6] || (_cache[6] = createTextVNode("Delete ")) + ]), + _: 1 + }) + ]), + content: withCtx(() => [ + createVNode(DeleteKeyDialog) + ]), + _: 1 + }) + ])) : createCommentVNode("", true), + unref(macroRecorder).state.editDelay !== false && typeof unref(macroRecorder).getEditDelay() === "object" ? (openBlock(), createBlock(_sfc_main$i, { + key: 1, + onOnOpen: onOpenDialog, + onOnClose: onCloseDialog + }, { + trigger: withCtx(() => [ + createVNode(_sfc_main$h, { + variant: "secondary", + size: "sm" + }, { + default: withCtx(() => [ + createVNode(unref(IconAlarm)), + _cache[7] || (_cache[7] = createTextVNode("Edit ")) + ]), + _: 1 + }) + ]), + content: withCtx(() => [ + createVNode(EditDelayDialog) + ]), + _: 1 + })) : createCommentVNode("", true) + ])) : createCommentVNode("", true); + }; + } +}; +const EditDialogs = /* @__PURE__ */ _export_sfc(_sfc_main$5, [["__scopeId", "data-v-bf9e32be"]]); +const _hoisted_1$4 = { class: "macro-recorder__header" }; +const _hoisted_2$3 = { class: "w-full grid grid-cols-[auto_1fr_auto] gap-2" }; +const _sfc_main$4 = { + __name: "RecorderHeader", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + const nameSet = ref(false); + function changeName(name) { + macroRecorder.changeName(name); + nameSet.value = name.length > 0; + } + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$4, [ + createBaseVNode("div", _hoisted_2$3, [ + _cache[7] || (_cache[7] = createBaseVNode("h4", { class: "" }, "Name:", -1)), + createBaseVNode("input", { + id: "macro-name", + type: "text", + onInput: _cache[0] || (_cache[0] = withModifiers(($event) => changeName($event.target.value), ["prevent"])), + placeholder: "New macro" + }, null, 32), + createBaseVNode("div", { + class: normalizeClass(`recording__buttons ${!nameSet.value || unref(macroRecorder).state.edit ? "disabled" : ""}`) + }, [ + createTextVNode(toDisplayString(unref(macroRecorder).name) + " ", 1), + !unref(macroRecorder).state.record ? (openBlock(), createBlock(_sfc_main$h, { + key: 0, + variant: "primary", + size: "sm", + onClick: _cache[1] || (_cache[1] = ($event) => unref(macroRecorder).state.record = true) + }, { + default: withCtx(() => [ + createVNode(unref(IconPlayerRecordFilled), { class: "text-red-500" }), + _cache[5] || (_cache[5] = createTextVNode("Record ")) + ]), + _: 1 + })) : createCommentVNode("", true), + unref(macroRecorder).state.record ? (openBlock(), createBlock(_sfc_main$h, { + key: 1, + variant: "danger", + size: "sm", + onClick: _cache[2] || (_cache[2] = ($event) => unref(macroRecorder).state.record = false) + }, { + default: withCtx(() => [ + createVNode(unref(IconPlayerStopFilled), { class: "text-white" }), + _cache[6] || (_cache[6] = createTextVNode("Stop ")) + ]), + _: 1 + })) : createCommentVNode("", true) + ], 2) + ]), + unref(macroRecorder).steps.length > 0 ? (openBlock(), createElementBlock("div", { + key: 0, + class: normalizeClass(`edit__buttons ${unref(macroRecorder).state.record ? "disabled" : ""}`) + }, [ + createBaseVNode("div", null, [ + !unref(macroRecorder).state.edit ? (openBlock(), createBlock(_sfc_main$h, { + key: 0, + variant: "secondary", + size: "sm", + onClick: _cache[3] || (_cache[3] = ($event) => unref(macroRecorder).state.edit = true) + }, { + default: withCtx(() => [ + createVNode(unref(IconPencil)), + _cache[8] || (_cache[8] = createTextVNode("Edit ")) + ]), + _: 1 + })) : createCommentVNode("", true), + unref(macroRecorder).state.edit ? (openBlock(), createBlock(_sfc_main$h, { + key: 1, + variant: "danger", + size: "sm", + onClick: _cache[4] || (_cache[4] = ($event) => unref(macroRecorder).resetEdit()) + }, { + default: withCtx(() => [ + createVNode(unref(IconPlayerStopFilled)), + _cache[9] || (_cache[9] = createTextVNode("Stop ")) + ]), + _: 1 + })) : createCommentVNode("", true) + ]), + unref(macroRecorder).state.edit ? (openBlock(), createBlock(FixedDelayMenu, { key: 0 })) : createCommentVNode("", true), + createVNode(EditDialogs) + ], 2)) : createCommentVNode("", true) + ]); + }; + } +}; +const RecorderHeader = /* @__PURE__ */ _export_sfc(_sfc_main$4, [["__scopeId", "data-v-19251359"]]); +const _hoisted_1$3 = { + id: "validation-error__dialog", + class: "dialog__content" +}; +const _hoisted_2$2 = { + key: 0, + class: "grid gap-4" +}; +const _hoisted_3$1 = { key: 0 }; +const _hoisted_4 = { key: 1 }; +const _hoisted_5 = { class: "flex justify-end mt-4" }; +const _sfc_main$3 = { + __name: "ValidationErrorDialog", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + const errors = reactive({ + up: [], + down: [] + }); + onMounted(() => { + macroRecorder.$subscribe((mutation) => { + if (mutation.events && mutation.events.key == "validationErrors") { + errors.up = mutation.events.newValue !== false ? macroRecorder.state.validationErrors.up : []; + errors.down = mutation.events.newValue !== false ? macroRecorder.state.validationErrors.down : []; + } + console.log(mutation); + }); + }); + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$3, [ + _cache[4] || (_cache[4] = createBaseVNode("h4", { class: "text-slate-50 mb-4" }, "There's an error in your macro", -1)), + errors && errors.up.length > 0 || errors.down.length > 0 ? (openBlock(), createElementBlock("div", _hoisted_2$2, [ + errors.down.length > 0 ? (openBlock(), createElementBlock("div", _hoisted_3$1, [ + _cache[1] || (_cache[1] = createBaseVNode("p", null, [ + createTextVNode(" The following keys have been "), + createBaseVNode("strong", null, "pressed"), + createTextVNode(" down, but "), + createBaseVNode("strong", null, "not released"), + createTextVNode(". ") + ], -1)), + createBaseVNode("ul", null, [ + (openBlock(true), createElementBlock(Fragment, null, renderList(errors.down, (key) => { + return openBlock(), createElementBlock("li", { key }, toDisplayString(key.toUpperCase()), 1); + }), 128)) + ]) + ])) : createCommentVNode("", true), + errors.up.length > 0 ? (openBlock(), createElementBlock("div", _hoisted_4, [ + _cache[2] || (_cache[2] = createBaseVNode("p", null, [ + createTextVNode(" The following keys have been "), + createBaseVNode("strong", null, "released"), + createTextVNode(", but "), + createBaseVNode("strong", null, "not pressed"), + createTextVNode(" down. ") + ], -1)), + createBaseVNode("ul", null, [ + (openBlock(true), createElementBlock(Fragment, null, renderList(errors.up, (key) => { + return openBlock(), createElementBlock("li", { key }, toDisplayString(key.toUpperCase()), 1); + }), 128)) + ]) + ])) : createCommentVNode("", true) + ])) : createCommentVNode("", true), + createBaseVNode("div", _hoisted_5, [ + createVNode(_sfc_main$h, { + size: "sm", + variant: "danger", + onClick: _cache[0] || (_cache[0] = ($event) => unref(macroRecorder).state.validationErrors = false) + }, { + default: withCtx(() => _cache[3] || (_cache[3] = [ + createTextVNode(" Close ") + ])), + _: 1 + }) + ]) + ]); + }; + } +}; +const ValidationErrorDialog = /* @__PURE__ */ _export_sfc(_sfc_main$3, [["__scopeId", "data-v-ff532573"]]); +const _hoisted_1$2 = { class: "macro-recorder__footer" }; +const _sfc_main$2 = { + __name: "RecorderFooter", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + const errorDialog = ref(); + onMounted(() => { + macroRecorder.$subscribe((mutation) => { + if (mutation.events && mutation.events.key == "validationErrors") { + errorDialog.value.toggleDialog(mutation.events.newValue !== false); + } + }); + }); + const toggleSave = () => { + if (!macroRecorder.save()) errorDialog.value.toggleDialog(true); + }; + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$2, [ + unref(macroRecorder).steps.length > 0 ? (openBlock(), createBlock(_sfc_main$h, { + key: 0, + variant: "danger", + size: "sm", + onClick: _cache[0] || (_cache[0] = ($event) => unref(macroRecorder).reset()) + }, { + default: withCtx(() => [ + createVNode(unref(IconRestore)), + _cache[2] || (_cache[2] = createTextVNode(" Reset ")) + ]), + _: 1 + })) : createCommentVNode("", true), + createVNode(_sfc_main$i, { + ref_key: "errorDialog", + ref: errorDialog + }, { + content: withCtx(() => [ + createVNode(ValidationErrorDialog) + ]), + _: 1 + }, 512), + unref(macroRecorder).steps.length > 0 ? (openBlock(), createBlock(_sfc_main$h, { + key: 1, + disabled: unref(macroRecorder).state.record || unref(macroRecorder).state.edit, + variant: "success", + size: "sm", + onClick: _cache[1] || (_cache[1] = ($event) => toggleSave()) + }, { + default: withCtx(() => [ + createVNode(unref(IconDeviceFloppy)), + _cache[3] || (_cache[3] = createTextVNode(" Save ")) + ]), + _: 1 + }, 8, ["disabled"])) : createCommentVNode("", true) + ]); + }; + } +}; +const RecorderFooter = /* @__PURE__ */ _export_sfc(_sfc_main$2, [["__scopeId", "data-v-fec5e8b6"]]); +const _hoisted_1$1 = { class: "macro-recorder mcrm-block block__light" }; +const _hoisted_2$1 = { class: "recorder-interface" }; +const _sfc_main$1 = { + __name: "MacroRecorder", + setup(__props) { + const macroRecorder = useMacroRecorderStore(); + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1$1, [ + createBaseVNode("div", _hoisted_2$1, [ + createVNode(RecorderHeader), + createBaseVNode("div", { + class: normalizeClass(`recorder-interface__container ${unref(macroRecorder).state.record && "record"} ${unref(macroRecorder).state.edit && "edit"}`) + }, [ + createVNode(RecorderOutput), + createVNode(RecorderInput) + ], 2), + createVNode(RecorderFooter) + ]) + ]); + }; + } +}; +const _hoisted_1 = { + id: "macros", + class: "panel" +}; +const _hoisted_2 = { class: "panel__content !p-0" }; +const _hoisted_3 = { class: "macro-panel__content" }; +const _sfc_main = { + __name: "MacrosView", + setup(__props) { + ref(false); + ref(null); + onMounted(() => { + }); + return (_ctx, _cache) => { + return openBlock(), createElementBlock("div", _hoisted_1, [ + _cache[0] || (_cache[0] = createBaseVNode("h1", { class: "panel__title" }, "Macros", -1)), + createBaseVNode("div", _hoisted_2, [ + createBaseVNode("div", _hoisted_3, [ + createVNode(MacroOverview), + createVNode(_sfc_main$1) + ]) + ]) + ]); + }; + } +}; +const MacrosView = /* @__PURE__ */ _export_sfc(_sfc_main, [["__scopeId", "data-v-c7be9772"]]); +export { + MacrosView as default +}; diff --git a/public/assets/MacrosView-CE74eyGa.js b/public/assets/MacrosView-CE74eyGa.js deleted file mode 100644 index a90218d..0000000 --- a/public/assets/MacrosView-CE74eyGa.js +++ /dev/null @@ -1,47 +0,0 @@ -import{c as V,d as f,f as g,e as d,k as r,t as O,u as i,H as ae,a as x,s as B,x as T,_ as j,r as h,o as S,G as le,g as a,F as R,i as H,j as p,l as _,q as m,J as re,b as Y,E as C,h as b,K as E,L as W,w as ie,v as de,M as ue}from"./index-oAtpp-VZ.js";import{I as Z,b as ee,a as ce}from"./IconTrash-DtIpQ-M_.js";import{_ as z}from"./DialogComp-CyRyORDj.js";/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var ve=V("outline","alarm","IconAlarm",[["path",{d:"M12 13m-7 0a7 7 0 1 0 14 0a7 7 0 1 0 -14 0",key:"svg-0"}],["path",{d:"M12 10l0 3l2 0",key:"svg-1"}],["path",{d:"M7 4l-2.75 2",key:"svg-2"}],["path",{d:"M17 4l2.75 2",key:"svg-3"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var ye=V("outline","arrow-left-circle","IconArrowLeftCircle",[["path",{d:"M17 12h-14",key:"svg-0"}],["path",{d:"M6 9l-3 3l3 3",key:"svg-1"}],["path",{d:"M19 12m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0",key:"svg-2"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var pe=V("outline","arrow-right-circle","IconArrowRightCircle",[["path",{d:"M18 15l3 -3l-3 -3",key:"svg-0"}],["path",{d:"M5 12m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0",key:"svg-1"}],["path",{d:"M7 12h14",key:"svg-2"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var fe=V("outline","loader-3","IconLoader3",[["path",{d:"M3 12a9 9 0 0 0 9 9a9 9 0 0 0 9 -9a9 9 0 0 0 -9 -9",key:"svg-0"}],["path",{d:"M17 12a5 5 0 1 0 -5 5",key:"svg-1"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var me=V("outline","plus","IconPlus",[["path",{d:"M12 5l0 14",key:"svg-0"}],["path",{d:"M5 12l14 0",key:"svg-1"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var ke=V("outline","restore","IconRestore",[["path",{d:"M3.06 13a9 9 0 1 0 .49 -4.087",key:"svg-0"}],["path",{d:"M3 4.001v5h5",key:"svg-1"}],["path",{d:"M12 12m-1 0a1 1 0 1 0 2 0a1 1 0 1 0 -2 0",key:"svg-2"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var ge=V("outline","time-duration-15","IconTimeDuration15",[["path",{d:"M12 15h2a1 1 0 0 0 1 -1v-1a1 1 0 0 0 -1 -1h-2v-3h3",key:"svg-0"}],["path",{d:"M9 9v6",key:"svg-1"}],["path",{d:"M3 12v.01",key:"svg-2"}],["path",{d:"M12 21v.01",key:"svg-3"}],["path",{d:"M7.5 4.2v.01",key:"svg-4"}],["path",{d:"M16.5 19.8v.01",key:"svg-5"}],["path",{d:"M7.5 19.8v.01",key:"svg-6"}],["path",{d:"M4.2 16.5v.01",key:"svg-7"}],["path",{d:"M19.8 16.5v.01",key:"svg-8"}],["path",{d:"M4.2 7.5v.01",key:"svg-9"}],["path",{d:"M21 12a9 9 0 0 0 -9 -9",key:"svg-10"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var _e=V("filled","player-record-filled","IconPlayerRecordFilled",[["path",{d:"M8 5.072a8 8 0 1 1 -3.995 7.213l-.005 -.285l.005 -.285a8 8 0 0 1 3.995 -6.643z",key:"svg-0"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var X=V("filled","player-stop-filled","IconPlayerStopFilled",[["path",{d:"M17 4h-10a3 3 0 0 0 -3 3v10a3 3 0 0 0 3 3h10a3 3 0 0 0 3 -3v-10a3 3 0 0 0 -3 -3z",key:"svg-0"}]]);const we={key:0,class:"loading-component"},$e={key:0},De={__name:"LoadComp",props:{loading:Boolean,text:String},setup(s){return(e,t)=>s.loading?(d(),f("div",we,[s.text?(d(),f("span",$e,O(s.text),1)):g("",!0),r(i(fe),{class:"duration-1000 animate-spin"})])):g("",!0)}},U={Control:"Ctrl",Shift:"Shift",Alt:"Alt",Meta:"Win",CapsLock:"Caps",PageUp:"PgUp",PageDown:"PgDn",ScrollLock:"Scr Lk",Insert:"Ins",Delete:"Del",Escape:"Esc",Space:"Space",Backquote:"`",Backslash:"\\",BracketLeft:"[",BracketRight:"]",Comma:",",Equal:"=",Minus:"-",Period:".",Quote:"'",Semicolon:";",Slash:"/",ArrowUp:"▲",ArrowRight:"▶",ArrowDown:"▼",ArrowLeft:"◀",MediaPlayPause:"Play",MediaStop:"Stop",MediaTrackNext:"Next",MediaTrackPrevious:"Prev",MediaVolumeDown:"Down",MediaVolumeUp:"Up",AudioVolumeMute:"Mute",AudioVolumeDown:"Down",AudioVolumeUp:"Up"},P=s=>{const e={};return s.location===1&&(e.loc="left"),s.location===2&&(e.loc="right"),s.location===3&&(e.loc="num"),(s.key.includes("Media")||s.key.includes("Audio"))&&(e.loc=be(s)),U[s.code]||U[s.key]?e.str=U[s.code]||U[s.key]:e.str=s.key.toLowerCase(),e},be=s=>{switch(s.key){case"MediaPlayPause":case"MediaStop":case"MediaTrackNext":case"MediaTrackPrevious":return"Media";case"MediaVolumeDown":case"MediaVolumeUp":case"AudioVolumeDown":case"AudioVolumeUp":case"AudioVolumeMute":return"Volume"}},xe=(s,e,t)=>s&&s.type==="key"&&s.code===e.code&&s.direction===t,Me=s=>{const e=[],t=[];return Object.keys(s).forEach(n=>{const l=s[n];l.type==="key"&&(l.direction=="down"&&e.push(l.key),l.direction=="up"&&(e.includes(l.key)?e.splice(e.indexOf(l.key),1):t.push(l.key)))}),t.length===0&&e.length===0?!1:{down:e,up:t}},Ke=s=>{const e=[];return s.forEach(t=>{t.type==="delay"&&e.push(t),t.type==="key"&&e.push(Ce(t.code,t.direction))}),e},Ce=(s,e)=>{let t="",n=0,l=s;s.includes("Left")&&(t=s.replace("Left",""),n=1),s.includes("Right")&&(t=s.replace("Right",""),n=2),s.includes("Numpad")&&(t=s.replace("Numpad",""),n=3),s.includes("Media")&&(l=""),t===""&&(t=s);const o={type:"key",code:l,key:t,location:n,direction:e};return{...o,keyObj:P(o)}},I=ae("macrorecorder",()=>{const s=x({record:!1,edit:!1,editKey:!1,editDelay:!1,validationErrors:!1}),e=x(""),t=x([]),n=x({start:0,fixed:!1}),l=()=>t.value[s.value.editKey],o=(k,M=!1)=>{let $=!1;const K=k=="before"?-1:1,D=s.value.editKey+2*K,N=M?s.value.editKey+1*K:!1;return t.value[D]&&($=t.value[D]),N&&t.value[N]&&($={delay:t.value[N],key:t.value[D],delayIndex:N}),$},v=()=>t.value[s.value.editDelay],u=(k,M=!1,$=!1)=>{k.ctrlKey,k.shiftKey,k.altKey,k.metaKey&&k.preventDefault();const K=t.value[t.value.length-1];let D={};typeof k=="object"&&!xe(K,k,M)?($===!1&&y(),D={type:"key",key:k.key,code:k.code,location:k.location,direction:M,keyObj:P(k)}):M&&$!==!1?(D=t.value[$],D.direction=M):typeof k=="number"&&(D={type:"delay",value:parseFloat(k.toFixed())}),$!==!1?t.value[$]=D:t.value.push(D)},y=()=>{n.value.fixed!==!1?u(n.value.fixed):(n.value.start==0||u(performance.now()-n.value.start),n.value.start=performance.now())},c=(k,M,$)=>{let K,D,N,L;if($===null?(K=s.value.editKey==0?0:s.value.editKey,D=s.value.editKey==0?1:!1,N=D===!1?K+2:K,L=K+1):s.value.editKey<$?(K=s.value.editKey,D=$,N=K+2,L=K+1):(K=$,D=s.value.editKey,N=K+1,L=K+2),D!==!1)for(let F=Object.keys(t.value).length-1;F>=D;F--)t.value[F+2]=t.value[F];u(k,M,N),u(10,!1,L),s.value.editKey=!1},w=()=>{s.value.editKey===0?t.value.splice(s.value.editKey,2):t.value.splice(s.value.editKey-1,2),s.value.editKey=!1},G=()=>{n.value.start=performance.now()},J=k=>{e.value=k},se=k=>{n.value.fixed=k,ne()},ne=()=>{t.value=t.value.map(k=>(k.type==="delay"&&n.value.fixed!==!1&&(k.value=n.value.fixed),k))},oe=(k,M)=>{k==="key"&&(s.value.editKey=M,s.value.editDelay=!1),k==="delay"&&(s.value.editKey=!1,s.value.editDelay=M)},Q=()=>{s.value.edit=!1,s.value.editKey=!1,s.value.editDelay=!1};return{state:s,macroName:e,steps:t,delay:n,getEditKey:l,getAdjacentKey:o,getEditDelay:v,recordStep:u,insertKey:c,deleteEditKey:w,restartDelay:G,changeName:J,changeDelay:se,toggleEdit:oe,resetEdit:Q,resetMacro:()=>{s.value.record=!1,n.value.start=0,e.value="",t.value=[],s.value.edit&&Q()},checkMacro:async()=>(await B.post(T()+"/macro/check",{macro:e.value})).data,saveMacro:async()=>(s.value.validationErrors=Me(t.value),s.value.validationErrors?!1:(await B.post(T()+"/macro/record",{name:e.value,steps:t.value})).status==200),deleteMacro:async k=>{const M=await B.post(T()+"/macro/delete",{macro:k});return M.status==200?M.data:!1},openMacro:async(k,M)=>{const $=await B.post(T()+"/macro/open",{macro:k});$.data&&(t.value=Ke($.data)),e.value=M}}}),je={class:"macro-overview mcrm-block block__dark"},Ie={class:"macro-overview__list"},Ee={class:"overview__macro-delete"},Oe={class:"grid gap-2"},Re={class:"mb-2 text-center text-sky-500"},Se={class:"flex justify-between"},Ne={__name:"MacroOverview",setup(s){const e=h({loading:!0,list:[]}),t=I(),n=x(""),l=x();S(()=>{o()});const o=async()=>{const y=await le();e.list=y,e.loading=!1},v=y=>{n.value=y,l.value.toggleDialog(!0)},u=async()=>{await t.deleteMacro(n.value)&&(l.value.toggleDialog(!1),n.value===t.macroName&&t.resetMacro(),n.value="",o())};return(y,c)=>(d(),f("div",je,[c[6]||(c[6]=a("h4",{class:"border-b-2 border-transparent"},"Saved Macros",-1)),a("div",Ie,[r(De,{loading:e.loading,text:"Loading macros..."},null,8,["loading"]),(d(!0),f(R,null,H(e.list,(w,G)=>(d(),f("div",{class:"macro-item",key:G},[r(_,{variant:i(t).macroName===w.name?"secondary":"dark",class:"overview__macro-open",size:"sm",onClick:J=>i(t).openMacro(w.macroname,w.name)},{default:p(()=>[r(i(re)),c[2]||(c[2]=m()),a("span",null,O(w.name),1)]),_:2},1032,["variant","onClick"]),a("div",Ee,[r(_,{class:"!text-red-500 hover:!text-red-300",variant:"ghost",size:"sm",onClick:J=>v(w.name)},{default:p(()=>[r(i(Z))]),_:2},1032,["onClick"])])]))),128))]),r(z,{ref_key:"deleteDialog",ref:l},{content:p(()=>[a("div",Oe,[c[5]||(c[5]=a("h4",{class:"pr-4"},"Are you sure you want to delete:",-1)),a("h3",Re,O(n.value),1),a("div",Se,[r(_,{size:"sm",variant:"subtle",onClick:c[0]||(c[0]=w=>l.value.toggleDialog(!1))},{default:p(()=>c[3]||(c[3]=[m(" No ")])),_:1}),r(_,{size:"sm",variant:"danger",onClick:c[1]||(c[1]=w=>u())},{default:p(()=>c[4]||(c[4]=[m("Yes")])),_:1})])])]),_:1},512)]))}},Ve=j(Ne,[["__scopeId","data-v-07eda649"]]),ze={key:0},Ae=["innerHTML"],Pe={class:"dir"},he={key:1},A={__name:"MacroKey",props:{keyObj:Object,direction:String,active:Boolean,empty:Boolean},setup(s){const e=s,t=h({value:!1});S(()=>{e.empty||n()}),Y(()=>{n()});const n=()=>{e.direction?t.value=e.direction:t.value=e.keyObj.direction};return(l,o)=>(d(),f("kbd",{class:C(`${s.active?"active":""} ${s.empty?"empty":""}`)},[s.keyObj?(d(),f(R,{key:0},[s.keyObj.loc?(d(),f("sup",ze,O(s.keyObj.loc),1)):g("",!0),a("span",{innerHTML:s.keyObj.str},null,8,Ae),a("span",Pe,O(t.value==="down"?"↓":"↑"),1)],64)):s.empty?(d(),f("span",he,"[ ]")):g("",!0)],2))}},Le={__name:"DelaySpan",props:{value:Number,active:Boolean,preset:Boolean},setup(s){return(e,t)=>(d(),f("span",{class:C(`delay ${s.active?"active":""} ${s.preset?"preset":""}`)},[s.value<1e4?(d(),f(R,{key:0},[m(O(s.value)+" ",1),t[0]||(t[0]=a("i",null,"ms",-1))],64)):(d(),f(R,{key:1},[t[1]||(t[1]=m(" >10 ")),t[2]||(t[2]=a("i",null,"s",-1))],64))],2))}},q=j(Le,[["__scopeId","data-v-eb548d44"]]),Fe={__name:"RecorderOutput",setup(s){const e=I();return(t,n)=>(d(),f("div",{class:C(`macro-recorder__output ${i(e).state.record&&"record"} ${i(e).state.edit&&"edit"}`)},[(d(!0),f(R,null,H(i(e).steps,(l,o)=>(d(),f(R,null,[l.type==="key"?(d(),b(A,{key:o,"key-obj":l.keyObj,direction:l.direction,active:i(e).state.editKey===o,onClick:v=>i(e).state.edit?i(e).toggleEdit("key",o):!1},null,8,["key-obj","direction","active","onClick"])):l.type==="delay"?(d(),b(q,{key:o,value:l.value,active:i(e).state.editDelay===o,onClick:v=>i(e).toggleEdit("delay",o)},null,8,["value","active","onClick"])):g("",!0),n[0]||(n[0]=a("hr",{class:"spacer"},null,-1))],64))),256))],2))}},Be=j(Fe,[["__scopeId","data-v-bfb55e2e"]]),Te={__name:"RecorderInput",setup(s){const e=x(null),t=I();return Y(()=>{t.state.record&&(e.value.focus(),t.delay.start!==0&&t.restartDelay())}),(n,l)=>(d(),f("div",{class:C(`recorder-input__container ${i(t).state.record&&"record"}`)},[i(t).state.record?(d(),f("input",{key:0,class:C(`macro-recorder__input ${i(t).state.record&&"record"}`),type:"text",ref_key:"macroInput",ref:e,onKeydown:l[0]||(l[0]=E(o=>i(t).recordStep(o,"down"),["prevent"])),onKeyup:l[1]||(l[1]=E(o=>i(t).recordStep(o,"up"),["prevent"]))},null,34)):g("",!0)],2))}},Ue=j(Te,[["__scopeId","data-v-f1475559"]]),He={class:"context-menu"},te={__name:"ContextMenu",props:{open:Boolean},setup(s,{expose:e}){e({toggle:l});const t=s,n=x(!1);S(()=>{n.value=t.open});function l(){n.value=!n.value}return(o,v)=>(d(),f("div",He,[a("div",{class:"context-menu__trigger",onClick:l},[W(o.$slots,"trigger")]),a("div",{class:C(`context-menu__content ${n.value?"open":""}`)},[W(o.$slots,"content")],2)]))}},qe={type:"number",step:"10",min:"0",max:"3600000",ref:"customDelayInput",placeholder:"100"},Ge={class:"flex justify-end"},Je={__name:"FixedDelayMenu",setup(s){const e=I(),t=x();function n(l){e.changeDelay(l),t.value.toggle()}return(l,o)=>(d(),b(te,{ref_key:"ctxtMenu",ref:t},{trigger:p(()=>[r(_,{variant:"secondary",size:"sm"},{default:p(()=>[r(i(ge)),o[5]||(o[5]=m("Fixed delay "))]),_:1})]),content:p(()=>[a("ul",null,[a("li",{onClick:o[0]||(o[0]=v=>n(0))},"0ms"),a("li",{onClick:o[1]||(o[1]=v=>n(15))},"15ms"),a("li",{onClick:o[2]||(o[2]=v=>n(50))},"50ms"),a("li",{onClick:o[3]||(o[3]=v=>n(100))},"100ms"),a("li",null,[r(z,null,{trigger:p(()=>o[6]||(o[6]=[a("span",null,"Custom delay",-1)])),content:p(()=>[o[9]||(o[9]=a("h4",{class:"text-slate-50 mb-4"},"Custom delay",-1)),a("form",{class:"grid gap-4 w-44",onSubmit:o[4]||(o[4]=E(v=>n(parseInt(l.$refs.customDelayInput.value)),["prevent"]))},[a("div",null,[a("input",qe,null,512),o[7]||(o[7]=a("span",null,"ms",-1))]),a("div",Ge,[r(_,{variant:"primary",size:"sm"},{default:p(()=>o[8]||(o[8]=[m("Set custom delay")])),_:1})])],32)]),_:1})])])]),_:1},512))}},Ye=j(Je,[["__scopeId","data-v-de355396"]]),Qe={id:"edit-key-dialog",class:"dialog__content"},We={class:"grid gap-4","submit.prevent":""},Xe={class:"flex gap-2 justify-center"},Ze={class:"flex justify-end"},et={__name:"EditKeyDialog",setup(s){const e=h({key:{},newKey:{}}),t=I(),n=x(null);S(()=>{e.key=t.getEditKey(),e.newKey.direction=e.key.direction});const l=u=>{e.newKey.e=u,e.newKey.keyObj=P(u)},o=u=>{e.newKey.direction=u,e.newKey.keyObj=P(e.key)},v=()=>{t.recordStep(e.newKey.e,e.newKey.direction,t.state.editKey),t.state.editKey=!1};return(u,y)=>(d(),f("div",Qe,[y[9]||(y[9]=a("h4",{class:"text-slate-50 mb-4"},"Press a key",-1)),a("div",{class:"flex justify-center",onClick:y[0]||(y[0]=c=>u.$refs.newKeyInput.focus())},[e.key.keyObj?(d(),b(A,{key:0,"key-obj":e.key.keyObj,direction:e.key.direction},null,8,["key-obj","direction"])):g("",!0),typeof e.newKey.keyObj=="object"?(d(),f(R,{key:1},[y[5]||(y[5]=a("span",{class:"px-4 flex items-center text-white"}," >>> ",-1)),r(A,{"key-obj":e.newKey.keyObj,direction:e.newKey.direction},null,8,["key-obj","direction"])],64)):g("",!0)]),a("form",We,[a("input",{class:"size-0 opacity-0",type:"text",min:"0",max:"1",ref_key:"newKeyInput",ref:n,placeholder:"New key",autofocus:"",onKeydown:y[1]||(y[1]=E(c=>l(c),["prevent"]))},null,544),a("div",Xe,[r(_,{variant:"secondary",class:C(e.newKey.direction==="down"?"selected":""),size:"sm",onClick:y[2]||(y[2]=E(c=>o("down"),["prevent"]))},{default:p(()=>y[6]||(y[6]=[m(" ↓ Down ")])),_:1},8,["class"]),r(_,{variant:"secondary",class:C(e.newKey.direction==="up"?"selected":""),size:"sm",onClick:y[3]||(y[3]=E(c=>o("up"),["prevent"]))},{default:p(()=>y[7]||(y[7]=[m(" ↑ Up ")])),_:1},8,["class"])]),a("div",Ze,[r(_,{variant:"primary",size:"sm",onClick:y[4]||(y[4]=E(c=>v(),["prevent"]))},{default:p(()=>y[8]||(y[8]=[m(" Change key ")])),_:1})])])]))}},tt=j(et,[["__scopeId","data-v-ba580ef2"]]),st={id:"edit-delay-dialog",class:"dialog__content"},nt={key:0,class:"flex justify-center"},ot={class:"grid gap-4 mt-6","submit.prevent":""},at={key:0},lt={class:"flex justify-end"},rt={__name:"EditDelayDialog",setup(s){const e=I(),t=h({delay:{},newDelay:{value:0}});S(()=>{t.delay=e.getEditDelay(),t.newDelay.value=t.delay.value});const n=()=>{t.newDelay.value&&(e.recordStep(t.newDelay.value,!1,e.state.editDelay),e.state.editDelay=!1)};return(l,o)=>(d(),f("div",st,[o[4]||(o[4]=a("h4",{class:"mb-4 text-slate-50"},"Edit delay",-1)),t.delay.value?(d(),f("div",nt,[r(q,{class:"!text-lg",value:t.delay.value},null,8,["value"])])):g("",!0),a("form",ot,[t.newDelay.value?(d(),f("div",at,[ie(a("input",{type:"number",min:"0",max:"3600000",step:"10","onUpdate:modelValue":o[0]||(o[0]=v=>t.newDelay.value=v),autofocus:""},null,512),[[de,t.newDelay.value]]),o[2]||(o[2]=a("span",null,"ms",-1))])):g("",!0),a("div",lt,[r(_,{variant:"primary",size:"sm",onClick:o[1]||(o[1]=E(v=>n(),["prevent"]))},{default:p(()=>o[3]||(o[3]=[m(" Change delay ")])),_:1})])])]))}},it=j(rt,[["__scopeId","data-v-a988f674"]]),dt={id:"delete-key-dialog",class:"dialog__content"},ut={class:"flex justify-center w-full mb-4"},ct={class:"flex justify-end gap-2 mt-6"},vt={__name:"DeleteKeyDialog",setup(s){const e=I(),t=x(null);return S(()=>{t.value=P(e.getEditKey())}),(n,l)=>(d(),f("div",dt,[l[2]||(l[2]=a("h4",{class:"mb-4 text-slate-50"},"Delete key",-1)),a("div",ut,[t.value?(d(),b(A,{key:0,"key-obj":t.value},null,8,["key-obj"])):g("",!0)]),l[3]||(l[3]=a("p",{class:"text-sm text-slate-300"},"Are you sure you want to delete this key?",-1)),a("div",ct,[r(_,{variant:"danger",size:"sm",onClick:l[0]||(l[0]=o=>i(e).deleteEditKey())},{default:p(()=>l[1]||(l[1]=[m(" Delete key ")])),_:1})])]))}},yt=j(vt,[["__scopeId","data-v-a48b7cc7"]]),pt={id:"insert-key-dialog",class:"dialog__content w-96"},ft={class:"text-slate-50 mb-4"},mt={key:0,class:"text-center"},kt={class:"insert-key__direction"},gt={class:"flex justify-end"},_t={__name:"InsertKeyDialog",props:{position:String},setup(s){const e=s,t=I(),n=h({selected:null,insert:null,insertEvent:null,insertDirection:"down",adjacent:null,adjacentDelay:null,adjacentDelayIndex:null}),l=x(null),o=x(!1);S(()=>{n.selected=P(t.getEditKey());const y=t.getAdjacentKey(e.position,!0);y&&(n.adjacent=P(y.key)),y.delay&&(n.adjacentDelay=y.delay,n.adjacentDelayIndex=y.delayIndex)});const v=y=>{n.insert=P(y),n.insertEvent=y},u=()=>{t.insertKey(n.insertEvent,n.insertDirection,n.adjacentDelayIndex)};return(y,c)=>(d(),f("div",pt,[a("h4",ft,"Insert key "+O(s.position),1),o.value?(d(),f("p",mt,"[Press a key]")):g("",!0),a("input",{class:"size-0 opacity-0",type:"text",min:"0",max:"1",ref_key:"insertKeyInput",ref:l,placeholder:"New key",onFocusin:c[0]||(c[0]=w=>o.value=!0),onFocusout:c[1]||(c[1]=w=>o.value=!1),onKeydown:c[2]||(c[2]=E(w=>v(w),["prevent"])),autofocus:""},null,544),a("div",{class:C(["insert-output",s.position=="before"?"flex-row-reverse":""])},[n.selected?(d(),b(A,{key:0,"key-obj":n.selected},null,8,["key-obj"])):g("",!0),c[10]||(c[10]=a("hr",{class:"spacer"},null,-1)),r(q,{preset:!0,value:10}),c[11]||(c[11]=a("hr",{class:"spacer"},null,-1)),n.insert?(d(),b(A,{key:1,class:"insert","key-obj":n.insert,direction:n.insertDirection,onClick:c[3]||(c[3]=w=>l.value.focus())},null,8,["key-obj","direction"])):g("",!0),n.insert?g("",!0):(d(),b(A,{key:2,empty:!0,onClick:c[4]||(c[4]=w=>l.value.focus())})),n.adjacentDelay?(d(),f(R,{key:3},[c[8]||(c[8]=a("hr",{class:"spacer"},null,-1)),r(q,{value:n.adjacentDelay.value},null,8,["value"])],64)):g("",!0),n.adjacent?(d(),f(R,{key:4},[c[9]||(c[9]=a("hr",{class:"spacer"},null,-1)),r(A,{"key-obj":n.adjacent},null,8,["key-obj"])],64)):g("",!0)],2),a("div",kt,[r(_,{variant:"secondary",class:C(n.insertDirection==="down"?"selected":""),size:"sm",onClick:c[5]||(c[5]=E(w=>n.insertDirection="down",["prevent"]))},{default:p(()=>c[12]||(c[12]=[m(" ↓ Down ")])),_:1},8,["class"]),r(_,{variant:"secondary",class:C(n.insertDirection==="up"?"selected":""),size:"sm",onClick:c[6]||(c[6]=E(w=>n.insertDirection="up",["prevent"]))},{default:p(()=>c[13]||(c[13]=[m(" ↑ Up ")])),_:1},8,["class"])]),a("div",gt,[r(_,{variant:"primary",size:"sm",onClick:c[7]||(c[7]=w=>u())},{default:p(()=>c[14]||(c[14]=[m("Insert key")])),_:1})])]))}},wt=j(_t,[["__scopeId","data-v-046a1063"]]),$t={key:0,class:"macro-edit__dialogs"},Dt={key:0,class:"flex gap-2"},bt={__name:"EditDialogs",setup(s){const e=I(),t=h({position:null}),n=x();S(()=>{e.$subscribe(v=>{v.events&&v.events.key=="editKey"&&v.events.newValue===!1&&(t.position=null)})});function l(){t.position!==null&&n.value.toggle()}function o(){e.state.editKey=!1,e.state.editDelay=!1,t.position=null}return(v,u)=>i(e).state.edit!==!1?(d(),f("div",$t,[i(e).state.editKey!==!1&&typeof i(e).getEditKey()=="object"?(d(),f("div",Dt,[r(te,{ref_key:"ctxtMenu",ref:n},{trigger:p(()=>[r(_,{variant:"dark",size:"sm"},{default:p(()=>[r(i(me)),u[2]||(u[2]=m(" Insert "))]),_:1})]),content:p(()=>[a("ul",null,[a("li",{onClick:u[0]||(u[0]=y=>t.position="before")},[r(i(ye)),u[3]||(u[3]=m(" Before"))]),a("li",{onClick:u[1]||(u[1]=y=>t.position="after")},[r(i(pe)),u[4]||(u[4]=m(" After"))])])]),_:1},512),t.position!==null?(d(),b(z,{key:0,open:t.position!==null,onOnOpen:l,onOnClose:o},{content:p(()=>[r(wt,{position:t.position},null,8,["position"])]),_:1},8,["open"])):g("",!0),r(z,{id:`edit-key-${i(e).state.editKey}`,onOnOpen:l,onOnClose:o},{trigger:p(()=>[r(_,{variant:"secondary",size:"sm"},{default:p(()=>[r(i(ee)),u[5]||(u[5]=m("Edit "))]),_:1})]),content:p(()=>[r(tt)]),_:1},8,["id"]),r(z,{onOnOpen:l,onOnClose:o},{trigger:p(()=>[r(_,{size:"sm",variant:"danger"},{default:p(()=>[r(i(Z)),u[6]||(u[6]=m("Delete "))]),_:1})]),content:p(()=>[r(yt)]),_:1})])):g("",!0),i(e).state.editDelay!==!1&&typeof i(e).getEditDelay()=="object"?(d(),b(z,{key:1,onOnOpen:l,onOnClose:o},{trigger:p(()=>[r(_,{variant:"secondary",size:"sm"},{default:p(()=>[r(i(ve)),u[7]||(u[7]=m("Edit "))]),_:1})]),content:p(()=>[r(it)]),_:1})):g("",!0)])):g("",!0)}},xt=j(bt,[["__scopeId","data-v-2ff36c22"]]),Mt={class:"macro-recorder__header"},Kt={class:"w-full grid grid-cols-[auto_1fr_auto] gap-2"},Ct=["value"],jt={__name:"RecorderHeader",setup(s){const e=I(),t=ue(()=>e.macroName),n=x(!1);Y(()=>{n.value=t.value&&t.value.length>0});function l(o){e.changeName(o),n.value=o.length>0}return(o,v)=>(d(),f("div",Mt,[a("div",Kt,[v[7]||(v[7]=a("h4",{class:""},"Name:",-1)),a("input",{id:"macro-name",type:"text",onInput:v[0]||(v[0]=E(u=>l(u.target.value),["prevent"])),value:t.value,placeholder:"New macro"},null,40,Ct),a("div",{class:C(`recording__buttons ${!n.value||i(e).state.edit?"disabled":""}`)},[m(O(i(e).name)+" ",1),i(e).state.record?g("",!0):(d(),b(_,{key:0,variant:"primary",onClick:v[1]||(v[1]=u=>i(e).state.record=!0)},{default:p(()=>[r(i(_e),{class:"text-red-500"}),v[5]||(v[5]=m("Record "))]),_:1})),i(e).state.record?(d(),b(_,{key:1,variant:"danger",onClick:v[2]||(v[2]=u=>i(e).state.record=!1)},{default:p(()=>[r(i(X),{class:"text-white"}),v[6]||(v[6]=m("Stop "))]),_:1})):g("",!0)],2)]),i(e).steps.length>0?(d(),f("div",{key:0,class:C(`edit__buttons ${i(e).state.record?"disabled":""}`)},[a("div",null,[i(e).state.edit?g("",!0):(d(),b(_,{key:0,variant:"secondary",onClick:v[3]||(v[3]=u=>i(e).state.edit=!0)},{default:p(()=>[r(i(ee)),v[8]||(v[8]=m("Edit "))]),_:1})),i(e).state.edit?(d(),b(_,{key:1,variant:"danger",onClick:v[4]||(v[4]=u=>i(e).resetEdit())},{default:p(()=>[r(i(X)),v[9]||(v[9]=m("Stop "))]),_:1})):g("",!0)]),i(e).state.edit?(d(),b(Ye,{key:0})):g("",!0),r(xt)],2)):g("",!0)]))}},It=j(jt,[["__scopeId","data-v-f2d09e68"]]),Et={id:"validation-error__dialog",class:"dialog__content"},Ot={key:0,class:"grid gap-4"},Rt={key:0},St={key:1},Nt={class:"flex justify-end mt-4"},Vt={__name:"ValidationErrorDialog",setup(s){const e=I(),t=h({up:[],down:[]});return S(()=>{e.$subscribe(n=>{n.events&&n.events.key=="validationErrors"&&(t.up=n.events.newValue!==!1?e.state.validationErrors.up:[],t.down=n.events.newValue!==!1?e.state.validationErrors.down:[])})}),(n,l)=>(d(),f("div",Et,[l[4]||(l[4]=a("h4",{class:"mb-4 text-slate-50"},"There's an error in your macro",-1)),t&&t.up.length>0||t.down.length>0?(d(),f("div",Ot,[t.down.length>0?(d(),f("div",Rt,[l[1]||(l[1]=a("p",null,[m(" The following keys have been "),a("strong",null,"pressed"),m(" down, but "),a("strong",null,"not released"),m(". ")],-1)),a("ul",null,[(d(!0),f(R,null,H(t.down,o=>(d(),f("li",{key:o},O(o.toUpperCase()),1))),128))])])):g("",!0),t.up.length>0?(d(),f("div",St,[l[2]||(l[2]=a("p",null,[m(" The following keys have been "),a("strong",null,"released"),m(", but "),a("strong",null,"not pressed"),m(" down. ")],-1)),a("ul",null,[(d(!0),f(R,null,H(t.up,o=>(d(),f("li",{key:o},O(o.toUpperCase()),1))),128))])])):g("",!0)])):g("",!0),a("div",Nt,[r(_,{size:"sm",variant:"danger",onClick:l[0]||(l[0]=o=>i(e).state.validationErrors=!1)},{default:p(()=>l[3]||(l[3]=[m(" Close ")])),_:1})])]))}},zt=j(Vt,[["__scopeId","data-v-d58db43f"]]),At={class:"macro-recorder__footer"},Pt={class:"grid gap-2"},ht={class:"mb-2 text-center text-sky-500"},Lt={class:"flex justify-between"},Ft={__name:"RecorderFooter",setup(s){const e=I(),t=x(),n=x();S(()=>{e.$subscribe(v=>{v.events&&v.events.key=="validationErrors"&&t.value.toggleDialog(v.events.newValue!==!1)})});const l=async()=>{await e.checkMacro()?n.value.toggleDialog(!0):o()},o=async()=>{n.value.toggleDialog(!1),await e.saveMacro()?window.location.reload():t.value.toggleDialog(!0)};return(v,u)=>(d(),f("div",At,[i(e).steps.length>0?(d(),b(_,{key:0,variant:"danger",onClick:u[0]||(u[0]=y=>i(e).reset())},{default:p(()=>[r(i(ke)),u[4]||(u[4]=m(" Reset "))]),_:1})):g("",!0),r(z,{ref_key:"errorDialog",ref:t},{content:p(()=>[r(zt)]),_:1},512),r(z,{ref_key:"overwriteDialog",ref:n},{content:p(()=>[a("div",Pt,[u[7]||(u[7]=a("h4",{class:"pr-4"},"Are you sure you want to overwrite:",-1)),a("h3",ht,O(i(e).macroName),1),a("div",Lt,[r(_,{size:"sm",variant:"subtle",onClick:u[1]||(u[1]=y=>n.value.toggleDialog(!1))},{default:p(()=>u[5]||(u[5]=[m("No")])),_:1}),r(_,{size:"sm",variant:"primary",onClick:u[2]||(u[2]=y=>o())},{default:p(()=>u[6]||(u[6]=[m("Yes")])),_:1})])])]),_:1},512),i(e).steps.length>0?(d(),b(_,{key:1,disabled:i(e).state.record||i(e).state.edit,variant:"success",onClick:u[3]||(u[3]=y=>l())},{default:p(()=>[r(i(ce)),u[8]||(u[8]=m(" Save "))]),_:1},8,["disabled"])):g("",!0)]))}},Bt=j(Ft,[["__scopeId","data-v-0a809300"]]),Tt={class:"macro-recorder mcrm-block block__light"},Ut={class:"recorder-interface"},Ht={__name:"MacroRecorder",setup(s){const e=I();return(t,n)=>(d(),f("div",Tt,[a("div",Ut,[r(It),a("div",{class:C(`recorder-interface__container ${i(e).state.record&&"record"} ${i(e).state.edit&&"edit"}`)},[r(Be),r(Ue)],2),r(Bt)])]))}},qt={id:"macros",class:"panel"},Gt={class:"panel__content !p-0 !overflow-hidden"},Jt={class:"macro-panel__content"},Yt={__name:"MacrosView",setup(s){return(e,t)=>(d(),f("div",qt,[t[0]||(t[0]=a("h1",{class:"panel__title"},"Macros",-1)),a("div",Gt,[a("div",Jt,[r(Ve),r(Ht)])])]))}},os=j(Yt,[["__scopeId","data-v-fc7e8117"]]);export{os as default}; -//# sourceMappingURL=MacrosView-CE74eyGa.js.map diff --git a/public/assets/MacrosView-CE74eyGa.js.map b/public/assets/MacrosView-CE74eyGa.js.map deleted file mode 100644 index 98538cd..0000000 --- a/public/assets/MacrosView-CE74eyGa.js.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"file":"MacrosView-CE74eyGa.js","sources":["../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconAlarm.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconArrowLeftCircle.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconArrowRightCircle.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconLoader3.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconPlus.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconRestore.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconTimeDuration15.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconPlayerRecordFilled.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconPlayerStopFilled.mjs","../../ui/src/services/MacroRecordService.js","../../ui/src/stores/macrorecorder.js","../../ui/src/components/macros/MacroOverview.vue","../../ui/src/components/macros/components/MacroKey.vue","../../ui/src/components/macros/parts/RecorderOutput.vue","../../ui/src/components/macros/parts/RecorderInput.vue","../../ui/src/components/base/ContextMenu.vue","../../ui/src/components/macros/components/FixedDelayMenu.vue","../../ui/src/components/macros/components/EditKeyDialog.vue","../../ui/src/components/macros/components/EditDelayDialog.vue","../../ui/src/components/macros/components/DeleteKeyDialog.vue","../../ui/src/components/macros/components/InsertKeyDialog.vue","../../ui/src/components/macros/parts/EditDialogs.vue","../../ui/src/components/macros/parts/RecorderHeader.vue","../../ui/src/components/macros/components/ValidationErrorDialog.vue","../../ui/src/components/macros/parts/RecorderFooter.vue","../../ui/src/components/macros/MacroRecorder.vue"],"sourcesContent":["/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconAlarm = createVueComponent(\"outline\", \"alarm\", \"IconAlarm\", [[\"path\", { \"d\": \"M12 13m-7 0a7 7 0 1 0 14 0a7 7 0 1 0 -14 0\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M12 10l0 3l2 0\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M7 4l-2.75 2\", \"key\": \"svg-2\" }], [\"path\", { \"d\": \"M17 4l2.75 2\", \"key\": \"svg-3\" }]]);\n\nexport { IconAlarm as default };\n//# sourceMappingURL=IconAlarm.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconArrowLeftCircle = createVueComponent(\"outline\", \"arrow-left-circle\", \"IconArrowLeftCircle\", [[\"path\", { \"d\": \"M17 12h-14\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M6 9l-3 3l3 3\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M19 12m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0\", \"key\": \"svg-2\" }]]);\n\nexport { IconArrowLeftCircle as default };\n//# sourceMappingURL=IconArrowLeftCircle.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconArrowRightCircle = createVueComponent(\"outline\", \"arrow-right-circle\", \"IconArrowRightCircle\", [[\"path\", { \"d\": \"M18 15l3 -3l-3 -3\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M5 12m-2 0a2 2 0 1 0 4 0a2 2 0 1 0 -4 0\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M7 12h14\", \"key\": \"svg-2\" }]]);\n\nexport { IconArrowRightCircle as default };\n//# sourceMappingURL=IconArrowRightCircle.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconLoader3 = createVueComponent(\"outline\", \"loader-3\", \"IconLoader3\", [[\"path\", { \"d\": \"M3 12a9 9 0 0 0 9 9a9 9 0 0 0 9 -9a9 9 0 0 0 -9 -9\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M17 12a5 5 0 1 0 -5 5\", \"key\": \"svg-1\" }]]);\n\nexport { IconLoader3 as default };\n//# sourceMappingURL=IconLoader3.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconPlus = createVueComponent(\"outline\", \"plus\", \"IconPlus\", [[\"path\", { \"d\": \"M12 5l0 14\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M5 12l14 0\", \"key\": \"svg-1\" }]]);\n\nexport { IconPlus as default };\n//# sourceMappingURL=IconPlus.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconRestore = createVueComponent(\"outline\", \"restore\", \"IconRestore\", [[\"path\", { \"d\": \"M3.06 13a9 9 0 1 0 .49 -4.087\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M3 4.001v5h5\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M12 12m-1 0a1 1 0 1 0 2 0a1 1 0 1 0 -2 0\", \"key\": \"svg-2\" }]]);\n\nexport { IconRestore as default };\n//# sourceMappingURL=IconRestore.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconTimeDuration15 = createVueComponent(\"outline\", \"time-duration-15\", \"IconTimeDuration15\", [[\"path\", { \"d\": \"M12 15h2a1 1 0 0 0 1 -1v-1a1 1 0 0 0 -1 -1h-2v-3h3\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M9 9v6\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M3 12v.01\", \"key\": \"svg-2\" }], [\"path\", { \"d\": \"M12 21v.01\", \"key\": \"svg-3\" }], [\"path\", { \"d\": \"M7.5 4.2v.01\", \"key\": \"svg-4\" }], [\"path\", { \"d\": \"M16.5 19.8v.01\", \"key\": \"svg-5\" }], [\"path\", { \"d\": \"M7.5 19.8v.01\", \"key\": \"svg-6\" }], [\"path\", { \"d\": \"M4.2 16.5v.01\", \"key\": \"svg-7\" }], [\"path\", { \"d\": \"M19.8 16.5v.01\", \"key\": \"svg-8\" }], [\"path\", { \"d\": \"M4.2 7.5v.01\", \"key\": \"svg-9\" }], [\"path\", { \"d\": \"M21 12a9 9 0 0 0 -9 -9\", \"key\": \"svg-10\" }]]);\n\nexport { IconTimeDuration15 as default };\n//# sourceMappingURL=IconTimeDuration15.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconPlayerRecordFilled = createVueComponent(\"filled\", \"player-record-filled\", \"IconPlayerRecordFilled\", [[\"path\", { \"d\": \"M8 5.072a8 8 0 1 1 -3.995 7.213l-.005 -.285l.005 -.285a8 8 0 0 1 3.995 -6.643z\", \"key\": \"svg-0\" }]]);\n\nexport { IconPlayerRecordFilled as default };\n//# sourceMappingURL=IconPlayerRecordFilled.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconPlayerStopFilled = createVueComponent(\"filled\", \"player-stop-filled\", \"IconPlayerStopFilled\", [[\"path\", { \"d\": \"M17 4h-10a3 3 0 0 0 -3 3v10a3 3 0 0 0 3 3h10a3 3 0 0 0 3 -3v-10a3 3 0 0 0 -3 -3z\", \"key\": \"svg-0\" }]]);\n\nexport { IconPlayerStopFilled as default };\n//# sourceMappingURL=IconPlayerStopFilled.mjs.map\n","/*\nMacrame is a program that enables the user to create keyboard macros and button panels. \nThe macros are saved as simple JSON files and can be linked to the button panels. The panels can \nbe created with HTML and CSS.\n\nCopyright (C) 2025 Jesse Malotaux\n\nThis program is free software: you can redistribute it and/or modify \nit under the terms of the GNU General Public License as published by \nthe Free Software Foundation, either version 3 of the License, or \n(at your option) any later version.\n\nThis program is distributed in the hope that it will be useful, \nbut WITHOUT ANY WARRANTY; without even the implied warranty of \nMERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the \nGNU General Public License for more details.\n\nYou should have received a copy of the GNU General Public License \nalong with this program. If not, see .\n*/\n\nconst keyMap = {\n // Modifier keys\n Control: 'Ctrl',\n Shift: 'Shift',\n Alt: 'Alt',\n Meta: 'Win',\n CapsLock: 'Caps',\n // Special keys\n PageUp: 'PgUp',\n PageDown: 'PgDn',\n ScrollLock: 'Scr Lk',\n Insert: 'Ins',\n Delete: 'Del',\n Escape: 'Esc',\n Space: 'Space',\n // Symbol keys\n Backquote: '`',\n Backslash: '\\\\',\n BracketLeft: '[',\n BracketRight: ']',\n Comma: ',',\n Equal: '=',\n Minus: '-',\n Period: '.',\n Quote: \"'\",\n Semicolon: ';',\n Slash: '/',\n // Arrow keys\n ArrowUp: '▲',\n ArrowRight: '▶',\n ArrowDown: '▼',\n ArrowLeft: '◀',\n // Media keys\n MediaPlayPause: 'Play',\n MediaStop: 'Stop',\n MediaTrackNext: 'Next',\n MediaTrackPrevious: 'Prev',\n MediaVolumeDown: 'Down',\n MediaVolumeUp: 'Up',\n AudioVolumeMute: 'Mute',\n AudioVolumeDown: 'Down',\n AudioVolumeUp: 'Up',\n}\n\n/**\n * Filters a keyboard event and returns an object with two properties:\n * loc (optional) and str.\n * loc is the location of the key (either 'left', 'right', or 'num').\n * str is the string representation of the key (e.g. 'a', 'A', 'Enter', etc.).\n * If the key is a modifier key, it is represented by its name (e.g. 'Ctrl', 'Shift', etc.).\n * If the key is not a modifier key, it is represented by its character (e.g. 'a', 'A', etc.).\n * If the key is not a character key, it is represented by its symbol (e.g. ',', '.', etc.).\n * @param {KeyboardEvent} e - The keyboard event to filter.\n * @return {Object} An object with two properties: loc (optional) and str.\n */\nexport const filterKey = (e) => {\n const k = {} // Object k (key)\n\n // If location is set, set loc (location)\n if (e.location === 1) k.loc = 'left'\n if (e.location === 2) k.loc = 'right'\n if (e.location === 3) k.loc = 'num'\n\n if (e.key.includes('Media') || e.key.includes('Audio')) k.loc = mediaPrefix(e)\n\n // If code is in keyMap, set str by code\n if (keyMap[e.code] || keyMap[e.key]) {\n k.str = keyMap[e.code] || keyMap[e.key]\n } else {\n // If code is not in keyMap, set str by e.key\n k.str = e.key.toLowerCase()\n }\n\n // return k object\n return k\n}\n\n/**\n * Returns a string prefix for the given media key.\n * @param {KeyboardEvent} e - The keyboard event to get the prefix for.\n * @return {string} The prefix for the key (either 'Media' or 'Volume').\n */\nconst mediaPrefix = (e) => {\n switch (e.key) {\n case 'MediaPlayPause':\n case 'MediaStop':\n case 'MediaTrackNext':\n case 'MediaTrackPrevious':\n return 'Media'\n case 'MediaVolumeDown':\n case 'MediaVolumeUp':\n case 'AudioVolumeDown':\n case 'AudioVolumeUp':\n case 'AudioVolumeMute':\n return 'Volume'\n }\n}\n\nexport const isRepeat = (lastStep, e, direction) => {\n return (\n lastStep &&\n lastStep.type === 'key' &&\n lastStep.code === e.code &&\n lastStep.direction === direction\n )\n}\n\nexport const invalidMacro = (steps) => {\n const downKeys = []\n const upKeys = []\n\n Object.keys(steps).forEach((stepKey) => {\n const step = steps[stepKey]\n\n if (step.type !== 'key') return\n\n if (step.direction == 'down') downKeys.push(step.key)\n if (step.direction == 'up') {\n if (!downKeys.includes(step.key)) upKeys.push(step.key)\n else downKeys.splice(downKeys.indexOf(step.key), 1)\n }\n })\n\n if (upKeys.length === 0 && downKeys.length === 0) return false\n\n return { down: downKeys, up: upKeys }\n}\n\nexport const translateJSON = (json) => {\n const steps = []\n\n json.forEach((step) => {\n if (step.type === 'delay') steps.push(step)\n if (step.type === 'key') steps.push(codeToStep(step.code, step.direction))\n })\n\n return steps\n}\n\nexport const codeToStep = (code, direction) => {\n let key = ''\n let location = 0\n let codeStr = code\n\n if (code.includes('Left')) {\n key = code.replace('Left', '')\n location = 1\n }\n if (code.includes('Right')) {\n key = code.replace('Right', '')\n location = 2\n }\n if (code.includes('Numpad')) {\n key = code.replace('Numpad', '')\n location = 3\n }\n\n if (code.includes('Media')) codeStr = ''\n\n if (key === '') key = code\n\n const stepObj = {\n type: 'key',\n code: codeStr,\n key: key,\n location: location,\n direction: direction,\n }\n\n return { ...stepObj, keyObj: filterKey(stepObj) }\n}\n","/*\nMacrame is a program that enables the user to create keyboard macros and button panels. \nThe macros are saved as simple JSON files and can be linked to the button panels. The panels can \nbe created with HTML and CSS.\n\nCopyright (C) 2025 Jesse Malotaux\n\nThis program is free software: you can redistribute it and/or modify \nit under the terms of the GNU General Public License as published by \nthe Free Software Foundation, either version 3 of the License, or \n(at your option) any later version.\n\nThis program is distributed in the hope that it will be useful, \nbut WITHOUT ANY WARRANTY; without even the implied warranty of \nMERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the \nGNU General Public License for more details.\n\nYou should have received a copy of the GNU General Public License \nalong with this program. If not, see .\n*/\n\nimport { ref } from 'vue'\nimport { defineStore } from 'pinia'\n\nimport { filterKey, isRepeat, invalidMacro, translateJSON } from '../services/MacroRecordService'\nimport axios from 'axios'\nimport { appUrl } from '@/services/ApiService'\n\nexport const useMacroRecorderStore = defineStore('macrorecorder', () => {\n // Properties - State values\n const state = ref({\n record: false,\n edit: false,\n editKey: false,\n editDelay: false,\n validationErrors: false,\n })\n\n const macroName = ref('')\n\n const steps = ref([])\n\n const delay = ref({\n start: 0,\n fixed: false,\n })\n\n // Getters - Computed values\n const getEditKey = () => steps.value[state.value.editKey]\n const getAdjacentKey = (pos, includeDelay = false) => {\n let returnVal = false\n\n const mod = pos == 'before' ? -1 : 1\n const keyIndex = state.value.editKey + 2 * mod\n const delayIndex = includeDelay ? state.value.editKey + 1 * mod : false\n\n if (steps.value[keyIndex]) returnVal = steps.value[keyIndex]\n if (delayIndex && steps.value[delayIndex])\n returnVal = {\n delay: steps.value[delayIndex],\n key: steps.value[keyIndex],\n delayIndex: delayIndex,\n }\n\n return returnVal\n }\n\n const getEditDelay = () => steps.value[state.value.editDelay]\n\n // Setters - Actions\n const recordStep = (e, direction = false, key = false) => {\n if ((e.ctrlKey, e.shiftKey, e.altKey, e.metaKey)) e.preventDefault()\n\n const lastStep = steps.value[steps.value.length - 1]\n\n let stepVal = {}\n\n if (typeof e === 'object' && !isRepeat(lastStep, e, direction)) {\n if (key === false) recordDelay()\n\n stepVal = {\n type: 'key',\n key: e.key,\n code: e.code,\n location: e.location,\n direction: direction,\n keyObj: filterKey(e),\n }\n } else if (direction && key !== false) {\n stepVal = steps.value[key]\n stepVal.direction = direction\n } else if (typeof e === 'number') {\n stepVal = { type: 'delay', value: parseFloat(e.toFixed()) }\n }\n\n if (key !== false) steps.value[key] = stepVal\n else steps.value.push(stepVal)\n }\n\n const recordDelay = () => {\n if (delay.value.fixed !== false)\n recordStep(delay.value.fixed) // Record fixed delay\n else if (delay.value.start == 0)\n delay.value.start = performance.now() // Record start of delay\n else {\n recordStep(performance.now() - delay.value.start) // Record end of delay\n delay.value.start = performance.now() // Reset start\n }\n }\n\n const insertKey = (e, direction, adjacentDelayIndex) => {\n let min, max, newKeyIndex, newDelayIndex\n\n if (adjacentDelayIndex === null) {\n min = state.value.editKey == 0 ? 0 : state.value.editKey\n max = state.value.editKey == 0 ? 1 : false\n\n newKeyIndex = max === false ? min + 2 : min\n newDelayIndex = min + 1\n } else if (state.value.editKey < adjacentDelayIndex) {\n min = state.value.editKey\n max = adjacentDelayIndex\n newKeyIndex = min + 2\n newDelayIndex = min + 1\n } else {\n min = adjacentDelayIndex\n max = state.value.editKey\n newKeyIndex = min + 1\n newDelayIndex = min + 2\n }\n\n if (max !== false) {\n for (let i = Object.keys(steps.value).length - 1; i >= max; i--) {\n steps.value[i + 2] = steps.value[i]\n }\n }\n\n recordStep(e, direction, newKeyIndex)\n recordStep(10, false, newDelayIndex)\n\n state.value.editKey = false\n }\n\n const deleteEditKey = () => {\n if (state.value.editKey === 0) steps.value.splice(state.value.editKey, 2)\n else steps.value.splice(state.value.editKey - 1, 2)\n state.value.editKey = false\n }\n\n const restartDelay = () => {\n delay.value.start = performance.now()\n }\n\n const changeName = (name) => {\n macroName.value = name\n }\n\n const changeDelay = (fixed) => {\n delay.value.fixed = fixed\n\n formatDelays()\n }\n\n const formatDelays = () => {\n steps.value = steps.value.map((step) => {\n if (step.type === 'delay' && delay.value.fixed !== false) step.value = delay.value.fixed\n return step\n })\n }\n\n const toggleEdit = (type, key) => {\n if (type === 'key') {\n state.value.editKey = key\n state.value.editDelay = false\n }\n\n if (type === 'delay') {\n state.value.editKey = false\n state.value.editDelay = key\n }\n }\n\n const resetEdit = () => {\n state.value.edit = false\n state.value.editKey = false\n state.value.editDelay = false\n }\n\n const resetMacro = () => {\n state.value.record = false\n delay.value.start = 0\n macroName.value = ''\n steps.value = []\n\n if (state.value.edit) resetEdit()\n }\n\n const checkMacro = async () => {\n const resp = await axios.post(appUrl() + '/macro/check', {\n macro: macroName.value,\n })\n\n return resp.data\n }\n\n const saveMacro = async () => {\n state.value.validationErrors = invalidMacro(steps.value)\n\n if (state.value.validationErrors) return false\n\n const resp = await axios.post(appUrl() + '/macro/record', {\n name: macroName.value,\n steps: steps.value,\n })\n\n return resp.status == 200\n }\n\n const deleteMacro = async (macroFilename) => {\n const resp = await axios.post(appUrl() + '/macro/delete', {\n macro: macroFilename,\n })\n\n if (resp.status == 200) return resp.data\n else return false\n }\n\n const openMacro = async (macroFileName, name) => {\n const openResp = await axios.post(appUrl() + '/macro/open', {\n macro: macroFileName,\n })\n\n if (openResp.data) steps.value = translateJSON(openResp.data)\n\n macroName.value = name\n }\n\n return {\n state,\n macroName,\n steps,\n delay,\n getEditKey,\n getAdjacentKey,\n getEditDelay,\n recordStep,\n insertKey,\n deleteEditKey,\n restartDelay,\n changeName,\n changeDelay,\n toggleEdit,\n resetEdit,\n resetMacro,\n checkMacro,\n saveMacro,\n deleteMacro,\n openMacro,\n }\n})\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n'\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n"],"names":["IconAlarm","createVueComponent","IconArrowLeftCircle","IconArrowRightCircle","IconLoader3","IconPlus","IconRestore","IconTimeDuration15","IconPlayerRecordFilled","IconPlayerStopFilled","keyMap","filterKey","e","k","mediaPrefix","isRepeat","lastStep","direction","invalidMacro","steps","downKeys","upKeys","stepKey","step","translateJSON","json","codeToStep","code","key","location","codeStr","stepObj","useMacroRecorderStore","defineStore","state","ref","macroName","delay","getEditKey","getAdjacentKey","pos","includeDelay","returnVal","mod","keyIndex","delayIndex","getEditDelay","recordStep","stepVal","recordDelay","insertKey","adjacentDelayIndex","min","max","newKeyIndex","newDelayIndex","i","deleteEditKey","restartDelay","changeName","name","changeDelay","fixed","formatDelays","toggleEdit","type","resetEdit","axios","appUrl","macroFilename","resp","macroFileName","openResp","macros","reactive","macroRecorder","macroToBeDeleted","deleteDialog","onMounted","loadMacroList","list","GetMacroList","startDelete","deleteMacro","props","__props","dir","setDirection","onUpdated","macroInput","__expose","toggle","menuOpen","ctxtMenu","num","editable","newKeyInput","handleNewKey","handleNewDirection","changeKey","keyObj","keyObjs","insertKeyInput","inputFocus","adjacentKey","handleInsertKey","insert","mutation","onOpenDialog","onCloseDialog","computed","nameSet","errors","errorDialog","overwriteDialog","startCheck","saveMacro"],"mappings":"kWAAA;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIA,GAAYC,EAAmB,UAAW,QAAS,YAAa,CAAC,CAAC,OAAQ,CAAE,EAAK,6CAA8C,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,iBAAkB,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,eAAgB,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,eAAgB,IAAO,OAAS,CAAA,CAAC,CAAC,ECThT;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIC,GAAsBD,EAAmB,UAAW,oBAAqB,sBAAuB,CAAC,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,gBAAiB,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,2CAA4C,IAAO,OAAO,CAAE,CAAC,CAAC,ECTxR;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIE,GAAuBF,EAAmB,UAAW,qBAAsB,uBAAwB,CAAC,CAAC,OAAQ,CAAE,EAAK,oBAAqB,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,0CAA2C,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,WAAY,IAAO,OAAO,CAAE,CAAC,CAAC,ECT5R;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIG,GAAcH,EAAmB,UAAW,WAAY,cAAe,CAAC,CAAC,OAAQ,CAAE,EAAK,qDAAsD,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,wBAAyB,IAAO,OAAS,CAAA,CAAC,CAAC,ECThO;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAII,GAAWJ,EAAmB,UAAW,OAAQ,WAAY,CAAC,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,CAAC,CAAC,ECTnK;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIK,GAAcL,EAAmB,UAAW,UAAW,cAAe,CAAC,CAAC,OAAQ,CAAE,EAAK,gCAAiC,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,eAAgB,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,2CAA4C,IAAO,OAAO,CAAE,CAAC,CAAC,ECThR;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIM,GAAqBN,EAAmB,UAAW,mBAAoB,qBAAsB,CAAC,CAAC,OAAQ,CAAE,EAAK,qDAAsD,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,SAAU,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,YAAa,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,eAAgB,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,iBAAkB,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,gBAAiB,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,gBAAiB,IAAO,OAAO,CAAE,EAAG,CAAC,OAAQ,CAAE,EAAK,iBAAkB,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,eAAgB,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,yBAA0B,IAAO,QAAU,CAAA,CAAC,CAAC,ECT9rB;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIO,GAAyBP,EAAmB,SAAU,uBAAwB,yBAA0B,CAAC,CAAC,OAAQ,CAAE,EAAK,iFAAkF,IAAO,OAAO,CAAE,CAAC,CAAC,ECTjO;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIQ,EAAuBR,EAAmB,SAAU,qBAAsB,uBAAwB,CAAC,CAAC,OAAQ,CAAE,EAAK,mFAAoF,IAAO,OAAO,CAAE,CAAC,CAAC,8QCYvNS,EAAS,CAEb,QAAS,OACT,MAAO,QACP,IAAK,MACL,KAAM,MACN,SAAU,OAEV,OAAQ,OACR,SAAU,OACV,WAAY,SACZ,OAAQ,MACR,OAAQ,MACR,OAAQ,MACR,MAAO,QAEP,UAAW,IACX,UAAW,KACX,YAAa,IACb,aAAc,IACd,MAAO,IACP,MAAO,IACP,MAAO,IACP,OAAQ,IACR,MAAO,IACP,UAAW,IACX,MAAO,IAEP,QAAS,UACT,WAAY,UACZ,UAAW,UACX,UAAW,UAEX,eAAgB,OAChB,UAAW,OACX,eAAgB,OAChB,mBAAoB,OACpB,gBAAiB,OACjB,cAAe,KACf,gBAAiB,OACjB,gBAAiB,OACjB,cAAe,IACjB,EAaaC,EAAaC,GAAM,CAC9B,MAAMC,EAAI,CAAE,EAGZ,OAAID,EAAE,WAAa,IAAGC,EAAE,IAAM,QAC1BD,EAAE,WAAa,IAAGC,EAAE,IAAM,SAC1BD,EAAE,WAAa,IAAGC,EAAE,IAAM,QAE1BD,EAAE,IAAI,SAAS,OAAO,GAAKA,EAAE,IAAI,SAAS,OAAO,KAAGC,EAAE,IAAMC,GAAYF,CAAC,GAGzEF,EAAOE,EAAE,IAAI,GAAKF,EAAOE,EAAE,GAAG,EAChCC,EAAE,IAAMH,EAAOE,EAAE,IAAI,GAAKF,EAAOE,EAAE,GAAG,EAGtCC,EAAE,IAAMD,EAAE,IAAI,YAAW,EAIpBC,CACT,EAOMC,GAAeF,GAAM,CACzB,OAAQA,EAAE,IAAG,CACX,IAAK,iBACL,IAAK,YACL,IAAK,iBACL,IAAK,qBACH,MAAO,QACT,IAAK,kBACL,IAAK,gBACL,IAAK,kBACL,IAAK,gBACL,IAAK,kBACH,MAAO,QACb,CACA,EAEaG,GAAW,CAACC,EAAU,EAAGC,IAElCD,GACAA,EAAS,OAAS,OAClBA,EAAS,OAAS,EAAE,MACpBA,EAAS,YAAcC,EAIdC,GAAgBC,GAAU,CACrC,MAAMC,EAAW,CAAA,EACXC,EAAS,CAAA,EAcf,OAZA,OAAO,KAAKF,CAAK,EAAE,QAASG,GAAY,CACtC,MAAMC,EAAOJ,EAAMG,CAAO,EAEtBC,EAAK,OAAS,QAEdA,EAAK,WAAa,QAAQH,EAAS,KAAKG,EAAK,GAAG,EAChDA,EAAK,WAAa,OACfH,EAAS,SAASG,EAAK,GAAG,EAC1BH,EAAS,OAAOA,EAAS,QAAQG,EAAK,GAAG,EAAG,CAAC,EADhBF,EAAO,KAAKE,EAAK,GAAG,GAGzD,CAAA,EAEGF,EAAO,SAAW,GAAKD,EAAS,SAAW,EAAU,GAElD,CAAE,KAAMA,EAAU,GAAIC,CAAM,CACrC,EAEaG,GAAiBC,GAAS,CACrC,MAAMN,EAAQ,CAAA,EAEd,OAAAM,EAAK,QAASF,GAAS,CACjBA,EAAK,OAAS,SAASJ,EAAM,KAAKI,CAAI,EACtCA,EAAK,OAAS,OAAOJ,EAAM,KAAKO,GAAWH,EAAK,KAAMA,EAAK,SAAS,CAAC,CAC1E,CAAA,EAEMJ,CACT,EAEaO,GAAa,CAACC,EAAMV,IAAc,CAC7C,IAAIW,EAAM,GACNC,EAAW,EACXC,EAAUH,EAEVA,EAAK,SAAS,MAAM,IACtBC,EAAMD,EAAK,QAAQ,OAAQ,EAAE,EAC7BE,EAAW,GAETF,EAAK,SAAS,OAAO,IACvBC,EAAMD,EAAK,QAAQ,QAAS,EAAE,EAC9BE,EAAW,GAETF,EAAK,SAAS,QAAQ,IACxBC,EAAMD,EAAK,QAAQ,SAAU,EAAE,EAC/BE,EAAW,GAGTF,EAAK,SAAS,OAAO,IAAGG,EAAU,IAElCF,IAAQ,KAAIA,EAAMD,GAEtB,MAAMI,EAAU,CACd,KAAM,MACN,KAAMD,EACN,IAAKF,EACL,SAAUC,EACV,UAAWZ,CACf,EAEE,MAAO,CAAE,GAAGc,EAAS,OAAQpB,EAAUoB,CAAO,CAAC,CACjD,ECnKaC,EAAwBC,GAAY,gBAAiB,IAAM,CAEtE,MAAMC,EAAQC,EAAI,CAChB,OAAQ,GACR,KAAM,GACN,QAAS,GACT,UAAW,GACX,iBAAkB,EACnB,CAAA,EAEKC,EAAYD,EAAI,EAAE,EAElBhB,EAAQgB,EAAI,CAAE,CAAA,EAEdE,EAAQF,EAAI,CAChB,MAAO,EACP,MAAO,EACR,CAAA,EAGKG,EAAa,IAAMnB,EAAM,MAAMe,EAAM,MAAM,OAAO,EAClDK,EAAiB,CAACC,EAAKC,EAAe,KAAU,CACpD,IAAIC,EAAY,GAEhB,MAAMC,EAAMH,GAAO,SAAW,GAAK,EAC7BI,EAAWV,EAAM,MAAM,QAAU,EAAIS,EACrCE,EAAaJ,EAAeP,EAAM,MAAM,QAAU,EAAIS,EAAM,GAElE,OAAIxB,EAAM,MAAMyB,CAAQ,IAAGF,EAAYvB,EAAM,MAAMyB,CAAQ,GACvDC,GAAc1B,EAAM,MAAM0B,CAAU,IACtCH,EAAY,CACV,MAAOvB,EAAM,MAAM0B,CAAU,EAC7B,IAAK1B,EAAM,MAAMyB,CAAQ,EACzB,WAAYC,CACpB,GAEWH,CACX,EAEQI,EAAe,IAAM3B,EAAM,MAAMe,EAAM,MAAM,SAAS,EAGtDa,EAAa,CAACnC,EAAGK,EAAY,GAAOW,EAAM,KAAU,CACnDhB,EAAE,QAASA,EAAE,SAAUA,EAAE,OAAQA,EAAE,SAAUA,EAAE,eAAc,EAElE,MAAMI,EAAWG,EAAM,MAAMA,EAAM,MAAM,OAAS,CAAC,EAEnD,IAAI6B,EAAU,CAAA,EAEV,OAAOpC,GAAM,UAAY,CAACG,GAASC,EAAUJ,EAAGK,CAAS,GACvDW,IAAQ,IAAOqB,EAAW,EAE9BD,EAAU,CACR,KAAM,MACN,IAAKpC,EAAE,IACP,KAAMA,EAAE,KACR,SAAUA,EAAE,SACZ,UAAWK,EACX,OAAQN,EAAUC,CAAC,CAC3B,GACeK,GAAaW,IAAQ,IAC9BoB,EAAU7B,EAAM,MAAMS,CAAG,EACzBoB,EAAQ,UAAY/B,GACX,OAAOL,GAAM,WACtBoC,EAAU,CAAE,KAAM,QAAS,MAAO,WAAWpC,EAAE,SAAS,CAAC,GAGvDgB,IAAQ,GAAOT,EAAM,MAAMS,CAAG,EAAIoB,EACjC7B,EAAM,MAAM,KAAK6B,CAAO,CACjC,EAEQC,EAAc,IAAM,CACpBZ,EAAM,MAAM,QAAU,GACxBU,EAAWV,EAAM,MAAM,KAAK,GACrBA,EAAM,MAAM,OAAS,GAG5BU,EAAW,YAAY,IAAG,EAAKV,EAAM,MAAM,KAAK,EAChDA,EAAM,MAAM,MAAQ,YAAY,IAAK,EAE3C,EAEQa,EAAY,CAACtC,EAAGK,EAAWkC,IAAuB,CACtD,IAAIC,EAAKC,EAAKC,EAAaC,EAoB3B,GAlBIJ,IAAuB,MACzBC,EAAMlB,EAAM,MAAM,SAAW,EAAI,EAAIA,EAAM,MAAM,QACjDmB,EAAMnB,EAAM,MAAM,SAAW,EAAI,EAAI,GAErCoB,EAAcD,IAAQ,GAAQD,EAAM,EAAIA,EACxCG,EAAgBH,EAAM,GACblB,EAAM,MAAM,QAAUiB,GAC/BC,EAAMlB,EAAM,MAAM,QAClBmB,EAAMF,EACNG,EAAcF,EAAM,EACpBG,EAAgBH,EAAM,IAEtBA,EAAMD,EACNE,EAAMnB,EAAM,MAAM,QAClBoB,EAAcF,EAAM,EACpBG,EAAgBH,EAAM,GAGpBC,IAAQ,GACV,QAASG,EAAI,OAAO,KAAKrC,EAAM,KAAK,EAAE,OAAS,EAAGqC,GAAKH,EAAKG,IAC1DrC,EAAM,MAAMqC,EAAI,CAAC,EAAIrC,EAAM,MAAMqC,CAAC,EAItCT,EAAWnC,EAAGK,EAAWqC,CAAW,EACpCP,EAAW,GAAI,GAAOQ,CAAa,EAEnCrB,EAAM,MAAM,QAAU,EAC1B,EAEQuB,EAAgB,IAAM,CACtBvB,EAAM,MAAM,UAAY,EAAGf,EAAM,MAAM,OAAOe,EAAM,MAAM,QAAS,CAAC,EACnEf,EAAM,MAAM,OAAOe,EAAM,MAAM,QAAU,EAAG,CAAC,EAClDA,EAAM,MAAM,QAAU,EAC1B,EAEQwB,EAAe,IAAM,CACzBrB,EAAM,MAAM,MAAQ,YAAY,IAAG,CACvC,EAEQsB,EAAcC,GAAS,CAC3BxB,EAAU,MAAQwB,CACtB,EAEQC,GAAeC,GAAU,CAC7BzB,EAAM,MAAM,MAAQyB,EAEpBC,GAAY,CAChB,EAEQA,GAAe,IAAM,CACzB5C,EAAM,MAAQA,EAAM,MAAM,IAAKI,IACzBA,EAAK,OAAS,SAAWc,EAAM,MAAM,QAAU,KAAOd,EAAK,MAAQc,EAAM,MAAM,OAC5Ed,EACR,CACL,EAEQyC,GAAa,CAACC,EAAMrC,IAAQ,CAC5BqC,IAAS,QACX/B,EAAM,MAAM,QAAUN,EACtBM,EAAM,MAAM,UAAY,IAGtB+B,IAAS,UACX/B,EAAM,MAAM,QAAU,GACtBA,EAAM,MAAM,UAAYN,EAE9B,EAEQsC,EAAY,IAAM,CACtBhC,EAAM,MAAM,KAAO,GACnBA,EAAM,MAAM,QAAU,GACtBA,EAAM,MAAM,UAAY,EAC5B,EAmDE,MAAO,CACL,MAAAA,EACA,UAAAE,EACA,MAAAjB,EACA,MAAAkB,EACA,WAAAC,EACA,eAAAC,EACA,aAAAO,EACA,WAAAC,EACA,UAAAG,EACA,cAAAO,EACA,aAAAC,EACA,WAAAC,EACA,YAAAE,GACA,WAAAG,GACA,UAAAE,EACA,WAjEiB,IAAM,CACvBhC,EAAM,MAAM,OAAS,GACrBG,EAAM,MAAM,MAAQ,EACpBD,EAAU,MAAQ,GAClBjB,EAAM,MAAQ,CAAA,EAEVe,EAAM,MAAM,MAAMgC,EAAS,CACnC,EA2DI,WAzDiB,UACJ,MAAMC,EAAM,KAAKC,EAAM,EAAK,eAAgB,CACvD,MAAOhC,EAAU,KAClB,CAAA,GAEW,KAqDZ,UAlDgB,UAChBF,EAAM,MAAM,iBAAmBhB,GAAaC,EAAM,KAAK,EAEnDe,EAAM,MAAM,iBAAyB,IAE5B,MAAMiC,EAAM,KAAKC,EAAM,EAAK,gBAAiB,CACxD,KAAMhC,EAAU,MAChB,MAAOjB,EAAM,KACd,CAAA,GAEW,QAAU,KAyCtB,YAtCkB,MAAOkD,GAAkB,CAC3C,MAAMC,EAAO,MAAMH,EAAM,KAAKC,EAAM,EAAK,gBAAiB,CACxD,MAAOC,CACR,CAAA,EAED,OAAIC,EAAK,QAAU,IAAYA,EAAK,KACxB,EAChB,EAgCI,UA9BgB,MAAOC,EAAeX,IAAS,CAC/C,MAAMY,EAAW,MAAML,EAAM,KAAKC,EAAM,EAAK,cAAe,CAC1D,MAAOG,CACR,CAAA,EAEGC,EAAS,OAAMrD,EAAM,MAAQK,GAAcgD,EAAS,IAAI,GAE5DpC,EAAU,MAAQwB,CACtB,CAuBA,CACA,CAAC,oQCvLD,MAAMa,EAASC,EAAS,CACtB,QAAS,GACT,KAAM,CAAE,CACV,CAAC,EAEKC,EAAgB3C,EAAqB,EAErC4C,EAAmBzC,EAAI,EAAE,EACzB0C,EAAe1C,EAAG,EAExB2C,EAAU,IAAM,CACdC,EAAa,CACf,CAAC,EAED,MAAMA,EAAgB,SAAY,CAChC,MAAMC,EAAO,MAAMC,GAAY,EAC/BR,EAAO,KAAOO,EACdP,EAAO,QAAU,EACnB,EAEMS,EAAeb,GAAkB,CACrCO,EAAiB,MAAQP,EACzBQ,EAAa,MAAM,aAAa,EAAI,CACtC,EAEMM,EAAc,SAAY,CACjB,MAAMR,EAAc,YAAYC,EAAiB,KAAK,IAGjEC,EAAa,MAAM,aAAa,EAAK,EAEjCD,EAAiB,QAAUD,EAAc,WAAWA,EAAc,WAAU,EAEhFC,EAAiB,MAAQ,GACzBG,EAAa,EAEjB,6xCCxEA,MAAMK,EAAQC,EAORC,EAAMZ,EAAS,CACnB,MAAO,EACT,CAAC,EAEDI,EAAU,IAAM,CACVM,EAAM,OACVG,EAAY,CACd,CAAC,EAEDC,EAAU,IAAM,CACdD,EAAY,CACd,CAAC,EAED,MAAMA,EAAe,IAAM,CACrBH,EAAM,UAAWE,EAAI,MAAQF,EAAM,UAClCE,EAAI,MAAQF,EAAM,OAAO,SAChC,6uBCLA,MAAMT,EAAgB3C,EAAqB,srBCpB3C,MAAMyD,EAAatD,EAAI,IAAI,EAErBwC,EAAgB3C,EAAqB,EAE3C,OAAAwD,EAAU,IAAM,CACVb,EAAc,MAAM,SACtBc,EAAW,MAAM,MAAK,EAClBd,EAAc,MAAM,QAAU,GAAGA,EAAc,aAAY,EAEnE,CAAC,ghBCZDe,EAAa,CAAE,OAAAC,CAAQ,CAAA,EAEvB,MAAMP,EAAQC,EAIRO,EAAWzD,EAAI,EAAK,EAE1B2C,EAAU,IAAM,CACdc,EAAS,MAAQR,EAAM,IACzB,CAAC,EAED,SAASO,GAAS,CAChBC,EAAS,MAAQ,CAACA,EAAS,KAC7B,yWC4BA,MAAMjB,EAAgB3C,EAAqB,EAErC6D,EAAW1D,EAAG,EAEpB,SAAS0B,EAAYiC,EAAK,CACxBnB,EAAc,YAAYmB,CAAG,EAC7BD,EAAS,MAAM,OAAM,CACvB,0mCCFA,MAAME,EAAWrB,EAAS,CACxB,IAAK,CAAE,EACP,OAAQ,CAAE,CACZ,CAAC,EAEKC,EAAgB3C,EAAqB,EAErCgE,EAAc7D,EAAI,IAAI,EAE5B2C,EAAU,IAAM,CACdiB,EAAS,IAAMpB,EAAc,WAAU,EACvCoB,EAAS,OAAO,UAAYA,EAAS,IAAI,SAC3C,CAAC,EAED,MAAME,EAAgBrF,GAAM,CAC1BmF,EAAS,OAAO,EAAInF,EACpBmF,EAAS,OAAO,OAASpF,EAAUC,CAAC,CACtC,EAEMsF,EAAsBjF,GAAc,CACxC8E,EAAS,OAAO,UAAY9E,EAC5B8E,EAAS,OAAO,OAASpF,EAAUoF,EAAS,GAAG,CACjD,EAEMI,EAAY,IAAM,CACtBxB,EAAc,WACZoB,EAAS,OAAO,EAChBA,EAAS,OAAO,UAChBpB,EAAc,MAAM,OACxB,EAEEA,EAAc,MAAM,QAAU,EAChC,giDC5DA,MAAMA,EAAgB3C,EAAqB,EAErC+D,EAAWrB,EAAS,CACxB,MAAO,CAAE,EACT,SAAU,CAAE,MAAO,CAAG,CACxB,CAAC,EAEDI,EAAU,IAAM,CACdiB,EAAS,MAAQpB,EAAc,aAAY,EAC3CoB,EAAS,SAAS,MAAQA,EAAS,MAAM,KAC3C,CAAC,EAED,MAAMlC,EAAc,IAAM,CACnBkC,EAAS,SAAS,QAEvBpB,EAAc,WAAWoB,EAAS,SAAS,MAAO,GAAOpB,EAAc,MAAM,SAAS,EACtFA,EAAc,MAAM,UAAY,GAClC,q0BC5BA,MAAMA,EAAgB3C,EAAqB,EAErCoE,EAASjE,EAAI,IAAI,EAEvB,OAAA2C,EAAU,IAAM,CACdsB,EAAO,MAAQzF,EAAUgE,EAAc,WAAY,CAAA,CACrD,CAAC,itBC2CD,MAAMS,EAAQC,EAIRV,EAAgB3C,EAAqB,EAErCqE,EAAU3B,EAAS,CACvB,SAAU,KACV,OAAQ,KACR,YAAa,KACb,gBAAiB,OACjB,SAAU,KACV,cAAe,KACf,mBAAoB,IACtB,CAAC,EAEK4B,EAAiBnE,EAAI,IAAI,EACzBoE,EAAapE,EAAI,EAAK,EAE5B2C,EAAU,IAAM,CACduB,EAAQ,SAAW1F,EAAUgE,EAAc,WAAY,CAAA,EAEvD,MAAM6B,EAAc7B,EAAc,eAAeS,EAAM,SAAU,EAAI,EACjEoB,IAAaH,EAAQ,SAAW1F,EAAU6F,EAAY,GAAG,GACzDA,EAAY,QACdH,EAAQ,cAAgBG,EAAY,MACpCH,EAAQ,mBAAqBG,EAAY,WAE7C,CAAC,EAED,MAAMC,EAAmB7F,GAAM,CAC7ByF,EAAQ,OAAS1F,EAAUC,CAAC,EAC5ByF,EAAQ,YAAczF,CACxB,EAEMsC,EAAY,IAAM,CACtByB,EAAc,UAAU0B,EAAQ,YAAaA,EAAQ,gBAAiBA,EAAQ,kBAAkB,CAClG,04DCpBA,MAAM1B,EAAgB3C,EAAqB,EAErC0E,EAAShC,EAAS,CAAE,SAAU,IAAM,CAAA,EACpCmB,EAAW1D,EAAG,EAEpB2C,EAAU,IAAM,CACdH,EAAc,WAAYgC,GAAa,CACjCA,EAAS,QAAUA,EAAS,OAAO,KAAO,WAAaA,EAAS,OAAO,WAAa,KACtFD,EAAO,SAAW,KAErB,CAAA,CACH,CAAC,EAED,SAASE,GAAe,CAClBF,EAAO,WAAa,MAAMb,EAAS,MAAM,OAAM,CACrD,CACA,SAASgB,GAAgB,CACvBlC,EAAc,MAAM,QAAU,GAC9BA,EAAc,MAAM,UAAY,GAEhC+B,EAAO,SAAW,IACpB,y+CC1CA,MAAM/B,EAAgB3C,EAAqB,EAErCI,EAAY0E,GAAS,IAAMnC,EAAc,SAAS,EAElDoC,EAAU5E,EAAI,EAAK,EAEzBqD,EAAU,IAAM,CACduB,EAAQ,MAAQ3E,EAAU,OAASA,EAAU,MAAM,OAAS,CAC9D,CAAC,EAED,SAASuB,EAAWC,EAAM,CACxBe,EAAc,WAAWf,CAAI,EAC7BmD,EAAQ,MAAQnD,EAAK,OAAS,CAChC,o7CC1CA,MAAMe,EAAgB3C,EAAqB,EAErCgF,EAAStC,EAAS,CACtB,GAAI,CAAE,EACN,KAAM,CAAE,CACV,CAAC,EAED,OAAAI,EAAU,IAAM,CACdH,EAAc,WAAYgC,GAAa,CACjCA,EAAS,QAAUA,EAAS,OAAO,KAAO,qBAC5CK,EAAO,GAAKL,EAAS,OAAO,WAAa,GAAQhC,EAAc,MAAM,iBAAiB,GAAK,CAAA,EAC3FqC,EAAO,KACLL,EAAS,OAAO,WAAa,GAAQhC,EAAc,MAAM,iBAAiB,KAAO,CAAA,EAEtF,CAAA,CACH,CAAC,imCCFD,MAAMA,EAAgB3C,EAAqB,EAErCiF,EAAc9E,EAAG,EACjB+E,EAAkB/E,EAAG,EAE3B2C,EAAU,IAAM,CACdH,EAAc,WAAYgC,GAAa,CACjCA,EAAS,QAAUA,EAAS,OAAO,KAAO,oBAC5CM,EAAY,MAAM,aAAaN,EAAS,OAAO,WAAa,EAAK,CAEpE,CAAA,CACH,CAAC,EAED,MAAMQ,EAAa,SAAY,CACX,MAAMxC,EAAc,WAAU,EAEjCuC,EAAgB,MAAM,aAAa,EAAI,EACjDE,EAAS,CAChB,EAEMA,EAAY,SAAY,CAC5BF,EAAgB,MAAM,aAAa,EAAK,EAEvB,MAAMvC,EAAc,UAAS,EAGzC,OAAO,SAAS,OAAM,EADZsC,EAAY,MAAM,aAAa,EAAI,CAEpD,mjCCjDA,MAAMtC,EAAgB3C,EAAqB","x_google_ignoreList":[0,1,2,3,4,5,6,7,8]} \ No newline at end of file diff --git a/public/assets/PanelsView-Bnnsxhnr.js b/public/assets/PanelsView-Bnnsxhnr.js deleted file mode 100644 index 2548c9c..0000000 --- a/public/assets/PanelsView-Bnnsxhnr.js +++ /dev/null @@ -1,22 +0,0 @@ -import{c as x,_ as B,r as E,a as y,o as I,b as z,d as v,e as l,f as _,g as s,t as b,w as R,h as g,v as Y,F as C,i as O,j as k,k as f,u as h,l as L,m as Z,n as j,G as ee,p as D,q as M,I as te,C as H,s as se,x as ne,R as ae,y as N,A as oe,z as le,B as T,D as ie,E as re}from"./index-oAtpp-VZ.js";import{A as q}from"./AccordionComp-D0eDAM6d.js";import{I as ce,a as ue,b as de}from"./IconTrash-DtIpQ-M_.js";/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var ve=x("outline","arrow-left","IconArrowLeft",[["path",{d:"M5 12l14 0",key:"svg-0"}],["path",{d:"M5 12l6 6",key:"svg-1"}],["path",{d:"M5 12l6 -6",key:"svg-2"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var pe=x("outline","eye","IconEye",[["path",{d:"M10 12a2 2 0 1 0 4 0a2 2 0 0 0 -4 0",key:"svg-0"}],["path",{d:"M21 12c-2.4 4 -5.4 6 -9 6c-3.6 0 -6.6 -2 -9 -6c2.4 -4 5.4 -6 9 -6c3.6 0 6.6 2 9 6",key:"svg-1"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var me=x("outline","search-off","IconSearchOff",[["path",{d:"M5.039 5.062a7 7 0 0 0 9.91 9.89m1.584 -2.434a7 7 0 0 0 -9.038 -9.057",key:"svg-0"}],["path",{d:"M3 3l18 18",key:"svg-1"}]]);/** - * @license @tabler/icons-vue v3.31.0 - MIT - * - * This source code is licensed under the MIT license. - * See the LICENSE file in the root directory of this source tree. - */var _e=x("outline","search","IconSearch",[["path",{d:"M10 10m-7 0a7 7 0 1 0 14 0a7 7 0 1 0 -14 0",key:"svg-0"}],["path",{d:"M21 21l-6 -6",key:"svg-1"}]]);const F=a=>{const n=document.createElement("style");n.setAttribute("custom_panel_style",!0),n.innerHTML=a,document.head.appendChild(n)},U=()=>{const a=document.querySelector("style[custom_panel_style]");a&&a.remove()},G=(a,n)=>{const t=new DOMParser().parseFromString(a,"text/html");let e=[];if(t.querySelectorAll("script").length>0){const S=fe(t);t.body=S.body,e=S.scripts}const r=t.body.innerHTML,c=document.createElement("div");return c.id="panel-html__body",c.style=`aspect-ratio: ${n}`,c.innerHTML=r,e.length>0&&he(e),c.outerHTML},fe=a=>{const n=a.querySelectorAll("script"),i=[];return n.forEach(t=>{t.getAttribute("no-compile")!=""&&i.push(t.innerHTML),t.remove()}),{body:a.body,scripts:i}},he=a=>{a.forEach(n=>{const i=document.createElement("script");i.setAttribute("custom_panel_script",!0),i.innerHTML=n,document.body.appendChild(i)})},ge=()=>{document.querySelectorAll("script[custom_panel_script]").forEach(n=>{n.remove()})},J=(a,n)=>{a.querySelectorAll("[mcrm__button]").forEach(i=>{i.addEventListener("click",()=>{n(i)})})},K=a=>{a.querySelectorAll("[mcrm__dialog-trigger]").forEach(n=>{const i=document.querySelector(n.getAttribute("dialog-trigger"));i&&n.addEventListener("click",()=>{i.show()})}),document.querySelectorAll("dialog, dialog .dialog__close").forEach(n=>{n.addEventListener("click",i=>{(i.target.classList.contains("dialog__close")||i.target.closest(".dialog__close")||i.target.tagName=="DIALOG")&&n.closest("dialog").close()})})},ye={class:"input-group form-select"},ke={key:0},be={class:"select__container"},we={key:0,class:"select__search-bar"},Se=["list","disabled"],$e=["id"],Le=["value"],Me=["name"],Ae={value:"",disabled:""},Pe=["value"],Ee={__name:"FormSelect",props:{label:String,name:String,options:[Array,Object],search:Boolean,value:String},emits:["change"],setup(a,{emit:n}){const i=n,t=a,e=E({options:[],search:"",searchActive:!1,changed:!1,value:""}),d=y(null),r=y(null);I(()=>{c(),typeof t.options=="object"&&(e.options=Object.values(t.options))}),z(()=>{c()});const c=()=>{(e.value==""&&t.value||!e.changed&&t.value!=e.value)&&(e.value=t.value),e.changed=!1},S=()=>{e.searchActive=!0,e.search="",d.value.classList="search__is-active",setTimeout(()=>{r.value.focus()},50)},P=()=>{e.search="",e.searchActive=!1,d.value.classList=""},V=A=>{u(A),P()},u=A=>{e.changed=!0,e.value=A.target.value,i("change",e.value)};return(A,w)=>(l(),v("div",ye,[a.label?(l(),v("label",ke,b(a.label),1)):_("",!0),s("div",be,[a.search?(l(),v("div",we,[R(s("input",{type:"search",ref_key:"selectSearch",ref:r,list:`${a.name}-search__options`,"onUpdate:modelValue":w[0]||(w[0]=p=>e.search=p),onChange:w[1]||(w[1]=p=>V(p)),disabled:!e.searchActive,autocomplete:"on"},null,40,Se),[[Y,e.search]]),s("datalist",{id:`${a.name}-search__options`},[(l(!0),v(C,null,O(e.options,p=>(l(),v("option",{key:p.value,value:p.value},b(p.label),9,Le))),128))],8,$e),e.searchActive?(l(),g(L,{key:1,variant:"ghost",size:"sm",onClick:P},{default:k(()=>[f(h(me))]),_:1})):(l(),g(L,{key:0,variant:"ghost",size:"sm",onClick:S},{default:k(()=>[f(h(_e))]),_:1}))])):_("",!0),R(s("select",{name:a.name,ref_key:"selectEl",ref:d,"onUpdate:modelValue":w[2]||(w[2]=p=>e.value=p),onChange:w[3]||(w[3]=p=>u(p))},[s("option",Ae,"- Select "+b(a.label.toLocaleLowerCase())+" -",1),(l(!0),v(C,null,O(e.options,p=>(l(),v("option",{key:p.value,value:p.value},b(p.label),9,Pe))),128))],40,Me),[[Z,e.value]])])]))}},Ce=B(Ee,[["__scopeId","data-v-a2e76de3"]]),Ie={key:0,id:"panel-edit",class:"mcrm-block block__dark !p-0 !gap-0"},xe={class:"panel-preview"},Be=["innerHTML"],Ve={class:"panel-settings"},Te={class:"grid grid-cols-[auto_1fr] gap-2 p-4"},Oe={class:"text-right"},je={class:"text-right"},Re={class:"text-right"},He={class:"grid gap-4 p-4"},qe={class:"grid grid-cols-[auto_1fr] gap-2"},ze={class:"text-right"},De={class:"grid"},Ne={class:"grid grid-cols-2 mt-4"},Fe={class:"flex items-end justify-end h-full p-4"},Ue={__name:"PanelEdit",props:{dirname:String},setup(a){const n=a,i=j(),t=y(!1),e=y({}),d=E({old:{},changed:!1}),r=y({}),c=y(!1),S=y(!1),P=y(null),V=y(null),u=E({id:"",macro:"",newMacro:"",changed:!1});I(async()=>{const m=await i.get(n.dirname);e.value=m,e.value.dir=n.dirname,e.value.html=G(e.value.html,e.value.aspectRatio),d.old=JSON.stringify(m.macros),c.value.toggleAccordion(!0);const o=await ee();r.value=Object.assign({},...Object.keys(o).map($=>({[$]:{value:o[$].macroname,label:o[$].name}}))),F(e.value.style),A()}),D(()=>{U()});function A(){const m=o=>{c.value.toggleAccordion(!1),w(o.id)};J(t.value,m),K(t.value)}function w(m){u.id=m,u.macro=e.value.macros[m]?e.value.macros[m]:""}function p(m,o){u.changed=e.value.macros[m]!=o,u.newMacro=o}function Q(m){e.value.macros[m]=u.newMacro,u.macro=u.newMacro,u.newMacro="",d.changed=H(d.old,e.value.macros)}function W(m){delete e.value.macros[m],S.value.toggleAccordion(!1),d.changed=H(d.old,e.value.macros)}function X(){const m={dir:e.value.dir,name:e.value.name,description:e.value.description,aspectRatio:e.value.aspectRatio,macros:e.value.macros};se.post(ne()+"/panel/save/json",m)}return(m,o)=>e.value?(l(),v("div",Ie,[s("div",xe,[s("div",{class:"panel-preview__content",ref_key:"panelPreview",ref:t,innerHTML:e.value.html},null,8,Be)]),s("div",Ve,[f(q,{title:"Panel info",ref_key:"infoAccordion",ref:c},{default:k(()=>[s("div",Te,[o[5]||(o[5]=s("span",null,"Name:",-1)),s("strong",Oe,b(e.value.name),1),o[6]||(o[6]=s("span",null,"Aspect ratio:",-1)),s("strong",je,b(e.value.aspectRatio),1),e.value.macros?(l(),v(C,{key:0},[o[4]||(o[4]=s("span",null,"Linked Macros:",-1)),s("strong",Re,b(Object.keys(e.value.macros).length),1)],64)):_("",!0)])]),_:1},512),s("div",null,[u.id?(l(),g(q,{key:0,title:"Button",ref_key:"buttonAccordion",ref:S,open:u.id!=""},{default:k(()=>[s("div",He,[s("div",qe,[o[7]||(o[7]=s("span",null,"Button ID:",-1)),s("strong",ze,b(u.id),1)]),s("div",De,[f(Ce,{name:"button_macro",label:"Button macro",search:!0,options:r.value,value:u.macro,onChange:o[0]||(o[0]=$=>p(u.id,$))},null,8,["options","value"]),s("div",Ne,[u.macro!=""?(l(),g(L,{key:0,class:"col-start-1 w-fit",size:"sm",variant:"danger",onClick:o[1]||(o[1]=$=>W(u.id)),ref_key:"unlinkButton",ref:P},{default:k(()=>[f(h(ce)),o[8]||(o[8]=M(" Unlink "))]),_:1},512)):_("",!0),u.changed?(l(),g(L,{key:1,class:"col-start-2 w-fit justify-self-end",size:"sm",variant:"primary",onClick:o[2]||(o[2]=$=>Q(u.id)),ref_key:"linkButton",ref:V},{default:k(()=>[f(h(te)),o[9]||(o[9]=M(" Link "))]),_:1},512)):_("",!0)])])])]),_:1},8,["open"])):_("",!0)]),s("footer",Fe,[d.changed?(l(),g(L,{key:0,variant:"success",onClick:o[3]||(o[3]=$=>X())},{default:k(()=>[f(h(ue)),o[10]||(o[10]=M(" Save changes "))]),_:1})):_("",!0)])])])):_("",!0)}},Ge={id:"panel-view"},Je=["innerHTML"],Ke={__name:"PanelView",props:{dirname:String},setup(a){const n=j(),i=a,t=y(null),e=y({});I(async()=>{const r=await n.get(i.dirname);e.value=r,e.value.html=G(e.value.html,e.value.aspectRatio),F(e.value.style),setTimeout(()=>{d(),typeof window.onPanelLoaded=="function"&&window.onPanelLoaded()},50)}),D(()=>{U(),ge()});const d=()=>{const r=c=>{ae(e.value.macros[c.id])};J(t.value,r),K(t.value)};return(r,c)=>(l(),v("div",Ge,[s("div",{class:"panel-preview__content",ref_key:"panelView",ref:t,innerHTML:e.value.html},null,8,Je)]))}},Qe=B(Ke,[["__scopeId","data-v-30e319d1"]]),We={id:"panels-overview"},Xe={class:"panel-list"},Ye=["onClick"],Ze={class:"thumb"},et=["src"],tt={key:0,class:"description"},st={class:"content"},nt={class:"block mb-1 text-slate-400"},at={key:0,class:"text-slate-200"},ot={__name:"PanelsOverview",setup(a){const n=j(),i=E({list:{}}),t=N();I(async()=>{const d=await n.getList();i.list=d});function e(d){T()||t.push(`/panel/view/${d}`)}return(d,r)=>(l(),v("div",We,[Object.keys(i.list).length==0?(l(),g(oe,{key:0,variant:"info"},{default:k(()=>r[0]||(r[0]=[M(" No panels found ")])),_:1})):_("",!0),s("div",Xe,[(l(!0),v(C,null,O(i.list,(c,S)=>(l(),v("div",{class:"panel-item mcrm-block block__dark",key:S},[s("div",{class:"panel-item__content",onClick:P=>e(c.dir)},[s("div",Ze,[c.thumb?(l(),v("img",{key:0,src:`data:image/jpeg;base64,${c.thumb}`,alt:""},null,8,et)):(l(),g(h(le),{key:1}))]),s("h4",null,b(c.name),1),h(T)()?(l(),v("div",tt,[s("div",st,[s("strong",nt,b(c.name),1),r[1]||(r[1]=s("hr",{class:"mb-2 border-slate-600"},null,-1)),c.description!="null"?(l(),v("p",at,b(c.description),1)):_("",!0)]),s("footer",null,[f(L,{variant:"subtle",size:"sm",href:`/panel/view/${c.dir}`},{default:k(()=>[f(h(pe)),r[2]||(r[2]=M(" Preview "))]),_:2},1032,["href"]),f(L,{variant:"primary",size:"sm",href:`/panel/edit/${c.dir}`},{default:k(()=>[f(h(de)),r[3]||(r[3]=M(" Edit "))]),_:2},1032,["href"])])])):_("",!0)],8,Ye),h(T)()?_("",!0):(l(),v(C,{key:0},[],64))]))),128))])]))}},lt=B(ot,[["__scopeId","data-v-a6f4d943"]]),it={id:"panels",class:"panel"},rt={class:"flex items-end justify-between !w-full panel__title"},ct={__name:"PanelsView",setup(a){const n=ie(),i=N(),t=E({function:"",dirname:""});I(()=>{e()}),z(()=>{e()});const e=()=>{n.name.includes("panel-")?t.function=n.name=="panel-edit"?"edit":"preview":t.function="overview",t.dirname=n.params.dirname};return(d,r)=>(l(),v("div",it,[s("h1",rt,[r[2]||(r[2]=s("div",null,"Panels",-1)),t.function!="overview"?(l(),g(L,{key:0,variant:"subtle",size:"sm",onClick:r[0]||(r[0]=c=>h(i).push("/panels"))},{default:k(()=>[f(h(ve)),r[1]||(r[1]=M(" Overview "))]),_:1})):_("",!0)]),s("div",{class:re(`panel__content !p-0 !pt-4 ${t.function=="overview"}`)},[t.function=="overview"?(l(),g(lt,{key:0})):_("",!0),t.function=="edit"?(l(),g(Ue,{key:1,dirname:t.dirname},null,8,["dirname"])):_("",!0),t.function=="preview"?(l(),g(Qe,{key:2,dirname:t.dirname},null,8,["dirname"])):_("",!0)],2)]))}},pt=B(ct,[["__scopeId","data-v-4fa76eeb"]]);export{pt as default}; -//# sourceMappingURL=PanelsView-Bnnsxhnr.js.map diff --git a/public/assets/PanelsView-Bnnsxhnr.js.map b/public/assets/PanelsView-Bnnsxhnr.js.map deleted file mode 100644 index bda384c..0000000 --- a/public/assets/PanelsView-Bnnsxhnr.js.map +++ /dev/null @@ -1 +0,0 @@ -{"version":3,"file":"PanelsView-Bnnsxhnr.js","sources":["../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconArrowLeft.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconEye.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconSearchOff.mjs","../../ui/node_modules/@tabler/icons-vue/dist/esm/icons/IconSearch.mjs","../../ui/src/services/PanelService.js","../../ui/src/components/form/FormSelect.vue","../../ui/src/components/panels/PanelEdit.vue","../../ui/src/components/panels/PanelView.vue","../../ui/src/components/panels/PanelsOverview.vue","../../ui/src/views/PanelsView.vue"],"sourcesContent":["/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconArrowLeft = createVueComponent(\"outline\", \"arrow-left\", \"IconArrowLeft\", [[\"path\", { \"d\": \"M5 12l14 0\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M5 12l6 6\", \"key\": \"svg-1\" }], [\"path\", { \"d\": \"M5 12l6 -6\", \"key\": \"svg-2\" }]]);\n\nexport { IconArrowLeft as default };\n//# sourceMappingURL=IconArrowLeft.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconEye = createVueComponent(\"outline\", \"eye\", \"IconEye\", [[\"path\", { \"d\": \"M10 12a2 2 0 1 0 4 0a2 2 0 0 0 -4 0\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M21 12c-2.4 4 -5.4 6 -9 6c-3.6 0 -6.6 -2 -9 -6c2.4 -4 5.4 -6 9 -6c3.6 0 6.6 2 9 6\", \"key\": \"svg-1\" }]]);\n\nexport { IconEye as default };\n//# sourceMappingURL=IconEye.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconSearchOff = createVueComponent(\"outline\", \"search-off\", \"IconSearchOff\", [[\"path\", { \"d\": \"M5.039 5.062a7 7 0 0 0 9.91 9.89m1.584 -2.434a7 7 0 0 0 -9.038 -9.057\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M3 3l18 18\", \"key\": \"svg-1\" }]]);\n\nexport { IconSearchOff as default };\n//# sourceMappingURL=IconSearchOff.mjs.map\n","/**\n * @license @tabler/icons-vue v3.31.0 - MIT\n *\n * This source code is licensed under the MIT license.\n * See the LICENSE file in the root directory of this source tree.\n */\n\nimport createVueComponent from '../createVueComponent.mjs';\n\nvar IconSearch = createVueComponent(\"outline\", \"search\", \"IconSearch\", [[\"path\", { \"d\": \"M10 10m-7 0a7 7 0 1 0 14 0a7 7 0 1 0 -14 0\", \"key\": \"svg-0\" }], [\"path\", { \"d\": \"M21 21l-6 -6\", \"key\": \"svg-1\" }]]);\n\nexport { IconSearch as default };\n//# sourceMappingURL=IconSearch.mjs.map\n","/*\nMacrame is a program that enables the user to create keyboard macros and button panels. \nThe macros are saved as simple JSON files and can be linked to the button panels. The panels can \nbe created with HTML and CSS.\n\nCopyright (C) 2025 Jesse Malotaux\n\nThis program is free software: you can redistribute it and/or modify \nit under the terms of the GNU General Public License as published by \nthe Free Software Foundation, either version 3 of the License, or \n(at your option) any later version.\n\nThis program is distributed in the hope that it will be useful, \nbut WITHOUT ANY WARRANTY; without even the implied warranty of \nMERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the \nGNU General Public License for more details.\n\nYou should have received a copy of the GNU General Public License \nalong with this program. If not, see .\n*/\n\nexport const SetPanelStyle = (styleStr) => {\n const styleEl = document.createElement('style')\n styleEl.setAttribute('custom_panel_style', true)\n styleEl.innerHTML = styleStr\n document.head.appendChild(styleEl)\n}\n\nexport const RemovePanelStyle = () => {\n const styleEl = document.querySelector('style[custom_panel_style]')\n if (styleEl) {\n styleEl.remove()\n }\n}\n\nexport const StripPanelHTML = (html, aspectRatio) => {\n const parser = new DOMParser()\n const doc = parser.parseFromString(html, 'text/html')\n let scripts = []\n\n if (doc.querySelectorAll('script').length > 0) {\n const stripped = StripPanelScripts(doc)\n doc.body = stripped.body\n scripts = stripped.scripts\n }\n\n const body = doc.body\n const bodyContents = body.innerHTML\n\n const panelBody = document.createElement('div')\n panelBody.id = 'panel-html__body'\n panelBody.style = `aspect-ratio: ${aspectRatio}`\n panelBody.innerHTML = bodyContents\n\n if (scripts.length > 0) {\n SetPanelScripts(scripts)\n }\n\n return panelBody.outerHTML\n}\n\nexport const StripPanelScripts = (doc) => {\n const scriptEls = doc.querySelectorAll('script')\n const scripts = []\n\n scriptEls.forEach((script) => {\n if (script.getAttribute('no-compile') != '') scripts.push(script.innerHTML)\n script.remove()\n })\n\n return { body: doc.body, scripts }\n}\n\nexport const SetPanelScripts = (scripts) => {\n scripts.forEach((script) => {\n const scriptEl = document.createElement('script')\n scriptEl.setAttribute('custom_panel_script', true)\n scriptEl.innerHTML = script\n document.body.appendChild(scriptEl)\n })\n}\n\nexport const RemovePanelScripts = () => {\n const scripts = document.querySelectorAll('script[custom_panel_script]')\n scripts.forEach((script) => {\n script.remove()\n })\n}\n\nexport const PanelButtonListeners = (panelEl, callback) => {\n panelEl.querySelectorAll('[mcrm__button]').forEach((button) => {\n button.addEventListener('click', () => {\n callback(button)\n })\n })\n}\n\nexport const PanelDialogListeners = (panelEl) => {\n panelEl.querySelectorAll('[mcrm__dialog-trigger]').forEach((dialogTrigger) => {\n const dialogEl = document.querySelector(dialogTrigger.getAttribute('dialog-trigger'))\n\n if (dialogEl) {\n dialogTrigger.addEventListener('click', () => {\n dialogEl.show()\n })\n }\n })\n\n document.querySelectorAll('dialog, dialog .dialog__close').forEach((dialogClose) => {\n dialogClose.addEventListener('click', (e) => {\n if (\n e.target.classList.contains('dialog__close') ||\n e.target.closest('.dialog__close') ||\n e.target.tagName == 'DIALOG'\n ) {\n dialogClose.closest('dialog').close()\n }\n })\n })\n}\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n","\n\n\n\n\n\n\n"],"names":["IconArrowLeft","createVueComponent","IconEye","IconSearchOff","IconSearch","SetPanelStyle","styleStr","styleEl","RemovePanelStyle","StripPanelHTML","html","aspectRatio","doc","scripts","stripped","StripPanelScripts","bodyContents","panelBody","SetPanelScripts","scriptEls","script","scriptEl","RemovePanelScripts","PanelButtonListeners","panelEl","callback","button","PanelDialogListeners","dialogTrigger","dialogEl","dialogClose","e","emit","__emit","props","__props","select","reactive","selectEl","ref","selectSearch","onMounted","setValue","onUpdated","initSearch","resetSearch","selectSearchValue","event","changeSelect","panel","usePanelStore","panelPreview","editPanel","panelMacros","macroList","infoAccordion","buttonAccordion","unlinkButton","linkButton","editButton","currentPanel","macros","GetMacroList","key","EditButtonListeners","onUnmounted","setEditButton","id","checkNewMacro","macro","linkMacro","CheckMacroListChange","unlinkMacro","savePanelChanges","panelData","axios","appUrl","panelView","viewPanel","viewPanelListeners","RunMacro","panels","router","useRouter","panelList","panelItemClick","dir","isLocal","route","useRoute","setVarsByRoute"],"mappings":"mZAAA;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIA,GAAgBC,EAAmB,UAAW,aAAc,gBAAiB,CAAC,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,YAAa,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAO,CAAE,CAAC,CAAC,ECTnO;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIC,GAAUD,EAAmB,UAAW,MAAO,UAAW,CAAC,CAAC,OAAQ,CAAE,EAAK,sCAAuC,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,oFAAqF,IAAO,OAAS,CAAA,CAAC,CAAC,ECThQ;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIE,GAAgBF,EAAmB,UAAW,aAAc,gBAAiB,CAAC,CAAC,OAAQ,CAAE,EAAK,wEAAyE,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,aAAc,IAAO,OAAS,CAAA,CAAC,CAAC,ECT9O;AAAA;AAAA;AAAA;AAAA;AAAA,GASA,IAAIG,GAAaH,EAAmB,UAAW,SAAU,aAAc,CAAC,CAAC,OAAQ,CAAE,EAAK,6CAA8C,IAAO,OAAS,CAAA,EAAG,CAAC,OAAQ,CAAE,EAAK,eAAgB,IAAO,OAAS,CAAA,CAAC,CAAC,ECYpM,MAAMI,EAAiBC,GAAa,CACzC,MAAMC,EAAU,SAAS,cAAc,OAAO,EAC9CA,EAAQ,aAAa,qBAAsB,EAAI,EAC/CA,EAAQ,UAAYD,EACpB,SAAS,KAAK,YAAYC,CAAO,CACnC,EAEaC,EAAmB,IAAM,CACpC,MAAMD,EAAU,SAAS,cAAc,2BAA2B,EAC9DA,GACFA,EAAQ,OAAM,CAElB,EAEaE,EAAiB,CAACC,EAAMC,IAAgB,CAEnD,MAAMC,EADS,IAAI,UAAS,EACT,gBAAgBF,EAAM,WAAW,EACpD,IAAIG,EAAU,CAAA,EAEd,GAAID,EAAI,iBAAiB,QAAQ,EAAE,OAAS,EAAG,CAC7C,MAAME,EAAWC,GAAkBH,CAAG,EACtCA,EAAI,KAAOE,EAAS,KACpBD,EAAUC,EAAS,OACvB,CAGE,MAAME,EADOJ,EAAI,KACS,UAEpBK,EAAY,SAAS,cAAc,KAAK,EAC9C,OAAAA,EAAU,GAAK,mBACfA,EAAU,MAAQ,iBAAiBN,CAAW,GAC9CM,EAAU,UAAYD,EAElBH,EAAQ,OAAS,GACnBK,GAAgBL,CAAO,EAGlBI,EAAU,SACnB,EAEaF,GAAqBH,GAAQ,CACxC,MAAMO,EAAYP,EAAI,iBAAiB,QAAQ,EACzCC,EAAU,CAAA,EAEhB,OAAAM,EAAU,QAASC,GAAW,CACxBA,EAAO,aAAa,YAAY,GAAK,IAAIP,EAAQ,KAAKO,EAAO,SAAS,EAC1EA,EAAO,OAAM,CACd,CAAA,EAEM,CAAE,KAAMR,EAAI,KAAM,QAAAC,CAAO,CAClC,EAEaK,GAAmBL,GAAY,CAC1CA,EAAQ,QAASO,GAAW,CAC1B,MAAMC,EAAW,SAAS,cAAc,QAAQ,EAChDA,EAAS,aAAa,sBAAuB,EAAI,EACjDA,EAAS,UAAYD,EACrB,SAAS,KAAK,YAAYC,CAAQ,CACnC,CAAA,CACH,EAEaC,GAAqB,IAAM,CACtB,SAAS,iBAAiB,6BAA6B,EAC/D,QAASF,GAAW,CAC1BA,EAAO,OAAM,CACd,CAAA,CACH,EAEaG,EAAuB,CAACC,EAASC,IAAa,CACzDD,EAAQ,iBAAiB,gBAAgB,EAAE,QAASE,GAAW,CAC7DA,EAAO,iBAAiB,QAAS,IAAM,CACrCD,EAASC,CAAM,CAChB,CAAA,CACF,CAAA,CACH,EAEaC,EAAwBH,GAAY,CAC/CA,EAAQ,iBAAiB,wBAAwB,EAAE,QAASI,GAAkB,CAC5E,MAAMC,EAAW,SAAS,cAAcD,EAAc,aAAa,gBAAgB,CAAC,EAEhFC,GACFD,EAAc,iBAAiB,QAAS,IAAM,CAC5CC,EAAS,KAAI,CACd,CAAA,CAEJ,CAAA,EAED,SAAS,iBAAiB,+BAA+B,EAAE,QAASC,GAAgB,CAClFA,EAAY,iBAAiB,QAAUC,GAAM,EAEzCA,EAAE,OAAO,UAAU,SAAS,eAAe,GAC3CA,EAAE,OAAO,QAAQ,gBAAgB,GACjCA,EAAE,OAAO,SAAW,WAEpBD,EAAY,QAAQ,QAAQ,EAAE,MAAK,CAEtC,CAAA,CACF,CAAA,CACH,uWCrDA,MAAME,EAAOC,EAEPC,EAAQC,EAQRC,EAASC,EAAS,CACtB,QAAS,CAAE,EACX,OAAQ,GACR,aAAc,GACd,QAAS,GACT,MAAO,EACT,CAAC,EAEKC,EAAWC,EAAI,IAAI,EACnBC,EAAeD,EAAI,IAAI,EAE7BE,EAAU,IAAM,CACdC,EAAQ,EAEJ,OAAOR,EAAM,SAAW,WAAUE,EAAO,QAAU,OAAO,OAAOF,EAAM,OAAO,EACpF,CAAC,EAEDS,EAAU,IAAM,CACdD,EAAQ,CACV,CAAC,EAED,MAAMA,EAAW,IAAM,EAChBN,EAAO,OAAS,IAAMF,EAAM,OAAW,CAACE,EAAO,SAAWF,EAAM,OAASE,EAAO,SACnFA,EAAO,MAAQF,EAAM,OAGvBE,EAAO,QAAU,EACnB,EAEMQ,EAAa,IAAM,CACvBR,EAAO,aAAe,GACtBA,EAAO,OAAS,GAChBE,EAAS,MAAM,UAAY,oBAC3B,WAAW,IAAM,CACfE,EAAa,MAAM,MAAK,CAC5B,EAAK,EAAE,CACP,EAEMK,EAAc,IAAM,CACxBT,EAAO,OAAS,GAChBA,EAAO,aAAe,GACtBE,EAAS,MAAM,UAAY,EAC7B,EAEMQ,EAAqBC,GAAU,CACnCC,EAAaD,CAAK,EAClBF,EAAW,CACb,EAEMG,EAAgBD,GAAU,CAC9BX,EAAO,QAAU,GACjBA,EAAO,MAAQW,EAAM,OAAO,MAE5Bf,EAAK,SAAUI,EAAO,KAAK,CAC7B,mkDCjBA,MAAMF,EAAQC,EAIRc,EAAQC,EAAa,EAErBC,EAAeZ,EAAI,EAAK,EACxBa,EAAYb,EAAI,CAAE,CAAA,EAClBc,EAAchB,EAAS,CAC3B,IAAK,CAAE,EACP,QAAS,EACX,CAAC,EAEKiB,EAAYf,EAAI,CAAE,CAAA,EAElBgB,EAAgBhB,EAAI,EAAK,EACzBiB,EAAkBjB,EAAI,EAAK,EAE3BkB,EAAelB,EAAI,IAAI,EACvBmB,EAAanB,EAAI,IAAI,EAErBoB,EAAatB,EAAS,CAC1B,GAAI,GACJ,MAAO,GACP,SAAU,GACV,QAAS,EACX,CAAC,EAEDI,EAAU,SAAY,CACpB,MAAMmB,EAAe,MAAMX,EAAM,IAAIf,EAAM,OAAO,EAClDkB,EAAU,MAAQQ,EAClBR,EAAU,MAAM,IAAMlB,EAAM,QAC5BkB,EAAU,MAAM,KAAO3C,EAAe2C,EAAU,MAAM,KAAMA,EAAU,MAAM,WAAW,EAEvFC,EAAY,IAAM,KAAK,UAAUO,EAAa,MAAM,EAEpDL,EAAc,MAAM,gBAAgB,EAAI,EAExC,MAAMM,EAAS,MAAMC,GAAY,EACjCR,EAAU,MAAQ,OAAO,OACvB,CAAE,EACF,GAAG,OAAO,KAAKO,CAAM,EAAE,IAAKE,IAAS,CACnC,CAACA,CAAG,EAAG,CAAE,MAAOF,EAAOE,CAAG,EAAE,UAAW,MAAOF,EAAOE,CAAG,EAAE,IAAM,CACtE,EAAM,CACN,EAEE1D,EAAc+C,EAAU,MAAM,KAAK,EAEnCY,EAAmB,CACrB,CAAC,EAEDC,EAAY,IAAM,CAChBzD,EAAgB,CAClB,CAAC,EAED,SAASwD,GAAsB,CAC7B,MAAMvC,EAAYC,GAAW,CAC3B6B,EAAc,MAAM,gBAAgB,EAAK,EACzCW,EAAcxC,EAAO,EAAE,CAC3B,EAEEH,EAAqB4B,EAAa,MAAO1B,CAAQ,EACjDE,EAAqBwB,EAAa,KAAK,CACzC,CAEA,SAASe,EAAcC,EAAI,CACzBR,EAAW,GAAKQ,EAChBR,EAAW,MAAQP,EAAU,MAAM,OAAOe,CAAE,EAAIf,EAAU,MAAM,OAAOe,CAAE,EAAI,EAC/E,CAEA,SAASC,EAAcD,EAAIE,EAAO,CAChCV,EAAW,QAAUP,EAAU,MAAM,OAAOe,CAAE,GAAKE,EACnDV,EAAW,SAAWU,CACxB,CAEA,SAASC,EAAUH,EAAI,CACrBf,EAAU,MAAM,OAAOe,CAAE,EAAIR,EAAW,SACxCA,EAAW,MAAQA,EAAW,SAC9BA,EAAW,SAAW,GAEtBN,EAAY,QAAUkB,EAAqBlB,EAAY,IAAKD,EAAU,MAAM,MAAM,CACpF,CAEA,SAASoB,EAAYL,EAAI,CACvB,OAAOf,EAAU,MAAM,OAAOe,CAAE,EAChCX,EAAgB,MAAM,gBAAgB,EAAK,EAC3CH,EAAY,QAAUkB,EAAqBlB,EAAY,IAAKD,EAAU,MAAM,MAAM,CACpF,CAEA,SAASqB,GAAmB,CAC1B,MAAMC,EAAY,CAChB,IAAKtB,EAAU,MAAM,IACrB,KAAMA,EAAU,MAAM,KACtB,YAAaA,EAAU,MAAM,YAC7B,YAAaA,EAAU,MAAM,YAC7B,OAAQA,EAAU,MAAM,MAC5B,EAEEuB,GAAM,KAAKC,GAAQ,EAAG,mBAAoBF,CAAS,CACrD,urDC5KA,MAAMzB,EAAQC,EAAa,EAErBhB,EAAQC,EAIR0C,EAAYtC,EAAI,IAAI,EAEpBuC,EAAYvC,EAAI,CAAE,CAAA,EAExBE,EAAU,SAAY,CACpB,MAAMmB,EAAe,MAAMX,EAAM,IAAIf,EAAM,OAAO,EAClD4C,EAAU,MAAQlB,EAElBkB,EAAU,MAAM,KAAOrE,EAAeqE,EAAU,MAAM,KAAMA,EAAU,MAAM,WAAW,EACvFzE,EAAcyE,EAAU,MAAM,KAAK,EAEnC,WAAW,IAAM,CACfC,EAAkB,EAEd,OAAO,OAAO,eAAkB,YAClC,OAAO,cAAa,CAE1B,EAAK,EAAE,CACP,CAAC,EAEDd,EAAY,IAAM,CAChBzD,EAAgB,EAChBc,GAAkB,CACpB,CAAC,EAED,MAAMyD,EAAqB,IAAM,CAC/B,MAAMtD,EAAYC,GAAW,CAC3BsD,GAASF,EAAU,MAAM,OAAOpD,EAAO,EAAE,CAAC,CAC9C,EAEEH,EAAqBsD,EAAU,MAAOpD,CAAQ,EAC9CE,EAAqBkD,EAAU,KAAK,CACtC,sbCXA,MAAM5B,EAAQC,EAAa,EAErB+B,EAAS5C,EAAS,CACtB,KAAM,CAAE,CACV,CAAC,EAEK6C,EAASC,EAAS,EAExB1C,EAAU,SAAY,CACpB,MAAM2C,EAAY,MAAMnC,EAAM,QAAO,EAErCgC,EAAO,KAAOG,CAChB,CAAC,EAED,SAASC,EAAeC,EAAK,CACvBC,EAAO,GAEXL,EAAO,KAAK,eAAeI,CAAG,EAAE,CAClC,2rCCjCA,MAAME,EAAQC,GAAQ,EAChBP,EAASC,EAAS,EAElBlC,EAAQZ,EAAS,CACrB,SAAU,GACV,QAAS,EACX,CAAC,EAEDI,EAAU,IAAM,CACdiD,EAAc,CAChB,CAAC,EAED/C,EAAU,IAAM,CACd+C,EAAc,CAChB,CAAC,EAED,MAAMA,EAAiB,IAAM,CACvBF,EAAM,KAAK,SAAS,QAAQ,EAC9BvC,EAAM,SAAWuC,EAAM,MAAQ,aAAe,OAAS,UAEvDvC,EAAM,SAAW,WAGnBA,EAAM,QAAUuC,EAAM,OAAO,OAC/B","x_google_ignoreList":[0,1,2,3]} \ No newline at end of file diff --git a/public/assets/PanelsView-DHxhdGwy.js b/public/assets/PanelsView-DHxhdGwy.js new file mode 100644 index 0000000..f8d47ff --- /dev/null +++ b/public/assets/PanelsView-DHxhdGwy.js @@ -0,0 +1,9 @@ +import { _ as _export_sfc, c as createElementBlock, o as openBlock } from "./index-GNAKlyBz.js"; +const _sfc_main = {}; +function _sfc_render(_ctx, _cache) { + return openBlock(), createElementBlock("div"); +} +const PanelsView = /* @__PURE__ */ _export_sfc(_sfc_main, [["render", _sfc_render]]); +export { + PanelsView as default +}; diff --git a/public/assets/PanelsView-DtMSunDc.css b/public/assets/PanelsView-DtMSunDc.css deleted file mode 100644 index 90cfb3e..0000000 --- a/public/assets/PanelsView-DtMSunDc.css +++ /dev/null @@ -1 +0,0 @@ -@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){[data-v-a2e76de3],[data-v-a2e76de3]:before,[data-v-a2e76de3]:after,[data-v-a2e76de3]::backdrop{--tw-border-style:solid;--tw-outline-style:solid}}}.select__container[data-v-a2e76de3]{height:calc(var(--spacing,.25rem)*8);position:relative}.select__container select[data-v-a2e76de3],.select__container .select__search-bar[data-v-a2e76de3]{top:calc(var(--spacing,.25rem)*0);height:calc(var(--spacing,.25rem)*8);position:absolute}.select__search-bar[data-v-a2e76de3]{pointer-events:none;right:calc(var(--spacing,.25rem)*0);z-index:10;width:100%;padding-right:calc(var(--spacing,.25rem)*4);grid-template-columns:1fr auto;align-items:center;display:grid}.select__search-bar button[data-v-a2e76de3]{pointer-events:auto}.select__search-bar input[data-v-a2e76de3]{pointer-events:auto;border-style:var(--tw-border-style);padding-inline:calc(var(--spacing,.25rem)*2);padding-block:calc(var(--spacing,.25rem)*0);background-color:#0000;border-width:0}.select__search-bar input[data-v-a2e76de3]:focus{outline-style:var(--tw-outline-style);outline-width:0}.select__search-bar input[disabled][data-v-a2e76de3]{pointer-events:none}.select__search-bar datalist[data-v-a2e76de3]{top:100%;left:calc(var(--spacing,.25rem)*0);position:absolute}select.search__is-active[data-v-a2e76de3]{color:#0000}@property --tw-outline-style{syntax:"*";inherits:false;initial-value:solid}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-border-style:solid}}}[mcrm__button]{cursor:pointer}#panel-edit{grid-template-columns:1fr 30ch;width:100%;height:100%;display:grid;overflow:hidden}#panel-edit .panel-preview{border-right-style:var(--tw-border-style);border-right-width:1px;border-color:var(--color-slate-700,oklch(37.2% .044 257.287))}#panel-edit .panel-preview .panel-preview__content{width:100%;height:100%;padding:calc(var(--spacing,.25rem)*8);justify-content:center;display:grid;position:relative}#panel-edit .panel-preview .panel-preview__content #panel-html__body{width:100%;max-width:100%;height:100%;max-height:100%}#panel-edit .panel-settings{background-color:#0000004d;grid-template-rows:auto auto 1fr;display:grid}@supports (color:color-mix(in lab,red,red)){#panel-edit .panel-settings{background-color:color-mix(in oklab,var(--color-black,#000)30%,transparent)}}#panel-view[data-v-30e319d1]{inset:calc(var(--spacing,.25rem)*0);background-color:var(--color-black,#000);width:100%;height:100%;position:fixed}#panel-view .panel-preview__content[data-v-30e319d1]{justify-content:center;width:100%;height:100%;display:grid;position:relative}#panel-view .panel-preview__content #panel-html__body[data-v-30e319d1]{width:100%;max-width:100%;height:100%;max-height:100%}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){[data-v-a6f4d943],[data-v-a6f4d943]:before,[data-v-a6f4d943]:after,[data-v-a6f4d943]::backdrop{--tw-backdrop-blur:initial;--tw-backdrop-brightness:initial;--tw-backdrop-contrast:initial;--tw-backdrop-grayscale:initial;--tw-backdrop-hue-rotate:initial;--tw-backdrop-invert:initial;--tw-backdrop-opacity:initial;--tw-backdrop-saturate:initial;--tw-backdrop-sepia:initial;--tw-border-style:solid}}}.panel-list[data-v-a6f4d943]{gap:calc(var(--spacing,.25rem)*4);grid-template-columns:repeat(2,minmax(0,1fr));width:100%;height:fit-content;display:grid}@media (min-width:48rem){.panel-list[data-v-a6f4d943]{grid-template-columns:repeat(4,minmax(0,1fr))}}@media (min-width:64rem){.panel-list[data-v-a6f4d943]{grid-template-columns:repeat(6,minmax(0,1fr))}}.panel-item[data-v-a6f4d943]{padding:1px;overflow:hidden}.panel-item .thumb[data-v-a6f4d943]{aspect-ratio:4/3;justify-content:center;align-items:center;width:100%;display:flex}.panel-item .thumb img[data-v-a6f4d943]{object-fit:cover;width:100%;height:100%}.panel-item .thumb[data-v-a6f4d943]:not(:has(img)){background-color:var(--color-sky-950,oklch(29.3% .066 243.157))}.panel-item .thumb svg[data-v-a6f4d943]{width:calc(var(--spacing,.25rem)*12);height:calc(var(--spacing,.25rem)*12)}.panel-item h4[data-v-a6f4d943]{height:calc(var(--spacing,.25rem)*12);text-overflow:ellipsis;white-space:nowrap;padding-inline:calc(var(--spacing,.25rem)*4);padding-block:calc(var(--spacing,.25rem)*2);overflow:hidden}.panel-item:hover .description[data-v-a6f4d943]{opacity:1}.panel-item .description[data-v-a6f4d943]{inset:calc(var(--spacing,.25rem)*0);z-index:10;cursor:default;width:100%;height:100%;padding-top:calc(var(--spacing,.25rem)*2);padding-right:calc(var(--spacing,.25rem)*1);padding-bottom:calc(var(--spacing,.25rem)*13);color:var(--color-slate-100,oklch(96.8% .007 247.896));opacity:0;--tw-backdrop-blur:blur(var(--blur-md,12px));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);transition-property:opacity;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));background-color:#0f172b99;position:absolute}@supports (color:color-mix(in lab,red,red)){.panel-item .description[data-v-a6f4d943]{background-color:color-mix(in oklab,var(--color-slate-900,oklch(20.8% .042 265.755))60%,transparent)}}.panel-item .description .content[data-v-a6f4d943]{height:100%;padding:calc(var(--spacing,.25rem)*4);padding-top:calc(var(--spacing,.25rem)*2);overflow-y:auto}.panel-item .description footer[data-v-a6f4d943]{bottom:calc(var(--spacing,.25rem)*0);left:calc(var(--spacing,.25rem)*0);height:calc(var(--spacing,.25rem)*12);border-top-style:var(--tw-border-style);border-top-width:1px;border-color:var(--color-slate-600,oklch(44.6% .043 257.281));background-color:var(--color-slate-900,oklch(20.8% .042 265.755));grid-template-columns:repeat(2,minmax(0,1fr));width:100%;display:grid;position:absolute}.panel-item .description footer .btn[data-v-a6f4d943]{border-style:var(--tw-border-style);border-width:0;border-radius:0;justify-content:center;width:100%;height:100%}.panel-item .description footer .btn[data-v-a6f4d943]:last-child{border-left-style:var(--tw-border-style);border-left-width:1px;border-color:var(--color-slate-600,oklch(44.6% .043 257.281))}@property --tw-backdrop-blur{syntax:"*";inherits:false}@property --tw-backdrop-brightness{syntax:"*";inherits:false}@property --tw-backdrop-contrast{syntax:"*";inherits:false}@property --tw-backdrop-grayscale{syntax:"*";inherits:false}@property --tw-backdrop-hue-rotate{syntax:"*";inherits:false}@property --tw-backdrop-invert{syntax:"*";inherits:false}@property --tw-backdrop-opacity{syntax:"*";inherits:false}@property --tw-backdrop-saturate{syntax:"*";inherits:false}@property --tw-backdrop-sepia{syntax:"*";inherits:false}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}/*! tailwindcss v4.1.2 | MIT License | https://tailwindcss.com */ diff --git a/public/assets/SettingsView-CVQl1jsc.js b/public/assets/SettingsView-CVQl1jsc.js new file mode 100644 index 0000000..03a013a --- /dev/null +++ b/public/assets/SettingsView-CVQl1jsc.js @@ -0,0 +1,9 @@ +import { _ as _export_sfc, c as createElementBlock, o as openBlock } from "./index-GNAKlyBz.js"; +const _sfc_main = {}; +function _sfc_render(_ctx, _cache) { + return openBlock(), createElementBlock("div"); +} +const SettingsView = /* @__PURE__ */ _export_sfc(_sfc_main, [["render", _sfc_render]]); +export { + SettingsView as default +}; diff --git a/public/assets/index-BwE95Wut.css b/public/assets/index-BwE95Wut.css deleted file mode 100644 index 1b4c039..0000000 --- a/public/assets/index-BwE95Wut.css +++ /dev/null @@ -1 +0,0 @@ -@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-font-weight:initial;--tw-tracking:initial;--tw-border-style:solid;--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-content:"";--tw-backdrop-blur:initial;--tw-backdrop-brightness:initial;--tw-backdrop-contrast:initial;--tw-backdrop-grayscale:initial;--tw-backdrop-hue-rotate:initial;--tw-backdrop-invert:initial;--tw-backdrop-opacity:initial;--tw-backdrop-saturate:initial;--tw-backdrop-sepia:initial;--tw-gradient-position:initial;--tw-gradient-from:#0000;--tw-gradient-via:#0000;--tw-gradient-to:#0000;--tw-gradient-stops:initial;--tw-gradient-via-stops:initial;--tw-gradient-from-position:0%;--tw-gradient-via-position:50%;--tw-gradient-to-position:100%;--tw-space-y-reverse:0;--tw-divide-y-reverse:0;--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000;--tw-outline-style:solid;--tw-blur:initial;--tw-brightness:initial;--tw-contrast:initial;--tw-grayscale:initial;--tw-hue-rotate:initial;--tw-invert:initial;--tw-opacity:initial;--tw-saturate:initial;--tw-sepia:initial;--tw-drop-shadow:initial;--tw-drop-shadow-color:initial;--tw-drop-shadow-alpha:100%;--tw-drop-shadow-size:initial;--tw-duration:initial}}}body{background-color:var(--color-slate-900);font-family:var(--font-sans);--tw-font-weight:var(--font-weight-light);font-weight:var(--font-weight-light);--tw-tracking:var(--tracking-wide);letter-spacing:var(--tracking-wide);color:var(--color-slate-50)}h1,h2{font-family:var(--font-mono);--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}h3,h4,h5,h6{--tw-font-weight:var(--font-weight-semibold);font-weight:var(--font-weight-semibold)}h1{font-size:var(--text-4xl);line-height:var(--tw-leading,var(--text-4xl--line-height))}h2{font-size:var(--text-3xl);line-height:var(--tw-leading,var(--text-3xl--line-height))}h3{font-size:var(--text-2xl);line-height:var(--tw-leading,var(--text-2xl--line-height))}h4{font-size:var(--text-xl);line-height:var(--tw-leading,var(--text-xl--line-height))}h5{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}ul{list-style-type:disc;list-style-position:inside}strong{--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}a{color:var(--color-amber-400);text-decoration-line:underline}@media (hover:hover){a:hover{color:var(--color-amber-300)}}.input-group{gap:calc(var(--spacing)*2);display:grid}input,select{border-radius:var(--radius-md);border-style:var(--tw-border-style);border-width:1px;border-color:var(--color-slate-400);width:100%;padding-inline:calc(var(--spacing)*2);padding-block:calc(var(--spacing)*1);color:var(--color-white);background-color:#0003}@supports (color:color-mix(in lab,red,red)){:is(input,select){background-color:color-mix(in oklab,var(--color-black)20%,transparent)}}:has(>input+span){display:flex}:has(>input+span) input{border-top-right-radius:0;border-bottom-right-radius:0}:has(>input+span) span{border-top-right-radius:var(--radius-md);border-bottom-right-radius:var(--radius-md);background-color:var(--color-slate-400);padding-inline:calc(var(--spacing)*2);color:var(--color-white);align-items:center;display:flex}select option{background-color:var(--color-slate-700)}select option:not([disabled]){cursor:pointer}::-webkit-scrollbar{width:calc(var(--spacing)*2)}::-moz-scrollbar{width:calc(var(--spacing)*2)}::-webkit-scrollbar-thumb{background-color:#90a1b9cc;border-radius:.25rem}@supports (color:color-mix(in lab,red,red)){::-webkit-scrollbar-thumb{background-color:color-mix(in oklab,var(--color-slate-400)80%,transparent)}}::-moz-scrollbar-thumb{background-color:#90a1b9cc;border-radius:.25rem}@supports (color:color-mix(in lab,red,red)){::-moz-scrollbar-thumb{background-color:color-mix(in oklab,var(--color-slate-400)80%,transparent)}}::-webkit-scrollbar-track{margin-right:calc(var(--spacing)*1);background-color:#f1f5f91a;border-radius:.25rem}@supports (color:color-mix(in lab,red,red)){::-webkit-scrollbar-track{background-color:color-mix(in oklab,var(--color-slate-100)10%,transparent)}}::-moz-scrollbar-track{margin-right:calc(var(--spacing)*1);background-color:#f1f5f91a;border-radius:.25rem}@supports (color:color-mix(in lab,red,red)){::-moz-scrollbar-track{background-color:color-mix(in oklab,var(--color-slate-100)10%,transparent)}}hr.spacer{width:calc(var(--spacing)*6);border-style:var(--tw-border-style);border-width:1px;border-color:var(--color-gray-300);opacity:.8;position:relative;overflow:visible}hr.spacer:before,hr.spacer:after{width:calc(var(--spacing)*2);height:calc(var(--spacing)*2);--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y);background-color:var(--color-gray-300);--tw-content:"";content:var(--tw-content);border-radius:3.40282e38px;position:absolute;top:50%}hr.spacer:before{left:calc(var(--spacing)*-1)}hr.spacer:after{right:calc(var(--spacing)*-1)}.mcrm-block{column-gap:calc(var(--spacing)*6);row-gap:calc(var(--spacing)*2);border-radius:var(--radius-2xl);padding:calc(var(--spacing)*6);--tw-backdrop-blur:blur(var(--blur-lg));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);position:relative;overflow:hidden}.mcrm-block:before{pointer-events:none;inset:calc(var(--spacing)*0);z-index:10;border-radius:var(--radius-2xl);--tw-gradient-position:to bottom right in oklab;background-image:linear-gradient(var(--tw-gradient-stops));--tw-gradient-to:transparent;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position));--tw-content:"";content:var(--tw-content);width:100%;height:100%;padding:1px;position:absolute;-webkit-mask:linear-gradient(#000 0 0),linear-gradient(#000 0 0) content-box;-webkit-mask-composite:xor,source-over;mask:linear-gradient(#000 0 0) exclude,linear-gradient(#000 0 0) content-box}.mcrm-block.block__light{background-color:#fff3}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__light{background-color:color-mix(in oklab,var(--color-white)20%,transparent)}}.mcrm-block.block__light:before{--tw-gradient-from:#fff3;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__light:before{--tw-gradient-from:color-mix(in oklab,var(--color-white)20%,transparent)}}.mcrm-block.block__dark{background-color:#0f172bb3}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__dark{background-color:color-mix(in oklab,var(--color-slate-900)70%,transparent)}}.mcrm-block.block__dark:before{--tw-gradient-from:#90a1b966;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__dark:before{--tw-gradient-from:color-mix(in oklab,var(--color-slate-400)40%,transparent)}}.mcrm-block.block__primary{background-color:#77d4ff33}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__primary{background-color:color-mix(in oklab,var(--color-sky-300)20%,transparent)}}.mcrm-block.block__primary:before{--tw-gradient-from:#dff2fe33;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__primary:before{--tw-gradient-from:color-mix(in oklab,var(--color-sky-100)20%,transparent)}}.mcrm-block.block__secondary{background-color:#ffd23633}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__secondary{background-color:color-mix(in oklab,var(--color-amber-300)20%,transparent)}}.mcrm-block.block__secondary:before{--tw-gradient-from:#fef3c633;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__secondary:before{--tw-gradient-from:color-mix(in oklab,var(--color-amber-100)20%,transparent)}}.mcrm-block.block__success{background-color:#5ee9b566}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__success{background-color:color-mix(in oklab,var(--color-emerald-300)40%,transparent)}}.mcrm-block.block__success:before{--tw-gradient-from:#d0fae566;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__success:before{--tw-gradient-from:color-mix(in oklab,var(--color-emerald-100)40%,transparent)}}.mcrm-block.block__warning{background-color:#ffb96d66}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__warning{background-color:color-mix(in oklab,var(--color-orange-300)40%,transparent)}}.mcrm-block.block__warning:before{--tw-gradient-from:#ffedd566;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__warning:before{--tw-gradient-from:color-mix(in oklab,var(--color-orange-100)40%,transparent)}}.mcrm-block.block__danger{background-color:#ffa2ae66}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__danger{background-color:color-mix(in oklab,var(--color-rose-300)40%,transparent)}}.mcrm-block.block__danger:before{--tw-gradient-from:#ffe4e666;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}@supports (color:color-mix(in lab,red,red)){.mcrm-block.block__danger:before{--tw-gradient-from:color-mix(in oklab,var(--color-rose-100)40%,transparent)}}.mcrm-block.block-spacing__sm,.mcrm-block.block-size__sm{column-gap:calc(var(--spacing)*4);row-gap:calc(var(--spacing)*2);padding:calc(var(--spacing)*4)}.mcrm-block.block-size__sm,.mcrm-block.block-size__sm:before{border-radius:var(--radius-lg)}.mcrm-block.block-spacing__lg,.mcrm-block.block-size__lg{column-gap:calc(var(--spacing)*8);row-gap:calc(var(--spacing)*4);padding:calc(var(--spacing)*8)}.mcrm-block.block-size__lg,.mcrm-block.block-size__lg:before{border-radius:var(--radius-3xl)}.panel{top:calc(var(--spacing)*2);right:calc(var(--spacing)*4);bottom:calc(var(--spacing)*2);left:calc(var(--spacing)*4);grid-template-rows:auto 1fr;display:grid;position:fixed;overflow:hidden}@media (min-width:40rem){.panel{right:calc(var(--spacing)*16);left:calc(var(--spacing)*16)}}.panel>.panel__header,.panel>.panel__title{padding-inline:calc(var(--spacing)*4);padding-block:calc(var(--spacing)*2)}.panel .panel__title{--tw-gradient-position:to right in oklab;background-image:linear-gradient(var(--tw-gradient-stops));--tw-gradient-from:var(--color-amber-300);--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position));--tw-gradient-to:#ffffff80;width:fit-content;padding-top:calc(var(--spacing)*3);padding-left:calc(var(--spacing)*16);color:#0000;-webkit-background-clip:text;background-clip:text}@supports (color:color-mix(in lab,red,red)){.panel .panel__title{--tw-gradient-to:color-mix(in oklab,var(--color-white)50%,transparent)}}@media (min-width:40rem){.panel .panel__title{padding-left:calc(var(--spacing)*4)}}.panel .panel__content{height:calc(100% - 1rem);padding-top:calc(var(--spacing)*4);padding-left:calc(var(--spacing)*0);display:grid;overflow:auto}@media (min-width:40rem){.panel .panel__content{padding-top:calc(var(--spacing)*0);padding-left:calc(var(--spacing)*4)}}@layer theme{:root,:host{--font-sans:ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-mono:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--color-red-300:oklch(80.8% .114 19.571);--color-red-500:oklch(63.7% .237 25.331);--color-orange-100:oklch(95.4% .038 75.164);--color-orange-300:oklch(83.7% .128 66.29);--color-amber-100:oklch(96.2% .059 95.617);--color-amber-300:oklch(87.9% .169 91.605);--color-amber-400:oklch(82.8% .189 84.429);--color-yellow-300:oklch(90.5% .182 98.111);--color-yellow-500:oklch(79.5% .184 86.047);--color-yellow-600:oklch(68.1% .162 75.834);--color-lime-100:oklch(96.7% .067 122.328);--color-lime-200:oklch(93.8% .127 124.321);--color-lime-400:oklch(84.1% .238 128.85);--color-lime-500:oklch(76.8% .233 130.85);--color-lime-700:oklch(53.2% .157 131.589);--color-emerald-100:oklch(95% .052 163.051);--color-emerald-300:oklch(84.5% .143 164.978);--color-sky-100:oklch(95.1% .026 236.824);--color-sky-300:oklch(82.8% .111 230.318);--color-sky-400:oklch(74.6% .16 232.661);--color-sky-500:oklch(68.5% .169 237.323);--color-sky-600:oklch(58.8% .158 241.966);--color-sky-900:oklch(39.1% .09 240.876);--color-rose-100:oklch(94.1% .03 12.58);--color-rose-200:oklch(89.2% .058 10.001);--color-rose-300:oklch(81% .117 11.638);--color-rose-400:oklch(71.2% .194 13.428);--color-rose-500:oklch(64.5% .246 16.439);--color-slate-50:oklch(98.4% .003 247.858);--color-slate-100:oklch(96.8% .007 247.896);--color-slate-200:oklch(92.9% .013 255.508);--color-slate-300:oklch(86.9% .022 252.894);--color-slate-400:oklch(70.4% .04 256.788);--color-slate-500:oklch(55.4% .046 257.417);--color-slate-600:oklch(44.6% .043 257.281);--color-slate-700:oklch(37.2% .044 257.287);--color-slate-800:oklch(27.9% .041 260.031);--color-slate-900:oklch(20.8% .042 265.755);--color-slate-950:oklch(12.9% .042 264.695);--color-gray-300:oklch(87.2% .01 258.338);--color-black:#000;--color-white:#fff;--spacing:.25rem;--text-xs:.75rem;--text-xs--line-height:calc(1/.75);--text-sm:.875rem;--text-sm--line-height:calc(1.25/.875);--text-lg:1.125rem;--text-lg--line-height:calc(1.75/1.125);--text-xl:1.25rem;--text-xl--line-height:calc(1.75/1.25);--text-2xl:1.5rem;--text-2xl--line-height:calc(2/1.5);--text-3xl:1.875rem;--text-3xl--line-height: 1.2 ;--text-4xl:2.25rem;--text-4xl--line-height:calc(2.5/2.25);--font-weight-light:300;--font-weight-normal:400;--font-weight-semibold:600;--font-weight-bold:700;--tracking-wide:.025em;--tracking-widest:.1em;--radius-sm:.25rem;--radius-md:.375rem;--radius-lg:.5rem;--radius-xl:.75rem;--radius-2xl:1rem;--radius-3xl:1.5rem;--animate-spin:spin 1s linear infinite;--blur-xs:4px;--blur-md:12px;--blur-lg:16px;--blur-3xl:64px;--default-transition-duration:.15s;--default-transition-timing-function:cubic-bezier(.4,0,.2,1);--default-font-family:var(--font-sans);--default-mono-font-family:var(--font-mono)}}@layer base{*,:after,:before,::backdrop{box-sizing:border-box;border:0 solid;margin:0;padding:0}::file-selector-button{box-sizing:border-box;border:0 solid;margin:0;padding:0}html,:host{-webkit-text-size-adjust:100%;-moz-tab-size:4;tab-size:4;line-height:1.5;font-family:var(--default-font-family,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-feature-settings:var(--default-font-feature-settings,normal);font-variation-settings:var(--default-font-variation-settings,normal);-webkit-tap-highlight-color:transparent}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;-webkit-text-decoration:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:var(--default-mono-font-family,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-feature-settings:var(--default-mono-font-feature-settings,normal);font-variation-settings:var(--default-mono-font-variation-settings,normal);font-size:1em}small{font-size:80%}sub,sup{vertical-align:baseline;font-size:75%;line-height:0;position:relative}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}:-moz-focusring{outline:auto}progress{vertical-align:baseline}summary{display:list-item}ol,ul,menu{list-style:none}img,svg,video,canvas,audio,iframe,embed,object{vertical-align:middle;display:block}img,video{max-width:100%;height:auto}button,input,select,optgroup,textarea{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}::file-selector-button{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}:where(select:is([multiple],[size])) optgroup{font-weight:bolder}:where(select:is([multiple],[size])) optgroup option{padding-inline-start:20px}::file-selector-button{margin-inline-end:4px}::placeholder{opacity:1}@supports (not ((-webkit-appearance:-apple-pay-button))) or (contain-intrinsic-size:1px){::placeholder{color:currentColor}@supports (color:color-mix(in lab,red,red)){::placeholder{color:color-mix(in oklab,currentcolor 50%,transparent)}}}textarea{resize:vertical}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-date-and-time-value{min-height:1lh;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-datetime-edit{padding-block:0}::-webkit-datetime-edit-year-field{padding-block:0}::-webkit-datetime-edit-month-field{padding-block:0}::-webkit-datetime-edit-day-field{padding-block:0}::-webkit-datetime-edit-hour-field{padding-block:0}::-webkit-datetime-edit-minute-field{padding-block:0}::-webkit-datetime-edit-second-field{padding-block:0}::-webkit-datetime-edit-millisecond-field{padding-block:0}::-webkit-datetime-edit-meridiem-field{padding-block:0}:-moz-ui-invalid{box-shadow:none}button,input:where([type=button],[type=reset],[type=submit]){-webkit-appearance:button;-moz-appearance:button;appearance:button}::file-selector-button{-webkit-appearance:button;-moz-appearance:button;appearance:button}::-webkit-inner-spin-button{height:auto}::-webkit-outer-spin-button{height:auto}[hidden]:where(:not([hidden=until-found])){display:none!important}}@layer components;@layer utilities{.pointer-events-auto{pointer-events:auto}.pointer-events-none{pointer-events:none}.absolute{position:absolute}.fixed{position:fixed}.relative{position:relative}.inset-0{inset:calc(var(--spacing)*0)}.inset-1\/2{top:50%;right:50%;bottom:50%;left:50%}.top-0{top:calc(var(--spacing)*0)}.top-1\/2{top:50%}.top-4{top:calc(var(--spacing)*4)}.top-20{top:calc(var(--spacing)*20)}.top-\[10\%\]{top:10%}.top-full{top:100%}.right-0{right:calc(var(--spacing)*0)}.right-4{right:calc(var(--spacing)*4)}.bottom-0{bottom:calc(var(--spacing)*0)}.left-0{left:calc(var(--spacing)*0)}.left-1\/2{left:50%}.left-4{left:calc(var(--spacing)*4)}.left-\[10\%\]{left:10%}.left-full{left:100%}.z-10{z-index:10}.z-50{z-index:50}.col-start-1{grid-column-start:1}.col-start-2{grid-column-start:2}.row-start-1{grid-row-start:1}.row-start-2{grid-row-start:2}.row-start-3{grid-row-start:3}.container{width:100%}@media (min-width:40rem){.container{max-width:40rem}}@media (min-width:48rem){.container{max-width:48rem}}@media (min-width:64rem){.container{max-width:64rem}}@media (min-width:80rem){.container{max-width:80rem}}@media (min-width:96rem){.container{max-width:96rem}}.mt-2{margin-top:calc(var(--spacing)*2)}.mt-4{margin-top:calc(var(--spacing)*4)}.mt-6{margin-top:calc(var(--spacing)*6)}.mt-8{margin-top:calc(var(--spacing)*8)}.-mr-1{margin-right:calc(var(--spacing)*-1)}.mb-1{margin-bottom:calc(var(--spacing)*1)}.mb-2{margin-bottom:calc(var(--spacing)*2)}.mb-4{margin-bottom:calc(var(--spacing)*4)}.block{display:block}.flex{display:flex}.grid{display:grid}.inline-flex{display:inline-flex}.aspect-square{aspect-ratio:1}.size-0{width:calc(var(--spacing)*0);height:calc(var(--spacing)*0)}.size-4{width:calc(var(--spacing)*4);height:calc(var(--spacing)*4)}.size-5{width:calc(var(--spacing)*5);height:calc(var(--spacing)*5)}.size-12{width:calc(var(--spacing)*12);height:calc(var(--spacing)*12)}.size-16{width:calc(var(--spacing)*16);height:calc(var(--spacing)*16)}.size-full{width:100%;height:100%}.\!h-fit{height:fit-content!important}.h-9{height:calc(var(--spacing)*9)}.h-12{height:calc(var(--spacing)*12)}.h-\[calc\(100vh-11\.7rem\)\]{height:calc(100vh - 11.7rem)}.h-fit{height:fit-content}.h-full{height:100%}.\!w-full{width:100%!important}.w-42{width:calc(var(--spacing)*42)}.w-44{width:calc(var(--spacing)*44)}.w-64{width:calc(var(--spacing)*64)}.w-96{width:calc(var(--spacing)*96)}.w-fit{width:fit-content}.w-full{width:100%}.w-px{width:1px}.max-w-\[calc\(100vw-2rem\)\]{max-width:calc(100vw - 2rem)}.max-w-full{max-width:100%}.min-w-full{min-width:100%}.flex-grow{flex-grow:1}.-translate-1\/2{--tw-translate-x: -50% ;--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.-translate-x-1\/2{--tw-translate-x: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.-translate-x-full{--tw-translate-x:-100%;translate:var(--tw-translate-x)var(--tw-translate-y)}.-translate-y-1\/2{--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y)}.-translate-y-full{--tw-translate-y:-100%;translate:var(--tw-translate-x)var(--tw-translate-y)}.translate-y-0{--tw-translate-y:calc(var(--spacing)*0);translate:var(--tw-translate-x)var(--tw-translate-y)}.scale-\[1\.8\]{scale:1.8}.animate-spin{animation:var(--animate-spin)}.cursor-default{cursor:default}.cursor-pointer{cursor:pointer}.list-none{list-style-type:none}.grid-cols-1{grid-template-columns:repeat(1,minmax(0,1fr))}.grid-cols-2{grid-template-columns:repeat(2,minmax(0,1fr))}.grid-cols-\[1fr_0fr\]{grid-template-columns:1fr 0fr}.grid-cols-\[1fr_30ch\]{grid-template-columns:1fr 30ch}.grid-cols-\[1fr_auto\]{grid-template-columns:1fr auto}.grid-cols-\[1rem_1fr\]{grid-template-columns:1rem 1fr}.grid-cols-\[2rem_1fr\]{grid-template-columns:2rem 1fr}.grid-cols-\[25ch_1fr\]{grid-template-columns:25ch 1fr}.grid-cols-\[auto_1fr\]{grid-template-columns:auto 1fr}.grid-cols-\[auto_1fr_auto\]{grid-template-columns:auto 1fr auto}.grid-rows-3{grid-template-rows:repeat(3,minmax(0,1fr))}.grid-rows-\[0fr\]{grid-template-rows:0fr}.grid-rows-\[1fr\]{grid-template-rows:1fr}.grid-rows-\[auto_1fr_auto\]{grid-template-rows:auto 1fr auto}.grid-rows-\[auto_auto_1fr\]{grid-template-rows:auto auto 1fr}.flex-col{flex-direction:column}.flex-row-reverse{flex-direction:row-reverse}.flex-wrap{flex-wrap:wrap}.content-start{align-content:flex-start}.items-center{align-items:center}.items-end{align-items:flex-end}.items-start{align-items:flex-start}.justify-between{justify-content:space-between}.justify-center{justify-content:center}.justify-end{justify-content:flex-end}.justify-items-center{justify-items:center}.\!gap-0{gap:calc(var(--spacing)*0)!important}.\!gap-4{gap:calc(var(--spacing)*4)!important}.gap-1{gap:calc(var(--spacing)*1)}.gap-2{gap:calc(var(--spacing)*2)}.gap-3{gap:calc(var(--spacing)*3)}.gap-4{gap:calc(var(--spacing)*4)}.gap-6{gap:calc(var(--spacing)*6)}.gap-8{gap:calc(var(--spacing)*8)}:where(.space-y-2>:not(:last-child)){--tw-space-y-reverse:0;margin-block-start:calc(calc(var(--spacing)*2)*var(--tw-space-y-reverse));margin-block-end:calc(calc(var(--spacing)*2)*calc(1 - var(--tw-space-y-reverse)))}.\!gap-y-16{row-gap:calc(var(--spacing)*16)!important}.gap-y-4{row-gap:calc(var(--spacing)*4)}:where(.divide-y>:not(:last-child)){--tw-divide-y-reverse:0;border-bottom-style:var(--tw-border-style);border-top-style:var(--tw-border-style);border-top-width:calc(1px*var(--tw-divide-y-reverse));border-bottom-width:calc(1px*calc(1 - var(--tw-divide-y-reverse)))}:where(.divide-slate-600>:not(:last-child)){border-color:var(--color-slate-600)}.justify-self-end{justify-self:flex-end}.truncate{text-overflow:ellipsis;white-space:nowrap;overflow:hidden}.\!overflow-hidden{overflow:hidden!important}.overflow-auto{overflow:auto}.overflow-hidden{overflow:hidden}.rounded-full{border-radius:3.40282e38px}.rounded-lg{border-radius:var(--radius-lg)}.rounded-md{border-radius:var(--radius-md)}.rounded-none{border-radius:0}.rounded-sm{border-radius:var(--radius-sm)}.rounded-xl{border-radius:var(--radius-xl)}.border{border-style:var(--tw-border-style);border-width:1px}.border-0{border-style:var(--tw-border-style);border-width:0}.border-y{border-block-style:var(--tw-border-style);border-block-width:1px}.border-t{border-top-style:var(--tw-border-style);border-top-width:1px}.border-r{border-right-style:var(--tw-border-style);border-right-width:1px}.border-b-2{border-bottom-style:var(--tw-border-style);border-bottom-width:2px}.border-l{border-left-style:var(--tw-border-style);border-left-width:1px}.border-solid{--tw-border-style:solid;border-style:solid}.border-amber-100{border-color:var(--color-amber-100)}.border-amber-300\/80{border-color:#ffd236cc}@supports (color:color-mix(in lab,red,red)){.border-amber-300\/80{border-color:color-mix(in oklab,var(--color-amber-300)80%,transparent)}}.border-lime-100{border-color:var(--color-lime-100)}.border-lime-500{border-color:var(--color-lime-500)}.border-rose-100{border-color:var(--color-rose-100)}.border-rose-300{border-color:var(--color-rose-300)}.border-rose-500{border-color:var(--color-rose-500)}.border-sky-100{border-color:var(--color-sky-100)}.border-sky-300{border-color:var(--color-sky-300)}.border-sky-400{border-color:var(--color-sky-400)}.border-slate-200{border-color:var(--color-slate-200)}.border-slate-400{border-color:var(--color-slate-400)}.border-slate-500{border-color:var(--color-slate-500)}.border-slate-600{border-color:var(--color-slate-600)}.border-transparent{border-color:#0000}.border-white\/10{border-color:#ffffff1a}@supports (color:color-mix(in lab,red,red)){.border-white\/10{border-color:color-mix(in oklab,var(--color-white)10%,transparent)}}.border-white\/50{border-color:#ffffff80}@supports (color:color-mix(in lab,red,red)){.border-white\/50{border-color:color-mix(in oklab,var(--color-white)50%,transparent)}}.border-yellow-300{border-color:var(--color-yellow-300)}.border-t-transparent{border-top-color:#0000}.border-t-white\/50{border-top-color:#ffffff80}@supports (color:color-mix(in lab,red,red)){.border-t-white\/50{border-top-color:color-mix(in oklab,var(--color-white)50%,transparent)}}.border-b-slate-300{border-bottom-color:var(--color-slate-300)}.border-b-white\/60{border-bottom-color:#fff9}@supports (color:color-mix(in lab,red,red)){.border-b-white\/60{border-bottom-color:color-mix(in oklab,var(--color-white)60%,transparent)}}.bg-amber-100\/10{background-color:#fef3c61a}@supports (color:color-mix(in lab,red,red)){.bg-amber-100\/10{background-color:color-mix(in oklab,var(--color-amber-100)10%,transparent)}}.bg-amber-300\/30{background-color:#ffd2364d}@supports (color:color-mix(in lab,red,red)){.bg-amber-300\/30{background-color:color-mix(in oklab,var(--color-amber-300)30%,transparent)}}.bg-amber-400\/40{background-color:#fcbb0066}@supports (color:color-mix(in lab,red,red)){.bg-amber-400\/40{background-color:color-mix(in oklab,var(--color-amber-400)40%,transparent)}}.bg-black\/50{background-color:#00000080}@supports (color:color-mix(in lab,red,red)){.bg-black\/50{background-color:color-mix(in oklab,var(--color-black)50%,transparent)}}.bg-lime-200\/10{background-color:#d8f9991a}@supports (color:color-mix(in lab,red,red)){.bg-lime-200\/10{background-color:color-mix(in oklab,var(--color-lime-200)10%,transparent)}}.bg-lime-400\/40{background-color:#9de50066}@supports (color:color-mix(in lab,red,red)){.bg-lime-400\/40{background-color:color-mix(in oklab,var(--color-lime-400)40%,transparent)}}.bg-lime-500\/80{background-color:#80cd00cc}@supports (color:color-mix(in lab,red,red)){.bg-lime-500\/80{background-color:color-mix(in oklab,var(--color-lime-500)80%,transparent)}}.bg-lime-700{background-color:var(--color-lime-700)}.bg-rose-200\/20{background-color:#ffccd333}@supports (color:color-mix(in lab,red,red)){.bg-rose-200\/20{background-color:color-mix(in oklab,var(--color-rose-200)20%,transparent)}}.bg-rose-300\/30{background-color:#ffa2ae4d}@supports (color:color-mix(in lab,red,red)){.bg-rose-300\/30{background-color:color-mix(in oklab,var(--color-rose-300)30%,transparent)}}.bg-rose-400\/40{background-color:#ff667f66}@supports (color:color-mix(in lab,red,red)){.bg-rose-400\/40{background-color:color-mix(in oklab,var(--color-rose-400)40%,transparent)}}.bg-sky-100\/10{background-color:#dff2fe1a}@supports (color:color-mix(in lab,red,red)){.bg-sky-100\/10{background-color:color-mix(in oklab,var(--color-sky-100)10%,transparent)}}.bg-sky-300\/30{background-color:#77d4ff4d}@supports (color:color-mix(in lab,red,red)){.bg-sky-300\/30{background-color:color-mix(in oklab,var(--color-sky-300)30%,transparent)}}.bg-sky-400\/40{background-color:#00bcfe66}@supports (color:color-mix(in lab,red,red)){.bg-sky-400\/40{background-color:color-mix(in oklab,var(--color-sky-400)40%,transparent)}}.bg-sky-400\/50{background-color:#00bcfe80}@supports (color:color-mix(in lab,red,red)){.bg-sky-400\/50{background-color:color-mix(in oklab,var(--color-sky-400)50%,transparent)}}.bg-sky-500{background-color:var(--color-sky-500)}.bg-sky-900{background-color:var(--color-sky-900)}.bg-slate-100\/60{background-color:#f1f5f999}@supports (color:color-mix(in lab,red,red)){.bg-slate-100\/60{background-color:color-mix(in oklab,var(--color-slate-100)60%,transparent)}}.bg-slate-200\/10{background-color:#e2e8f01a}@supports (color:color-mix(in lab,red,red)){.bg-slate-200\/10{background-color:color-mix(in oklab,var(--color-slate-200)10%,transparent)}}.bg-slate-400\/40{background-color:#90a1b966}@supports (color:color-mix(in lab,red,red)){.bg-slate-400\/40{background-color:color-mix(in oklab,var(--color-slate-400)40%,transparent)}}.bg-slate-500{background-color:var(--color-slate-500)}.bg-slate-700{background-color:var(--color-slate-700)}.bg-slate-700\/80{background-color:#314158cc}@supports (color:color-mix(in lab,red,red)){.bg-slate-700\/80{background-color:color-mix(in oklab,var(--color-slate-700)80%,transparent)}}.bg-slate-900{background-color:var(--color-slate-900)}.bg-slate-900\/60{background-color:#0f172b99}@supports (color:color-mix(in lab,red,red)){.bg-slate-900\/60{background-color:color-mix(in oklab,var(--color-slate-900)60%,transparent)}}.bg-slate-950\/50{background-color:#02061880}@supports (color:color-mix(in lab,red,red)){.bg-slate-950\/50{background-color:color-mix(in oklab,var(--color-slate-950)50%,transparent)}}.bg-transparent{background-color:#0000}.bg-white\/10{background-color:#ffffff1a}@supports (color:color-mix(in lab,red,red)){.bg-white\/10{background-color:color-mix(in oklab,var(--color-white)10%,transparent)}}.bg-white\/20{background-color:#fff3}@supports (color:color-mix(in lab,red,red)){.bg-white\/20{background-color:color-mix(in oklab,var(--color-white)20%,transparent)}}.bg-yellow-500\/50{background-color:#edb20080}@supports (color:color-mix(in lab,red,red)){.bg-yellow-500\/50{background-color:color-mix(in oklab,var(--color-yellow-500)50%,transparent)}}.to-white\/30{--tw-gradient-to:#ffffff4d;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position))}@supports (color:color-mix(in lab,red,red)){.to-white\/30{--tw-gradient-to:color-mix(in oklab,var(--color-white)30%,transparent)}}.\!p-0{padding:calc(var(--spacing)*0)!important}.p-0{padding:calc(var(--spacing)*0)}.p-1{padding:calc(var(--spacing)*1)}.p-2{padding:calc(var(--spacing)*2)}.p-4{padding:calc(var(--spacing)*4)}.p-px{padding:1px}.\!px-1{padding-inline:calc(var(--spacing)*1)!important}.px-2{padding-inline:calc(var(--spacing)*2)}.px-3{padding-inline:calc(var(--spacing)*3)}.px-4{padding-inline:calc(var(--spacing)*4)}.px-6{padding-inline:calc(var(--spacing)*6)}.py-0{padding-block:calc(var(--spacing)*0)}.py-1{padding-block:calc(var(--spacing)*1)}.py-2{padding-block:calc(var(--spacing)*2)}.py-3{padding-block:calc(var(--spacing)*3)}.py-4{padding-block:calc(var(--spacing)*4)}.\!pt-4{padding-top:calc(var(--spacing)*4)!important}.pt-2{padding-top:calc(var(--spacing)*2)}.pt-8{padding-top:calc(var(--spacing)*8)}.\!pr-4{padding-right:calc(var(--spacing)*4)!important}.pr-1{padding-right:calc(var(--spacing)*1)}.pr-2{padding-right:calc(var(--spacing)*2)}.pr-3{padding-right:calc(var(--spacing)*3)}.pr-4{padding-right:calc(var(--spacing)*4)}.pb-13{padding-bottom:calc(var(--spacing)*13)}.pl-1{padding-left:calc(var(--spacing)*1)}.pl-3{padding-left:calc(var(--spacing)*3)}.pl-4{padding-left:calc(var(--spacing)*4)}.pl-6{padding-left:calc(var(--spacing)*6)}.text-center{text-align:center}.text-right{text-align:right}.font-mono{font-family:var(--font-mono)}.font-sans{font-family:var(--font-sans)}.\!text-lg{font-size:var(--text-lg)!important;line-height:var(--tw-leading,var(--text-lg--line-height))!important}.text-4xl{font-size:var(--text-4xl);line-height:var(--tw-leading,var(--text-4xl--line-height))}.text-lg{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}.text-sm{font-size:var(--text-sm);line-height:var(--tw-leading,var(--text-sm--line-height))}.text-xs{font-size:var(--text-xs);line-height:var(--tw-leading,var(--text-xs--line-height))}.font-bold{--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}.font-light{--tw-font-weight:var(--font-weight-light);font-weight:var(--font-weight-light)}.font-normal{--tw-font-weight:var(--font-weight-normal);font-weight:var(--font-weight-normal)}.font-semibold{--tw-font-weight:var(--font-weight-semibold);font-weight:var(--font-weight-semibold)}.tracking-wide{--tw-tracking:var(--tracking-wide);letter-spacing:var(--tracking-wide)}.tracking-widest{--tw-tracking:var(--tracking-widest);letter-spacing:var(--tracking-widest)}.whitespace-nowrap{white-space:nowrap}.\!text-red-500{color:var(--color-red-500)!important}.text-amber-400{color:var(--color-amber-400)}.text-lime-400{color:var(--color-lime-400)}.text-red-500{color:var(--color-red-500)}.text-rose-400{color:var(--color-rose-400)}.text-sky-100{color:var(--color-sky-100)}.text-sky-300{color:var(--color-sky-300)}.text-sky-400{color:var(--color-sky-400)}.text-sky-500{color:var(--color-sky-500)}.text-slate-50{color:var(--color-slate-50)}.text-slate-100{color:var(--color-slate-100)}.text-slate-200{color:var(--color-slate-200)}.text-slate-300{color:var(--color-slate-300)}.text-slate-400{color:var(--color-slate-400)}.text-slate-800{color:var(--color-slate-800)}.text-slate-950{color:var(--color-slate-950)}.text-white{color:var(--color-white)}.text-white\/40{color:#fff6}@supports (color:color-mix(in lab,red,red)){.text-white\/40{color:color-mix(in oklab,var(--color-white)40%,transparent)}}.text-white\/80{color:#fffc}@supports (color:color-mix(in lab,red,red)){.text-white\/80{color:color-mix(in oklab,var(--color-white)80%,transparent)}}.uppercase{text-transform:uppercase}.not-italic{font-style:normal}.no-underline{text-decoration-line:none}.opacity-0{opacity:0}.opacity-35{opacity:.35}.opacity-40{opacity:.4}.opacity-50{opacity:.5}.opacity-100{opacity:1}.shadow-md{--tw-shadow:0 4px 6px -1px var(--tw-shadow-color,#0000001a),0 2px 4px -2px var(--tw-shadow-color,#0000001a);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.ring-2{--tw-ring-shadow:var(--tw-ring-inset,)0 0 0 calc(2px + var(--tw-ring-offset-width))var(--tw-ring-color,currentcolor);box-shadow:var(--tw-inset-shadow),var(--tw-inset-ring-shadow),var(--tw-ring-offset-shadow),var(--tw-ring-shadow),var(--tw-shadow)}.shadow-black{--tw-shadow-color:#000}@supports (color:color-mix(in lab,red,red)){.shadow-black{--tw-shadow-color:color-mix(in oklab,var(--color-black)var(--tw-shadow-alpha),transparent)}}.shadow-sky-600{--tw-shadow-color:oklch(58.8% .158 241.966)}@supports (color:color-mix(in lab,red,red)){.shadow-sky-600{--tw-shadow-color:color-mix(in oklab,var(--color-sky-600)var(--tw-shadow-alpha),transparent)}}.shadow-yellow-600{--tw-shadow-color:oklch(68.1% .162 75.834)}@supports (color:color-mix(in lab,red,red)){.shadow-yellow-600{--tw-shadow-color:color-mix(in oklab,var(--color-yellow-600)var(--tw-shadow-alpha),transparent)}}.ring-sky-500{--tw-ring-color:var(--color-sky-500)}.ring-offset-1{--tw-ring-offset-width:1px;--tw-ring-offset-shadow:var(--tw-ring-inset,)0 0 0 var(--tw-ring-offset-width)var(--tw-ring-offset-color)}.outline-0{outline-style:var(--tw-outline-style);outline-width:0}.filter{filter:var(--tw-blur,)var(--tw-brightness,)var(--tw-contrast,)var(--tw-grayscale,)var(--tw-hue-rotate,)var(--tw-invert,)var(--tw-saturate,)var(--tw-sepia,)var(--tw-drop-shadow,)}.backdrop-blur-3xl{--tw-backdrop-blur:blur(var(--blur-3xl));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,)}.backdrop-blur-md{--tw-backdrop-blur:blur(var(--blur-md));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,)}.backdrop-blur-xs{--tw-backdrop-blur:blur(var(--blur-xs));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,)}.transition{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to,opacity,box-shadow,transform,translate,scale,rotate,filter,-webkit-backdrop-filter,backdrop-filter;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-\[grid-template-columns\]{transition-property:grid-template-columns;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-\[stroke\]{transition-property:stroke;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-all{transition-property:all;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-colors{transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-opacity{transition-property:opacity;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.transition-transform{transition-property:transform,translate,scale,rotate;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function));transition-duration:var(--tw-duration,var(--default-transition-duration))}.delay-0{transition-delay:0s}.duration-300{--tw-duration:.3s;transition-duration:.3s}.duration-400{--tw-duration:.4s;transition-duration:.4s}.duration-1000{--tw-duration:1s;transition-duration:1s}.content-\[\'\'\]{--tw-content:"";content:var(--tw-content)}@media (hover:hover){.hover\:bg-black\/10:hover{background-color:#0000001a}@supports (color:color-mix(in lab,red,red)){.hover\:bg-black\/10:hover{background-color:color-mix(in oklab,var(--color-black)10%,transparent)}}.hover\:bg-lime-500:hover{background-color:var(--color-lime-500)}.hover\:bg-slate-700:hover{background-color:var(--color-slate-700)}.hover\:bg-white\/10:hover{background-color:#ffffff1a}@supports (color:color-mix(in lab,red,red)){.hover\:bg-white\/10:hover{background-color:color-mix(in oklab,var(--color-white)10%,transparent)}}.hover\:bg-white\/40:hover{background-color:#fff6}@supports (color:color-mix(in lab,red,red)){.hover\:bg-white\/40:hover{background-color:color-mix(in oklab,var(--color-white)40%,transparent)}}.hover\:\!text-red-300:hover{color:var(--color-red-300)!important}}.focus\:border-transparent:focus{border-color:#0000}.focus\:border-b-sky-400:focus{border-bottom-color:var(--color-sky-400)}.focus\:bg-sky-400\/10:focus{background-color:#00bcfe1a}@supports (color:color-mix(in lab,red,red)){.focus\:bg-sky-400\/10:focus{background-color:color-mix(in oklab,var(--color-sky-400)10%,transparent)}}@media (min-width:48rem){.md\:\!row-start-1{grid-row-start:1!important}.md\:w-fit{width:fit-content}.md\:grid-cols-3{grid-template-columns:repeat(3,minmax(0,1fr))}.md\:grid-cols-4{grid-template-columns:repeat(4,minmax(0,1fr))}.md\:grid-rows-1{grid-template-rows:repeat(1,minmax(0,1fr))}}@media (min-width:64rem){.lg\:grid-cols-6{grid-template-columns:repeat(6,minmax(0,1fr))}}}html,body,:not(#panel-html__body){--font-sans:"Roboto",sans-serif;--font-mono:"Fira Code",monospace}@property --tw-content{syntax:"*";inherits:false;initial-value:""}@property --tw-space-y-reverse{syntax:"*";inherits:false;initial-value:0}@property --tw-outline-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-blur{syntax:"*";inherits:false}@property --tw-brightness{syntax:"*";inherits:false}@property --tw-contrast{syntax:"*";inherits:false}@property --tw-grayscale{syntax:"*";inherits:false}@property --tw-hue-rotate{syntax:"*";inherits:false}@property --tw-invert{syntax:"*";inherits:false}@property --tw-opacity{syntax:"*";inherits:false}@property --tw-saturate{syntax:"*";inherits:false}@property --tw-sepia{syntax:"*";inherits:false}@property --tw-drop-shadow{syntax:"*";inherits:false}@property --tw-drop-shadow-color{syntax:"*";inherits:false}@property --tw-drop-shadow-alpha{syntax:"";inherits:false;initial-value:100%}@property --tw-drop-shadow-size{syntax:"*";inherits:false}@keyframes spin{to{transform:rotate(360deg)}}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-border-style:solid;--tw-backdrop-blur:initial;--tw-backdrop-brightness:initial;--tw-backdrop-contrast:initial;--tw-backdrop-grayscale:initial;--tw-backdrop-hue-rotate:initial;--tw-backdrop-invert:initial;--tw-backdrop-opacity:initial;--tw-backdrop-saturate:initial;--tw-backdrop-sepia:initial;--tw-translate-x:0;--tw-translate-y:0;--tw-translate-z:0;--tw-duration:initial;--tw-ease:initial;--tw-divide-y-reverse:0}}}nav{z-index:50;display:flex;position:relative}nav button{top:calc(var(--spacing,.25rem)*4);left:calc(var(--spacing,.25rem)*4);aspect-ratio:1;width:calc(var(--spacing,.25rem)*12);height:calc(var(--spacing,.25rem)*12);cursor:pointer;border-style:var(--tw-border-style);--tw-backdrop-blur:blur(var(--blur-md,12px));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));background-color:#fff3;border-width:0;border-radius:3.40282e38px;position:absolute}@supports (color:color-mix(in lab,red,red)){nav button{background-color:color-mix(in oklab,var(--color-white,#fff)20%,transparent)}}@media (hover:hover){nav button:hover{background-color:#fff6}@supports (color:color-mix(in lab,red,red)){nav button:hover{background-color:color-mix(in oklab,var(--color-white,#fff)40%,transparent)}}}nav button .logo,nav button svg{--tw-translate-x: -50% ;--tw-translate-y: -50% ;translate:var(--tw-translate-x)var(--tw-translate-y);transition-property:opacity;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));--tw-duration:.4s;--tw-ease:var(--ease-in-out,cubic-bezier(.4,0,.2,1));transition-duration:.4s;transition-timing-function:var(--ease-in-out,cubic-bezier(.4,0,.2,1));position:absolute;top:50%;right:50%;bottom:50%;left:50%}nav button .logo{width:100%}nav ul{top:calc(var(--spacing,.25rem)*20);left:calc(var(--spacing,.25rem)*0);--tw-translate-x:-100%;translate:var(--tw-translate-x)var(--tw-translate-y);border-radius:var(--radius-xl,.75rem);--tw-backdrop-blur:blur(var(--blur-md,12px));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);transition-property:transform,translate,scale,rotate;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));--tw-duration:.3s;--tw-ease:var(--ease-in-out,cubic-bezier(.4,0,.2,1));transition-duration:.3s;transition-timing-function:var(--ease-in-out,cubic-bezier(.4,0,.2,1));background-color:#ffffff1a;list-style-type:none;display:grid;position:absolute;overflow:hidden}:where(nav ul>:not(:last-child)){--tw-divide-y-reverse:0;border-bottom-style:var(--tw-border-style);border-top-style:var(--tw-border-style);border-top-width:calc(1px*var(--tw-divide-y-reverse));border-bottom-width:calc(1px*calc(1 - var(--tw-divide-y-reverse)));border-color:var(--color-slate-600,oklch(44.6% .043 257.281))}@supports (color:color-mix(in lab,red,red)){nav ul{background-color:color-mix(in oklab,var(--color-white,#fff)10%,transparent)}}nav ul.open{left:calc(var(--spacing,.25rem)*4);--tw-translate-x:calc(var(--spacing,.25rem)*0);translate:var(--tw-translate-x)var(--tw-translate-y)}nav ul li a{align-items:center;gap:calc(var(--spacing,.25rem)*2);padding-inline:calc(var(--spacing,.25rem)*4);padding-block:calc(var(--spacing,.25rem)*2);color:var(--color-white,#fff);transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));border-color:#0000;text-decoration-line:none;display:flex}nav ul li a svg{color:#fff6;transition-property:color,background-color,border-color,outline-color,text-decoration-color,fill,stroke,--tw-gradient-from,--tw-gradient-via,--tw-gradient-to;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s))}@supports (color:color-mix(in lab,red,red)){nav ul li a svg{color:color-mix(in oklab,var(--color-white,#fff)40%,transparent)}}nav ul li a:hover{background-color:#fff3}@supports (color:color-mix(in lab,red,red)){nav ul li a:hover{background-color:color-mix(in oklab,var(--color-white,#fff)20%,transparent)}}nav ul li a:hover svg{color:var(--color-white,#fff)}nav ul li a.router-link-active{color:var(--color-sky-300,oklch(82.8% .111 230.318));background-color:#b8e6fe33}@supports (color:color-mix(in lab,red,red)){nav ul li a.router-link-active{background-color:color-mix(in oklab,var(--color-sky-200,oklch(90.1% .058 230.902))20%,transparent)}}@property --tw-translate-x{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-y{syntax:"*";inherits:false;initial-value:0}@property --tw-translate-z{syntax:"*";inherits:false;initial-value:0}@property --tw-divide-y-reverse{syntax:"*";inherits:false;initial-value:0}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){[data-v-c788cb13],[data-v-c788cb13]:before,[data-v-c788cb13]:after,[data-v-c788cb13]::backdrop{--tw-border-style:solid;--tw-backdrop-blur:initial;--tw-backdrop-brightness:initial;--tw-backdrop-contrast:initial;--tw-backdrop-grayscale:initial;--tw-backdrop-hue-rotate:initial;--tw-backdrop-invert:initial;--tw-backdrop-opacity:initial;--tw-backdrop-saturate:initial;--tw-backdrop-sepia:initial}}}.alert[data-v-c788cb13]{align-items:flex-start;gap:calc(var(--spacing,.25rem)*4);border-radius:var(--radius-md,.375rem);border-style:var(--tw-border-style);padding:calc(var(--spacing,.25rem)*4);--tw-backdrop-blur:blur(var(--blur-md,12px));-webkit-backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);backdrop-filter:var(--tw-backdrop-blur,)var(--tw-backdrop-brightness,)var(--tw-backdrop-contrast,)var(--tw-backdrop-grayscale,)var(--tw-backdrop-hue-rotate,)var(--tw-backdrop-invert,)var(--tw-backdrop-opacity,)var(--tw-backdrop-saturate,)var(--tw-backdrop-sepia,);background-color:#ffffff1a;border-width:1px;border-color:#ffffff1a;grid-template-columns:1rem 1fr;display:grid}@supports (color:color-mix(in lab,red,red)){.alert[data-v-c788cb13]{border-color:color-mix(in oklab,var(--color-white,#fff)10%,transparent);background-color:color-mix(in oklab,var(--color-white,#fff)10%,transparent)}}.alert.alert__info[data-v-c788cb13]{color:var(--color-sky-100,oklch(95.1% .026 236.824));background-color:#00bcfe66}@supports (color:color-mix(in lab,red,red)){.alert.alert__info[data-v-c788cb13]{background-color:color-mix(in oklab,var(--color-sky-400,oklch(74.6% .16 232.661))40%,transparent)}}.alert.alert__success[data-v-c788cb13]{color:var(--color-lime-400,oklch(84.1% .238 128.85));background-color:#9de5001a}@supports (color:color-mix(in lab,red,red)){.alert.alert__success[data-v-c788cb13]{background-color:color-mix(in oklab,var(--color-lime-400,oklch(84.1% .238 128.85))10%,transparent)}}.alert.alert__warning[data-v-c788cb13]{color:var(--color-amber-400,oklch(82.8% .189 84.429));background-color:#fcbb001a}@supports (color:color-mix(in lab,red,red)){.alert.alert__warning[data-v-c788cb13]{background-color:color-mix(in oklab,var(--color-amber-400,oklch(82.8% .189 84.429))10%,transparent)}}.alert.alert__error[data-v-c788cb13]{color:var(--color-rose-400,oklch(71.2% .194 13.428));background-color:#ff667f1a}@supports (color:color-mix(in lab,red,red)){.alert.alert__error[data-v-c788cb13]{background-color:color-mix(in oklab,var(--color-rose-400,oklch(71.2% .194 13.428))10%,transparent)}}.alert.page-wide[data-v-c788cb13]{bottom:calc(var(--spacing,.25rem)*0);left:calc(var(--spacing,.25rem)*0);width:100%;position:fixed}.alert[href][data-v-c788cb13]{cursor:pointer}.alert .alert__content[data-v-c788cb13]{gap:calc(var(--spacing,.25rem)*2);display:grid}@property --tw-backdrop-blur{syntax:"*";inherits:false}@property --tw-backdrop-brightness{syntax:"*";inherits:false}@property --tw-backdrop-contrast{syntax:"*";inherits:false}@property --tw-backdrop-grayscale{syntax:"*";inherits:false}@property --tw-backdrop-hue-rotate{syntax:"*";inherits:false}@property --tw-backdrop-invert{syntax:"*";inherits:false}@property --tw-backdrop-opacity{syntax:"*";inherits:false}@property --tw-backdrop-saturate{syntax:"*";inherits:false}@property --tw-backdrop-sepia{syntax:"*";inherits:false}.app-background[data-v-ec0604e4]{pointer-events:none;inset:calc(var(--spacing,.25rem)*0);z-index:-1;opacity:.4;width:100%;height:100%;position:fixed;overflow:hidden}.app-background img[data-v-ec0604e4]{object-fit:cover;width:100%;height:100%;position:absolute}.app-background .logo[data-v-ec0604e4]{opacity:.35;mix-blend-mode:overlay;position:absolute;top:10%;left:10%;scale:1.8}@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-border-style:solid;--tw-font-weight:initial;--tw-tracking:initial;--tw-shadow:0 0 #0000;--tw-shadow-color:initial;--tw-shadow-alpha:100%;--tw-inset-shadow:0 0 #0000;--tw-inset-shadow-color:initial;--tw-inset-shadow-alpha:100%;--tw-ring-color:initial;--tw-ring-shadow:0 0 #0000;--tw-inset-ring-color:initial;--tw-inset-ring-shadow:0 0 #0000;--tw-ring-inset:initial;--tw-ring-offset-width:0px;--tw-ring-offset-color:#fff;--tw-ring-offset-shadow:0 0 #0000;--tw-duration:initial;--tw-ease:initial;--tw-gradient-position:initial;--tw-gradient-from:#0000;--tw-gradient-via:#0000;--tw-gradient-to:#0000;--tw-gradient-stops:initial;--tw-gradient-via-stops:initial;--tw-gradient-from-position:0%;--tw-gradient-via-position:50%;--tw-gradient-to-position:100%}}}button,.btn{cursor:pointer;align-items:center;gap:calc(var(--spacing,.25rem)*3);border-radius:var(--radius-lg,.5rem);border-style:var(--tw-border-style);--tw-border-style:solid;height:fit-content;padding-inline:calc(var(--spacing,.25rem)*4);padding-block:calc(var(--spacing,.25rem)*2);--tw-font-weight:var(--font-weight-normal,400);font-weight:var(--font-weight-normal,400);--tw-tracking:var(--tracking-wide,.025em);letter-spacing:var(--tracking-wide,.025em);transition-property:all;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));border-style:solid;border-width:1px;text-decoration-line:none;transition:border-color .1s ease-in-out,background-color .2s;display:flex}:is(button,.btn):not(.button__subtle,.button__ghost):hover{--tw-shadow-color:#000}@supports (color:color-mix(in lab,red,red)){:is(button,.btn):not(.button__subtle,.button__ghost):hover{--tw-shadow-color:color-mix(in oklab,var(--color-black,#000)var(--tw-shadow-alpha),transparent)}}:is(button,.btn)[disabled],:is(button,.btn).disabled{pointer-events:none;cursor:not-allowed;opacity:.5}:is(button,.btn) svg{width:calc(var(--spacing,.25rem)*5);height:calc(var(--spacing,.25rem)*5);transition-property:stroke;transition-timing-function:var(--tw-ease,var(--default-transition-timing-function,cubic-bezier(.4,0,.2,1)));transition-duration:var(--tw-duration,var(--default-transition-duration,.15s));--tw-duration:.4s;--tw-ease:var(--ease-in-out,cubic-bezier(.4,0,.2,1));transition-duration:.4s;transition-timing-function:var(--ease-in-out,cubic-bezier(.4,0,.2,1))}:is(button,.btn).btn__sm{padding-inline:calc(var(--spacing,.25rem)*3);padding-block:calc(var(--spacing,.25rem)*1);font-size:var(--text-sm,.875rem);line-height:var(--tw-leading,var(--text-sm--line-height,calc(1.25/.875)))}:is(button,.btn).btn__sm svg{width:calc(var(--spacing,.25rem)*4);height:calc(var(--spacing,.25rem)*4)}:is(button,.btn).btn__lg{padding-inline:calc(var(--spacing,.25rem)*6);padding-block:calc(var(--spacing,.25rem)*3);font-size:var(--text-lg,1.125rem);line-height:var(--tw-leading,var(--text-lg--line-height,calc(1.75/1.125)))}:is(button,.btn).btn__lg svg{width:calc(var(--spacing,.25rem)*6);height:calc(var(--spacing,.25rem)*6)}:is(button,.btn):hover{color:var(--color-white,#fff)}:is(button,.btn):hover svg{stroke:currentColor}:is(button,.btn).btn__primary{border-color:var(--color-sky-100,oklch(95.1% .026 236.824));color:var(--color-sky-100,oklch(95.1% .026 236.824));background-color:#dff2fe1a}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__primary{background-color:color-mix(in oklab,var(--color-sky-100,oklch(95.1% .026 236.824))10%,transparent)}}:is(button,.btn).btn__primary svg{stroke:var(--color-sky-200,oklch(90.1% .058 230.902))}:is(button,.btn).btn__primary:hover{border-color:var(--color-sky-300,oklch(82.8% .111 230.318));background-color:#00bcfe66}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__primary:hover{background-color:color-mix(in oklab,var(--color-sky-400,oklch(74.6% .16 232.661))40%,transparent)}}:is(button,.btn).btn__secondary{border-color:var(--color-amber-100,oklch(96.2% .059 95.617));color:var(--color-amber-100,oklch(96.2% .059 95.617));background-color:#fef3c61a}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__secondary{background-color:color-mix(in oklab,var(--color-amber-100,oklch(96.2% .059 95.617))10%,transparent)}}:is(button,.btn).btn__secondary svg{stroke:var(--color-amber-300,oklch(87.9% .169 91.605))}:is(button,.btn).btn__secondary:hover{border-color:var(--color-amber-400,oklch(82.8% .189 84.429));background-color:#fcbb0066}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__secondary:hover{background-color:color-mix(in oklab,var(--color-amber-400,oklch(82.8% .189 84.429))40%,transparent)}}:is(button,.btn).btn__danger{border-color:var(--color-rose-100,oklch(94.1% .03 12.58));color:var(--color-rose-200,oklch(89.2% .058 10.001));background-color:#ffccd333}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__danger{background-color:color-mix(in oklab,var(--color-rose-200,oklch(89.2% .058 10.001))20%,transparent)}}:is(button,.btn).btn__danger svg{stroke:var(--color-rose-400,oklch(71.2% .194 13.428))}:is(button,.btn).btn__danger:hover{border-color:var(--color-rose-500,oklch(64.5% .246 16.439));color:var(--color-white,#fff);background-color:#ff667f66}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__danger:hover{background-color:color-mix(in oklab,var(--color-rose-400,oklch(71.2% .194 13.428))40%,transparent)}}:is(button,.btn).btn__dark{border-color:var(--color-slate-400,oklch(70.4% .04 256.788));color:var(--color-slate-100,oklch(96.8% .007 247.896));background-color:#e2e8f01a}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__dark{background-color:color-mix(in oklab,var(--color-slate-200,oklch(92.9% .013 255.508))10%,transparent)}}:is(button,.btn).btn__dark svg{stroke:var(--color-slate-300,oklch(86.9% .022 252.894))}:is(button,.btn).btn__dark:hover{border-color:var(--color-slate-200,oklch(92.9% .013 255.508));color:var(--color-white,#fff);background-color:#90a1b966}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__dark:hover{background-color:color-mix(in oklab,var(--color-slate-400,oklch(70.4% .04 256.788))40%,transparent)}}:is(button,.btn).btn__success{border-color:var(--color-lime-100,oklch(96.7% .067 122.328));color:var(--color-lime-100,oklch(96.7% .067 122.328));background-color:#d8f9991a}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__success{background-color:color-mix(in oklab,var(--color-lime-200,oklch(93.8% .127 124.321))10%,transparent)}}:is(button,.btn).btn__success svg{stroke:var(--color-lime-400,oklch(84.1% .238 128.85))}:is(button,.btn).btn__success:hover{border-color:var(--color-lime-500,oklch(76.8% .233 130.85));color:var(--color-white,#fff);background-color:#9de50066}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__success:hover{background-color:color-mix(in oklab,var(--color-lime-400,oklch(84.1% .238 128.85))40%,transparent)}}:is(button,.btn).btn__subtle{color:var(--color-white,#fff);background-color:#0000;border-color:#0000}@media (hover:hover){:is(button,.btn).btn__subtle:hover{background-color:#ffffff1a}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__subtle:hover{background-color:color-mix(in oklab,var(--color-white,#fff)10%,transparent)}}}:is(button,.btn).btn__subtle:hover{--tw-gradient-to:#ffffff4d;--tw-gradient-stops:var(--tw-gradient-via-stops,var(--tw-gradient-position),var(--tw-gradient-from)var(--tw-gradient-from-position),var(--tw-gradient-to)var(--tw-gradient-to-position));background-color:#fff3;border-color:#fff6}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__subtle:hover{border-color:color-mix(in oklab,var(--color-white,#fff)40%,transparent);background-color:color-mix(in oklab,var(--color-white,#fff)20%,transparent);--tw-gradient-to:color-mix(in oklab,var(--color-white,#fff)30%,transparent)}}:is(button,.btn).btn__ghost{color:#fffc;background-color:#0000;border-color:#0000}@supports (color:color-mix(in lab,red,red)){:is(button,.btn).btn__ghost{color:color-mix(in oklab,var(--color-white,#fff)80%,transparent)}}@media (hover:hover){:is(button,.btn).btn__ghost:hover{color:var(--color-white,#fff)}}@property --tw-font-weight{syntax:"*";inherits:false}@property --tw-tracking{syntax:"*";inherits:false}@property --tw-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-shadow-color{syntax:"*";inherits:false}@property --tw-shadow-alpha{syntax:"";inherits:false;initial-value:100%}@property --tw-inset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-shadow-color{syntax:"*";inherits:false}@property --tw-inset-shadow-alpha{syntax:"";inherits:false;initial-value:100%}@property --tw-ring-color{syntax:"*";inherits:false}@property --tw-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-inset-ring-color{syntax:"*";inherits:false}@property --tw-inset-ring-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-ring-inset{syntax:"*";inherits:false}@property --tw-ring-offset-width{syntax:"";inherits:false;initial-value:0}@property --tw-ring-offset-color{syntax:"*";inherits:false;initial-value:#fff}@property --tw-ring-offset-shadow{syntax:"*";inherits:false;initial-value:0 0 #0000}@property --tw-duration{syntax:"*";inherits:false}@property --tw-ease{syntax:"*";inherits:false}@property --tw-gradient-position{syntax:"*";inherits:false}@property --tw-gradient-from{syntax:"";inherits:false;initial-value:#0000}@property --tw-gradient-via{syntax:"";inherits:false;initial-value:#0000}@property --tw-gradient-to{syntax:"";inherits:false;initial-value:#0000}@property --tw-gradient-stops{syntax:"*";inherits:false}@property --tw-gradient-via-stops{syntax:"*";inherits:false}@property --tw-gradient-from-position{syntax:"";inherits:false;initial-value:0%}@property --tw-gradient-via-position{syntax:"";inherits:false;initial-value:50%}@property --tw-gradient-to-position{syntax:"";inherits:false;initial-value:100%}#server-dashboard[data-v-1ac3bac6]{gap:calc(var(--spacing,.25rem)*4);width:fit-content;height:fit-content;padding-top:calc(var(--spacing,.25rem)*8);grid-template-rows:repeat(3,minmax(0,1fr));grid-template-columns:repeat(1,minmax(0,1fr));display:grid}@media (min-width:48rem){#server-dashboard[data-v-1ac3bac6]{grid-template-rows:repeat(1,minmax(0,1fr));grid-template-columns:repeat(3,minmax(0,1fr))}}#server-dashboard.no__devices #devices[data-v-1ac3bac6]{grid-row-start:1}@media (min-width:48rem){#server-dashboard.no__devices #devices[data-v-1ac3bac6]{grid-column-start:1}}#server-dashboard.no__macros.devices__found #devices[data-v-1ac3bac6]{grid-row-start:3}@media (min-width:48rem){#server-dashboard.no__macros.devices__found #devices[data-v-1ac3bac6]{grid-column-start:3}}#server-dashboard.devices__found #devices[data-v-1ac3bac6]{grid-row-start:3}@media (min-width:48rem){#server-dashboard.devices__found #devices[data-v-1ac3bac6]{grid-column-start:3}}#server-dashboard.no__devices.no__macros #macros[data-v-1ac3bac6]{grid-row-start:2}@media (min-width:48rem){#server-dashboard.no__devices.no__macros #macros[data-v-1ac3bac6]{grid-column-start:2}}#server-dashboard.no__macros #macros[data-v-1ac3bac6]{grid-row-start:1}@media (min-width:48rem){#server-dashboard.no__macros #macros[data-v-1ac3bac6]{grid-column-start:1}}#server-dashboard.macros__found #macros[data-v-1ac3bac6]{grid-row-start:2}@media (min-width:48rem){#server-dashboard.macros__found #macros[data-v-1ac3bac6]{grid-column-start:2}}#server-dashboard.no__devices.macros__found #macros[data-v-1ac3bac6]{grid-row-start:3}@media (min-width:48rem){#server-dashboard.no__devices.macros__found #macros[data-v-1ac3bac6]{grid-column-start:3}}#remote-dashboard[data-v-9e6b5589]{align-content:flex-start;gap:calc(var(--spacing,.25rem)*4);height:fit-content;padding-top:calc(var(--spacing,.25rem)*8);display:grid}@media (min-width:48rem){#remote-dashboard[data-v-9e6b5589]{width:fit-content}}#remote-dashboard.not__linked #server[data-v-9e6b5589]{grid-row-start:1}@media (min-width:48rem){#remote-dashboard.not__linked #server[data-v-9e6b5589]{grid-column-start:1}}/*! tailwindcss v4.1.2 | MIT License | https://tailwindcss.com */@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-border-style:solid}}}.dashboard-block{justify-items:center;gap:calc(var(--spacing,.25rem)*4);display:grid}@media (min-width:48rem){.dashboard-block{grid-row-start:1!important}}.dashboard-block#devices .icon__container,.dashboard-block#server .icon__container{color:var(--color-sky-400,oklch(74.6% .16 232.661));background-color:#77d4ff4d;border-color:#77d4ff99}@supports (color:color-mix(in lab,red,red)){:is(.dashboard-block#devices .icon__container,.dashboard-block#server .icon__container){border-color:color-mix(in oklab,var(--color-sky-300,oklch(82.8% .111 230.318))60%,transparent);background-color:color-mix(in oklab,var(--color-sky-300,oklch(82.8% .111 230.318))30%,transparent)}}.dashboard-block#macros .icon__container{color:var(--color-amber-400,oklch(82.8% .189 84.429));background-color:#ffd2364d;border-color:#ffd23699}@supports (color:color-mix(in lab,red,red)){.dashboard-block#macros .icon__container{border-color:color-mix(in oklab,var(--color-amber-300,oklch(87.9% .169 91.605))60%,transparent);background-color:color-mix(in oklab,var(--color-amber-300,oklch(87.9% .169 91.605))30%,transparent)}}.dashboard-block#panels .icon__container{color:var(--color-rose-400,oklch(71.2% .194 13.428));background-color:#ffa2ae4d;border-color:#ffa2ae99}@supports (color:color-mix(in lab,red,red)){.dashboard-block#panels .icon__container{border-color:color-mix(in oklab,var(--color-rose-300,oklch(81% .117 11.638))60%,transparent);background-color:color-mix(in oklab,var(--color-rose-300,oklch(81% .117 11.638))30%,transparent)}}.dashboard-block .icon__container{aspect-ratio:1;width:calc(var(--spacing,.25rem)*16);height:calc(var(--spacing,.25rem)*16);border-style:var(--tw-border-style);border-width:1px;border-radius:3.40282e38px;justify-content:center;align-items:center;display:flex}.dashboard-block .icon__container svg{width:calc(var(--spacing,.25rem)*8);height:calc(var(--spacing,.25rem)*8)}.dashboard-block p{width:calc(var(--spacing,.25rem)*42);text-align:center;opacity:.5}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid} diff --git a/public/assets/index-DjeOPht9.css b/public/assets/index-DjeOPht9.css new file mode 100644 index 0000000..34c8025 --- /dev/null +++ b/public/assets/index-DjeOPht9.css @@ -0,0 +1,2256 @@ +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +hr.spacer { + width: calc(var(--spacing) * 6); + border-style: var(--tw-border-style); + border-width: 1px; + border-color: var(--color-gray-300); + opacity: .8; + position: relative; + overflow: visible; +} + +hr.spacer:before, hr.spacer:after { + width: calc(var(--spacing) * 2); + height: calc(var(--spacing) * 2); + --tw-translate-y: calc(calc(1 / 2 * 100%) * -1); + translate: var(--tw-translate-x) var(--tw-translate-y); + background-color: var(--color-gray-300); + --tw-content: ""; + content: var(--tw-content); + border-radius: 3.40282e38px; + position: absolute; + top: 50%; +} + +hr.spacer:before { + left: calc(var(--spacing) * -1); +} + +hr.spacer:after { + right: calc(var(--spacing) * -1); +} + +.mcrm-block { + column-gap: calc(var(--spacing) * 6); + row-gap: calc(var(--spacing) * 2); + border-radius: var(--radius-2xl); + padding: calc(var(--spacing) * 6); + --tw-backdrop-blur: blur(var(--blur-lg)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + position: relative; + overflow: hidden; +} + +.mcrm-block:before { + inset: calc(var(--spacing) * 0); + z-index: -1; + border-radius: var(--radius-2xl); + --tw-gradient-position: to bottom right in oklab; + background-image: linear-gradient(var(--tw-gradient-stops)); + --tw-gradient-to: transparent; + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); + --tw-content: ""; + content: var(--tw-content); + -webkit-mask-composite: xor, source-over; + width: 100%; + height: 100%; + padding: 1px; + position: absolute; + -webkit-mask: linear-gradient(#000 0 0), linear-gradient(#000 0 0) content-box; + -webkit-mask-composite: xor, source-over; + mask: linear-gradient(#000 0 0) exclude, linear-gradient(#000 0 0) content-box; +} + +.mcrm-block.block__light { + background-color: color-mix(in oklab, var(--color-white) 20%, transparent); +} + +.mcrm-block.block__light:before { + --tw-gradient-from: color-mix(in oklab, var(--color-white) 20%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); +} + +.mcrm-block.block__dark { + background-color: color-mix(in oklab, var(--color-slate-900) 70%, transparent); +} + +.mcrm-block.block__dark:before { + --tw-gradient-from: color-mix(in oklab, var(--color-slate-400) 40%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); +} + +.mcrm-block.block__primary { + background-color: color-mix(in oklab, var(--color-sky-300) 40%, transparent); +} + +.mcrm-block.block__primary:before { + --tw-gradient-from: color-mix(in oklab, var(--color-sky-100) 40%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); +} + +.mcrm-block.block__secondary { + background-color: color-mix(in oklab, var(--color-amber-300) 40%, transparent); +} + +.mcrm-block.block__secondary:before { + --tw-gradient-from: color-mix(in oklab, var(--color-amber-100) 40%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); +} + +.mcrm-block.block__success { + background-color: color-mix(in oklab, var(--color-emerald-300) 40%, transparent); +} + +.mcrm-block.block__success:before { + --tw-gradient-from: color-mix(in oklab, var(--color-emerald-100) 40%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); +} + +.mcrm-block.block__warning { + background-color: color-mix(in oklab, var(--color-orange-300) 40%, transparent); +} + +.mcrm-block.block__warning:before { + --tw-gradient-from: color-mix(in oklab, var(--color-orange-100) 40%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); +} + +.mcrm-block.block__danger { + background-color: color-mix(in oklab, var(--color-rose-300) 40%, transparent); +} + +.mcrm-block.block__danger:before { + --tw-gradient-from: color-mix(in oklab, var(--color-rose-100) 40%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); +} + +.mcrm-block.block-spacing__sm, .mcrm-block.block-size__sm { + column-gap: calc(var(--spacing) * 4); + row-gap: calc(var(--spacing) * 2); + padding: calc(var(--spacing) * 4); +} + +.mcrm-block.block-size__sm, .mcrm-block.block-size__sm:before { + border-radius: var(--radius-lg); +} + +.mcrm-block.block-spacing__lg, .mcrm-block.block-size__lg { + column-gap: calc(var(--spacing) * 8); + row-gap: calc(var(--spacing) * 4); + padding: calc(var(--spacing) * 8); +} + +.mcrm-block.block-size__lg, .mcrm-block.block-size__lg:before { + border-radius: var(--radius-3xl); +} + +.panel { + top: calc(var(--spacing) * 2); + right: calc(var(--spacing) * 4); + bottom: calc(var(--spacing) * 2); + left: calc(var(--spacing) * 4); + grid-template-rows: auto 1fr; + display: grid; + position: fixed; + overflow: hidden; +} + +@media (width >= 40rem) { + .panel { + right: calc(var(--spacing) * 16); + left: calc(var(--spacing) * 16); + } +} + +.panel > .panel__header, .panel > .panel__title { + padding-inline: calc(var(--spacing) * 4); + padding-block: calc(var(--spacing) * 2); +} + +.panel .panel__title { + --tw-gradient-position: to right in oklab; + background-image: linear-gradient(var(--tw-gradient-stops)); + --tw-gradient-from: var(--color-amber-300); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); + --tw-gradient-to: color-mix(in oklab, var(--color-white) 50%, transparent); + width: fit-content; + padding-top: calc(var(--spacing) * 3); + padding-left: calc(var(--spacing) * 16); + color: #0000; + -webkit-background-clip: text; + background-clip: text; +} + +@media (width >= 40rem) { + .panel .panel__title { + padding-left: calc(var(--spacing) * 4); + } +} + +.panel .panel__content { + height: 100%; + padding-top: calc(var(--spacing) * 4); + padding-left: calc(var(--spacing) * 0); + display: grid; + overflow: auto; +} + +@media (width >= 40rem) { + .panel .panel__content { + padding-top: calc(var(--spacing) * 0); + padding-left: calc(var(--spacing) * 4); + } +} + +@layer theme { + :root, :host { + --font-sans: "Roboto", sans-serif; + --font-mono: "Fira Code", monospace; + --color-red-500: oklch(.637 .237 25.331); + --color-orange-100: oklch(.954 .038 75.164); + --color-orange-300: oklch(.837 .128 66.29); + --color-amber-100: oklch(.962 .059 95.617); + --color-amber-300: oklch(.879 .169 91.605); + --color-amber-400: oklch(.828 .189 84.429); + --color-yellow-300: oklch(.905 .182 98.111); + --color-yellow-500: oklch(.795 .184 86.047); + --color-yellow-600: oklch(.681 .162 75.834); + --color-lime-100: oklch(.967 .067 122.328); + --color-lime-200: oklch(.938 .127 124.321); + --color-lime-400: oklch(.841 .238 128.85); + --color-lime-500: oklch(.768 .233 130.85); + --color-lime-600: oklch(.648 .2 131.684); + --color-lime-700: oklch(.532 .157 131.589); + --color-emerald-100: oklch(.95 .052 163.051); + --color-emerald-300: oklch(.845 .143 164.978); + --color-sky-100: oklch(.951 .026 236.824); + --color-sky-200: oklch(.901 .058 230.902); + --color-sky-300: oklch(.828 .111 230.318); + --color-sky-400: oklch(.746 .16 232.661); + --color-sky-500: oklch(.685 .169 237.323); + --color-sky-600: oklch(.588 .158 241.966); + --color-sky-700: oklch(.5 .134 242.749); + --color-sky-900: oklch(.391 .09 240.876); + --color-rose-100: oklch(.941 .03 12.58); + --color-rose-200: oklch(.892 .058 10.001); + --color-rose-300: oklch(.81 .117 11.638); + --color-rose-400: oklch(.712 .194 13.428); + --color-rose-500: oklch(.645 .246 16.439); + --color-slate-50: oklch(.984 .003 247.858); + --color-slate-100: oklch(.968 .007 247.896); + --color-slate-200: oklch(.929 .013 255.508); + --color-slate-300: oklch(.869 .022 252.894); + --color-slate-400: oklch(.704 .04 256.788); + --color-slate-500: oklch(.554 .046 257.417); + --color-slate-600: oklch(.446 .043 257.281); + --color-slate-700: oklch(.372 .044 257.287); + --color-slate-800: oklch(.279 .041 260.031); + --color-slate-900: oklch(.208 .042 265.755); + --color-slate-950: oklch(.129 .042 264.695); + --color-gray-300: oklch(.872 .01 258.338); + --color-black: #000; + --color-white: #fff; + --spacing: .25rem; + --text-xs: .75rem; + --text-xs--line-height: calc(1 / .75); + --text-sm: .875rem; + --text-sm--line-height: calc(1.25 / .875); + --text-lg: 1.125rem; + --text-lg--line-height: calc(1.75 / 1.125); + --text-xl: 1.25rem; + --text-xl--line-height: calc(1.75 / 1.25); + --text-2xl: 1.5rem; + --text-2xl--line-height: calc(2 / 1.5); + --text-3xl: 1.875rem; + --text-3xl--line-height: calc(2.25 / 1.875); + --text-4xl: 2.25rem; + --text-4xl--line-height: calc(2.5 / 2.25); + --font-weight-light: 300; + --font-weight-normal: 400; + --font-weight-semibold: 600; + --font-weight-bold: 700; + --tracking-wide: .025em; + --tracking-widest: .1em; + --radius-sm: .25rem; + --radius-md: .375rem; + --radius-lg: .5rem; + --radius-xl: .75rem; + --radius-2xl: 1rem; + --radius-3xl: 1.5rem; + --ease-in-out: cubic-bezier(.4, 0, .2, 1); + --animate-spin: spin 1s linear infinite; + --blur-xs: 4px; + --blur-md: 12px; + --blur-lg: 16px; + --blur-3xl: 64px; + --default-transition-duration: .15s; + --default-transition-timing-function: cubic-bezier(.4, 0, .2, 1); + --default-font-family: var(--font-sans); + --default-font-feature-settings: var(--font-sans--font-feature-settings); + --default-font-variation-settings: var(--font-sans--font-variation-settings); + --default-mono-font-family: var(--font-mono); + --default-mono-font-feature-settings: var(--font-mono--font-feature-settings); + --default-mono-font-variation-settings: var(--font-mono--font-variation-settings); + } +} + +@layer base { + *, :after, :before, ::backdrop { + box-sizing: border-box; + border: 0 solid; + margin: 0; + padding: 0; + } + + ::file-selector-button { + box-sizing: border-box; + border: 0 solid; + margin: 0; + padding: 0; + } + + html, :host { + -webkit-text-size-adjust: 100%; + tab-size: 4; + line-height: 1.5; + font-family: var(--default-font-family, ui-sans-serif, system-ui, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"); + font-feature-settings: var(--default-font-feature-settings, normal); + font-variation-settings: var(--default-font-variation-settings, normal); + -webkit-tap-highlight-color: transparent; + } + + body { + line-height: inherit; + } + + hr { + height: 0; + color: inherit; + border-top-width: 1px; + } + + abbr:where([title]) { + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; + } + + h1, h2, h3, h4, h5, h6 { + font-size: inherit; + font-weight: inherit; + } + + a { + color: inherit; + -webkit-text-decoration: inherit; + -webkit-text-decoration: inherit; + -webkit-text-decoration: inherit; + text-decoration: inherit; + } + + b, strong { + font-weight: bolder; + } + + code, kbd, samp, pre { + font-family: var(--default-mono-font-family, ui-monospace, SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace); + font-feature-settings: var(--default-mono-font-feature-settings, normal); + font-variation-settings: var(--default-mono-font-variation-settings, normal); + font-size: 1em; + } + + small { + font-size: 80%; + } + + sub, sup { + vertical-align: baseline; + font-size: 75%; + line-height: 0; + position: relative; + } + + sub { + bottom: -.25em; + } + + sup { + top: -.5em; + } + + table { + text-indent: 0; + border-color: inherit; + border-collapse: collapse; + } + + :-moz-focusring { + outline: auto; + } + + progress { + vertical-align: baseline; + } + + summary { + display: list-item; + } + + ol, ul, menu { + list-style: none; + } + + img, svg, video, canvas, audio, iframe, embed, object { + vertical-align: middle; + display: block; + } + + img, video { + max-width: 100%; + height: auto; + } + + button, input, select, optgroup, textarea { + font: inherit; + font-feature-settings: inherit; + font-variation-settings: inherit; + letter-spacing: inherit; + color: inherit; + opacity: 1; + background-color: #0000; + border-radius: 0; + } + + ::file-selector-button { + font: inherit; + font-feature-settings: inherit; + font-variation-settings: inherit; + letter-spacing: inherit; + color: inherit; + opacity: 1; + background-color: #0000; + border-radius: 0; + } + + :where(select:is([multiple], [size])) optgroup { + font-weight: bolder; + } + + :where(select:is([multiple], [size])) optgroup option { + padding-inline-start: 20px; + } + + ::file-selector-button { + margin-inline-end: 4px; + } + + ::placeholder { + opacity: 1; + color: color-mix(in oklab, currentColor 50%, transparent); + } + + textarea { + resize: vertical; + } + + ::-webkit-search-decoration { + -webkit-appearance: none; + } + + ::-webkit-date-and-time-value { + min-height: 1lh; + text-align: inherit; + } + + ::-webkit-datetime-edit { + display: inline-flex; + } + + ::-webkit-datetime-edit-fields-wrapper { + padding: 0; + } + + ::-webkit-datetime-edit { + padding-block: 0; + } + + ::-webkit-datetime-edit-year-field { + padding-block: 0; + } + + ::-webkit-datetime-edit-month-field { + padding-block: 0; + } + + ::-webkit-datetime-edit-day-field { + padding-block: 0; + } + + ::-webkit-datetime-edit-hour-field { + padding-block: 0; + } + + ::-webkit-datetime-edit-minute-field { + padding-block: 0; + } + + ::-webkit-datetime-edit-second-field { + padding-block: 0; + } + + ::-webkit-datetime-edit-millisecond-field { + padding-block: 0; + } + + ::-webkit-datetime-edit-meridiem-field { + padding-block: 0; + } + + :-moz-ui-invalid { + box-shadow: none; + } + + button, input:where([type="button"], [type="reset"], [type="submit"]) { + appearance: button; + } + + ::file-selector-button { + appearance: button; + } + + ::-webkit-inner-spin-button { + height: auto; + } + + ::-webkit-outer-spin-button { + height: auto; + } + + [hidden]:where(:not([hidden="until-found"])) { + display: none !important; + } +} + +@layer components; + +@layer utilities { + .pointer-events-auto { + pointer-events: auto; + } + + .pointer-events-none { + pointer-events: none; + } + + .absolute { + position: absolute; + } + + .fixed { + position: fixed; + } + + .relative { + position: relative; + } + + .inset-0 { + inset: calc(var(--spacing) * 0); + } + + .inset-1\/2 { + inset: 50%; + } + + .top-0 { + top: calc(var(--spacing) * 0); + } + + .top-1\/2 { + top: 50%; + } + + .top-4 { + top: calc(var(--spacing) * 4); + } + + .top-20 { + top: calc(var(--spacing) * 20); + } + + .top-\[10\%\] { + top: 10%; + } + + .top-full { + top: 100%; + } + + .right-4 { + right: calc(var(--spacing) * 4); + } + + .left-0 { + left: calc(var(--spacing) * 0); + } + + .left-1\/2 { + left: 50%; + } + + .left-4 { + left: calc(var(--spacing) * 4); + } + + .left-\[10\%\] { + left: 10%; + } + + .left-full { + left: 100%; + } + + .z-50 { + z-index: 50; + } + + .z-\[-1\] { + z-index: -1; + } + + .container { + width: 100%; + } + + @media (width >= 40rem) { + .container { + max-width: 40rem; + } + } + + @media (width >= 48rem) { + .container { + max-width: 48rem; + } + } + + @media (width >= 64rem) { + .container { + max-width: 64rem; + } + } + + @media (width >= 80rem) { + .container { + max-width: 80rem; + } + } + + @media (width >= 96rem) { + .container { + max-width: 96rem; + } + } + + .mt-1 { + margin-top: calc(var(--spacing) * 1); + } + + .mt-2 { + margin-top: calc(var(--spacing) * 2); + } + + .mt-4 { + margin-top: calc(var(--spacing) * 4); + } + + .mt-6 { + margin-top: calc(var(--spacing) * 6); + } + + .mb-4 { + margin-bottom: calc(var(--spacing) * 4); + } + + .block { + display: block; + } + + .flex { + display: flex; + } + + .grid { + display: grid; + } + + .hidden { + display: none; + } + + .aspect-square { + aspect-ratio: 1; + } + + .size-0 { + width: calc(var(--spacing) * 0); + height: calc(var(--spacing) * 0); + } + + .size-4 { + width: calc(var(--spacing) * 4); + height: calc(var(--spacing) * 4); + } + + .size-5 { + width: calc(var(--spacing) * 5); + height: calc(var(--spacing) * 5); + } + + .size-6 { + width: calc(var(--spacing) * 6); + height: calc(var(--spacing) * 6); + } + + .size-12 { + width: calc(var(--spacing) * 12); + height: calc(var(--spacing) * 12); + } + + .size-full { + width: 100%; + height: 100%; + } + + .h-9 { + height: calc(var(--spacing) * 9); + } + + .h-fit { + height: fit-content; + } + + .h-full { + height: 100%; + } + + .w-44 { + width: calc(var(--spacing) * 44); + } + + .w-64 { + width: calc(var(--spacing) * 64); + } + + .w-96 { + width: calc(var(--spacing) * 96); + } + + .w-fit { + width: fit-content; + } + + .w-full { + width: 100%; + } + + .w-px { + width: 1px; + } + + .max-w-\[calc\(100vw-2rem\)\] { + max-width: calc(100vw - 2rem); + } + + .min-w-full { + min-width: 100%; + } + + .flex-grow { + flex-grow: 1; + } + + .-translate-1\/2 { + --tw-translate-x: calc(calc(1 / 2 * 100%) * -1); + --tw-translate-y: calc(calc(1 / 2 * 100%) * -1); + translate: var(--tw-translate-x) var(--tw-translate-y); + } + + .-translate-x-1\/2 { + --tw-translate-x: calc(calc(1 / 2 * 100%) * -1); + translate: var(--tw-translate-x) var(--tw-translate-y); + } + + .-translate-x-full { + --tw-translate-x: -100%; + translate: var(--tw-translate-x) var(--tw-translate-y); + } + + .translate-x-0 { + --tw-translate-x: calc(var(--spacing) * 0); + translate: var(--tw-translate-x) var(--tw-translate-y); + } + + .-translate-y-1\/2 { + --tw-translate-y: calc(calc(1 / 2 * 100%) * -1); + translate: var(--tw-translate-x) var(--tw-translate-y); + } + + .-translate-y-full { + --tw-translate-y: -100%; + translate: var(--tw-translate-x) var(--tw-translate-y); + } + + .translate-y-0 { + --tw-translate-y: calc(var(--spacing) * 0); + translate: var(--tw-translate-x) var(--tw-translate-y); + } + + .scale-\[1\.8\] { + scale: 1.8; + } + + .animate-spin { + animation: var(--animate-spin); + } + + .cursor-default { + cursor: default; + } + + .cursor-not-allowed { + cursor: not-allowed; + } + + .cursor-pointer { + cursor: pointer; + } + + .list-none { + list-style-type: none; + } + + .grid-cols-\[1rem_1fr\] { + grid-template-columns: 1rem 1fr; + } + + .grid-cols-\[2rem_1fr\] { + grid-template-columns: 2rem 1fr; + } + + .grid-cols-\[25ch_1fr\] { + grid-template-columns: 25ch 1fr; + } + + .grid-cols-\[auto_1fr\] { + grid-template-columns: auto 1fr; + } + + .grid-cols-\[auto_1fr_auto\] { + grid-template-columns: auto 1fr auto; + } + + .grid-rows-\[0fr\] { + grid-template-rows: 0fr; + } + + .grid-rows-\[auto_1fr\] { + grid-template-rows: auto 1fr; + } + + .grid-rows-\[auto_1fr_auto\] { + grid-template-rows: auto 1fr auto; + } + + .flex-row-reverse { + flex-direction: row-reverse; + } + + .flex-wrap { + flex-wrap: wrap; + } + + .content-start { + align-content: flex-start; + } + + .items-center { + align-items: center; + } + + .items-end { + align-items: flex-end; + } + + .items-start { + align-items: flex-start; + } + + .justify-between { + justify-content: space-between; + } + + .justify-center { + justify-content: center; + } + + .justify-end { + justify-content: flex-end; + } + + .\!gap-4 { + gap: calc(var(--spacing) * 4) !important; + } + + .gap-1 { + gap: calc(var(--spacing) * 1); + } + + .gap-2 { + gap: calc(var(--spacing) * 2); + } + + .gap-3 { + gap: calc(var(--spacing) * 3); + } + + .gap-4 { + gap: calc(var(--spacing) * 4); + } + + .gap-6 { + gap: calc(var(--spacing) * 6); + } + + .gap-8 { + gap: calc(var(--spacing) * 8); + } + + .gap-y-4 { + row-gap: calc(var(--spacing) * 4); + } + + :where(.divide-y > :not(:last-child)) { + --tw-divide-y-reverse: 0; + border-bottom-style: var(--tw-border-style); + border-top-style: var(--tw-border-style); + border-top-width: calc(1px * var(--tw-divide-y-reverse)); + border-bottom-width: calc(1px * calc(1 - var(--tw-divide-y-reverse))); + } + + :where(.divide-slate-300 > :not(:last-child)) { + border-color: var(--color-slate-300); + } + + :where(.divide-slate-600 > :not(:last-child)) { + border-color: var(--color-slate-600); + } + + .truncate { + text-overflow: ellipsis; + white-space: nowrap; + overflow: hidden; + } + + .overflow-auto { + overflow: auto; + } + + .overflow-hidden { + overflow: hidden; + } + + .rounded-full { + border-radius: 3.40282e38px; + } + + .rounded-lg { + border-radius: var(--radius-lg); + } + + .rounded-md { + border-radius: var(--radius-md); + } + + .rounded-none { + border-radius: 0; + } + + .rounded-sm { + border-radius: var(--radius-sm); + } + + .rounded-xl { + border-radius: var(--radius-xl); + } + + .border { + border-style: var(--tw-border-style); + border-width: 1px; + } + + .border-0 { + border-style: var(--tw-border-style); + border-width: 0; + } + + .border-b-2 { + border-bottom-style: var(--tw-border-style); + border-bottom-width: 2px; + } + + .border-solid { + --tw-border-style: solid; + border-style: solid; + } + + .border-amber-100 { + border-color: var(--color-amber-100); + } + + .border-amber-300\/80 { + border-color: color-mix(in oklab, var(--color-amber-300) 80%, transparent); + } + + .border-amber-400 { + border-color: var(--color-amber-400); + } + + .border-lime-100 { + border-color: var(--color-lime-100); + } + + .border-lime-500 { + border-color: var(--color-lime-500); + } + + .border-lime-600 { + border-color: var(--color-lime-600); + } + + .border-rose-100 { + border-color: var(--color-rose-100); + } + + .border-rose-300 { + border-color: var(--color-rose-300); + } + + .border-rose-500 { + border-color: var(--color-rose-500); + } + + .border-sky-100 { + border-color: var(--color-sky-100); + } + + .border-sky-300 { + border-color: var(--color-sky-300); + } + + .border-sky-400 { + border-color: var(--color-sky-400); + } + + .border-slate-200 { + border-color: var(--color-slate-200); + } + + .border-slate-400 { + border-color: var(--color-slate-400); + } + + .border-slate-500 { + border-color: var(--color-slate-500); + } + + .border-slate-600 { + border-color: var(--color-slate-600); + } + + .border-transparent { + border-color: #0000; + } + + .border-white\/10 { + border-color: color-mix(in oklab, var(--color-white) 10%, transparent); + } + + .border-white\/40 { + border-color: color-mix(in oklab, var(--color-white) 40%, transparent); + } + + .border-white\/50 { + border-color: color-mix(in oklab, var(--color-white) 50%, transparent); + } + + .border-yellow-300 { + border-color: var(--color-yellow-300); + } + + .border-b-slate-300 { + border-bottom-color: var(--color-slate-300); + } + + .bg-amber-100\/10 { + background-color: color-mix(in oklab, var(--color-amber-100) 10%, transparent); + } + + .bg-amber-100\/60 { + background-color: color-mix(in oklab, var(--color-amber-100) 60%, transparent); + } + + .bg-amber-400\/10 { + background-color: color-mix(in oklab, var(--color-amber-400) 10%, transparent); + } + + .bg-amber-400\/40 { + background-color: color-mix(in oklab, var(--color-amber-400) 40%, transparent); + } + + .bg-black\/50 { + background-color: color-mix(in oklab, var(--color-black) 50%, transparent); + } + + .bg-lime-200\/10 { + background-color: color-mix(in oklab, var(--color-lime-200) 10%, transparent); + } + + .bg-lime-400\/10 { + background-color: color-mix(in oklab, var(--color-lime-400) 10%, transparent); + } + + .bg-lime-400\/40 { + background-color: color-mix(in oklab, var(--color-lime-400) 40%, transparent); + } + + .bg-lime-500\/80 { + background-color: color-mix(in oklab, var(--color-lime-500) 80%, transparent); + } + + .bg-lime-700 { + background-color: var(--color-lime-700); + } + + .bg-rose-200\/20 { + background-color: color-mix(in oklab, var(--color-rose-200) 20%, transparent); + } + + .bg-rose-400\/10 { + background-color: color-mix(in oklab, var(--color-rose-400) 10%, transparent); + } + + .bg-rose-400\/40 { + background-color: color-mix(in oklab, var(--color-rose-400) 40%, transparent); + } + + .bg-sky-100\/10 { + background-color: color-mix(in oklab, var(--color-sky-100) 10%, transparent); + } + + .bg-sky-200\/20 { + background-color: color-mix(in oklab, var(--color-sky-200) 20%, transparent); + } + + .bg-sky-400\/40 { + background-color: color-mix(in oklab, var(--color-sky-400) 40%, transparent); + } + + .bg-sky-400\/50 { + background-color: color-mix(in oklab, var(--color-sky-400) 50%, transparent); + } + + .bg-sky-500 { + background-color: var(--color-sky-500); + } + + .bg-sky-900 { + background-color: var(--color-sky-900); + } + + .bg-sky-900\/10 { + background-color: color-mix(in oklab, var(--color-sky-900) 10%, transparent); + } + + .bg-slate-100\/60 { + background-color: color-mix(in oklab, var(--color-slate-100) 60%, transparent); + } + + .bg-slate-200\/10 { + background-color: color-mix(in oklab, var(--color-slate-200) 10%, transparent); + } + + .bg-slate-400\/40 { + background-color: color-mix(in oklab, var(--color-slate-400) 40%, transparent); + } + + .bg-slate-500 { + background-color: var(--color-slate-500); + } + + .bg-slate-600 { + background-color: var(--color-slate-600); + } + + .bg-slate-700 { + background-color: var(--color-slate-700); + } + + .bg-slate-700\/80 { + background-color: color-mix(in oklab, var(--color-slate-700) 80%, transparent); + } + + .bg-slate-950\/50 { + background-color: color-mix(in oklab, var(--color-slate-950) 50%, transparent); + } + + .bg-transparent { + background-color: #0000; + } + + .bg-white\/10 { + background-color: color-mix(in oklab, var(--color-white) 10%, transparent); + } + + .bg-white\/20 { + background-color: color-mix(in oklab, var(--color-white) 20%, transparent); + } + + .bg-yellow-500\/50 { + background-color: color-mix(in oklab, var(--color-yellow-500) 50%, transparent); + } + + .to-white\/30 { + --tw-gradient-to: color-mix(in oklab, var(--color-white) 30%, transparent); + --tw-gradient-stops: var(--tw-gradient-via-stops, var(--tw-gradient-position), var(--tw-gradient-from) var(--tw-gradient-from-position), var(--tw-gradient-to) var(--tw-gradient-to-position)); + } + + .\!stroke-white { + stroke: var(--color-white) !important; + } + + .stroke-amber-300 { + stroke: var(--color-amber-300); + } + + .stroke-lime-400 { + stroke: var(--color-lime-400); + } + + .stroke-rose-400 { + stroke: var(--color-rose-400); + } + + .stroke-sky-200 { + stroke: var(--color-sky-200); + } + + .stroke-slate-300 { + stroke: var(--color-slate-300); + } + + .object-cover { + object-fit: cover; + } + + .\!p-0 { + padding: calc(var(--spacing) * 0) !important; + } + + .p-0 { + padding: calc(var(--spacing) * 0); + } + + .p-1 { + padding: calc(var(--spacing) * 1); + } + + .p-2 { + padding: calc(var(--spacing) * 2); + } + + .p-4 { + padding: calc(var(--spacing) * 4); + } + + .p-28 { + padding: calc(var(--spacing) * 28); + } + + .px-2 { + padding-inline: calc(var(--spacing) * 2); + } + + .px-4 { + padding-inline: calc(var(--spacing) * 4); + } + + .py-0 { + padding-block: calc(var(--spacing) * 0); + } + + .py-1 { + padding-block: calc(var(--spacing) * 1); + } + + .py-2 { + padding-block: calc(var(--spacing) * 2); + } + + .pt-2 { + padding-top: calc(var(--spacing) * 2); + } + + .pr-2 { + padding-right: calc(var(--spacing) * 2); + } + + .pr-3 { + padding-right: calc(var(--spacing) * 3); + } + + .pr-8 { + padding-right: calc(var(--spacing) * 8); + } + + .pl-1 { + padding-left: calc(var(--spacing) * 1); + } + + .pl-2 { + padding-left: calc(var(--spacing) * 2); + } + + .pl-3 { + padding-left: calc(var(--spacing) * 3); + } + + .pl-4 { + padding-left: calc(var(--spacing) * 4); + } + + .text-center { + text-align: center; + } + + .font-mono { + font-family: var(--font-mono); + } + + .font-sans { + font-family: var(--font-sans); + } + + .\!text-lg { + font-size: var(--text-lg) !important; + line-height: var(--tw-leading, var(--text-lg--line-height)) !important; + } + + .text-4xl { + font-size: var(--text-4xl); + line-height: var(--tw-leading, var(--text-4xl--line-height)); + } + + .text-lg { + font-size: var(--text-lg); + line-height: var(--tw-leading, var(--text-lg--line-height)); + } + + .text-sm { + font-size: var(--text-sm); + line-height: var(--tw-leading, var(--text-sm--line-height)); + } + + .text-xs { + font-size: var(--text-xs); + line-height: var(--tw-leading, var(--text-xs--line-height)); + } + + .font-bold { + --tw-font-weight: var(--font-weight-bold); + font-weight: var(--font-weight-bold); + } + + .font-light { + --tw-font-weight: var(--font-weight-light); + font-weight: var(--font-weight-light); + } + + .font-normal { + --tw-font-weight: var(--font-weight-normal); + font-weight: var(--font-weight-normal); + } + + .font-semibold { + --tw-font-weight: var(--font-weight-semibold); + font-weight: var(--font-weight-semibold); + } + + .tracking-wide { + --tw-tracking: var(--tracking-wide); + letter-spacing: var(--tracking-wide); + } + + .tracking-widest { + --tw-tracking: var(--tracking-widest); + letter-spacing: var(--tracking-widest); + } + + .whitespace-nowrap { + white-space: nowrap; + } + + .\!text-white { + color: var(--color-white) !important; + } + + .text-amber-100 { + color: var(--color-amber-100); + } + + .text-amber-400 { + color: var(--color-amber-400); + } + + .text-lime-100 { + color: var(--color-lime-100); + } + + .text-lime-200 { + color: var(--color-lime-200); + } + + .text-lime-400 { + color: var(--color-lime-400); + } + + .text-red-500 { + color: var(--color-red-500); + } + + .text-rose-200 { + color: var(--color-rose-200); + } + + .text-rose-400 { + color: var(--color-rose-400); + } + + .text-sky-100 { + color: var(--color-sky-100); + } + + .text-sky-300 { + color: var(--color-sky-300); + } + + .text-slate-50 { + color: var(--color-slate-50); + } + + .text-slate-100 { + color: var(--color-slate-100); + } + + .text-slate-200 { + color: var(--color-slate-200); + } + + .text-slate-300 { + color: var(--color-slate-300); + } + + .text-slate-800 { + color: var(--color-slate-800); + } + + .text-slate-950 { + color: var(--color-slate-950); + } + + .text-white { + color: var(--color-white); + } + + .text-white\/40 { + color: color-mix(in oklab, var(--color-white) 40%, transparent); + } + + .text-white\/80 { + color: color-mix(in oklab, var(--color-white) 80%, transparent); + } + + .uppercase { + text-transform: uppercase; + } + + .not-italic { + font-style: normal; + } + + .opacity-0 { + opacity: 0; + } + + .opacity-35 { + opacity: .35; + } + + .opacity-40 { + opacity: .4; + } + + .opacity-50 { + opacity: .5; + } + + .opacity-80 { + opacity: .8; + } + + .opacity-100 { + opacity: 1; + } + + .mix-blend-overlay { + mix-blend-mode: overlay; + } + + .shadow-md { + --tw-shadow: 0 4px 6px -1px var(--tw-shadow-color, #0000001a), 0 2px 4px -2px var(--tw-shadow-color, #0000001a); + box-shadow: var(--tw-inset-shadow), var(--tw-inset-ring-shadow), var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow); + } + + .ring-2 { + --tw-ring-shadow: var(--tw-ring-inset, ) 0 0 0 calc(2px + var(--tw-ring-offset-width)) var(--tw-ring-color, currentColor); + box-shadow: var(--tw-inset-shadow), var(--tw-inset-ring-shadow), var(--tw-ring-offset-shadow), var(--tw-ring-shadow), var(--tw-shadow); + } + + .shadow-black { + --tw-shadow-color: var(--color-black); + } + + .shadow-sky-600 { + --tw-shadow-color: var(--color-sky-600); + } + + .shadow-sky-700 { + --tw-shadow-color: var(--color-sky-700); + } + + .shadow-slate-500 { + --tw-shadow-color: var(--color-slate-500); + } + + .shadow-yellow-600 { + --tw-shadow-color: var(--color-yellow-600); + } + + .ring-sky-500 { + --tw-ring-color: var(--color-sky-500); + } + + .ring-offset-1 { + --tw-ring-offset-width: 1px; + --tw-ring-offset-shadow: var(--tw-ring-inset, ) 0 0 0 var(--tw-ring-offset-width) var(--tw-ring-offset-color); + } + + .outline-0 { + outline-style: var(--tw-outline-style); + outline-width: 0; + } + + .filter { + filter: var(--tw-blur, ) var(--tw-brightness, ) var(--tw-contrast, ) var(--tw-grayscale, ) var(--tw-hue-rotate, ) var(--tw-invert, ) var(--tw-saturate, ) var(--tw-sepia, ) var(--tw-drop-shadow, ); + } + + .backdrop-blur-3xl { + --tw-backdrop-blur: blur(var(--blur-3xl)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + } + + .backdrop-blur-md { + --tw-backdrop-blur: blur(var(--blur-md)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + } + + .backdrop-blur-xs { + --tw-backdrop-blur: blur(var(--blur-xs)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + } + + .transition { + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to, opacity, box-shadow, transform, translate, scale, rotate, filter, -webkit-backdrop-filter, backdrop-filter; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function)); + transition-duration: var(--tw-duration, var(--default-transition-duration)); + } + + .transition-\[grid-template-rows\] { + transition-property: grid-template-rows; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function)); + transition-duration: var(--tw-duration, var(--default-transition-duration)); + } + + .transition-\[stroke\] { + transition-property: stroke; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function)); + transition-duration: var(--tw-duration, var(--default-transition-duration)); + } + + .transition-all { + transition-property: all; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function)); + transition-duration: var(--tw-duration, var(--default-transition-duration)); + } + + .transition-colors { + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function)); + transition-duration: var(--tw-duration, var(--default-transition-duration)); + } + + .transition-opacity { + transition-property: opacity; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function)); + transition-duration: var(--tw-duration, var(--default-transition-duration)); + } + + .transition-transform { + transition-property: transform, translate, scale, rotate; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function)); + transition-duration: var(--tw-duration, var(--default-transition-duration)); + } + + .duration-300 { + --tw-duration: .3s; + transition-duration: .3s; + } + + .duration-400 { + --tw-duration: .4s; + transition-duration: .4s; + } + + .ease-in-out { + --tw-ease: var(--ease-in-out); + transition-timing-function: var(--ease-in-out); + } + + .content-\[\'\'\] { + --tw-content: ""; + content: var(--tw-content); + } + + @media (hover: hover) { + .hover\:bg-black\/10:hover { + background-color: color-mix(in oklab, var(--color-black) 10%, transparent); + } + + .hover\:bg-lime-500:hover { + background-color: var(--color-lime-500); + } + + .hover\:bg-slate-700:hover { + background-color: var(--color-slate-700); + } + + .hover\:bg-white\/10:hover { + background-color: color-mix(in oklab, var(--color-white) 10%, transparent); + } + + .hover\:bg-white\/40:hover { + background-color: color-mix(in oklab, var(--color-white) 40%, transparent); + } + + .hover\:text-white:hover { + color: var(--color-white); + } + } + + .focus\:border-transparent:focus { + border-color: #0000; + } + + .focus\:border-b-sky-400:focus { + border-bottom-color: var(--color-sky-400); + } + + .focus\:bg-sky-400\/10:focus { + background-color: color-mix(in oklab, var(--color-sky-400) 10%, transparent); + } +} + +body { + background-color: var(--color-slate-900); + font-family: var(--font-sans); + --tw-font-weight: var(--font-weight-light); + font-weight: var(--font-weight-light); + --tw-tracking: var(--tracking-wide); + letter-spacing: var(--tracking-wide); + color: var(--color-slate-50); +} + +h1, h2 { + font-family: var(--font-mono); + --tw-font-weight: var(--font-weight-bold); + font-weight: var(--font-weight-bold); +} + +h3, h4, h5, h6 { + --tw-font-weight: var(--font-weight-semibold); + font-weight: var(--font-weight-semibold); +} + +h1 { + font-size: var(--text-4xl); + line-height: var(--tw-leading, var(--text-4xl--line-height)); +} + +h2 { + font-size: var(--text-3xl); + line-height: var(--tw-leading, var(--text-3xl--line-height)); +} + +h3 { + font-size: var(--text-2xl); + line-height: var(--tw-leading, var(--text-2xl--line-height)); +} + +h4 { + font-size: var(--text-xl); + line-height: var(--tw-leading, var(--text-xl--line-height)); +} + +h5 { + font-size: var(--text-lg); + line-height: var(--tw-leading, var(--text-lg--line-height)); +} + +input { + border-radius: var(--radius-md); + border-style: var(--tw-border-style); + border-width: 1px; + border-color: var(--color-slate-400); + background-color: color-mix(in oklab, var(--color-black) 20%, transparent); + width: 100%; + padding-inline: calc(var(--spacing) * 2); + padding-block: calc(var(--spacing) * 1); + color: var(--color-white); +} + +:has( > input + span) { + display: flex; +} + +:has( > input + span) input { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +:has( > input + span) span { + border-top-right-radius: var(--radius-md); + border-bottom-right-radius: var(--radius-md); + background-color: var(--color-slate-400); + padding-inline: calc(var(--spacing) * 2); + color: var(--color-white); + align-items: center; + display: flex; +} + +ul { + list-style-type: disc; + list-style-position: inside; +} + +strong { + --tw-font-weight: var(--font-weight-bold); + font-weight: var(--font-weight-bold); +} + +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} + +@property --tw-translate-x { + syntax: "*"; + inherits: false; + initial-value: 0; +} + +@property --tw-translate-y { + syntax: "*"; + inherits: false; + initial-value: 0; +} + +@property --tw-translate-z { + syntax: "*"; + inherits: false; + initial-value: 0; +} + +@property --tw-content { + syntax: "*"; + inherits: false; + initial-value: ""; +} + +@property --tw-backdrop-blur { + syntax: "*"; + inherits: false +} + +@property --tw-backdrop-brightness { + syntax: "*"; + inherits: false +} + +@property --tw-backdrop-contrast { + syntax: "*"; + inherits: false +} + +@property --tw-backdrop-grayscale { + syntax: "*"; + inherits: false +} + +@property --tw-backdrop-hue-rotate { + syntax: "*"; + inherits: false +} + +@property --tw-backdrop-invert { + syntax: "*"; + inherits: false +} + +@property --tw-backdrop-opacity { + syntax: "*"; + inherits: false +} + +@property --tw-backdrop-saturate { + syntax: "*"; + inherits: false +} + +@property --tw-backdrop-sepia { + syntax: "*"; + inherits: false +} + +@property --tw-gradient-position { + syntax: "*"; + inherits: false +} + +@property --tw-gradient-from { + syntax: ""; + inherits: false; + initial-value: #0000; +} + +@property --tw-gradient-via { + syntax: ""; + inherits: false; + initial-value: #0000; +} + +@property --tw-gradient-to { + syntax: ""; + inherits: false; + initial-value: #0000; +} + +@property --tw-gradient-stops { + syntax: "*"; + inherits: false +} + +@property --tw-gradient-via-stops { + syntax: "*"; + inherits: false +} + +@property --tw-gradient-from-position { + syntax: ""; + inherits: false; + initial-value: 0%; +} + +@property --tw-gradient-via-position { + syntax: ""; + inherits: false; + initial-value: 50%; +} + +@property --tw-gradient-to-position { + syntax: ""; + inherits: false; + initial-value: 100%; +} + +@property --tw-divide-y-reverse { + syntax: "*"; + inherits: false; + initial-value: 0; +} + +@property --tw-font-weight { + syntax: "*"; + inherits: false +} + +@property --tw-tracking { + syntax: "*"; + inherits: false +} + +@property --tw-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} + +@property --tw-shadow-color { + syntax: "*"; + inherits: false +} + +@property --tw-inset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} + +@property --tw-inset-shadow-color { + syntax: "*"; + inherits: false +} + +@property --tw-ring-color { + syntax: "*"; + inherits: false +} + +@property --tw-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} + +@property --tw-inset-ring-color { + syntax: "*"; + inherits: false +} + +@property --tw-inset-ring-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} + +@property --tw-ring-inset { + syntax: "*"; + inherits: false +} + +@property --tw-ring-offset-width { + syntax: ""; + inherits: false; + initial-value: 0; +} + +@property --tw-ring-offset-color { + syntax: "*"; + inherits: false; + initial-value: #fff; +} + +@property --tw-ring-offset-shadow { + syntax: "*"; + inherits: false; + initial-value: 0 0 #0000; +} + +@property --tw-outline-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} + +@property --tw-blur { + syntax: "*"; + inherits: false +} + +@property --tw-brightness { + syntax: "*"; + inherits: false +} + +@property --tw-contrast { + syntax: "*"; + inherits: false +} + +@property --tw-grayscale { + syntax: "*"; + inherits: false +} + +@property --tw-hue-rotate { + syntax: "*"; + inherits: false +} + +@property --tw-invert { + syntax: "*"; + inherits: false +} + +@property --tw-opacity { + syntax: "*"; + inherits: false +} + +@property --tw-saturate { + syntax: "*"; + inherits: false +} + +@property --tw-sepia { + syntax: "*"; + inherits: false +} + +@property --tw-drop-shadow { + syntax: "*"; + inherits: false +} + +@property --tw-duration { + syntax: "*"; + inherits: false +} + +@property --tw-ease { + syntax: "*"; + inherits: false +} + +@keyframes spin { + to { + transform: rotate(360deg); + } +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +nav { + z-index: 50; + display: flex; + position: relative; +} +nav button { + top: calc(var(--spacing, .25rem) * 4); + left: calc(var(--spacing, .25rem) * 4); + aspect-ratio: 1; + width: calc(var(--spacing, .25rem) * 12); + height: calc(var(--spacing, .25rem) * 12); + cursor: pointer; + border-style: var(--tw-border-style); + background-color: color-mix(in oklab, var(--color-white, #fff) 20%, transparent); + --tw-backdrop-blur: blur(var(--blur-md, 12px)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + border-width: 0; + border-radius: 3.40282e38px; + position: absolute; +} +@media (hover: hover) { +nav button:hover { + background-color: color-mix(in oklab, var(--color-white, #fff) 40%, transparent); +} +} +nav button .logo, nav button svg { + --tw-translate-x: calc(calc(1 / 2 * 100%) * -1); + --tw-translate-y: calc(calc(1 / 2 * 100%) * -1); + translate: var(--tw-translate-x) var(--tw-translate-y); + transition-property: opacity; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + --tw-duration: .4s; + --tw-ease: var(--ease-in-out, cubic-bezier(.4, 0, .2, 1)); + transition-duration: .4s; + transition-timing-function: var(--ease-in-out, cubic-bezier(.4, 0, .2, 1)); + position: absolute; + inset: 50%; +} +nav button .logo { + width: 100%; +} +nav ul { + top: calc(var(--spacing, .25rem) * 20); + left: calc(var(--spacing, .25rem) * 0); + --tw-translate-x: -100%; + translate: var(--tw-translate-x) var(--tw-translate-y); + border-radius: var(--radius-xl, .75rem); + background-color: color-mix(in oklab, var(--color-white, #fff) 10%, transparent); + --tw-backdrop-blur: blur(var(--blur-md, 12px)); + -webkit-backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + backdrop-filter: var(--tw-backdrop-blur, ) var(--tw-backdrop-brightness, ) var(--tw-backdrop-contrast, ) var(--tw-backdrop-grayscale, ) var(--tw-backdrop-hue-rotate, ) var(--tw-backdrop-invert, ) var(--tw-backdrop-opacity, ) var(--tw-backdrop-saturate, ) var(--tw-backdrop-sepia, ); + transition-property: transform, translate, scale, rotate; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + --tw-duration: .3s; + --tw-ease: var(--ease-in-out, cubic-bezier(.4, 0, .2, 1)); + transition-duration: .3s; + transition-timing-function: var(--ease-in-out, cubic-bezier(.4, 0, .2, 1)); + list-style-type: none; + display: grid; + position: absolute; + overflow: hidden; +} +:where(nav ul > :not(:last-child)) { + --tw-divide-y-reverse: 0; + border-bottom-style: var(--tw-border-style); + border-top-style: var(--tw-border-style); + border-top-width: calc(1px * var(--tw-divide-y-reverse)); + border-bottom-width: calc(1px * calc(1 - var(--tw-divide-y-reverse))); + border-color: var(--color-slate-600, oklch(.446 .043 257.281)); +} +nav ul.open { + left: calc(var(--spacing, .25rem) * 4); + --tw-translate-x: calc(var(--spacing, .25rem) * 0); + translate: var(--tw-translate-x) var(--tw-translate-y); +} +nav ul li a { + align-items: center; + gap: calc(var(--spacing, .25rem) * 2); + padding-inline: calc(var(--spacing, .25rem) * 4); + padding-block: calc(var(--spacing, .25rem) * 2); + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); + border-color: #0000; + display: flex; +} +nav ul li a svg { + color: color-mix(in oklab, var(--color-white, #fff) 40%, transparent); + transition-property: color, background-color, border-color, outline-color, text-decoration-color, fill, stroke, --tw-gradient-from, --tw-gradient-via, --tw-gradient-to; + transition-timing-function: var(--tw-ease, var(--default-transition-timing-function, cubic-bezier(.4, 0, .2, 1))); + transition-duration: var(--tw-duration, var(--default-transition-duration, .15s)); +} +nav ul li a:hover { + background-color: color-mix(in oklab, var(--color-white, #fff) 20%, transparent); +} +nav ul li a:hover svg { + color: var(--color-white, #fff); +} +nav ul li a.router-link-active { + background-color: color-mix(in oklab, var(--color-sky-200, oklch(.901 .058 230.902)) 20%, transparent); + color: var(--color-sky-300, oklch(.828 .111 230.318)); +} +@property --tw-border-style { + syntax: "*"; + inherits: false; + initial-value: solid; +} +@property --tw-backdrop-blur { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-brightness { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-contrast { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-grayscale { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-hue-rotate { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-invert { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-opacity { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-saturate { + syntax: "*"; + inherits: false +} +@property --tw-backdrop-sepia { + syntax: "*"; + inherits: false +} +@property --tw-translate-x { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-y { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-translate-z { + syntax: "*"; + inherits: false; + initial-value: 0; +} +@property --tw-duration { + syntax: "*"; + inherits: false +} +@property --tw-ease { + syntax: "*"; + inherits: false +} +@property --tw-divide-y-reverse { + syntax: "*"; + inherits: false; + initial-value: 0; +} +/*! tailwindcss v4.0.9 | MIT License | https://tailwindcss.com */ +.app-background[data-v-bf34f349] { + pointer-events: none; + inset: calc(var(--spacing, .25rem) * 0); + z-index: -1; + opacity: .4; + width: 100%; + height: 100%; + position: fixed; + overflow: hidden; +} +.app-background img[data-v-bf34f349] { + object-fit: cover; + width: 100%; + height: 100%; + position: absolute; +} +.app-background .logo[data-v-bf34f349] { + padding: calc(var(--spacing, .25rem) * 28); + opacity: .35; + mix-blend-mode: overlay; + position: absolute; + top: 10%; + left: 10%; + scale: 1.8; +} diff --git a/public/assets/index-GNAKlyBz.js b/public/assets/index-GNAKlyBz.js new file mode 100644 index 0000000..e973032 --- /dev/null +++ b/public/assets/index-GNAKlyBz.js @@ -0,0 +1,18013 @@ +const __vite__mapDeps=(i,m=__vite__mapDeps,d=(m.f||(m.f=["assets/MacrosView-Bf1eb3go.js","assets/DialogComp-Ba5-BUTe.js","assets/DialogComp-ByJn29_w.css","assets/MacrosView-B-ccNLSC.css","assets/DevicesView-DqasecOn.js","assets/DevicesView-Dw_Mls3X.css"])))=>i.map(i=>d[i]); +(function polyfill() { + const relList = document.createElement("link").relList; + if (relList && relList.supports && relList.supports("modulepreload")) { + return; + } + for (const link of document.querySelectorAll('link[rel="modulepreload"]')) { + processPreload(link); + } + new MutationObserver((mutations) => { + for (const mutation of mutations) { + if (mutation.type !== "childList") { + continue; + } + for (const node of mutation.addedNodes) { + if (node.tagName === "LINK" && node.rel === "modulepreload") + processPreload(node); + } + } + }).observe(document, { childList: true, subtree: true }); + function getFetchOpts(link) { + const fetchOpts = {}; + if (link.integrity) fetchOpts.integrity = link.integrity; + if (link.referrerPolicy) fetchOpts.referrerPolicy = link.referrerPolicy; + if (link.crossOrigin === "use-credentials") + fetchOpts.credentials = "include"; + else if (link.crossOrigin === "anonymous") fetchOpts.credentials = "omit"; + else fetchOpts.credentials = "same-origin"; + return fetchOpts; + } + function processPreload(link) { + if (link.ep) + return; + link.ep = true; + const fetchOpts = getFetchOpts(link); + fetch(link.href, fetchOpts); + } +})(); +/** +* @vue/shared v3.5.13 +* (c) 2018-present Yuxi (Evan) You and Vue contributors +* @license MIT +**/ +/*! #__NO_SIDE_EFFECTS__ */ +// @__NO_SIDE_EFFECTS__ +function makeMap(str) { + const map = /* @__PURE__ */ Object.create(null); + for (const key of str.split(",")) map[key] = 1; + return (val) => val in map; +} +const EMPTY_OBJ = {}; +const EMPTY_ARR = []; +const NOOP = () => { +}; +const NO = () => false; +const isOn = (key) => key.charCodeAt(0) === 111 && key.charCodeAt(1) === 110 && // uppercase letter +(key.charCodeAt(2) > 122 || key.charCodeAt(2) < 97); +const isModelListener = (key) => key.startsWith("onUpdate:"); +const extend$1 = Object.assign; +const remove = (arr, el) => { + const i = arr.indexOf(el); + if (i > -1) { + arr.splice(i, 1); + } +}; +const hasOwnProperty$2 = Object.prototype.hasOwnProperty; +const hasOwn = (val, key) => hasOwnProperty$2.call(val, key); +const isArray$2 = Array.isArray; +const isMap = (val) => toTypeString(val) === "[object Map]"; +const isSet = (val) => toTypeString(val) === "[object Set]"; +const isFunction$1 = (val) => typeof val === "function"; +const isString$1 = (val) => typeof val === "string"; +const isSymbol = (val) => typeof val === "symbol"; +const isObject$1 = (val) => val !== null && typeof val === "object"; +const isPromise = (val) => { + return (isObject$1(val) || isFunction$1(val)) && isFunction$1(val.then) && isFunction$1(val.catch); +}; +const objectToString = Object.prototype.toString; +const toTypeString = (value) => objectToString.call(value); +const toRawType = (value) => { + return toTypeString(value).slice(8, -1); +}; +const isPlainObject$2 = (val) => toTypeString(val) === "[object Object]"; +const isIntegerKey = (key) => isString$1(key) && key !== "NaN" && key[0] !== "-" && "" + parseInt(key, 10) === key; +const isReservedProp = /* @__PURE__ */ makeMap( + // the leading comma is intentional so empty string "" is also included + ",key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted" +); +const cacheStringFunction = (fn) => { + const cache = /* @__PURE__ */ Object.create(null); + return (str) => { + const hit = cache[str]; + return hit || (cache[str] = fn(str)); + }; +}; +const camelizeRE = /-(\w)/g; +const camelize = cacheStringFunction( + (str) => { + return str.replace(camelizeRE, (_, c) => c ? c.toUpperCase() : ""); + } +); +const hyphenateRE = /\B([A-Z])/g; +const hyphenate = cacheStringFunction( + (str) => str.replace(hyphenateRE, "-$1").toLowerCase() +); +const capitalize = cacheStringFunction((str) => { + return str.charAt(0).toUpperCase() + str.slice(1); +}); +const toHandlerKey = cacheStringFunction( + (str) => { + const s = str ? `on${capitalize(str)}` : ``; + return s; + } +); +const hasChanged = (value, oldValue) => !Object.is(value, oldValue); +const invokeArrayFns = (fns, ...arg) => { + for (let i = 0; i < fns.length; i++) { + fns[i](...arg); + } +}; +const def = (obj, key, value, writable = false) => { + Object.defineProperty(obj, key, { + configurable: true, + enumerable: false, + writable, + value + }); +}; +const looseToNumber = (val) => { + const n = parseFloat(val); + return isNaN(n) ? val : n; +}; +let _globalThis; +const getGlobalThis = () => { + return _globalThis || (_globalThis = typeof globalThis !== "undefined" ? globalThis : typeof self !== "undefined" ? self : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : {}); +}; +function normalizeStyle(value) { + if (isArray$2(value)) { + const res = {}; + for (let i = 0; i < value.length; i++) { + const item = value[i]; + const normalized = isString$1(item) ? parseStringStyle(item) : normalizeStyle(item); + if (normalized) { + for (const key in normalized) { + res[key] = normalized[key]; + } + } + } + return res; + } else if (isString$1(value) || isObject$1(value)) { + return value; + } +} +const listDelimiterRE = /;(?![^(]*\))/g; +const propertyDelimiterRE = /:([^]+)/; +const styleCommentRE = /\/\*[^]*?\*\//g; +function parseStringStyle(cssText) { + const ret = {}; + cssText.replace(styleCommentRE, "").split(listDelimiterRE).forEach((item) => { + if (item) { + const tmp = item.split(propertyDelimiterRE); + tmp.length > 1 && (ret[tmp[0].trim()] = tmp[1].trim()); + } + }); + return ret; +} +function normalizeClass(value) { + let res = ""; + if (isString$1(value)) { + res = value; + } else if (isArray$2(value)) { + for (let i = 0; i < value.length; i++) { + const normalized = normalizeClass(value[i]); + if (normalized) { + res += normalized + " "; + } + } + } else if (isObject$1(value)) { + for (const name in value) { + if (value[name]) { + res += name + " "; + } + } + } + return res.trim(); +} +const specialBooleanAttrs = `itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly`; +const isSpecialBooleanAttr = /* @__PURE__ */ makeMap(specialBooleanAttrs); +function includeBooleanAttr(value) { + return !!value || value === ""; +} +const isRef$1 = (val) => { + return !!(val && val["__v_isRef"] === true); +}; +const toDisplayString = (val) => { + return isString$1(val) ? val : val == null ? "" : isArray$2(val) || isObject$1(val) && (val.toString === objectToString || !isFunction$1(val.toString)) ? isRef$1(val) ? toDisplayString(val.value) : JSON.stringify(val, replacer, 2) : String(val); +}; +const replacer = (_key, val) => { + if (isRef$1(val)) { + return replacer(_key, val.value); + } else if (isMap(val)) { + return { + [`Map(${val.size})`]: [...val.entries()].reduce( + (entries, [key, val2], i) => { + entries[stringifySymbol(key, i) + " =>"] = val2; + return entries; + }, + {} + ) + }; + } else if (isSet(val)) { + return { + [`Set(${val.size})`]: [...val.values()].map((v) => stringifySymbol(v)) + }; + } else if (isSymbol(val)) { + return stringifySymbol(val); + } else if (isObject$1(val) && !isArray$2(val) && !isPlainObject$2(val)) { + return String(val); + } + return val; +}; +const stringifySymbol = (v, i = "") => { + var _a; + return ( + // Symbol.description in es2019+ so we need to cast here to pass + // the lib: es2016 check + isSymbol(v) ? `Symbol(${(_a = v.description) != null ? _a : i})` : v + ); +}; +/** +* @vue/reactivity v3.5.13 +* (c) 2018-present Yuxi (Evan) You and Vue contributors +* @license MIT +**/ +let activeEffectScope; +class EffectScope { + constructor(detached = false) { + this.detached = detached; + this._active = true; + this.effects = []; + this.cleanups = []; + this._isPaused = false; + this.parent = activeEffectScope; + if (!detached && activeEffectScope) { + this.index = (activeEffectScope.scopes || (activeEffectScope.scopes = [])).push( + this + ) - 1; + } + } + get active() { + return this._active; + } + pause() { + if (this._active) { + this._isPaused = true; + let i, l; + if (this.scopes) { + for (i = 0, l = this.scopes.length; i < l; i++) { + this.scopes[i].pause(); + } + } + for (i = 0, l = this.effects.length; i < l; i++) { + this.effects[i].pause(); + } + } + } + /** + * Resumes the effect scope, including all child scopes and effects. + */ + resume() { + if (this._active) { + if (this._isPaused) { + this._isPaused = false; + let i, l; + if (this.scopes) { + for (i = 0, l = this.scopes.length; i < l; i++) { + this.scopes[i].resume(); + } + } + for (i = 0, l = this.effects.length; i < l; i++) { + this.effects[i].resume(); + } + } + } + } + run(fn) { + if (this._active) { + const currentEffectScope = activeEffectScope; + try { + activeEffectScope = this; + return fn(); + } finally { + activeEffectScope = currentEffectScope; + } + } + } + /** + * This should only be called on non-detached scopes + * @internal + */ + on() { + activeEffectScope = this; + } + /** + * This should only be called on non-detached scopes + * @internal + */ + off() { + activeEffectScope = this.parent; + } + stop(fromParent) { + if (this._active) { + this._active = false; + let i, l; + for (i = 0, l = this.effects.length; i < l; i++) { + this.effects[i].stop(); + } + this.effects.length = 0; + for (i = 0, l = this.cleanups.length; i < l; i++) { + this.cleanups[i](); + } + this.cleanups.length = 0; + if (this.scopes) { + for (i = 0, l = this.scopes.length; i < l; i++) { + this.scopes[i].stop(true); + } + this.scopes.length = 0; + } + if (!this.detached && this.parent && !fromParent) { + const last = this.parent.scopes.pop(); + if (last && last !== this) { + this.parent.scopes[this.index] = last; + last.index = this.index; + } + } + this.parent = void 0; + } + } +} +function effectScope(detached) { + return new EffectScope(detached); +} +function getCurrentScope() { + return activeEffectScope; +} +function onScopeDispose(fn, failSilently = false) { + if (activeEffectScope) { + activeEffectScope.cleanups.push(fn); + } +} +let activeSub; +const pausedQueueEffects = /* @__PURE__ */ new WeakSet(); +class ReactiveEffect { + constructor(fn) { + this.fn = fn; + this.deps = void 0; + this.depsTail = void 0; + this.flags = 1 | 4; + this.next = void 0; + this.cleanup = void 0; + this.scheduler = void 0; + if (activeEffectScope && activeEffectScope.active) { + activeEffectScope.effects.push(this); + } + } + pause() { + this.flags |= 64; + } + resume() { + if (this.flags & 64) { + this.flags &= -65; + if (pausedQueueEffects.has(this)) { + pausedQueueEffects.delete(this); + this.trigger(); + } + } + } + /** + * @internal + */ + notify() { + if (this.flags & 2 && !(this.flags & 32)) { + return; + } + if (!(this.flags & 8)) { + batch(this); + } + } + run() { + if (!(this.flags & 1)) { + return this.fn(); + } + this.flags |= 2; + cleanupEffect(this); + prepareDeps(this); + const prevEffect = activeSub; + const prevShouldTrack = shouldTrack; + activeSub = this; + shouldTrack = true; + try { + return this.fn(); + } finally { + cleanupDeps(this); + activeSub = prevEffect; + shouldTrack = prevShouldTrack; + this.flags &= -3; + } + } + stop() { + if (this.flags & 1) { + for (let link = this.deps; link; link = link.nextDep) { + removeSub(link); + } + this.deps = this.depsTail = void 0; + cleanupEffect(this); + this.onStop && this.onStop(); + this.flags &= -2; + } + } + trigger() { + if (this.flags & 64) { + pausedQueueEffects.add(this); + } else if (this.scheduler) { + this.scheduler(); + } else { + this.runIfDirty(); + } + } + /** + * @internal + */ + runIfDirty() { + if (isDirty(this)) { + this.run(); + } + } + get dirty() { + return isDirty(this); + } +} +let batchDepth = 0; +let batchedSub; +let batchedComputed; +function batch(sub, isComputed2 = false) { + sub.flags |= 8; + if (isComputed2) { + sub.next = batchedComputed; + batchedComputed = sub; + return; + } + sub.next = batchedSub; + batchedSub = sub; +} +function startBatch() { + batchDepth++; +} +function endBatch() { + if (--batchDepth > 0) { + return; + } + if (batchedComputed) { + let e = batchedComputed; + batchedComputed = void 0; + while (e) { + const next = e.next; + e.next = void 0; + e.flags &= -9; + e = next; + } + } + let error; + while (batchedSub) { + let e = batchedSub; + batchedSub = void 0; + while (e) { + const next = e.next; + e.next = void 0; + e.flags &= -9; + if (e.flags & 1) { + try { + ; + e.trigger(); + } catch (err) { + if (!error) error = err; + } + } + e = next; + } + } + if (error) throw error; +} +function prepareDeps(sub) { + for (let link = sub.deps; link; link = link.nextDep) { + link.version = -1; + link.prevActiveLink = link.dep.activeLink; + link.dep.activeLink = link; + } +} +function cleanupDeps(sub) { + let head; + let tail = sub.depsTail; + let link = tail; + while (link) { + const prev = link.prevDep; + if (link.version === -1) { + if (link === tail) tail = prev; + removeSub(link); + removeDep(link); + } else { + head = link; + } + link.dep.activeLink = link.prevActiveLink; + link.prevActiveLink = void 0; + link = prev; + } + sub.deps = head; + sub.depsTail = tail; +} +function isDirty(sub) { + for (let link = sub.deps; link; link = link.nextDep) { + if (link.dep.version !== link.version || link.dep.computed && (refreshComputed(link.dep.computed) || link.dep.version !== link.version)) { + return true; + } + } + if (sub._dirty) { + return true; + } + return false; +} +function refreshComputed(computed2) { + if (computed2.flags & 4 && !(computed2.flags & 16)) { + return; + } + computed2.flags &= -17; + if (computed2.globalVersion === globalVersion) { + return; + } + computed2.globalVersion = globalVersion; + const dep = computed2.dep; + computed2.flags |= 2; + if (dep.version > 0 && !computed2.isSSR && computed2.deps && !isDirty(computed2)) { + computed2.flags &= -3; + return; + } + const prevSub = activeSub; + const prevShouldTrack = shouldTrack; + activeSub = computed2; + shouldTrack = true; + try { + prepareDeps(computed2); + const value = computed2.fn(computed2._value); + if (dep.version === 0 || hasChanged(value, computed2._value)) { + computed2._value = value; + dep.version++; + } + } catch (err) { + dep.version++; + throw err; + } finally { + activeSub = prevSub; + shouldTrack = prevShouldTrack; + cleanupDeps(computed2); + computed2.flags &= -3; + } +} +function removeSub(link, soft = false) { + const { dep, prevSub, nextSub } = link; + if (prevSub) { + prevSub.nextSub = nextSub; + link.prevSub = void 0; + } + if (nextSub) { + nextSub.prevSub = prevSub; + link.nextSub = void 0; + } + if (dep.subs === link) { + dep.subs = prevSub; + if (!prevSub && dep.computed) { + dep.computed.flags &= -5; + for (let l = dep.computed.deps; l; l = l.nextDep) { + removeSub(l, true); + } + } + } + if (!soft && !--dep.sc && dep.map) { + dep.map.delete(dep.key); + } +} +function removeDep(link) { + const { prevDep, nextDep } = link; + if (prevDep) { + prevDep.nextDep = nextDep; + link.prevDep = void 0; + } + if (nextDep) { + nextDep.prevDep = prevDep; + link.nextDep = void 0; + } +} +let shouldTrack = true; +const trackStack = []; +function pauseTracking() { + trackStack.push(shouldTrack); + shouldTrack = false; +} +function resetTracking() { + const last = trackStack.pop(); + shouldTrack = last === void 0 ? true : last; +} +function cleanupEffect(e) { + const { cleanup } = e; + e.cleanup = void 0; + if (cleanup) { + const prevSub = activeSub; + activeSub = void 0; + try { + cleanup(); + } finally { + activeSub = prevSub; + } + } +} +let globalVersion = 0; +class Link { + constructor(sub, dep) { + this.sub = sub; + this.dep = dep; + this.version = dep.version; + this.nextDep = this.prevDep = this.nextSub = this.prevSub = this.prevActiveLink = void 0; + } +} +class Dep { + constructor(computed2) { + this.computed = computed2; + this.version = 0; + this.activeLink = void 0; + this.subs = void 0; + this.map = void 0; + this.key = void 0; + this.sc = 0; + } + track(debugInfo) { + if (!activeSub || !shouldTrack || activeSub === this.computed) { + return; + } + let link = this.activeLink; + if (link === void 0 || link.sub !== activeSub) { + link = this.activeLink = new Link(activeSub, this); + if (!activeSub.deps) { + activeSub.deps = activeSub.depsTail = link; + } else { + link.prevDep = activeSub.depsTail; + activeSub.depsTail.nextDep = link; + activeSub.depsTail = link; + } + addSub(link); + } else if (link.version === -1) { + link.version = this.version; + if (link.nextDep) { + const next = link.nextDep; + next.prevDep = link.prevDep; + if (link.prevDep) { + link.prevDep.nextDep = next; + } + link.prevDep = activeSub.depsTail; + link.nextDep = void 0; + activeSub.depsTail.nextDep = link; + activeSub.depsTail = link; + if (activeSub.deps === link) { + activeSub.deps = next; + } + } + } + return link; + } + trigger(debugInfo) { + this.version++; + globalVersion++; + this.notify(debugInfo); + } + notify(debugInfo) { + startBatch(); + try { + if (false) ; + for (let link = this.subs; link; link = link.prevSub) { + if (link.sub.notify()) { + ; + link.sub.dep.notify(); + } + } + } finally { + endBatch(); + } + } +} +function addSub(link) { + link.dep.sc++; + if (link.sub.flags & 4) { + const computed2 = link.dep.computed; + if (computed2 && !link.dep.subs) { + computed2.flags |= 4 | 16; + for (let l = computed2.deps; l; l = l.nextDep) { + addSub(l); + } + } + const currentTail = link.dep.subs; + if (currentTail !== link) { + link.prevSub = currentTail; + if (currentTail) currentTail.nextSub = link; + } + link.dep.subs = link; + } +} +const targetMap = /* @__PURE__ */ new WeakMap(); +const ITERATE_KEY = Symbol( + "" +); +const MAP_KEY_ITERATE_KEY = Symbol( + "" +); +const ARRAY_ITERATE_KEY = Symbol( + "" +); +function track(target, type, key) { + if (shouldTrack && activeSub) { + let depsMap = targetMap.get(target); + if (!depsMap) { + targetMap.set(target, depsMap = /* @__PURE__ */ new Map()); + } + let dep = depsMap.get(key); + if (!dep) { + depsMap.set(key, dep = new Dep()); + dep.map = depsMap; + dep.key = key; + } + { + dep.track(); + } + } +} +function trigger(target, type, key, newValue, oldValue, oldTarget) { + const depsMap = targetMap.get(target); + if (!depsMap) { + globalVersion++; + return; + } + const run = (dep) => { + if (dep) { + { + dep.trigger(); + } + } + }; + startBatch(); + if (type === "clear") { + depsMap.forEach(run); + } else { + const targetIsArray = isArray$2(target); + const isArrayIndex = targetIsArray && isIntegerKey(key); + if (targetIsArray && key === "length") { + const newLength = Number(newValue); + depsMap.forEach((dep, key2) => { + if (key2 === "length" || key2 === ARRAY_ITERATE_KEY || !isSymbol(key2) && key2 >= newLength) { + run(dep); + } + }); + } else { + if (key !== void 0 || depsMap.has(void 0)) { + run(depsMap.get(key)); + } + if (isArrayIndex) { + run(depsMap.get(ARRAY_ITERATE_KEY)); + } + switch (type) { + case "add": + if (!targetIsArray) { + run(depsMap.get(ITERATE_KEY)); + if (isMap(target)) { + run(depsMap.get(MAP_KEY_ITERATE_KEY)); + } + } else if (isArrayIndex) { + run(depsMap.get("length")); + } + break; + case "delete": + if (!targetIsArray) { + run(depsMap.get(ITERATE_KEY)); + if (isMap(target)) { + run(depsMap.get(MAP_KEY_ITERATE_KEY)); + } + } + break; + case "set": + if (isMap(target)) { + run(depsMap.get(ITERATE_KEY)); + } + break; + } + } + } + endBatch(); +} +function getDepFromReactive(object, key) { + const depMap = targetMap.get(object); + return depMap && depMap.get(key); +} +function reactiveReadArray(array) { + const raw = toRaw(array); + if (raw === array) return raw; + track(raw, "iterate", ARRAY_ITERATE_KEY); + return isShallow(array) ? raw : raw.map(toReactive); +} +function shallowReadArray(arr) { + track(arr = toRaw(arr), "iterate", ARRAY_ITERATE_KEY); + return arr; +} +const arrayInstrumentations = { + __proto__: null, + [Symbol.iterator]() { + return iterator(this, Symbol.iterator, toReactive); + }, + concat(...args) { + return reactiveReadArray(this).concat( + ...args.map((x) => isArray$2(x) ? reactiveReadArray(x) : x) + ); + }, + entries() { + return iterator(this, "entries", (value) => { + value[1] = toReactive(value[1]); + return value; + }); + }, + every(fn, thisArg) { + return apply(this, "every", fn, thisArg, void 0, arguments); + }, + filter(fn, thisArg) { + return apply(this, "filter", fn, thisArg, (v) => v.map(toReactive), arguments); + }, + find(fn, thisArg) { + return apply(this, "find", fn, thisArg, toReactive, arguments); + }, + findIndex(fn, thisArg) { + return apply(this, "findIndex", fn, thisArg, void 0, arguments); + }, + findLast(fn, thisArg) { + return apply(this, "findLast", fn, thisArg, toReactive, arguments); + }, + findLastIndex(fn, thisArg) { + return apply(this, "findLastIndex", fn, thisArg, void 0, arguments); + }, + // flat, flatMap could benefit from ARRAY_ITERATE but are not straight-forward to implement + forEach(fn, thisArg) { + return apply(this, "forEach", fn, thisArg, void 0, arguments); + }, + includes(...args) { + return searchProxy(this, "includes", args); + }, + indexOf(...args) { + return searchProxy(this, "indexOf", args); + }, + join(separator) { + return reactiveReadArray(this).join(separator); + }, + // keys() iterator only reads `length`, no optimisation required + lastIndexOf(...args) { + return searchProxy(this, "lastIndexOf", args); + }, + map(fn, thisArg) { + return apply(this, "map", fn, thisArg, void 0, arguments); + }, + pop() { + return noTracking(this, "pop"); + }, + push(...args) { + return noTracking(this, "push", args); + }, + reduce(fn, ...args) { + return reduce(this, "reduce", fn, args); + }, + reduceRight(fn, ...args) { + return reduce(this, "reduceRight", fn, args); + }, + shift() { + return noTracking(this, "shift"); + }, + // slice could use ARRAY_ITERATE but also seems to beg for range tracking + some(fn, thisArg) { + return apply(this, "some", fn, thisArg, void 0, arguments); + }, + splice(...args) { + return noTracking(this, "splice", args); + }, + toReversed() { + return reactiveReadArray(this).toReversed(); + }, + toSorted(comparer) { + return reactiveReadArray(this).toSorted(comparer); + }, + toSpliced(...args) { + return reactiveReadArray(this).toSpliced(...args); + }, + unshift(...args) { + return noTracking(this, "unshift", args); + }, + values() { + return iterator(this, "values", toReactive); + } +}; +function iterator(self2, method, wrapValue) { + const arr = shallowReadArray(self2); + const iter = arr[method](); + if (arr !== self2 && !isShallow(self2)) { + iter._next = iter.next; + iter.next = () => { + const result = iter._next(); + if (result.value) { + result.value = wrapValue(result.value); + } + return result; + }; + } + return iter; +} +const arrayProto = Array.prototype; +function apply(self2, method, fn, thisArg, wrappedRetFn, args) { + const arr = shallowReadArray(self2); + const needsWrap = arr !== self2 && !isShallow(self2); + const methodFn = arr[method]; + if (methodFn !== arrayProto[method]) { + const result2 = methodFn.apply(self2, args); + return needsWrap ? toReactive(result2) : result2; + } + let wrappedFn = fn; + if (arr !== self2) { + if (needsWrap) { + wrappedFn = function(item, index) { + return fn.call(this, toReactive(item), index, self2); + }; + } else if (fn.length > 2) { + wrappedFn = function(item, index) { + return fn.call(this, item, index, self2); + }; + } + } + const result = methodFn.call(arr, wrappedFn, thisArg); + return needsWrap && wrappedRetFn ? wrappedRetFn(result) : result; +} +function reduce(self2, method, fn, args) { + const arr = shallowReadArray(self2); + let wrappedFn = fn; + if (arr !== self2) { + if (!isShallow(self2)) { + wrappedFn = function(acc, item, index) { + return fn.call(this, acc, toReactive(item), index, self2); + }; + } else if (fn.length > 3) { + wrappedFn = function(acc, item, index) { + return fn.call(this, acc, item, index, self2); + }; + } + } + return arr[method](wrappedFn, ...args); +} +function searchProxy(self2, method, args) { + const arr = toRaw(self2); + track(arr, "iterate", ARRAY_ITERATE_KEY); + const res = arr[method](...args); + if ((res === -1 || res === false) && isProxy(args[0])) { + args[0] = toRaw(args[0]); + return arr[method](...args); + } + return res; +} +function noTracking(self2, method, args = []) { + pauseTracking(); + startBatch(); + const res = toRaw(self2)[method].apply(self2, args); + endBatch(); + resetTracking(); + return res; +} +const isNonTrackableKeys = /* @__PURE__ */ makeMap(`__proto__,__v_isRef,__isVue`); +const builtInSymbols = new Set( + /* @__PURE__ */ Object.getOwnPropertyNames(Symbol).filter((key) => key !== "arguments" && key !== "caller").map((key) => Symbol[key]).filter(isSymbol) +); +function hasOwnProperty$1(key) { + if (!isSymbol(key)) key = String(key); + const obj = toRaw(this); + track(obj, "has", key); + return obj.hasOwnProperty(key); +} +class BaseReactiveHandler { + constructor(_isReadonly = false, _isShallow = false) { + this._isReadonly = _isReadonly; + this._isShallow = _isShallow; + } + get(target, key, receiver) { + if (key === "__v_skip") return target["__v_skip"]; + const isReadonly2 = this._isReadonly, isShallow2 = this._isShallow; + if (key === "__v_isReactive") { + return !isReadonly2; + } else if (key === "__v_isReadonly") { + return isReadonly2; + } else if (key === "__v_isShallow") { + return isShallow2; + } else if (key === "__v_raw") { + if (receiver === (isReadonly2 ? isShallow2 ? shallowReadonlyMap : readonlyMap : isShallow2 ? shallowReactiveMap : reactiveMap).get(target) || // receiver is not the reactive proxy, but has the same prototype + // this means the receiver is a user proxy of the reactive proxy + Object.getPrototypeOf(target) === Object.getPrototypeOf(receiver)) { + return target; + } + return; + } + const targetIsArray = isArray$2(target); + if (!isReadonly2) { + let fn; + if (targetIsArray && (fn = arrayInstrumentations[key])) { + return fn; + } + if (key === "hasOwnProperty") { + return hasOwnProperty$1; + } + } + const res = Reflect.get( + target, + key, + // if this is a proxy wrapping a ref, return methods using the raw ref + // as receiver so that we don't have to call `toRaw` on the ref in all + // its class methods + isRef(target) ? target : receiver + ); + if (isSymbol(key) ? builtInSymbols.has(key) : isNonTrackableKeys(key)) { + return res; + } + if (!isReadonly2) { + track(target, "get", key); + } + if (isShallow2) { + return res; + } + if (isRef(res)) { + return targetIsArray && isIntegerKey(key) ? res : res.value; + } + if (isObject$1(res)) { + return isReadonly2 ? readonly(res) : reactive(res); + } + return res; + } +} +class MutableReactiveHandler extends BaseReactiveHandler { + constructor(isShallow2 = false) { + super(false, isShallow2); + } + set(target, key, value, receiver) { + let oldValue = target[key]; + if (!this._isShallow) { + const isOldValueReadonly = isReadonly(oldValue); + if (!isShallow(value) && !isReadonly(value)) { + oldValue = toRaw(oldValue); + value = toRaw(value); + } + if (!isArray$2(target) && isRef(oldValue) && !isRef(value)) { + if (isOldValueReadonly) { + return false; + } else { + oldValue.value = value; + return true; + } + } + } + const hadKey = isArray$2(target) && isIntegerKey(key) ? Number(key) < target.length : hasOwn(target, key); + const result = Reflect.set( + target, + key, + value, + isRef(target) ? target : receiver + ); + if (target === toRaw(receiver)) { + if (!hadKey) { + trigger(target, "add", key, value); + } else if (hasChanged(value, oldValue)) { + trigger(target, "set", key, value); + } + } + return result; + } + deleteProperty(target, key) { + const hadKey = hasOwn(target, key); + target[key]; + const result = Reflect.deleteProperty(target, key); + if (result && hadKey) { + trigger(target, "delete", key, void 0); + } + return result; + } + has(target, key) { + const result = Reflect.has(target, key); + if (!isSymbol(key) || !builtInSymbols.has(key)) { + track(target, "has", key); + } + return result; + } + ownKeys(target) { + track( + target, + "iterate", + isArray$2(target) ? "length" : ITERATE_KEY + ); + return Reflect.ownKeys(target); + } +} +class ReadonlyReactiveHandler extends BaseReactiveHandler { + constructor(isShallow2 = false) { + super(true, isShallow2); + } + set(target, key) { + return true; + } + deleteProperty(target, key) { + return true; + } +} +const mutableHandlers = /* @__PURE__ */ new MutableReactiveHandler(); +const readonlyHandlers = /* @__PURE__ */ new ReadonlyReactiveHandler(); +const shallowReactiveHandlers = /* @__PURE__ */ new MutableReactiveHandler(true); +const shallowReadonlyHandlers = /* @__PURE__ */ new ReadonlyReactiveHandler(true); +const toShallow = (value) => value; +const getProto = (v) => Reflect.getPrototypeOf(v); +function createIterableMethod(method, isReadonly2, isShallow2) { + return function(...args) { + const target = this["__v_raw"]; + const rawTarget = toRaw(target); + const targetIsMap = isMap(rawTarget); + const isPair = method === "entries" || method === Symbol.iterator && targetIsMap; + const isKeyOnly = method === "keys" && targetIsMap; + const innerIterator = target[method](...args); + const wrap = isShallow2 ? toShallow : isReadonly2 ? toReadonly : toReactive; + !isReadonly2 && track( + rawTarget, + "iterate", + isKeyOnly ? MAP_KEY_ITERATE_KEY : ITERATE_KEY + ); + return { + // iterator protocol + next() { + const { value, done } = innerIterator.next(); + return done ? { value, done } : { + value: isPair ? [wrap(value[0]), wrap(value[1])] : wrap(value), + done + }; + }, + // iterable protocol + [Symbol.iterator]() { + return this; + } + }; + }; +} +function createReadonlyMethod(type) { + return function(...args) { + return type === "delete" ? false : type === "clear" ? void 0 : this; + }; +} +function createInstrumentations(readonly2, shallow) { + const instrumentations = { + get(key) { + const target = this["__v_raw"]; + const rawTarget = toRaw(target); + const rawKey = toRaw(key); + if (!readonly2) { + if (hasChanged(key, rawKey)) { + track(rawTarget, "get", key); + } + track(rawTarget, "get", rawKey); + } + const { has } = getProto(rawTarget); + const wrap = shallow ? toShallow : readonly2 ? toReadonly : toReactive; + if (has.call(rawTarget, key)) { + return wrap(target.get(key)); + } else if (has.call(rawTarget, rawKey)) { + return wrap(target.get(rawKey)); + } else if (target !== rawTarget) { + target.get(key); + } + }, + get size() { + const target = this["__v_raw"]; + !readonly2 && track(toRaw(target), "iterate", ITERATE_KEY); + return Reflect.get(target, "size", target); + }, + has(key) { + const target = this["__v_raw"]; + const rawTarget = toRaw(target); + const rawKey = toRaw(key); + if (!readonly2) { + if (hasChanged(key, rawKey)) { + track(rawTarget, "has", key); + } + track(rawTarget, "has", rawKey); + } + return key === rawKey ? target.has(key) : target.has(key) || target.has(rawKey); + }, + forEach(callback, thisArg) { + const observed = this; + const target = observed["__v_raw"]; + const rawTarget = toRaw(target); + const wrap = shallow ? toShallow : readonly2 ? toReadonly : toReactive; + !readonly2 && track(rawTarget, "iterate", ITERATE_KEY); + return target.forEach((value, key) => { + return callback.call(thisArg, wrap(value), wrap(key), observed); + }); + } + }; + extend$1( + instrumentations, + readonly2 ? { + add: createReadonlyMethod("add"), + set: createReadonlyMethod("set"), + delete: createReadonlyMethod("delete"), + clear: createReadonlyMethod("clear") + } : { + add(value) { + if (!shallow && !isShallow(value) && !isReadonly(value)) { + value = toRaw(value); + } + const target = toRaw(this); + const proto = getProto(target); + const hadKey = proto.has.call(target, value); + if (!hadKey) { + target.add(value); + trigger(target, "add", value, value); + } + return this; + }, + set(key, value) { + if (!shallow && !isShallow(value) && !isReadonly(value)) { + value = toRaw(value); + } + const target = toRaw(this); + const { has, get } = getProto(target); + let hadKey = has.call(target, key); + if (!hadKey) { + key = toRaw(key); + hadKey = has.call(target, key); + } + const oldValue = get.call(target, key); + target.set(key, value); + if (!hadKey) { + trigger(target, "add", key, value); + } else if (hasChanged(value, oldValue)) { + trigger(target, "set", key, value); + } + return this; + }, + delete(key) { + const target = toRaw(this); + const { has, get } = getProto(target); + let hadKey = has.call(target, key); + if (!hadKey) { + key = toRaw(key); + hadKey = has.call(target, key); + } + get ? get.call(target, key) : void 0; + const result = target.delete(key); + if (hadKey) { + trigger(target, "delete", key, void 0); + } + return result; + }, + clear() { + const target = toRaw(this); + const hadItems = target.size !== 0; + const result = target.clear(); + if (hadItems) { + trigger( + target, + "clear", + void 0, + void 0 + ); + } + return result; + } + } + ); + const iteratorMethods = [ + "keys", + "values", + "entries", + Symbol.iterator + ]; + iteratorMethods.forEach((method) => { + instrumentations[method] = createIterableMethod(method, readonly2, shallow); + }); + return instrumentations; +} +function createInstrumentationGetter(isReadonly2, shallow) { + const instrumentations = createInstrumentations(isReadonly2, shallow); + return (target, key, receiver) => { + if (key === "__v_isReactive") { + return !isReadonly2; + } else if (key === "__v_isReadonly") { + return isReadonly2; + } else if (key === "__v_raw") { + return target; + } + return Reflect.get( + hasOwn(instrumentations, key) && key in target ? instrumentations : target, + key, + receiver + ); + }; +} +const mutableCollectionHandlers = { + get: /* @__PURE__ */ createInstrumentationGetter(false, false) +}; +const shallowCollectionHandlers = { + get: /* @__PURE__ */ createInstrumentationGetter(false, true) +}; +const readonlyCollectionHandlers = { + get: /* @__PURE__ */ createInstrumentationGetter(true, false) +}; +const shallowReadonlyCollectionHandlers = { + get: /* @__PURE__ */ createInstrumentationGetter(true, true) +}; +const reactiveMap = /* @__PURE__ */ new WeakMap(); +const shallowReactiveMap = /* @__PURE__ */ new WeakMap(); +const readonlyMap = /* @__PURE__ */ new WeakMap(); +const shallowReadonlyMap = /* @__PURE__ */ new WeakMap(); +function targetTypeMap(rawType) { + switch (rawType) { + case "Object": + case "Array": + return 1; + case "Map": + case "Set": + case "WeakMap": + case "WeakSet": + return 2; + default: + return 0; + } +} +function getTargetType(value) { + return value["__v_skip"] || !Object.isExtensible(value) ? 0 : targetTypeMap(toRawType(value)); +} +function reactive(target) { + if (isReadonly(target)) { + return target; + } + return createReactiveObject( + target, + false, + mutableHandlers, + mutableCollectionHandlers, + reactiveMap + ); +} +function shallowReactive(target) { + return createReactiveObject( + target, + false, + shallowReactiveHandlers, + shallowCollectionHandlers, + shallowReactiveMap + ); +} +function readonly(target) { + return createReactiveObject( + target, + true, + readonlyHandlers, + readonlyCollectionHandlers, + readonlyMap + ); +} +function shallowReadonly(target) { + return createReactiveObject( + target, + true, + shallowReadonlyHandlers, + shallowReadonlyCollectionHandlers, + shallowReadonlyMap + ); +} +function createReactiveObject(target, isReadonly2, baseHandlers, collectionHandlers, proxyMap) { + if (!isObject$1(target)) { + return target; + } + if (target["__v_raw"] && !(isReadonly2 && target["__v_isReactive"])) { + return target; + } + const existingProxy = proxyMap.get(target); + if (existingProxy) { + return existingProxy; + } + const targetType = getTargetType(target); + if (targetType === 0) { + return target; + } + const proxy = new Proxy( + target, + targetType === 2 ? collectionHandlers : baseHandlers + ); + proxyMap.set(target, proxy); + return proxy; +} +function isReactive(value) { + if (isReadonly(value)) { + return isReactive(value["__v_raw"]); + } + return !!(value && value["__v_isReactive"]); +} +function isReadonly(value) { + return !!(value && value["__v_isReadonly"]); +} +function isShallow(value) { + return !!(value && value["__v_isShallow"]); +} +function isProxy(value) { + return value ? !!value["__v_raw"] : false; +} +function toRaw(observed) { + const raw = observed && observed["__v_raw"]; + return raw ? toRaw(raw) : observed; +} +function markRaw(value) { + if (!hasOwn(value, "__v_skip") && Object.isExtensible(value)) { + def(value, "__v_skip", true); + } + return value; +} +const toReactive = (value) => isObject$1(value) ? reactive(value) : value; +const toReadonly = (value) => isObject$1(value) ? readonly(value) : value; +function isRef(r) { + return r ? r["__v_isRef"] === true : false; +} +function ref(value) { + return createRef(value, false); +} +function shallowRef(value) { + return createRef(value, true); +} +function createRef(rawValue, shallow) { + if (isRef(rawValue)) { + return rawValue; + } + return new RefImpl(rawValue, shallow); +} +class RefImpl { + constructor(value, isShallow2) { + this.dep = new Dep(); + this["__v_isRef"] = true; + this["__v_isShallow"] = false; + this._rawValue = isShallow2 ? value : toRaw(value); + this._value = isShallow2 ? value : toReactive(value); + this["__v_isShallow"] = isShallow2; + } + get value() { + { + this.dep.track(); + } + return this._value; + } + set value(newValue) { + const oldValue = this._rawValue; + const useDirectValue = this["__v_isShallow"] || isShallow(newValue) || isReadonly(newValue); + newValue = useDirectValue ? newValue : toRaw(newValue); + if (hasChanged(newValue, oldValue)) { + this._rawValue = newValue; + this._value = useDirectValue ? newValue : toReactive(newValue); + { + this.dep.trigger(); + } + } + } +} +function unref(ref2) { + return isRef(ref2) ? ref2.value : ref2; +} +const shallowUnwrapHandlers = { + get: (target, key, receiver) => key === "__v_raw" ? target : unref(Reflect.get(target, key, receiver)), + set: (target, key, value, receiver) => { + const oldValue = target[key]; + if (isRef(oldValue) && !isRef(value)) { + oldValue.value = value; + return true; + } else { + return Reflect.set(target, key, value, receiver); + } + } +}; +function proxyRefs(objectWithRefs) { + return isReactive(objectWithRefs) ? objectWithRefs : new Proxy(objectWithRefs, shallowUnwrapHandlers); +} +function toRefs(object) { + const ret = isArray$2(object) ? new Array(object.length) : {}; + for (const key in object) { + ret[key] = propertyToRef(object, key); + } + return ret; +} +class ObjectRefImpl { + constructor(_object, _key, _defaultValue) { + this._object = _object; + this._key = _key; + this._defaultValue = _defaultValue; + this["__v_isRef"] = true; + this._value = void 0; + } + get value() { + const val = this._object[this._key]; + return this._value = val === void 0 ? this._defaultValue : val; + } + set value(newVal) { + this._object[this._key] = newVal; + } + get dep() { + return getDepFromReactive(toRaw(this._object), this._key); + } +} +function propertyToRef(source, key, defaultValue) { + const val = source[key]; + return isRef(val) ? val : new ObjectRefImpl(source, key, defaultValue); +} +class ComputedRefImpl { + constructor(fn, setter, isSSR) { + this.fn = fn; + this.setter = setter; + this._value = void 0; + this.dep = new Dep(this); + this.__v_isRef = true; + this.deps = void 0; + this.depsTail = void 0; + this.flags = 16; + this.globalVersion = globalVersion - 1; + this.next = void 0; + this.effect = this; + this["__v_isReadonly"] = !setter; + this.isSSR = isSSR; + } + /** + * @internal + */ + notify() { + this.flags |= 16; + if (!(this.flags & 8) && // avoid infinite self recursion + activeSub !== this) { + batch(this, true); + return true; + } + } + get value() { + const link = this.dep.track(); + refreshComputed(this); + if (link) { + link.version = this.dep.version; + } + return this._value; + } + set value(newValue) { + if (this.setter) { + this.setter(newValue); + } + } +} +function computed$1(getterOrOptions, debugOptions, isSSR = false) { + let getter; + let setter; + if (isFunction$1(getterOrOptions)) { + getter = getterOrOptions; + } else { + getter = getterOrOptions.get; + setter = getterOrOptions.set; + } + const cRef = new ComputedRefImpl(getter, setter, isSSR); + return cRef; +} +const INITIAL_WATCHER_VALUE = {}; +const cleanupMap = /* @__PURE__ */ new WeakMap(); +let activeWatcher = void 0; +function onWatcherCleanup(cleanupFn, failSilently = false, owner = activeWatcher) { + if (owner) { + let cleanups = cleanupMap.get(owner); + if (!cleanups) cleanupMap.set(owner, cleanups = []); + cleanups.push(cleanupFn); + } +} +function watch$1(source, cb, options = EMPTY_OBJ) { + const { immediate, deep, once, scheduler, augmentJob, call } = options; + const reactiveGetter = (source2) => { + if (deep) return source2; + if (isShallow(source2) || deep === false || deep === 0) + return traverse(source2, 1); + return traverse(source2); + }; + let effect2; + let getter; + let cleanup; + let boundCleanup; + let forceTrigger = false; + let isMultiSource = false; + if (isRef(source)) { + getter = () => source.value; + forceTrigger = isShallow(source); + } else if (isReactive(source)) { + getter = () => reactiveGetter(source); + forceTrigger = true; + } else if (isArray$2(source)) { + isMultiSource = true; + forceTrigger = source.some((s) => isReactive(s) || isShallow(s)); + getter = () => source.map((s) => { + if (isRef(s)) { + return s.value; + } else if (isReactive(s)) { + return reactiveGetter(s); + } else if (isFunction$1(s)) { + return call ? call(s, 2) : s(); + } else ; + }); + } else if (isFunction$1(source)) { + if (cb) { + getter = call ? () => call(source, 2) : source; + } else { + getter = () => { + if (cleanup) { + pauseTracking(); + try { + cleanup(); + } finally { + resetTracking(); + } + } + const currentEffect = activeWatcher; + activeWatcher = effect2; + try { + return call ? call(source, 3, [boundCleanup]) : source(boundCleanup); + } finally { + activeWatcher = currentEffect; + } + }; + } + } else { + getter = NOOP; + } + if (cb && deep) { + const baseGetter = getter; + const depth = deep === true ? Infinity : deep; + getter = () => traverse(baseGetter(), depth); + } + const scope = getCurrentScope(); + const watchHandle = () => { + effect2.stop(); + if (scope && scope.active) { + remove(scope.effects, effect2); + } + }; + if (once && cb) { + const _cb = cb; + cb = (...args) => { + _cb(...args); + watchHandle(); + }; + } + let oldValue = isMultiSource ? new Array(source.length).fill(INITIAL_WATCHER_VALUE) : INITIAL_WATCHER_VALUE; + const job = (immediateFirstRun) => { + if (!(effect2.flags & 1) || !effect2.dirty && !immediateFirstRun) { + return; + } + if (cb) { + const newValue = effect2.run(); + if (deep || forceTrigger || (isMultiSource ? newValue.some((v, i) => hasChanged(v, oldValue[i])) : hasChanged(newValue, oldValue))) { + if (cleanup) { + cleanup(); + } + const currentWatcher = activeWatcher; + activeWatcher = effect2; + try { + const args = [ + newValue, + // pass undefined as the old value when it's changed for the first time + oldValue === INITIAL_WATCHER_VALUE ? void 0 : isMultiSource && oldValue[0] === INITIAL_WATCHER_VALUE ? [] : oldValue, + boundCleanup + ]; + call ? call(cb, 3, args) : ( + // @ts-expect-error + cb(...args) + ); + oldValue = newValue; + } finally { + activeWatcher = currentWatcher; + } + } + } else { + effect2.run(); + } + }; + if (augmentJob) { + augmentJob(job); + } + effect2 = new ReactiveEffect(getter); + effect2.scheduler = scheduler ? () => scheduler(job, false) : job; + boundCleanup = (fn) => onWatcherCleanup(fn, false, effect2); + cleanup = effect2.onStop = () => { + const cleanups = cleanupMap.get(effect2); + if (cleanups) { + if (call) { + call(cleanups, 4); + } else { + for (const cleanup2 of cleanups) cleanup2(); + } + cleanupMap.delete(effect2); + } + }; + if (cb) { + if (immediate) { + job(true); + } else { + oldValue = effect2.run(); + } + } else if (scheduler) { + scheduler(job.bind(null, true), true); + } else { + effect2.run(); + } + watchHandle.pause = effect2.pause.bind(effect2); + watchHandle.resume = effect2.resume.bind(effect2); + watchHandle.stop = watchHandle; + return watchHandle; +} +function traverse(value, depth = Infinity, seen2) { + if (depth <= 0 || !isObject$1(value) || value["__v_skip"]) { + return value; + } + seen2 = seen2 || /* @__PURE__ */ new Set(); + if (seen2.has(value)) { + return value; + } + seen2.add(value); + depth--; + if (isRef(value)) { + traverse(value.value, depth, seen2); + } else if (isArray$2(value)) { + for (let i = 0; i < value.length; i++) { + traverse(value[i], depth, seen2); + } + } else if (isSet(value) || isMap(value)) { + value.forEach((v) => { + traverse(v, depth, seen2); + }); + } else if (isPlainObject$2(value)) { + for (const key in value) { + traverse(value[key], depth, seen2); + } + for (const key of Object.getOwnPropertySymbols(value)) { + if (Object.prototype.propertyIsEnumerable.call(value, key)) { + traverse(value[key], depth, seen2); + } + } + } + return value; +} +/** +* @vue/runtime-core v3.5.13 +* (c) 2018-present Yuxi (Evan) You and Vue contributors +* @license MIT +**/ +const stack = []; +let isWarning = false; +function warn$1(msg, ...args) { + if (isWarning) return; + isWarning = true; + pauseTracking(); + const instance = stack.length ? stack[stack.length - 1].component : null; + const appWarnHandler = instance && instance.appContext.config.warnHandler; + const trace = getComponentTrace(); + if (appWarnHandler) { + callWithErrorHandling( + appWarnHandler, + instance, + 11, + [ + // eslint-disable-next-line no-restricted-syntax + msg + args.map((a) => { + var _a, _b; + return (_b = (_a = a.toString) == null ? void 0 : _a.call(a)) != null ? _b : JSON.stringify(a); + }).join(""), + instance && instance.proxy, + trace.map( + ({ vnode }) => `at <${formatComponentName(instance, vnode.type)}>` + ).join("\n"), + trace + ] + ); + } else { + const warnArgs = [`[Vue warn]: ${msg}`, ...args]; + if (trace.length && // avoid spamming console during tests + true) { + warnArgs.push(` +`, ...formatTrace(trace)); + } + console.warn(...warnArgs); + } + resetTracking(); + isWarning = false; +} +function getComponentTrace() { + let currentVNode = stack[stack.length - 1]; + if (!currentVNode) { + return []; + } + const normalizedStack = []; + while (currentVNode) { + const last = normalizedStack[0]; + if (last && last.vnode === currentVNode) { + last.recurseCount++; + } else { + normalizedStack.push({ + vnode: currentVNode, + recurseCount: 0 + }); + } + const parentInstance = currentVNode.component && currentVNode.component.parent; + currentVNode = parentInstance && parentInstance.vnode; + } + return normalizedStack; +} +function formatTrace(trace) { + const logs = []; + trace.forEach((entry, i) => { + logs.push(...i === 0 ? [] : [` +`], ...formatTraceEntry(entry)); + }); + return logs; +} +function formatTraceEntry({ vnode, recurseCount }) { + const postfix = recurseCount > 0 ? `... (${recurseCount} recursive calls)` : ``; + const isRoot = vnode.component ? vnode.component.parent == null : false; + const open = ` at <${formatComponentName( + vnode.component, + vnode.type, + isRoot + )}`; + const close = `>` + postfix; + return vnode.props ? [open, ...formatProps(vnode.props), close] : [open + close]; +} +function formatProps(props) { + const res = []; + const keys = Object.keys(props); + keys.slice(0, 3).forEach((key) => { + res.push(...formatProp(key, props[key])); + }); + if (keys.length > 3) { + res.push(` ...`); + } + return res; +} +function formatProp(key, value, raw) { + if (isString$1(value)) { + value = JSON.stringify(value); + return raw ? value : [`${key}=${value}`]; + } else if (typeof value === "number" || typeof value === "boolean" || value == null) { + return raw ? value : [`${key}=${value}`]; + } else if (isRef(value)) { + value = formatProp(key, toRaw(value.value), true); + return raw ? value : [`${key}=Ref<`, value, `>`]; + } else if (isFunction$1(value)) { + return [`${key}=fn${value.name ? `<${value.name}>` : ``}`]; + } else { + value = toRaw(value); + return raw ? value : [`${key}=`, value]; + } +} +function callWithErrorHandling(fn, instance, type, args) { + try { + return args ? fn(...args) : fn(); + } catch (err) { + handleError(err, instance, type); + } +} +function callWithAsyncErrorHandling(fn, instance, type, args) { + if (isFunction$1(fn)) { + const res = callWithErrorHandling(fn, instance, type, args); + if (res && isPromise(res)) { + res.catch((err) => { + handleError(err, instance, type); + }); + } + return res; + } + if (isArray$2(fn)) { + const values = []; + for (let i = 0; i < fn.length; i++) { + values.push(callWithAsyncErrorHandling(fn[i], instance, type, args)); + } + return values; + } +} +function handleError(err, instance, type, throwInDev = true) { + const contextVNode = instance ? instance.vnode : null; + const { errorHandler, throwUnhandledErrorInProduction } = instance && instance.appContext.config || EMPTY_OBJ; + if (instance) { + let cur = instance.parent; + const exposedInstance = instance.proxy; + const errorInfo = `https://vuejs.org/error-reference/#runtime-${type}`; + while (cur) { + const errorCapturedHooks = cur.ec; + if (errorCapturedHooks) { + for (let i = 0; i < errorCapturedHooks.length; i++) { + if (errorCapturedHooks[i](err, exposedInstance, errorInfo) === false) { + return; + } + } + } + cur = cur.parent; + } + if (errorHandler) { + pauseTracking(); + callWithErrorHandling(errorHandler, null, 10, [ + err, + exposedInstance, + errorInfo + ]); + resetTracking(); + return; + } + } + logError(err, type, contextVNode, throwInDev, throwUnhandledErrorInProduction); +} +function logError(err, type, contextVNode, throwInDev = true, throwInProd = false) { + if (throwInProd) { + throw err; + } else { + console.error(err); + } +} +const queue = []; +let flushIndex = -1; +const pendingPostFlushCbs = []; +let activePostFlushCbs = null; +let postFlushIndex = 0; +const resolvedPromise = /* @__PURE__ */ Promise.resolve(); +let currentFlushPromise = null; +function nextTick(fn) { + const p2 = currentFlushPromise || resolvedPromise; + return fn ? p2.then(this ? fn.bind(this) : fn) : p2; +} +function findInsertionIndex$1(id) { + let start = flushIndex + 1; + let end = queue.length; + while (start < end) { + const middle = start + end >>> 1; + const middleJob = queue[middle]; + const middleJobId = getId(middleJob); + if (middleJobId < id || middleJobId === id && middleJob.flags & 2) { + start = middle + 1; + } else { + end = middle; + } + } + return start; +} +function queueJob(job) { + if (!(job.flags & 1)) { + const jobId = getId(job); + const lastJob = queue[queue.length - 1]; + if (!lastJob || // fast path when the job id is larger than the tail + !(job.flags & 2) && jobId >= getId(lastJob)) { + queue.push(job); + } else { + queue.splice(findInsertionIndex$1(jobId), 0, job); + } + job.flags |= 1; + queueFlush(); + } +} +function queueFlush() { + if (!currentFlushPromise) { + currentFlushPromise = resolvedPromise.then(flushJobs); + } +} +function queuePostFlushCb(cb) { + if (!isArray$2(cb)) { + if (activePostFlushCbs && cb.id === -1) { + activePostFlushCbs.splice(postFlushIndex + 1, 0, cb); + } else if (!(cb.flags & 1)) { + pendingPostFlushCbs.push(cb); + cb.flags |= 1; + } + } else { + pendingPostFlushCbs.push(...cb); + } + queueFlush(); +} +function flushPreFlushCbs(instance, seen2, i = flushIndex + 1) { + for (; i < queue.length; i++) { + const cb = queue[i]; + if (cb && cb.flags & 2) { + if (instance && cb.id !== instance.uid) { + continue; + } + queue.splice(i, 1); + i--; + if (cb.flags & 4) { + cb.flags &= -2; + } + cb(); + if (!(cb.flags & 4)) { + cb.flags &= -2; + } + } + } +} +function flushPostFlushCbs(seen2) { + if (pendingPostFlushCbs.length) { + const deduped = [...new Set(pendingPostFlushCbs)].sort( + (a, b) => getId(a) - getId(b) + ); + pendingPostFlushCbs.length = 0; + if (activePostFlushCbs) { + activePostFlushCbs.push(...deduped); + return; + } + activePostFlushCbs = deduped; + for (postFlushIndex = 0; postFlushIndex < activePostFlushCbs.length; postFlushIndex++) { + const cb = activePostFlushCbs[postFlushIndex]; + if (cb.flags & 4) { + cb.flags &= -2; + } + if (!(cb.flags & 8)) cb(); + cb.flags &= -2; + } + activePostFlushCbs = null; + postFlushIndex = 0; + } +} +const getId = (job) => job.id == null ? job.flags & 2 ? -1 : Infinity : job.id; +function flushJobs(seen2) { + try { + for (flushIndex = 0; flushIndex < queue.length; flushIndex++) { + const job = queue[flushIndex]; + if (job && !(job.flags & 8)) { + if (false) ; + if (job.flags & 4) { + job.flags &= ~1; + } + callWithErrorHandling( + job, + job.i, + job.i ? 15 : 14 + ); + if (!(job.flags & 4)) { + job.flags &= ~1; + } + } + } + } finally { + for (; flushIndex < queue.length; flushIndex++) { + const job = queue[flushIndex]; + if (job) { + job.flags &= -2; + } + } + flushIndex = -1; + queue.length = 0; + flushPostFlushCbs(); + currentFlushPromise = null; + if (queue.length || pendingPostFlushCbs.length) { + flushJobs(); + } + } +} +let currentRenderingInstance = null; +let currentScopeId = null; +function setCurrentRenderingInstance(instance) { + const prev = currentRenderingInstance; + currentRenderingInstance = instance; + currentScopeId = instance && instance.type.__scopeId || null; + return prev; +} +function withCtx(fn, ctx = currentRenderingInstance, isNonScopedSlot) { + if (!ctx) return fn; + if (fn._n) { + return fn; + } + const renderFnWithContext = (...args) => { + if (renderFnWithContext._d) { + setBlockTracking(-1); + } + const prevInstance = setCurrentRenderingInstance(ctx); + let res; + try { + res = fn(...args); + } finally { + setCurrentRenderingInstance(prevInstance); + if (renderFnWithContext._d) { + setBlockTracking(1); + } + } + return res; + }; + renderFnWithContext._n = true; + renderFnWithContext._c = true; + renderFnWithContext._d = true; + return renderFnWithContext; +} +function withDirectives(vnode, directives) { + if (currentRenderingInstance === null) { + return vnode; + } + const instance = getComponentPublicInstance(currentRenderingInstance); + const bindings = vnode.dirs || (vnode.dirs = []); + for (let i = 0; i < directives.length; i++) { + let [dir, value, arg, modifiers = EMPTY_OBJ] = directives[i]; + if (dir) { + if (isFunction$1(dir)) { + dir = { + mounted: dir, + updated: dir + }; + } + if (dir.deep) { + traverse(value); + } + bindings.push({ + dir, + instance, + value, + oldValue: void 0, + arg, + modifiers + }); + } + } + return vnode; +} +function invokeDirectiveHook(vnode, prevVNode, instance, name) { + const bindings = vnode.dirs; + const oldBindings = prevVNode && prevVNode.dirs; + for (let i = 0; i < bindings.length; i++) { + const binding = bindings[i]; + if (oldBindings) { + binding.oldValue = oldBindings[i].value; + } + let hook = binding.dir[name]; + if (hook) { + pauseTracking(); + callWithAsyncErrorHandling(hook, instance, 8, [ + vnode.el, + binding, + vnode, + prevVNode + ]); + resetTracking(); + } + } +} +const TeleportEndKey = Symbol("_vte"); +const isTeleport = (type) => type.__isTeleport; +function setTransitionHooks(vnode, hooks) { + if (vnode.shapeFlag & 6 && vnode.component) { + vnode.transition = hooks; + setTransitionHooks(vnode.component.subTree, hooks); + } else if (vnode.shapeFlag & 128) { + vnode.ssContent.transition = hooks.clone(vnode.ssContent); + vnode.ssFallback.transition = hooks.clone(vnode.ssFallback); + } else { + vnode.transition = hooks; + } +} +/*! #__NO_SIDE_EFFECTS__ */ +// @__NO_SIDE_EFFECTS__ +function defineComponent(options, extraOptions) { + return isFunction$1(options) ? ( + // #8236: extend call and options.name access are considered side-effects + // by Rollup, so we have to wrap it in a pure-annotated IIFE. + /* @__PURE__ */ (() => extend$1({ name: options.name }, extraOptions, { setup: options }))() + ) : options; +} +function markAsyncBoundary(instance) { + instance.ids = [instance.ids[0] + instance.ids[2]++ + "-", 0, 0]; +} +function setRef(rawRef, oldRawRef, parentSuspense, vnode, isUnmount = false) { + if (isArray$2(rawRef)) { + rawRef.forEach( + (r, i) => setRef( + r, + oldRawRef && (isArray$2(oldRawRef) ? oldRawRef[i] : oldRawRef), + parentSuspense, + vnode, + isUnmount + ) + ); + return; + } + if (isAsyncWrapper(vnode) && !isUnmount) { + if (vnode.shapeFlag & 512 && vnode.type.__asyncResolved && vnode.component.subTree.component) { + setRef(rawRef, oldRawRef, parentSuspense, vnode.component.subTree); + } + return; + } + const refValue = vnode.shapeFlag & 4 ? getComponentPublicInstance(vnode.component) : vnode.el; + const value = isUnmount ? null : refValue; + const { i: owner, r: ref3 } = rawRef; + const oldRef = oldRawRef && oldRawRef.r; + const refs = owner.refs === EMPTY_OBJ ? owner.refs = {} : owner.refs; + const setupState = owner.setupState; + const rawSetupState = toRaw(setupState); + const canSetSetupRef = setupState === EMPTY_OBJ ? () => false : (key) => { + return hasOwn(rawSetupState, key); + }; + if (oldRef != null && oldRef !== ref3) { + if (isString$1(oldRef)) { + refs[oldRef] = null; + if (canSetSetupRef(oldRef)) { + setupState[oldRef] = null; + } + } else if (isRef(oldRef)) { + oldRef.value = null; + } + } + if (isFunction$1(ref3)) { + callWithErrorHandling(ref3, owner, 12, [value, refs]); + } else { + const _isString = isString$1(ref3); + const _isRef = isRef(ref3); + if (_isString || _isRef) { + const doSet = () => { + if (rawRef.f) { + const existing = _isString ? canSetSetupRef(ref3) ? setupState[ref3] : refs[ref3] : ref3.value; + if (isUnmount) { + isArray$2(existing) && remove(existing, refValue); + } else { + if (!isArray$2(existing)) { + if (_isString) { + refs[ref3] = [refValue]; + if (canSetSetupRef(ref3)) { + setupState[ref3] = refs[ref3]; + } + } else { + ref3.value = [refValue]; + if (rawRef.k) refs[rawRef.k] = ref3.value; + } + } else if (!existing.includes(refValue)) { + existing.push(refValue); + } + } + } else if (_isString) { + refs[ref3] = value; + if (canSetSetupRef(ref3)) { + setupState[ref3] = value; + } + } else if (_isRef) { + ref3.value = value; + if (rawRef.k) refs[rawRef.k] = value; + } else ; + }; + if (value) { + doSet.id = -1; + queuePostRenderEffect(doSet, parentSuspense); + } else { + doSet(); + } + } + } +} +getGlobalThis().requestIdleCallback || ((cb) => setTimeout(cb, 1)); +getGlobalThis().cancelIdleCallback || ((id) => clearTimeout(id)); +const isAsyncWrapper = (i) => !!i.type.__asyncLoader; +const isKeepAlive = (vnode) => vnode.type.__isKeepAlive; +function onActivated(hook, target) { + registerKeepAliveHook(hook, "a", target); +} +function onDeactivated(hook, target) { + registerKeepAliveHook(hook, "da", target); +} +function registerKeepAliveHook(hook, type, target = currentInstance) { + const wrappedHook = hook.__wdc || (hook.__wdc = () => { + let current = target; + while (current) { + if (current.isDeactivated) { + return; + } + current = current.parent; + } + return hook(); + }); + injectHook(type, wrappedHook, target); + if (target) { + let current = target.parent; + while (current && current.parent) { + if (isKeepAlive(current.parent.vnode)) { + injectToKeepAliveRoot(wrappedHook, type, target, current); + } + current = current.parent; + } + } +} +function injectToKeepAliveRoot(hook, type, target, keepAliveRoot) { + const injected = injectHook( + type, + hook, + keepAliveRoot, + true + /* prepend */ + ); + onUnmounted(() => { + remove(keepAliveRoot[type], injected); + }, target); +} +function injectHook(type, hook, target = currentInstance, prepend = false) { + if (target) { + const hooks = target[type] || (target[type] = []); + const wrappedHook = hook.__weh || (hook.__weh = (...args) => { + pauseTracking(); + const reset = setCurrentInstance(target); + const res = callWithAsyncErrorHandling(hook, target, type, args); + reset(); + resetTracking(); + return res; + }); + if (prepend) { + hooks.unshift(wrappedHook); + } else { + hooks.push(wrappedHook); + } + return wrappedHook; + } +} +const createHook = (lifecycle) => (hook, target = currentInstance) => { + if (!isInSSRComponentSetup || lifecycle === "sp") { + injectHook(lifecycle, (...args) => hook(...args), target); + } +}; +const onBeforeMount = createHook("bm"); +const onMounted = createHook("m"); +const onBeforeUpdate = createHook( + "bu" +); +const onUpdated = createHook("u"); +const onBeforeUnmount = createHook( + "bum" +); +const onUnmounted = createHook("um"); +const onServerPrefetch = createHook( + "sp" +); +const onRenderTriggered = createHook("rtg"); +const onRenderTracked = createHook("rtc"); +function onErrorCaptured(hook, target = currentInstance) { + injectHook("ec", hook, target); +} +const NULL_DYNAMIC_COMPONENT = Symbol.for("v-ndc"); +function renderList(source, renderItem, cache, index) { + let ret; + const cached = cache; + const sourceIsArray = isArray$2(source); + if (sourceIsArray || isString$1(source)) { + const sourceIsReactiveArray = sourceIsArray && isReactive(source); + let needsWrap = false; + if (sourceIsReactiveArray) { + needsWrap = !isShallow(source); + source = shallowReadArray(source); + } + ret = new Array(source.length); + for (let i = 0, l = source.length; i < l; i++) { + ret[i] = renderItem( + needsWrap ? toReactive(source[i]) : source[i], + i, + void 0, + cached + ); + } + } else if (typeof source === "number") { + ret = new Array(source); + for (let i = 0; i < source; i++) { + ret[i] = renderItem(i + 1, i, void 0, cached); + } + } else if (isObject$1(source)) { + if (source[Symbol.iterator]) { + ret = Array.from( + source, + (item, i) => renderItem(item, i, void 0, cached) + ); + } else { + const keys = Object.keys(source); + ret = new Array(keys.length); + for (let i = 0, l = keys.length; i < l; i++) { + const key = keys[i]; + ret[i] = renderItem(source[key], key, i, cached); + } + } + } else { + ret = []; + } + return ret; +} +function renderSlot(slots, name, props = {}, fallback, noSlotted) { + if (currentRenderingInstance.ce || currentRenderingInstance.parent && isAsyncWrapper(currentRenderingInstance.parent) && currentRenderingInstance.parent.ce) { + if (name !== "default") props.name = name; + return openBlock(), createBlock( + Fragment, + null, + [createVNode("slot", props, fallback)], + 64 + ); + } + let slot = slots[name]; + if (slot && slot._c) { + slot._d = false; + } + openBlock(); + const validSlotContent = slot && ensureValidVNode(slot(props)); + const slotKey = props.key || // slot content array of a dynamic conditional slot may have a branch + // key attached in the `createSlots` helper, respect that + validSlotContent && validSlotContent.key; + const rendered = createBlock( + Fragment, + { + key: (slotKey && !isSymbol(slotKey) ? slotKey : `_${name}`) + // #7256 force differentiate fallback content from actual content + "" + }, + validSlotContent || [], + validSlotContent && slots._ === 1 ? 64 : -2 + ); + if (!noSlotted && rendered.scopeId) { + rendered.slotScopeIds = [rendered.scopeId + "-s"]; + } + if (slot && slot._c) { + slot._d = true; + } + return rendered; +} +function ensureValidVNode(vnodes) { + return vnodes.some((child) => { + if (!isVNode(child)) return true; + if (child.type === Comment) return false; + if (child.type === Fragment && !ensureValidVNode(child.children)) + return false; + return true; + }) ? vnodes : null; +} +const getPublicInstance = (i) => { + if (!i) return null; + if (isStatefulComponent(i)) return getComponentPublicInstance(i); + return getPublicInstance(i.parent); +}; +const publicPropertiesMap = ( + // Move PURE marker to new line to workaround compiler discarding it + // due to type annotation + /* @__PURE__ */ extend$1(/* @__PURE__ */ Object.create(null), { + $: (i) => i, + $el: (i) => i.vnode.el, + $data: (i) => i.data, + $props: (i) => i.props, + $attrs: (i) => i.attrs, + $slots: (i) => i.slots, + $refs: (i) => i.refs, + $parent: (i) => getPublicInstance(i.parent), + $root: (i) => getPublicInstance(i.root), + $host: (i) => i.ce, + $emit: (i) => i.emit, + $options: (i) => resolveMergedOptions(i), + $forceUpdate: (i) => i.f || (i.f = () => { + queueJob(i.update); + }), + $nextTick: (i) => i.n || (i.n = nextTick.bind(i.proxy)), + $watch: (i) => instanceWatch.bind(i) + }) +); +const hasSetupBinding = (state, key) => state !== EMPTY_OBJ && !state.__isScriptSetup && hasOwn(state, key); +const PublicInstanceProxyHandlers = { + get({ _: instance }, key) { + if (key === "__v_skip") { + return true; + } + const { ctx, setupState, data, props, accessCache, type, appContext } = instance; + let normalizedProps; + if (key[0] !== "$") { + const n = accessCache[key]; + if (n !== void 0) { + switch (n) { + case 1: + return setupState[key]; + case 2: + return data[key]; + case 4: + return ctx[key]; + case 3: + return props[key]; + } + } else if (hasSetupBinding(setupState, key)) { + accessCache[key] = 1; + return setupState[key]; + } else if (data !== EMPTY_OBJ && hasOwn(data, key)) { + accessCache[key] = 2; + return data[key]; + } else if ( + // only cache other properties when instance has declared (thus stable) + // props + (normalizedProps = instance.propsOptions[0]) && hasOwn(normalizedProps, key) + ) { + accessCache[key] = 3; + return props[key]; + } else if (ctx !== EMPTY_OBJ && hasOwn(ctx, key)) { + accessCache[key] = 4; + return ctx[key]; + } else if (shouldCacheAccess) { + accessCache[key] = 0; + } + } + const publicGetter = publicPropertiesMap[key]; + let cssModule, globalProperties; + if (publicGetter) { + if (key === "$attrs") { + track(instance.attrs, "get", ""); + } + return publicGetter(instance); + } else if ( + // css module (injected by vue-loader) + (cssModule = type.__cssModules) && (cssModule = cssModule[key]) + ) { + return cssModule; + } else if (ctx !== EMPTY_OBJ && hasOwn(ctx, key)) { + accessCache[key] = 4; + return ctx[key]; + } else if ( + // global properties + globalProperties = appContext.config.globalProperties, hasOwn(globalProperties, key) + ) { + { + return globalProperties[key]; + } + } else ; + }, + set({ _: instance }, key, value) { + const { data, setupState, ctx } = instance; + if (hasSetupBinding(setupState, key)) { + setupState[key] = value; + return true; + } else if (data !== EMPTY_OBJ && hasOwn(data, key)) { + data[key] = value; + return true; + } else if (hasOwn(instance.props, key)) { + return false; + } + if (key[0] === "$" && key.slice(1) in instance) { + return false; + } else { + { + ctx[key] = value; + } + } + return true; + }, + has({ + _: { data, setupState, accessCache, ctx, appContext, propsOptions } + }, key) { + let normalizedProps; + return !!accessCache[key] || data !== EMPTY_OBJ && hasOwn(data, key) || hasSetupBinding(setupState, key) || (normalizedProps = propsOptions[0]) && hasOwn(normalizedProps, key) || hasOwn(ctx, key) || hasOwn(publicPropertiesMap, key) || hasOwn(appContext.config.globalProperties, key); + }, + defineProperty(target, key, descriptor) { + if (descriptor.get != null) { + target._.accessCache[key] = 0; + } else if (hasOwn(descriptor, "value")) { + this.set(target, key, descriptor.value, null); + } + return Reflect.defineProperty(target, key, descriptor); + } +}; +function normalizePropsOrEmits(props) { + return isArray$2(props) ? props.reduce( + (normalized, p2) => (normalized[p2] = null, normalized), + {} + ) : props; +} +let shouldCacheAccess = true; +function applyOptions(instance) { + const options = resolveMergedOptions(instance); + const publicThis = instance.proxy; + const ctx = instance.ctx; + shouldCacheAccess = false; + if (options.beforeCreate) { + callHook(options.beforeCreate, instance, "bc"); + } + const { + // state + data: dataOptions, + computed: computedOptions, + methods, + watch: watchOptions, + provide: provideOptions, + inject: injectOptions, + // lifecycle + created, + beforeMount, + mounted, + beforeUpdate, + updated, + activated, + deactivated, + beforeDestroy, + beforeUnmount, + destroyed, + unmounted, + render, + renderTracked, + renderTriggered, + errorCaptured, + serverPrefetch, + // public API + expose, + inheritAttrs, + // assets + components, + directives, + filters + } = options; + const checkDuplicateProperties = null; + if (injectOptions) { + resolveInjections(injectOptions, ctx, checkDuplicateProperties); + } + if (methods) { + for (const key in methods) { + const methodHandler = methods[key]; + if (isFunction$1(methodHandler)) { + { + ctx[key] = methodHandler.bind(publicThis); + } + } + } + } + if (dataOptions) { + const data = dataOptions.call(publicThis, publicThis); + if (!isObject$1(data)) ; + else { + instance.data = reactive(data); + } + } + shouldCacheAccess = true; + if (computedOptions) { + for (const key in computedOptions) { + const opt = computedOptions[key]; + const get = isFunction$1(opt) ? opt.bind(publicThis, publicThis) : isFunction$1(opt.get) ? opt.get.bind(publicThis, publicThis) : NOOP; + const set = !isFunction$1(opt) && isFunction$1(opt.set) ? opt.set.bind(publicThis) : NOOP; + const c = computed({ + get, + set + }); + Object.defineProperty(ctx, key, { + enumerable: true, + configurable: true, + get: () => c.value, + set: (v) => c.value = v + }); + } + } + if (watchOptions) { + for (const key in watchOptions) { + createWatcher(watchOptions[key], ctx, publicThis, key); + } + } + if (provideOptions) { + const provides = isFunction$1(provideOptions) ? provideOptions.call(publicThis) : provideOptions; + Reflect.ownKeys(provides).forEach((key) => { + provide(key, provides[key]); + }); + } + if (created) { + callHook(created, instance, "c"); + } + function registerLifecycleHook(register, hook) { + if (isArray$2(hook)) { + hook.forEach((_hook) => register(_hook.bind(publicThis))); + } else if (hook) { + register(hook.bind(publicThis)); + } + } + registerLifecycleHook(onBeforeMount, beforeMount); + registerLifecycleHook(onMounted, mounted); + registerLifecycleHook(onBeforeUpdate, beforeUpdate); + registerLifecycleHook(onUpdated, updated); + registerLifecycleHook(onActivated, activated); + registerLifecycleHook(onDeactivated, deactivated); + registerLifecycleHook(onErrorCaptured, errorCaptured); + registerLifecycleHook(onRenderTracked, renderTracked); + registerLifecycleHook(onRenderTriggered, renderTriggered); + registerLifecycleHook(onBeforeUnmount, beforeUnmount); + registerLifecycleHook(onUnmounted, unmounted); + registerLifecycleHook(onServerPrefetch, serverPrefetch); + if (isArray$2(expose)) { + if (expose.length) { + const exposed = instance.exposed || (instance.exposed = {}); + expose.forEach((key) => { + Object.defineProperty(exposed, key, { + get: () => publicThis[key], + set: (val) => publicThis[key] = val + }); + }); + } else if (!instance.exposed) { + instance.exposed = {}; + } + } + if (render && instance.render === NOOP) { + instance.render = render; + } + if (inheritAttrs != null) { + instance.inheritAttrs = inheritAttrs; + } + if (components) instance.components = components; + if (directives) instance.directives = directives; + if (serverPrefetch) { + markAsyncBoundary(instance); + } +} +function resolveInjections(injectOptions, ctx, checkDuplicateProperties = NOOP) { + if (isArray$2(injectOptions)) { + injectOptions = normalizeInject(injectOptions); + } + for (const key in injectOptions) { + const opt = injectOptions[key]; + let injected; + if (isObject$1(opt)) { + if ("default" in opt) { + injected = inject( + opt.from || key, + opt.default, + true + ); + } else { + injected = inject(opt.from || key); + } + } else { + injected = inject(opt); + } + if (isRef(injected)) { + Object.defineProperty(ctx, key, { + enumerable: true, + configurable: true, + get: () => injected.value, + set: (v) => injected.value = v + }); + } else { + ctx[key] = injected; + } + } +} +function callHook(hook, instance, type) { + callWithAsyncErrorHandling( + isArray$2(hook) ? hook.map((h2) => h2.bind(instance.proxy)) : hook.bind(instance.proxy), + instance, + type + ); +} +function createWatcher(raw, ctx, publicThis, key) { + let getter = key.includes(".") ? createPathGetter(publicThis, key) : () => publicThis[key]; + if (isString$1(raw)) { + const handler = ctx[raw]; + if (isFunction$1(handler)) { + { + watch(getter, handler); + } + } + } else if (isFunction$1(raw)) { + { + watch(getter, raw.bind(publicThis)); + } + } else if (isObject$1(raw)) { + if (isArray$2(raw)) { + raw.forEach((r) => createWatcher(r, ctx, publicThis, key)); + } else { + const handler = isFunction$1(raw.handler) ? raw.handler.bind(publicThis) : ctx[raw.handler]; + if (isFunction$1(handler)) { + watch(getter, handler, raw); + } + } + } else ; +} +function resolveMergedOptions(instance) { + const base = instance.type; + const { mixins, extends: extendsOptions } = base; + const { + mixins: globalMixins, + optionsCache: cache, + config: { optionMergeStrategies } + } = instance.appContext; + const cached = cache.get(base); + let resolved; + if (cached) { + resolved = cached; + } else if (!globalMixins.length && !mixins && !extendsOptions) { + { + resolved = base; + } + } else { + resolved = {}; + if (globalMixins.length) { + globalMixins.forEach( + (m) => mergeOptions$1(resolved, m, optionMergeStrategies, true) + ); + } + mergeOptions$1(resolved, base, optionMergeStrategies); + } + if (isObject$1(base)) { + cache.set(base, resolved); + } + return resolved; +} +function mergeOptions$1(to, from, strats, asMixin = false) { + const { mixins, extends: extendsOptions } = from; + if (extendsOptions) { + mergeOptions$1(to, extendsOptions, strats, true); + } + if (mixins) { + mixins.forEach( + (m) => mergeOptions$1(to, m, strats, true) + ); + } + for (const key in from) { + if (asMixin && key === "expose") ; + else { + const strat = internalOptionMergeStrats[key] || strats && strats[key]; + to[key] = strat ? strat(to[key], from[key]) : from[key]; + } + } + return to; +} +const internalOptionMergeStrats = { + data: mergeDataFn, + props: mergeEmitsOrPropsOptions, + emits: mergeEmitsOrPropsOptions, + // objects + methods: mergeObjectOptions, + computed: mergeObjectOptions, + // lifecycle + beforeCreate: mergeAsArray, + created: mergeAsArray, + beforeMount: mergeAsArray, + mounted: mergeAsArray, + beforeUpdate: mergeAsArray, + updated: mergeAsArray, + beforeDestroy: mergeAsArray, + beforeUnmount: mergeAsArray, + destroyed: mergeAsArray, + unmounted: mergeAsArray, + activated: mergeAsArray, + deactivated: mergeAsArray, + errorCaptured: mergeAsArray, + serverPrefetch: mergeAsArray, + // assets + components: mergeObjectOptions, + directives: mergeObjectOptions, + // watch + watch: mergeWatchOptions, + // provide / inject + provide: mergeDataFn, + inject: mergeInject +}; +function mergeDataFn(to, from) { + if (!from) { + return to; + } + if (!to) { + return from; + } + return function mergedDataFn() { + return extend$1( + isFunction$1(to) ? to.call(this, this) : to, + isFunction$1(from) ? from.call(this, this) : from + ); + }; +} +function mergeInject(to, from) { + return mergeObjectOptions(normalizeInject(to), normalizeInject(from)); +} +function normalizeInject(raw) { + if (isArray$2(raw)) { + const res = {}; + for (let i = 0; i < raw.length; i++) { + res[raw[i]] = raw[i]; + } + return res; + } + return raw; +} +function mergeAsArray(to, from) { + return to ? [...new Set([].concat(to, from))] : from; +} +function mergeObjectOptions(to, from) { + return to ? extend$1(/* @__PURE__ */ Object.create(null), to, from) : from; +} +function mergeEmitsOrPropsOptions(to, from) { + if (to) { + if (isArray$2(to) && isArray$2(from)) { + return [.../* @__PURE__ */ new Set([...to, ...from])]; + } + return extend$1( + /* @__PURE__ */ Object.create(null), + normalizePropsOrEmits(to), + normalizePropsOrEmits(from != null ? from : {}) + ); + } else { + return from; + } +} +function mergeWatchOptions(to, from) { + if (!to) return from; + if (!from) return to; + const merged = extend$1(/* @__PURE__ */ Object.create(null), to); + for (const key in from) { + merged[key] = mergeAsArray(to[key], from[key]); + } + return merged; +} +function createAppContext() { + return { + app: null, + config: { + isNativeTag: NO, + performance: false, + globalProperties: {}, + optionMergeStrategies: {}, + errorHandler: void 0, + warnHandler: void 0, + compilerOptions: {} + }, + mixins: [], + components: {}, + directives: {}, + provides: /* @__PURE__ */ Object.create(null), + optionsCache: /* @__PURE__ */ new WeakMap(), + propsCache: /* @__PURE__ */ new WeakMap(), + emitsCache: /* @__PURE__ */ new WeakMap() + }; +} +let uid$1 = 0; +function createAppAPI(render, hydrate) { + return function createApp2(rootComponent, rootProps = null) { + if (!isFunction$1(rootComponent)) { + rootComponent = extend$1({}, rootComponent); + } + if (rootProps != null && !isObject$1(rootProps)) { + rootProps = null; + } + const context = createAppContext(); + const installedPlugins = /* @__PURE__ */ new WeakSet(); + const pluginCleanupFns = []; + let isMounted = false; + const app2 = context.app = { + _uid: uid$1++, + _component: rootComponent, + _props: rootProps, + _container: null, + _context: context, + _instance: null, + version, + get config() { + return context.config; + }, + set config(v) { + }, + use(plugin, ...options) { + if (installedPlugins.has(plugin)) ; + else if (plugin && isFunction$1(plugin.install)) { + installedPlugins.add(plugin); + plugin.install(app2, ...options); + } else if (isFunction$1(plugin)) { + installedPlugins.add(plugin); + plugin(app2, ...options); + } else ; + return app2; + }, + mixin(mixin) { + { + if (!context.mixins.includes(mixin)) { + context.mixins.push(mixin); + } + } + return app2; + }, + component(name, component) { + if (!component) { + return context.components[name]; + } + context.components[name] = component; + return app2; + }, + directive(name, directive) { + if (!directive) { + return context.directives[name]; + } + context.directives[name] = directive; + return app2; + }, + mount(rootContainer, isHydrate, namespace) { + if (!isMounted) { + const vnode = app2._ceVNode || createVNode(rootComponent, rootProps); + vnode.appContext = context; + if (namespace === true) { + namespace = "svg"; + } else if (namespace === false) { + namespace = void 0; + } + { + render(vnode, rootContainer, namespace); + } + isMounted = true; + app2._container = rootContainer; + rootContainer.__vue_app__ = app2; + return getComponentPublicInstance(vnode.component); + } + }, + onUnmount(cleanupFn) { + pluginCleanupFns.push(cleanupFn); + }, + unmount() { + if (isMounted) { + callWithAsyncErrorHandling( + pluginCleanupFns, + app2._instance, + 16 + ); + render(null, app2._container); + delete app2._container.__vue_app__; + } + }, + provide(key, value) { + context.provides[key] = value; + return app2; + }, + runWithContext(fn) { + const lastApp = currentApp; + currentApp = app2; + try { + return fn(); + } finally { + currentApp = lastApp; + } + } + }; + return app2; + }; +} +let currentApp = null; +function provide(key, value) { + if (!currentInstance) ; + else { + let provides = currentInstance.provides; + const parentProvides = currentInstance.parent && currentInstance.parent.provides; + if (parentProvides === provides) { + provides = currentInstance.provides = Object.create(parentProvides); + } + provides[key] = value; + } +} +function inject(key, defaultValue, treatDefaultAsFactory = false) { + const instance = currentInstance || currentRenderingInstance; + if (instance || currentApp) { + const provides = currentApp ? currentApp._context.provides : instance ? instance.parent == null ? instance.vnode.appContext && instance.vnode.appContext.provides : instance.parent.provides : void 0; + if (provides && key in provides) { + return provides[key]; + } else if (arguments.length > 1) { + return treatDefaultAsFactory && isFunction$1(defaultValue) ? defaultValue.call(instance && instance.proxy) : defaultValue; + } else ; + } +} +function hasInjectionContext() { + return !!(currentInstance || currentRenderingInstance || currentApp); +} +const internalObjectProto = {}; +const createInternalObject = () => Object.create(internalObjectProto); +const isInternalObject = (obj) => Object.getPrototypeOf(obj) === internalObjectProto; +function initProps(instance, rawProps, isStateful, isSSR = false) { + const props = {}; + const attrs = createInternalObject(); + instance.propsDefaults = /* @__PURE__ */ Object.create(null); + setFullProps(instance, rawProps, props, attrs); + for (const key in instance.propsOptions[0]) { + if (!(key in props)) { + props[key] = void 0; + } + } + if (isStateful) { + instance.props = isSSR ? props : shallowReactive(props); + } else { + if (!instance.type.props) { + instance.props = attrs; + } else { + instance.props = props; + } + } + instance.attrs = attrs; +} +function updateProps(instance, rawProps, rawPrevProps, optimized) { + const { + props, + attrs, + vnode: { patchFlag } + } = instance; + const rawCurrentProps = toRaw(props); + const [options] = instance.propsOptions; + let hasAttrsChanged = false; + if ( + // always force full diff in dev + // - #1942 if hmr is enabled with sfc component + // - vite#872 non-sfc component used by sfc component + (optimized || patchFlag > 0) && !(patchFlag & 16) + ) { + if (patchFlag & 8) { + const propsToUpdate = instance.vnode.dynamicProps; + for (let i = 0; i < propsToUpdate.length; i++) { + let key = propsToUpdate[i]; + if (isEmitListener(instance.emitsOptions, key)) { + continue; + } + const value = rawProps[key]; + if (options) { + if (hasOwn(attrs, key)) { + if (value !== attrs[key]) { + attrs[key] = value; + hasAttrsChanged = true; + } + } else { + const camelizedKey = camelize(key); + props[camelizedKey] = resolvePropValue( + options, + rawCurrentProps, + camelizedKey, + value, + instance, + false + ); + } + } else { + if (value !== attrs[key]) { + attrs[key] = value; + hasAttrsChanged = true; + } + } + } + } + } else { + if (setFullProps(instance, rawProps, props, attrs)) { + hasAttrsChanged = true; + } + let kebabKey; + for (const key in rawCurrentProps) { + if (!rawProps || // for camelCase + !hasOwn(rawProps, key) && // it's possible the original props was passed in as kebab-case + // and converted to camelCase (#955) + ((kebabKey = hyphenate(key)) === key || !hasOwn(rawProps, kebabKey))) { + if (options) { + if (rawPrevProps && // for camelCase + (rawPrevProps[key] !== void 0 || // for kebab-case + rawPrevProps[kebabKey] !== void 0)) { + props[key] = resolvePropValue( + options, + rawCurrentProps, + key, + void 0, + instance, + true + ); + } + } else { + delete props[key]; + } + } + } + if (attrs !== rawCurrentProps) { + for (const key in attrs) { + if (!rawProps || !hasOwn(rawProps, key) && true) { + delete attrs[key]; + hasAttrsChanged = true; + } + } + } + } + if (hasAttrsChanged) { + trigger(instance.attrs, "set", ""); + } +} +function setFullProps(instance, rawProps, props, attrs) { + const [options, needCastKeys] = instance.propsOptions; + let hasAttrsChanged = false; + let rawCastValues; + if (rawProps) { + for (let key in rawProps) { + if (isReservedProp(key)) { + continue; + } + const value = rawProps[key]; + let camelKey; + if (options && hasOwn(options, camelKey = camelize(key))) { + if (!needCastKeys || !needCastKeys.includes(camelKey)) { + props[camelKey] = value; + } else { + (rawCastValues || (rawCastValues = {}))[camelKey] = value; + } + } else if (!isEmitListener(instance.emitsOptions, key)) { + if (!(key in attrs) || value !== attrs[key]) { + attrs[key] = value; + hasAttrsChanged = true; + } + } + } + } + if (needCastKeys) { + const rawCurrentProps = toRaw(props); + const castValues = rawCastValues || EMPTY_OBJ; + for (let i = 0; i < needCastKeys.length; i++) { + const key = needCastKeys[i]; + props[key] = resolvePropValue( + options, + rawCurrentProps, + key, + castValues[key], + instance, + !hasOwn(castValues, key) + ); + } + } + return hasAttrsChanged; +} +function resolvePropValue(options, props, key, value, instance, isAbsent) { + const opt = options[key]; + if (opt != null) { + const hasDefault = hasOwn(opt, "default"); + if (hasDefault && value === void 0) { + const defaultValue = opt.default; + if (opt.type !== Function && !opt.skipFactory && isFunction$1(defaultValue)) { + const { propsDefaults } = instance; + if (key in propsDefaults) { + value = propsDefaults[key]; + } else { + const reset = setCurrentInstance(instance); + value = propsDefaults[key] = defaultValue.call( + null, + props + ); + reset(); + } + } else { + value = defaultValue; + } + if (instance.ce) { + instance.ce._setProp(key, value); + } + } + if (opt[ + 0 + /* shouldCast */ + ]) { + if (isAbsent && !hasDefault) { + value = false; + } else if (opt[ + 1 + /* shouldCastTrue */ + ] && (value === "" || value === hyphenate(key))) { + value = true; + } + } + } + return value; +} +const mixinPropsCache = /* @__PURE__ */ new WeakMap(); +function normalizePropsOptions(comp, appContext, asMixin = false) { + const cache = asMixin ? mixinPropsCache : appContext.propsCache; + const cached = cache.get(comp); + if (cached) { + return cached; + } + const raw = comp.props; + const normalized = {}; + const needCastKeys = []; + let hasExtends = false; + if (!isFunction$1(comp)) { + const extendProps = (raw2) => { + hasExtends = true; + const [props, keys] = normalizePropsOptions(raw2, appContext, true); + extend$1(normalized, props); + if (keys) needCastKeys.push(...keys); + }; + if (!asMixin && appContext.mixins.length) { + appContext.mixins.forEach(extendProps); + } + if (comp.extends) { + extendProps(comp.extends); + } + if (comp.mixins) { + comp.mixins.forEach(extendProps); + } + } + if (!raw && !hasExtends) { + if (isObject$1(comp)) { + cache.set(comp, EMPTY_ARR); + } + return EMPTY_ARR; + } + if (isArray$2(raw)) { + for (let i = 0; i < raw.length; i++) { + const normalizedKey = camelize(raw[i]); + if (validatePropName(normalizedKey)) { + normalized[normalizedKey] = EMPTY_OBJ; + } + } + } else if (raw) { + for (const key in raw) { + const normalizedKey = camelize(key); + if (validatePropName(normalizedKey)) { + const opt = raw[key]; + const prop = normalized[normalizedKey] = isArray$2(opt) || isFunction$1(opt) ? { type: opt } : extend$1({}, opt); + const propType = prop.type; + let shouldCast = false; + let shouldCastTrue = true; + if (isArray$2(propType)) { + for (let index = 0; index < propType.length; ++index) { + const type = propType[index]; + const typeName = isFunction$1(type) && type.name; + if (typeName === "Boolean") { + shouldCast = true; + break; + } else if (typeName === "String") { + shouldCastTrue = false; + } + } + } else { + shouldCast = isFunction$1(propType) && propType.name === "Boolean"; + } + prop[ + 0 + /* shouldCast */ + ] = shouldCast; + prop[ + 1 + /* shouldCastTrue */ + ] = shouldCastTrue; + if (shouldCast || hasOwn(prop, "default")) { + needCastKeys.push(normalizedKey); + } + } + } + } + const res = [normalized, needCastKeys]; + if (isObject$1(comp)) { + cache.set(comp, res); + } + return res; +} +function validatePropName(key) { + if (key[0] !== "$" && !isReservedProp(key)) { + return true; + } + return false; +} +const isInternalKey = (key) => key[0] === "_" || key === "$stable"; +const normalizeSlotValue = (value) => isArray$2(value) ? value.map(normalizeVNode) : [normalizeVNode(value)]; +const normalizeSlot$1 = (key, rawSlot, ctx) => { + if (rawSlot._n) { + return rawSlot; + } + const normalized = withCtx((...args) => { + if (false) ; + return normalizeSlotValue(rawSlot(...args)); + }, ctx); + normalized._c = false; + return normalized; +}; +const normalizeObjectSlots = (rawSlots, slots, instance) => { + const ctx = rawSlots._ctx; + for (const key in rawSlots) { + if (isInternalKey(key)) continue; + const value = rawSlots[key]; + if (isFunction$1(value)) { + slots[key] = normalizeSlot$1(key, value, ctx); + } else if (value != null) { + const normalized = normalizeSlotValue(value); + slots[key] = () => normalized; + } + } +}; +const normalizeVNodeSlots = (instance, children) => { + const normalized = normalizeSlotValue(children); + instance.slots.default = () => normalized; +}; +const assignSlots = (slots, children, optimized) => { + for (const key in children) { + if (optimized || key !== "_") { + slots[key] = children[key]; + } + } +}; +const initSlots = (instance, children, optimized) => { + const slots = instance.slots = createInternalObject(); + if (instance.vnode.shapeFlag & 32) { + const type = children._; + if (type) { + assignSlots(slots, children, optimized); + if (optimized) { + def(slots, "_", type, true); + } + } else { + normalizeObjectSlots(children, slots); + } + } else if (children) { + normalizeVNodeSlots(instance, children); + } +}; +const updateSlots = (instance, children, optimized) => { + const { vnode, slots } = instance; + let needDeletionCheck = true; + let deletionComparisonTarget = EMPTY_OBJ; + if (vnode.shapeFlag & 32) { + const type = children._; + if (type) { + if (optimized && type === 1) { + needDeletionCheck = false; + } else { + assignSlots(slots, children, optimized); + } + } else { + needDeletionCheck = !children.$stable; + normalizeObjectSlots(children, slots); + } + deletionComparisonTarget = children; + } else if (children) { + normalizeVNodeSlots(instance, children); + deletionComparisonTarget = { default: 1 }; + } + if (needDeletionCheck) { + for (const key in slots) { + if (!isInternalKey(key) && deletionComparisonTarget[key] == null) { + delete slots[key]; + } + } + } +}; +const queuePostRenderEffect = queueEffectWithSuspense; +function createRenderer(options) { + return baseCreateRenderer(options); +} +function baseCreateRenderer(options, createHydrationFns) { + const target = getGlobalThis(); + target.__VUE__ = true; + const { + insert: hostInsert, + remove: hostRemove, + patchProp: hostPatchProp, + createElement: hostCreateElement, + createText: hostCreateText, + createComment: hostCreateComment, + setText: hostSetText, + setElementText: hostSetElementText, + parentNode: hostParentNode, + nextSibling: hostNextSibling, + setScopeId: hostSetScopeId = NOOP, + insertStaticContent: hostInsertStaticContent + } = options; + const patch = (n1, n2, container, anchor = null, parentComponent = null, parentSuspense = null, namespace = void 0, slotScopeIds = null, optimized = !!n2.dynamicChildren) => { + if (n1 === n2) { + return; + } + if (n1 && !isSameVNodeType(n1, n2)) { + anchor = getNextHostNode(n1); + unmount(n1, parentComponent, parentSuspense, true); + n1 = null; + } + if (n2.patchFlag === -2) { + optimized = false; + n2.dynamicChildren = null; + } + const { type, ref: ref3, shapeFlag } = n2; + switch (type) { + case Text: + processText(n1, n2, container, anchor); + break; + case Comment: + processCommentNode(n1, n2, container, anchor); + break; + case Static: + if (n1 == null) { + mountStaticNode(n2, container, anchor, namespace); + } + break; + case Fragment: + processFragment( + n1, + n2, + container, + anchor, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized + ); + break; + default: + if (shapeFlag & 1) { + processElement( + n1, + n2, + container, + anchor, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized + ); + } else if (shapeFlag & 6) { + processComponent( + n1, + n2, + container, + anchor, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized + ); + } else if (shapeFlag & 64) { + type.process( + n1, + n2, + container, + anchor, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized, + internals + ); + } else if (shapeFlag & 128) { + type.process( + n1, + n2, + container, + anchor, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized, + internals + ); + } else ; + } + if (ref3 != null && parentComponent) { + setRef(ref3, n1 && n1.ref, parentSuspense, n2 || n1, !n2); + } + }; + const processText = (n1, n2, container, anchor) => { + if (n1 == null) { + hostInsert( + n2.el = hostCreateText(n2.children), + container, + anchor + ); + } else { + const el = n2.el = n1.el; + if (n2.children !== n1.children) { + hostSetText(el, n2.children); + } + } + }; + const processCommentNode = (n1, n2, container, anchor) => { + if (n1 == null) { + hostInsert( + n2.el = hostCreateComment(n2.children || ""), + container, + anchor + ); + } else { + n2.el = n1.el; + } + }; + const mountStaticNode = (n2, container, anchor, namespace) => { + [n2.el, n2.anchor] = hostInsertStaticContent( + n2.children, + container, + anchor, + namespace, + n2.el, + n2.anchor + ); + }; + const moveStaticNode = ({ el, anchor }, container, nextSibling) => { + let next; + while (el && el !== anchor) { + next = hostNextSibling(el); + hostInsert(el, container, nextSibling); + el = next; + } + hostInsert(anchor, container, nextSibling); + }; + const removeStaticNode = ({ el, anchor }) => { + let next; + while (el && el !== anchor) { + next = hostNextSibling(el); + hostRemove(el); + el = next; + } + hostRemove(anchor); + }; + const processElement = (n1, n2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => { + if (n2.type === "svg") { + namespace = "svg"; + } else if (n2.type === "math") { + namespace = "mathml"; + } + if (n1 == null) { + mountElement( + n2, + container, + anchor, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized + ); + } else { + patchElement( + n1, + n2, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized + ); + } + }; + const mountElement = (vnode, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => { + let el; + let vnodeHook; + const { props, shapeFlag, transition, dirs } = vnode; + el = vnode.el = hostCreateElement( + vnode.type, + namespace, + props && props.is, + props + ); + if (shapeFlag & 8) { + hostSetElementText(el, vnode.children); + } else if (shapeFlag & 16) { + mountChildren( + vnode.children, + el, + null, + parentComponent, + parentSuspense, + resolveChildrenNamespace(vnode, namespace), + slotScopeIds, + optimized + ); + } + if (dirs) { + invokeDirectiveHook(vnode, null, parentComponent, "created"); + } + setScopeId(el, vnode, vnode.scopeId, slotScopeIds, parentComponent); + if (props) { + for (const key in props) { + if (key !== "value" && !isReservedProp(key)) { + hostPatchProp(el, key, null, props[key], namespace, parentComponent); + } + } + if ("value" in props) { + hostPatchProp(el, "value", null, props.value, namespace); + } + if (vnodeHook = props.onVnodeBeforeMount) { + invokeVNodeHook(vnodeHook, parentComponent, vnode); + } + } + if (dirs) { + invokeDirectiveHook(vnode, null, parentComponent, "beforeMount"); + } + const needCallTransitionHooks = needTransition(parentSuspense, transition); + if (needCallTransitionHooks) { + transition.beforeEnter(el); + } + hostInsert(el, container, anchor); + if ((vnodeHook = props && props.onVnodeMounted) || needCallTransitionHooks || dirs) { + queuePostRenderEffect(() => { + vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode); + needCallTransitionHooks && transition.enter(el); + dirs && invokeDirectiveHook(vnode, null, parentComponent, "mounted"); + }, parentSuspense); + } + }; + const setScopeId = (el, vnode, scopeId, slotScopeIds, parentComponent) => { + if (scopeId) { + hostSetScopeId(el, scopeId); + } + if (slotScopeIds) { + for (let i = 0; i < slotScopeIds.length; i++) { + hostSetScopeId(el, slotScopeIds[i]); + } + } + if (parentComponent) { + let subTree = parentComponent.subTree; + if (vnode === subTree || isSuspense(subTree.type) && (subTree.ssContent === vnode || subTree.ssFallback === vnode)) { + const parentVNode = parentComponent.vnode; + setScopeId( + el, + parentVNode, + parentVNode.scopeId, + parentVNode.slotScopeIds, + parentComponent.parent + ); + } + } + }; + const mountChildren = (children, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized, start = 0) => { + for (let i = start; i < children.length; i++) { + const child = children[i] = optimized ? cloneIfMounted(children[i]) : normalizeVNode(children[i]); + patch( + null, + child, + container, + anchor, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized + ); + } + }; + const patchElement = (n1, n2, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => { + const el = n2.el = n1.el; + let { patchFlag, dynamicChildren, dirs } = n2; + patchFlag |= n1.patchFlag & 16; + const oldProps = n1.props || EMPTY_OBJ; + const newProps = n2.props || EMPTY_OBJ; + let vnodeHook; + parentComponent && toggleRecurse(parentComponent, false); + if (vnodeHook = newProps.onVnodeBeforeUpdate) { + invokeVNodeHook(vnodeHook, parentComponent, n2, n1); + } + if (dirs) { + invokeDirectiveHook(n2, n1, parentComponent, "beforeUpdate"); + } + parentComponent && toggleRecurse(parentComponent, true); + if (oldProps.innerHTML && newProps.innerHTML == null || oldProps.textContent && newProps.textContent == null) { + hostSetElementText(el, ""); + } + if (dynamicChildren) { + patchBlockChildren( + n1.dynamicChildren, + dynamicChildren, + el, + parentComponent, + parentSuspense, + resolveChildrenNamespace(n2, namespace), + slotScopeIds + ); + } else if (!optimized) { + patchChildren( + n1, + n2, + el, + null, + parentComponent, + parentSuspense, + resolveChildrenNamespace(n2, namespace), + slotScopeIds, + false + ); + } + if (patchFlag > 0) { + if (patchFlag & 16) { + patchProps(el, oldProps, newProps, parentComponent, namespace); + } else { + if (patchFlag & 2) { + if (oldProps.class !== newProps.class) { + hostPatchProp(el, "class", null, newProps.class, namespace); + } + } + if (patchFlag & 4) { + hostPatchProp(el, "style", oldProps.style, newProps.style, namespace); + } + if (patchFlag & 8) { + const propsToUpdate = n2.dynamicProps; + for (let i = 0; i < propsToUpdate.length; i++) { + const key = propsToUpdate[i]; + const prev = oldProps[key]; + const next = newProps[key]; + if (next !== prev || key === "value") { + hostPatchProp(el, key, prev, next, namespace, parentComponent); + } + } + } + } + if (patchFlag & 1) { + if (n1.children !== n2.children) { + hostSetElementText(el, n2.children); + } + } + } else if (!optimized && dynamicChildren == null) { + patchProps(el, oldProps, newProps, parentComponent, namespace); + } + if ((vnodeHook = newProps.onVnodeUpdated) || dirs) { + queuePostRenderEffect(() => { + vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, n2, n1); + dirs && invokeDirectiveHook(n2, n1, parentComponent, "updated"); + }, parentSuspense); + } + }; + const patchBlockChildren = (oldChildren, newChildren, fallbackContainer, parentComponent, parentSuspense, namespace, slotScopeIds) => { + for (let i = 0; i < newChildren.length; i++) { + const oldVNode = oldChildren[i]; + const newVNode = newChildren[i]; + const container = ( + // oldVNode may be an errored async setup() component inside Suspense + // which will not have a mounted element + oldVNode.el && // - In the case of a Fragment, we need to provide the actual parent + // of the Fragment itself so it can move its children. + (oldVNode.type === Fragment || // - In the case of different nodes, there is going to be a replacement + // which also requires the correct parent container + !isSameVNodeType(oldVNode, newVNode) || // - In the case of a component, it could contain anything. + oldVNode.shapeFlag & (6 | 64)) ? hostParentNode(oldVNode.el) : ( + // In other cases, the parent container is not actually used so we + // just pass the block element here to avoid a DOM parentNode call. + fallbackContainer + ) + ); + patch( + oldVNode, + newVNode, + container, + null, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + true + ); + } + }; + const patchProps = (el, oldProps, newProps, parentComponent, namespace) => { + if (oldProps !== newProps) { + if (oldProps !== EMPTY_OBJ) { + for (const key in oldProps) { + if (!isReservedProp(key) && !(key in newProps)) { + hostPatchProp( + el, + key, + oldProps[key], + null, + namespace, + parentComponent + ); + } + } + } + for (const key in newProps) { + if (isReservedProp(key)) continue; + const next = newProps[key]; + const prev = oldProps[key]; + if (next !== prev && key !== "value") { + hostPatchProp(el, key, prev, next, namespace, parentComponent); + } + } + if ("value" in newProps) { + hostPatchProp(el, "value", oldProps.value, newProps.value, namespace); + } + } + }; + const processFragment = (n1, n2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized) => { + const fragmentStartAnchor = n2.el = n1 ? n1.el : hostCreateText(""); + const fragmentEndAnchor = n2.anchor = n1 ? n1.anchor : hostCreateText(""); + let { patchFlag, dynamicChildren, slotScopeIds: fragmentSlotScopeIds } = n2; + if (fragmentSlotScopeIds) { + slotScopeIds = slotScopeIds ? slotScopeIds.concat(fragmentSlotScopeIds) : fragmentSlotScopeIds; + } + if (n1 == null) { + hostInsert(fragmentStartAnchor, container, anchor); + hostInsert(fragmentEndAnchor, container, anchor); + mountChildren( + // #10007 + // such fragment like `<>` will be compiled into + // a fragment which doesn't have a children. + // In this case fallback to an empty array + n2.children || [], + container, + fragmentEndAnchor, + parentComponent, + parentSuspense, + namespace, + slotScopeIds, + optimized + ); + } else { + if (patchFlag > 0 && patchFlag & 64 && dynamicChildren && // #2715 the previous fragment could've been a BAILed one as a result + // of renderSlot() with no valid children + n1.dynamicChildren) { + patchBlockChildren( + n1.dynamicChildren, + dynamicChildren, + container, + parentComponent, + parentSuspense, + namespace, + slotScopeIds + ); + if ( + // #2080 if the stable fragment has a key, it's a